| /* |
| * Copyright (c) 1997, 2015, Oracle and/or its affiliates. All rights reserved. |
| * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
| * |
| * This code is free software; you can redistribute it and/or modify it |
| * under the terms of the GNU General Public License version 2 only, as |
| * published by the Free Software Foundation. |
| * |
| * This code is distributed in the hope that it will be useful, but WITHOUT |
| * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or |
| * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License |
| * version 2 for more details (a copy is included in the LICENSE file that |
| * accompanied this code). |
| * |
| * You should have received a copy of the GNU General Public License version |
| * 2 along with this work; if not, write to the Free Software Foundation, |
| * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. |
| * |
| * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA |
| * or visit www.oracle.com if you need additional information or have any |
| * questions. |
| * |
| */ |
| |
| #ifndef SHARE_VM_OPTO_COMPILE_HPP |
| #define SHARE_VM_OPTO_COMPILE_HPP |
| |
| #include "asm/codeBuffer.hpp" |
| #include "ci/compilerInterface.hpp" |
| #include "code/debugInfoRec.hpp" |
| #include "code/exceptionHandlerTable.hpp" |
| #include "compiler/compilerOracle.hpp" |
| #include "compiler/compileBroker.hpp" |
| #include "libadt/dict.hpp" |
| #include "libadt/vectset.hpp" |
| #include "memory/resourceArea.hpp" |
| #include "opto/idealGraphPrinter.hpp" |
| #include "opto/phasetype.hpp" |
| #include "opto/phase.hpp" |
| #include "opto/regmask.hpp" |
| #include "runtime/deoptimization.hpp" |
| #include "runtime/vmThread.hpp" |
| #include "trace/tracing.hpp" |
| #include "utilities/ticks.hpp" |
| |
| class Block; |
| class Bundle; |
| class C2Compiler; |
| class CallGenerator; |
| class CloneMap; |
| class ConnectionGraph; |
| class InlineTree; |
| class Int_Array; |
| class Matcher; |
| class MachConstantNode; |
| class MachConstantBaseNode; |
| class MachNode; |
| class MachOper; |
| class MachSafePointNode; |
| class Node; |
| class Node_Array; |
| class Node_Notes; |
| class NodeCloneInfo; |
| class OptoReg; |
| class PhaseCFG; |
| class PhaseGVN; |
| class PhaseIterGVN; |
| class PhaseRegAlloc; |
| class PhaseCCP; |
| class PhaseCCP_DCE; |
| class RootNode; |
| class relocInfo; |
| class Scope; |
| class StartNode; |
| class SafePointNode; |
| class JVMState; |
| class Type; |
| class TypeData; |
| class TypeInt; |
| class TypePtr; |
| class TypeOopPtr; |
| class TypeFunc; |
| class Unique_Node_List; |
| class nmethod; |
| class WarmCallInfo; |
| class Node_Stack; |
| struct Final_Reshape_Counts; |
| |
| typedef unsigned int node_idx_t; |
| class NodeCloneInfo { |
| private: |
| uint64_t _idx_clone_orig; |
| public: |
| |
| void set_idx(node_idx_t idx) { |
| _idx_clone_orig = _idx_clone_orig & CONST64(0xFFFFFFFF00000000) | idx; |
| } |
| node_idx_t idx() const { return (node_idx_t)(_idx_clone_orig & 0xFFFFFFFF); } |
| |
| void set_gen(int generation) { |
| uint64_t g = (uint64_t)generation << 32; |
| _idx_clone_orig = _idx_clone_orig & 0xFFFFFFFF | g; |
| } |
| int gen() const { return (int)(_idx_clone_orig >> 32); } |
| |
| void set(uint64_t x) { _idx_clone_orig = x; } |
| void set(node_idx_t x, int g) { set_idx(x); set_gen(g); } |
| uint64_t get() const { return _idx_clone_orig; } |
| |
| NodeCloneInfo(uint64_t idx_clone_orig) : _idx_clone_orig(idx_clone_orig) {} |
| NodeCloneInfo(node_idx_t x, int g) {set(x, g);} |
| |
| void dump() const; |
| }; |
| |
| class CloneMap { |
| friend class Compile; |
| private: |
| bool _debug; |
| Dict* _dict; |
| int _clone_idx; // current cloning iteration/generation in loop unroll |
| public: |
| void* _2p(node_idx_t key) const { return (void*)(intptr_t)key; } // 2 conversion functions to make gcc happy |
| node_idx_t _2_node_idx_t(const void* k) const { return (node_idx_t)(intptr_t)k; } |
| Dict* dict() const { return _dict; } |
| void insert(node_idx_t key, uint64_t val) { assert(_dict->operator[](_2p(key)) == NULL, "key existed"); _dict->Insert(_2p(key), (void*)val); } |
| void insert(node_idx_t key, NodeCloneInfo& ci) { insert(key, ci.get()); } |
| void remove(node_idx_t key) { _dict->Delete(_2p(key)); } |
| uint64_t value(node_idx_t key) const { return (uint64_t)_dict->operator[](_2p(key)); } |
| node_idx_t idx(node_idx_t key) const { return NodeCloneInfo(value(key)).idx(); } |
| int gen(node_idx_t key) const { return NodeCloneInfo(value(key)).gen(); } |
| int gen(const void* k) const { return gen(_2_node_idx_t(k)); } |
| int max_gen() const; |
| void clone(Node* old, Node* nnn, int gen); |
| void verify_insert_and_clone(Node* old, Node* nnn, int gen); |
| void dump(node_idx_t key) const; |
| |
| int clone_idx() const { return _clone_idx; } |
| void set_clone_idx(int x) { _clone_idx = x; } |
| bool is_debug() const { return _debug; } |
| void set_debug(bool debug) { _debug = debug; } |
| static const char* debug_option_name; |
| |
| bool same_idx(node_idx_t k1, node_idx_t k2) const { return idx(k1) == idx(k2); } |
| bool same_gen(node_idx_t k1, node_idx_t k2) const { return gen(k1) == gen(k2); } |
| }; |
| |
| //------------------------------Compile---------------------------------------- |
| // This class defines a top-level Compiler invocation. |
| |
| class Compile : public Phase { |
| friend class VMStructs; |
| |
| public: |
| // Fixed alias indexes. (See also MergeMemNode.) |
| enum { |
| AliasIdxTop = 1, // pseudo-index, aliases to nothing (used as sentinel value) |
| AliasIdxBot = 2, // pseudo-index, aliases to everything |
| AliasIdxRaw = 3 // hard-wired index for TypeRawPtr::BOTTOM |
| }; |
| |
| // Variant of TraceTime(NULL, &_t_accumulator, CITime); |
| // Integrated with logging. If logging is turned on, and CITimeVerbose is true, |
| // then brackets are put into the log, with time stamps and node counts. |
| // (The time collection itself is always conditionalized on CITime.) |
| class TracePhase : public TraceTime { |
| private: |
| Compile* C; |
| CompileLog* _log; |
| const char* _phase_name; |
| bool _dolog; |
| public: |
| TracePhase(const char* name, elapsedTimer* accumulator); |
| ~TracePhase(); |
| }; |
| |
| // Information per category of alias (memory slice) |
| class AliasType { |
| private: |
| friend class Compile; |
| |
| int _index; // unique index, used with MergeMemNode |
| const TypePtr* _adr_type; // normalized address type |
| ciField* _field; // relevant instance field, or null if none |
| const Type* _element; // relevant array element type, or null if none |
| bool _is_rewritable; // false if the memory is write-once only |
| int _general_index; // if this is type is an instance, the general |
| // type that this is an instance of |
| |
| void Init(int i, const TypePtr* at); |
| |
| public: |
| int index() const { return _index; } |
| const TypePtr* adr_type() const { return _adr_type; } |
| ciField* field() const { return _field; } |
| const Type* element() const { return _element; } |
| bool is_rewritable() const { return _is_rewritable; } |
| bool is_volatile() const { return (_field ? _field->is_volatile() : false); } |
| int general_index() const { return (_general_index != 0) ? _general_index : _index; } |
| |
| void set_rewritable(bool z) { _is_rewritable = z; } |
| void set_field(ciField* f) { |
| assert(!_field,""); |
| _field = f; |
| if (f->is_final() || f->is_stable()) { |
| // In the case of @Stable, multiple writes are possible but may be assumed to be no-ops. |
| _is_rewritable = false; |
| } |
| } |
| void set_element(const Type* e) { |
| assert(_element == NULL, ""); |
| _element = e; |
| } |
| |
| void print_on(outputStream* st) PRODUCT_RETURN; |
| }; |
| |
| enum { |
| logAliasCacheSize = 6, |
| AliasCacheSize = (1<<logAliasCacheSize) |
| }; |
| struct AliasCacheEntry { const TypePtr* _adr_type; int _index; }; // simple duple type |
| enum { |
| trapHistLength = MethodData::_trap_hist_limit |
| }; |
| |
| // Constant entry of the constant table. |
| class Constant { |
| private: |
| BasicType _type; |
| union { |
| jvalue _value; |
| Metadata* _metadata; |
| } _v; |
| int _offset; // offset of this constant (in bytes) relative to the constant table base. |
| float _freq; |
| bool _can_be_reused; // true (default) if the value can be shared with other users. |
| |
| public: |
| Constant() : _type(T_ILLEGAL), _offset(-1), _freq(0.0f), _can_be_reused(true) { _v._value.l = 0; } |
| Constant(BasicType type, jvalue value, float freq = 0.0f, bool can_be_reused = true) : |
| _type(type), |
| _offset(-1), |
| _freq(freq), |
| _can_be_reused(can_be_reused) |
| { |
| assert(type != T_METADATA, "wrong constructor"); |
| _v._value = value; |
| } |
| Constant(Metadata* metadata, bool can_be_reused = true) : |
| _type(T_METADATA), |
| _offset(-1), |
| _freq(0.0f), |
| _can_be_reused(can_be_reused) |
| { |
| _v._metadata = metadata; |
| } |
| |
| bool operator==(const Constant& other); |
| |
| BasicType type() const { return _type; } |
| |
| jlong get_jlong() const { return _v._value.j; } |
| jfloat get_jfloat() const { return _v._value.f; } |
| jdouble get_jdouble() const { return _v._value.d; } |
| jobject get_jobject() const { return _v._value.l; } |
| |
| Metadata* get_metadata() const { return _v._metadata; } |
| |
| int offset() const { return _offset; } |
| void set_offset(int offset) { _offset = offset; } |
| |
| float freq() const { return _freq; } |
| void inc_freq(float freq) { _freq += freq; } |
| |
| bool can_be_reused() const { return _can_be_reused; } |
| }; |
| |
| // Constant table. |
| class ConstantTable { |
| private: |
| GrowableArray<Constant> _constants; // Constants of this table. |
| int _size; // Size in bytes the emitted constant table takes (including padding). |
| int _table_base_offset; // Offset of the table base that gets added to the constant offsets. |
| int _nof_jump_tables; // Number of jump-tables in this constant table. |
| |
| static int qsort_comparator(Constant* a, Constant* b); |
| |
| // We use negative frequencies to keep the order of the |
| // jump-tables in which they were added. Otherwise we get into |
| // trouble with relocation. |
| float next_jump_table_freq() { return -1.0f * (++_nof_jump_tables); } |
| |
| public: |
| ConstantTable() : |
| _size(-1), |
| _table_base_offset(-1), // We can use -1 here since the constant table is always bigger than 2 bytes (-(size / 2), see MachConstantBaseNode::emit). |
| _nof_jump_tables(0) |
| {} |
| |
| int size() const { assert(_size != -1, "not calculated yet"); return _size; } |
| |
| int calculate_table_base_offset() const; // AD specific |
| void set_table_base_offset(int x) { assert(_table_base_offset == -1 || x == _table_base_offset, "can't change"); _table_base_offset = x; } |
| int table_base_offset() const { assert(_table_base_offset != -1, "not set yet"); return _table_base_offset; } |
| |
| void emit(CodeBuffer& cb); |
| |
| // Returns the offset of the last entry (the top) of the constant table. |
| int top_offset() const { assert(_constants.top().offset() != -1, "not bound yet"); return _constants.top().offset(); } |
| |
| void calculate_offsets_and_size(); |
| int find_offset(Constant& con) const; |
| |
| void add(Constant& con); |
| Constant add(MachConstantNode* n, BasicType type, jvalue value); |
| Constant add(Metadata* metadata); |
| Constant add(MachConstantNode* n, MachOper* oper); |
| Constant add(MachConstantNode* n, jfloat f) { |
| jvalue value; value.f = f; |
| return add(n, T_FLOAT, value); |
| } |
| Constant add(MachConstantNode* n, jdouble d) { |
| jvalue value; value.d = d; |
| return add(n, T_DOUBLE, value); |
| } |
| |
| // Jump-table |
| Constant add_jump_table(MachConstantNode* n); |
| void fill_jump_table(CodeBuffer& cb, MachConstantNode* n, GrowableArray<Label*> labels) const; |
| }; |
| |
| private: |
| // Fixed parameters to this compilation. |
| const int _compile_id; |
| const bool _save_argument_registers; // save/restore arg regs for trampolines |
| const bool _subsume_loads; // Load can be matched as part of a larger op. |
| const bool _do_escape_analysis; // Do escape analysis. |
| const bool _eliminate_boxing; // Do boxing elimination. |
| ciMethod* _method; // The method being compiled. |
| int _entry_bci; // entry bci for osr methods. |
| const TypeFunc* _tf; // My kind of signature |
| InlineTree* _ilt; // Ditto (temporary). |
| address _stub_function; // VM entry for stub being compiled, or NULL |
| const char* _stub_name; // Name of stub or adapter being compiled, or NULL |
| address _stub_entry_point; // Compile code entry for generated stub, or NULL |
| |
| // Control of this compilation. |
| int _num_loop_opts; // Number of iterations for doing loop optimiztions |
| int _max_inline_size; // Max inline size for this compilation |
| int _freq_inline_size; // Max hot method inline size for this compilation |
| int _fixed_slots; // count of frame slots not allocated by the register |
| // allocator i.e. locks, original deopt pc, etc. |
| uintx _max_node_limit; // Max unique node count during a single compilation. |
| // For deopt |
| int _orig_pc_slot; |
| int _orig_pc_slot_offset_in_bytes; |
| |
| int _major_progress; // Count of something big happening |
| bool _inlining_progress; // progress doing incremental inlining? |
| bool _inlining_incrementally;// Are we doing incremental inlining (post parse) |
| bool _has_loops; // True if the method _may_ have some loops |
| bool _has_split_ifs; // True if the method _may_ have some split-if |
| bool _has_unsafe_access; // True if the method _may_ produce faults in unsafe loads or stores. |
| bool _has_stringbuilder; // True StringBuffers or StringBuilders are allocated |
| bool _has_boxed_value; // True if a boxed object is allocated |
| int _max_vector_size; // Maximum size of generated vectors |
| uint _trap_hist[trapHistLength]; // Cumulative traps |
| bool _trap_can_recompile; // Have we emitted a recompiling trap? |
| uint _decompile_count; // Cumulative decompilation counts. |
| bool _do_inlining; // True if we intend to do inlining |
| bool _do_scheduling; // True if we intend to do scheduling |
| bool _do_freq_based_layout; // True if we intend to do frequency based block layout |
| bool _do_count_invocations; // True if we generate code to count invocations |
| bool _do_method_data_update; // True if we generate code to update MethodData*s |
| bool _do_vector_loop; // True if allowed to execute loop in parallel iterations |
| bool _age_code; // True if we need to profile code age (decrement the aging counter) |
| int _AliasLevel; // Locally-adjusted version of AliasLevel flag. |
| bool _print_assembly; // True if we should dump assembly code for this compilation |
| bool _print_inlining; // True if we should print inlining for this compilation |
| bool _print_intrinsics; // True if we should print intrinsics for this compilation |
| #ifndef PRODUCT |
| bool _trace_opto_output; |
| bool _parsed_irreducible_loop; // True if ciTypeFlow detected irreducible loops during parsing |
| #endif |
| bool _has_irreducible_loop; // Found irreducible loops |
| // JSR 292 |
| bool _has_method_handle_invokes; // True if this method has MethodHandle invokes. |
| RTMState _rtm_state; // State of Restricted Transactional Memory usage |
| |
| // Compilation environment. |
| Arena _comp_arena; // Arena with lifetime equivalent to Compile |
| ciEnv* _env; // CI interface |
| CompileLog* _log; // from CompilerThread |
| const char* _failure_reason; // for record_failure/failing pattern |
| GrowableArray<CallGenerator*>* _intrinsics; // List of intrinsics. |
| GrowableArray<Node*>* _macro_nodes; // List of nodes which need to be expanded before matching. |
| GrowableArray<Node*>* _predicate_opaqs; // List of Opaque1 nodes for the loop predicates. |
| GrowableArray<Node*>* _expensive_nodes; // List of nodes that are expensive to compute and that we'd better not let the GVN freely common |
| ConnectionGraph* _congraph; |
| #ifndef PRODUCT |
| IdealGraphPrinter* _printer; |
| #endif |
| |
| |
| // Node management |
| uint _unique; // Counter for unique Node indices |
| VectorSet _dead_node_list; // Set of dead nodes |
| uint _dead_node_count; // Number of dead nodes; VectorSet::Size() is O(N). |
| // So use this to keep count and make the call O(1). |
| DEBUG_ONLY( Unique_Node_List* _modified_nodes; ) // List of nodes which inputs were modified |
| |
| debug_only(static int _debug_idx;) // Monotonic counter (not reset), use -XX:BreakAtNode=<idx> |
| Arena _node_arena; // Arena for new-space Nodes |
| Arena _old_arena; // Arena for old-space Nodes, lifetime during xform |
| RootNode* _root; // Unique root of compilation, or NULL after bail-out. |
| Node* _top; // Unique top node. (Reset by various phases.) |
| |
| Node* _immutable_memory; // Initial memory state |
| |
| Node* _recent_alloc_obj; |
| Node* _recent_alloc_ctl; |
| |
| // Constant table |
| ConstantTable _constant_table; // The constant table for this compile. |
| MachConstantBaseNode* _mach_constant_base_node; // Constant table base node singleton. |
| |
| |
| // Blocked array of debugging and profiling information, |
| // tracked per node. |
| enum { _log2_node_notes_block_size = 8, |
| _node_notes_block_size = (1<<_log2_node_notes_block_size) |
| }; |
| GrowableArray<Node_Notes*>* _node_note_array; |
| Node_Notes* _default_node_notes; // default notes for new nodes |
| |
| // After parsing and every bulk phase we hang onto the Root instruction. |
| // The RootNode instruction is where the whole program begins. It produces |
| // the initial Control and BOTTOM for everybody else. |
| |
| // Type management |
| Arena _Compile_types; // Arena for all types |
| Arena* _type_arena; // Alias for _Compile_types except in Initialize_shared() |
| Dict* _type_dict; // Intern table |
| CloneMap _clone_map; // used for recording history of cloned nodes |
| void* _type_hwm; // Last allocation (see Type::operator new/delete) |
| size_t _type_last_size; // Last allocation size (see Type::operator new/delete) |
| ciMethod* _last_tf_m; // Cache for |
| const TypeFunc* _last_tf; // TypeFunc::make |
| AliasType** _alias_types; // List of alias types seen so far. |
| int _num_alias_types; // Logical length of _alias_types |
| int _max_alias_types; // Physical length of _alias_types |
| AliasCacheEntry _alias_cache[AliasCacheSize]; // Gets aliases w/o data structure walking |
| |
| // Parsing, optimization |
| PhaseGVN* _initial_gvn; // Results of parse-time PhaseGVN |
| Unique_Node_List* _for_igvn; // Initial work-list for next round of Iterative GVN |
| WarmCallInfo* _warm_calls; // Sorted work-list for heat-based inlining. |
| |
| GrowableArray<CallGenerator*> _late_inlines; // List of CallGenerators to be revisited after |
| // main parsing has finished. |
| GrowableArray<CallGenerator*> _string_late_inlines; // same but for string operations |
| |
| GrowableArray<CallGenerator*> _boxing_late_inlines; // same but for boxing operations |
| |
| int _late_inlines_pos; // Where in the queue should the next late inlining candidate go (emulate depth first inlining) |
| uint _number_of_mh_late_inlines; // number of method handle late inlining still pending |
| |
| |
| // Inlining may not happen in parse order which would make |
| // PrintInlining output confusing. Keep track of PrintInlining |
| // pieces in order. |
| class PrintInliningBuffer : public ResourceObj { |
| private: |
| CallGenerator* _cg; |
| stringStream* _ss; |
| |
| public: |
| PrintInliningBuffer() |
| : _cg(NULL) { _ss = new stringStream(); } |
| |
| stringStream* ss() const { return _ss; } |
| CallGenerator* cg() const { return _cg; } |
| void set_cg(CallGenerator* cg) { _cg = cg; } |
| }; |
| |
| stringStream* _print_inlining_stream; |
| GrowableArray<PrintInliningBuffer>* _print_inlining_list; |
| int _print_inlining_idx; |
| char* _print_inlining_output; |
| |
| // Only keep nodes in the expensive node list that need to be optimized |
| void cleanup_expensive_nodes(PhaseIterGVN &igvn); |
| // Use for sorting expensive nodes to bring similar nodes together |
| static int cmp_expensive_nodes(Node** n1, Node** n2); |
| // Expensive nodes list already sorted? |
| bool expensive_nodes_sorted() const; |
| // Remove the speculative part of types and clean up the graph |
| void remove_speculative_types(PhaseIterGVN &igvn); |
| |
| void* _replay_inline_data; // Pointer to data loaded from file |
| |
| void print_inlining_init(); |
| void print_inlining_reinit(); |
| void print_inlining_commit(); |
| void print_inlining_push(); |
| PrintInliningBuffer& print_inlining_current(); |
| |
| void log_late_inline_failure(CallGenerator* cg, const char* msg); |
| |
| public: |
| |
| outputStream* print_inlining_stream() const { |
| assert(print_inlining() || print_intrinsics(), "PrintInlining off?"); |
| return _print_inlining_stream; |
| } |
| |
| void print_inlining_update(CallGenerator* cg); |
| void print_inlining_update_delayed(CallGenerator* cg); |
| void print_inlining_move_to(CallGenerator* cg); |
| void print_inlining_assert_ready(); |
| void print_inlining_reset(); |
| |
| void print_inlining(ciMethod* method, int inline_level, int bci, const char* msg = NULL) { |
| stringStream ss; |
| CompileTask::print_inlining_inner(&ss, method, inline_level, bci, msg); |
| print_inlining_stream()->print("%s", ss.as_string()); |
| } |
| |
| void log_late_inline(CallGenerator* cg); |
| void log_inline_id(CallGenerator* cg); |
| void log_inline_failure(const char* msg); |
| |
| void* replay_inline_data() const { return _replay_inline_data; } |
| |
| // Dump inlining replay data to the stream. |
| void dump_inline_data(outputStream* out); |
| |
| private: |
| // Matching, CFG layout, allocation, code generation |
| PhaseCFG* _cfg; // Results of CFG finding |
| bool _select_24_bit_instr; // We selected an instruction with a 24-bit result |
| bool _in_24_bit_fp_mode; // We are emitting instructions with 24-bit results |
| int _java_calls; // Number of java calls in the method |
| int _inner_loops; // Number of inner loops in the method |
| Matcher* _matcher; // Engine to map ideal to machine instructions |
| PhaseRegAlloc* _regalloc; // Results of register allocation. |
| int _frame_slots; // Size of total frame in stack slots |
| CodeOffsets _code_offsets; // Offsets into the code for various interesting entries |
| RegMask _FIRST_STACK_mask; // All stack slots usable for spills (depends on frame layout) |
| Arena* _indexSet_arena; // control IndexSet allocation within PhaseChaitin |
| void* _indexSet_free_block_list; // free list of IndexSet bit blocks |
| int _interpreter_frame_size; |
| |
| uint _node_bundling_limit; |
| Bundle* _node_bundling_base; // Information for instruction bundling |
| |
| // Instruction bits passed off to the VM |
| int _method_size; // Size of nmethod code segment in bytes |
| CodeBuffer _code_buffer; // Where the code is assembled |
| int _first_block_size; // Size of unvalidated entry point code / OSR poison code |
| ExceptionHandlerTable _handler_table; // Table of native-code exception handlers |
| ImplicitExceptionTable _inc_table; // Table of implicit null checks in native code |
| OopMapSet* _oop_map_set; // Table of oop maps (one for each safepoint location) |
| static int _CompiledZap_count; // counter compared against CompileZap[First/Last] |
| BufferBlob* _scratch_buffer_blob; // For temporary code buffers. |
| relocInfo* _scratch_locs_memory; // For temporary code buffers. |
| int _scratch_const_size; // For temporary code buffers. |
| bool _in_scratch_emit_size; // true when in scratch_emit_size. |
| |
| public: |
| // Accessors |
| |
| // The Compile instance currently active in this (compiler) thread. |
| static Compile* current() { |
| return (Compile*) ciEnv::current()->compiler_data(); |
| } |
| |
| // ID for this compilation. Useful for setting breakpoints in the debugger. |
| int compile_id() const { return _compile_id; } |
| |
| // Does this compilation allow instructions to subsume loads? User |
| // instructions that subsume a load may result in an unschedulable |
| // instruction sequence. |
| bool subsume_loads() const { return _subsume_loads; } |
| /** Do escape analysis. */ |
| bool do_escape_analysis() const { return _do_escape_analysis; } |
| /** Do boxing elimination. */ |
| bool eliminate_boxing() const { return _eliminate_boxing; } |
| /** Do aggressive boxing elimination. */ |
| bool aggressive_unboxing() const { return _eliminate_boxing && AggressiveUnboxing; } |
| bool save_argument_registers() const { return _save_argument_registers; } |
| |
| |
| // Other fixed compilation parameters. |
| ciMethod* method() const { return _method; } |
| int entry_bci() const { return _entry_bci; } |
| bool is_osr_compilation() const { return _entry_bci != InvocationEntryBci; } |
| bool is_method_compilation() const { return (_method != NULL && !_method->flags().is_native()); } |
| const TypeFunc* tf() const { assert(_tf!=NULL, ""); return _tf; } |
| void init_tf(const TypeFunc* tf) { assert(_tf==NULL, ""); _tf = tf; } |
| InlineTree* ilt() const { return _ilt; } |
| address stub_function() const { return _stub_function; } |
| const char* stub_name() const { return _stub_name; } |
| address stub_entry_point() const { return _stub_entry_point; } |
| |
| // Control of this compilation. |
| int fixed_slots() const { assert(_fixed_slots >= 0, ""); return _fixed_slots; } |
| void set_fixed_slots(int n) { _fixed_slots = n; } |
| int major_progress() const { return _major_progress; } |
| void set_inlining_progress(bool z) { _inlining_progress = z; } |
| int inlining_progress() const { return _inlining_progress; } |
| void set_inlining_incrementally(bool z) { _inlining_incrementally = z; } |
| int inlining_incrementally() const { return _inlining_incrementally; } |
| void set_major_progress() { _major_progress++; } |
| void clear_major_progress() { _major_progress = 0; } |
| int num_loop_opts() const { return _num_loop_opts; } |
| void set_num_loop_opts(int n) { _num_loop_opts = n; } |
| int max_inline_size() const { return _max_inline_size; } |
| void set_freq_inline_size(int n) { _freq_inline_size = n; } |
| int freq_inline_size() const { return _freq_inline_size; } |
| void set_max_inline_size(int n) { _max_inline_size = n; } |
| bool has_loops() const { return _has_loops; } |
| void set_has_loops(bool z) { _has_loops = z; } |
| bool has_split_ifs() const { return _has_split_ifs; } |
| void set_has_split_ifs(bool z) { _has_split_ifs = z; } |
| bool has_unsafe_access() const { return _has_unsafe_access; } |
| void set_has_unsafe_access(bool z) { _has_unsafe_access = z; } |
| bool has_stringbuilder() const { return _has_stringbuilder; } |
| void set_has_stringbuilder(bool z) { _has_stringbuilder = z; } |
| bool has_boxed_value() const { return _has_boxed_value; } |
| void set_has_boxed_value(bool z) { _has_boxed_value = z; } |
| int max_vector_size() const { return _max_vector_size; } |
| void set_max_vector_size(int s) { _max_vector_size = s; } |
| void set_trap_count(uint r, uint c) { assert(r < trapHistLength, "oob"); _trap_hist[r] = c; } |
| uint trap_count(uint r) const { assert(r < trapHistLength, "oob"); return _trap_hist[r]; } |
| bool trap_can_recompile() const { return _trap_can_recompile; } |
| void set_trap_can_recompile(bool z) { _trap_can_recompile = z; } |
| uint decompile_count() const { return _decompile_count; } |
| void set_decompile_count(uint c) { _decompile_count = c; } |
| bool allow_range_check_smearing() const; |
| bool do_inlining() const { return _do_inlining; } |
| void set_do_inlining(bool z) { _do_inlining = z; } |
| bool do_scheduling() const { return _do_scheduling; } |
| void set_do_scheduling(bool z) { _do_scheduling = z; } |
| bool do_freq_based_layout() const{ return _do_freq_based_layout; } |
| void set_do_freq_based_layout(bool z){ _do_freq_based_layout = z; } |
| bool do_count_invocations() const{ return _do_count_invocations; } |
| void set_do_count_invocations(bool z){ _do_count_invocations = z; } |
| bool do_method_data_update() const { return _do_method_data_update; } |
| void set_do_method_data_update(bool z) { _do_method_data_update = z; } |
| bool do_vector_loop() const { return _do_vector_loop; } |
| void set_do_vector_loop(bool z) { _do_vector_loop = z; } |
| bool age_code() const { return _age_code; } |
| void set_age_code(bool z) { _age_code = z; } |
| int AliasLevel() const { return _AliasLevel; } |
| bool print_assembly() const { return _print_assembly; } |
| void set_print_assembly(bool z) { _print_assembly = z; } |
| bool print_inlining() const { return _print_inlining; } |
| void set_print_inlining(bool z) { _print_inlining = z; } |
| bool print_intrinsics() const { return _print_intrinsics; } |
| void set_print_intrinsics(bool z) { _print_intrinsics = z; } |
| RTMState rtm_state() const { return _rtm_state; } |
| void set_rtm_state(RTMState s) { _rtm_state = s; } |
| bool use_rtm() const { return (_rtm_state & NoRTM) == 0; } |
| bool profile_rtm() const { return _rtm_state == ProfileRTM; } |
| uint max_node_limit() const { return (uint)_max_node_limit; } |
| void set_max_node_limit(uint n) { _max_node_limit = n; } |
| |
| // check the CompilerOracle for special behaviours for this compile |
| bool method_has_option(const char * option) { |
| return method() != NULL && method()->has_option(option); |
| } |
| template<typename T> |
| bool method_has_option_value(const char * option, T& value) { |
| return method() != NULL && method()->has_option_value(option, value); |
| } |
| #ifndef PRODUCT |
| bool trace_opto_output() const { return _trace_opto_output; } |
| bool parsed_irreducible_loop() const { return _parsed_irreducible_loop; } |
| void set_parsed_irreducible_loop(bool z) { _parsed_irreducible_loop = z; } |
| int _in_dump_cnt; // Required for dumping ir nodes. |
| #endif |
| bool has_irreducible_loop() const { return _has_irreducible_loop; } |
| void set_has_irreducible_loop(bool z) { _has_irreducible_loop = z; } |
| |
| // JSR 292 |
| bool has_method_handle_invokes() const { return _has_method_handle_invokes; } |
| void set_has_method_handle_invokes(bool z) { _has_method_handle_invokes = z; } |
| |
| Ticks _latest_stage_start_counter; |
| |
| void begin_method() { |
| #ifndef PRODUCT |
| if (_printer && _printer->should_print(_method)) { |
| _printer->begin_method(this); |
| } |
| #endif |
| C->_latest_stage_start_counter.stamp(); |
| } |
| |
| void print_method(CompilerPhaseType cpt, int level = 1) { |
| EventCompilerPhase event; |
| if (event.should_commit()) { |
| event.set_starttime(C->_latest_stage_start_counter); |
| event.set_phase((u1) cpt); |
| event.set_compileID(C->_compile_id); |
| event.set_phaseLevel(level); |
| event.commit(); |
| } |
| |
| |
| #ifndef PRODUCT |
| if (_printer && _printer->should_print(_method)) { |
| _printer->print_method(this, CompilerPhaseTypeHelper::to_string(cpt), level); |
| } |
| #endif |
| C->_latest_stage_start_counter.stamp(); |
| } |
| |
| void end_method(int level = 1) { |
| EventCompilerPhase event; |
| if (event.should_commit()) { |
| event.set_starttime(C->_latest_stage_start_counter); |
| event.set_phase((u1) PHASE_END); |
| event.set_compileID(C->_compile_id); |
| event.set_phaseLevel(level); |
| event.commit(); |
| } |
| #ifndef PRODUCT |
| if (_printer && _printer->should_print(_method)) { |
| _printer->end_method(); |
| } |
| #endif |
| } |
| |
| int macro_count() const { return _macro_nodes->length(); } |
| int predicate_count() const { return _predicate_opaqs->length();} |
| int expensive_count() const { return _expensive_nodes->length(); } |
| Node* macro_node(int idx) const { return _macro_nodes->at(idx); } |
| Node* predicate_opaque1_node(int idx) const { return _predicate_opaqs->at(idx);} |
| Node* expensive_node(int idx) const { return _expensive_nodes->at(idx); } |
| ConnectionGraph* congraph() { return _congraph;} |
| void set_congraph(ConnectionGraph* congraph) { _congraph = congraph;} |
| void add_macro_node(Node * n) { |
| //assert(n->is_macro(), "must be a macro node"); |
| assert(!_macro_nodes->contains(n), " duplicate entry in expand list"); |
| _macro_nodes->append(n); |
| } |
| void remove_macro_node(Node * n) { |
| // this function may be called twice for a node so check |
| // that the node is in the array before attempting to remove it |
| if (_macro_nodes->contains(n)) |
| _macro_nodes->remove(n); |
| // remove from _predicate_opaqs list also if it is there |
| if (predicate_count() > 0 && _predicate_opaqs->contains(n)){ |
| _predicate_opaqs->remove(n); |
| } |
| } |
| void add_expensive_node(Node * n); |
| void remove_expensive_node(Node * n) { |
| if (_expensive_nodes->contains(n)) { |
| _expensive_nodes->remove(n); |
| } |
| } |
| void add_predicate_opaq(Node * n) { |
| assert(!_predicate_opaqs->contains(n), " duplicate entry in predicate opaque1"); |
| assert(_macro_nodes->contains(n), "should have already been in macro list"); |
| _predicate_opaqs->append(n); |
| } |
| // remove the opaque nodes that protect the predicates so that the unused checks and |
| // uncommon traps will be eliminated from the graph. |
| void cleanup_loop_predicates(PhaseIterGVN &igvn); |
| bool is_predicate_opaq(Node * n) { |
| return _predicate_opaqs->contains(n); |
| } |
| |
| // Are there candidate expensive nodes for optimization? |
| bool should_optimize_expensive_nodes(PhaseIterGVN &igvn); |
| // Check whether n1 and n2 are similar |
| static int cmp_expensive_nodes(Node* n1, Node* n2); |
| // Sort expensive nodes to locate similar expensive nodes |
| void sort_expensive_nodes(); |
| |
| // Compilation environment. |
| Arena* comp_arena() { return &_comp_arena; } |
| ciEnv* env() const { return _env; } |
| CompileLog* log() const { return _log; } |
| bool failing() const { return _env->failing() || _failure_reason != NULL; } |
| const char* failure_reason() const { return (_env->failing()) ? _env->failure_reason() : _failure_reason; } |
| |
| bool failure_reason_is(const char* r) const { |
| return (r == _failure_reason) || (r != NULL && _failure_reason != NULL && strcmp(r, _failure_reason) == 0); |
| } |
| |
| void record_failure(const char* reason); |
| void record_method_not_compilable(const char* reason, bool all_tiers = false) { |
| // All bailouts cover "all_tiers" when TieredCompilation is off. |
| if (!TieredCompilation) all_tiers = true; |
| env()->record_method_not_compilable(reason, all_tiers); |
| // Record failure reason. |
| record_failure(reason); |
| } |
| void record_method_not_compilable_all_tiers(const char* reason) { |
| record_method_not_compilable(reason, true); |
| } |
| bool check_node_count(uint margin, const char* reason) { |
| if (live_nodes() + margin > max_node_limit()) { |
| record_method_not_compilable(reason); |
| return true; |
| } else { |
| return false; |
| } |
| } |
| |
| // Node management |
| uint unique() const { return _unique; } |
| uint next_unique() { return _unique++; } |
| void set_unique(uint i) { _unique = i; } |
| static int debug_idx() { return debug_only(_debug_idx)+0; } |
| static void set_debug_idx(int i) { debug_only(_debug_idx = i); } |
| Arena* node_arena() { return &_node_arena; } |
| Arena* old_arena() { return &_old_arena; } |
| RootNode* root() const { return _root; } |
| void set_root(RootNode* r) { _root = r; } |
| StartNode* start() const; // (Derived from root.) |
| void init_start(StartNode* s); |
| Node* immutable_memory(); |
| |
| Node* recent_alloc_ctl() const { return _recent_alloc_ctl; } |
| Node* recent_alloc_obj() const { return _recent_alloc_obj; } |
| void set_recent_alloc(Node* ctl, Node* obj) { |
| _recent_alloc_ctl = ctl; |
| _recent_alloc_obj = obj; |
| } |
| void record_dead_node(uint idx) { if (_dead_node_list.test_set(idx)) return; |
| _dead_node_count++; |
| } |
| bool is_dead_node(uint idx) { return _dead_node_list.test(idx) != 0; } |
| uint dead_node_count() { return _dead_node_count; } |
| void reset_dead_node_list() { _dead_node_list.Reset(); |
| _dead_node_count = 0; |
| } |
| uint live_nodes() const { |
| int val = _unique - _dead_node_count; |
| assert (val >= 0, "number of tracked dead nodes %d more than created nodes %d", _unique, _dead_node_count); |
| return (uint) val; |
| } |
| #ifdef ASSERT |
| uint count_live_nodes_by_graph_walk(); |
| void print_missing_nodes(); |
| #endif |
| |
| // Record modified nodes to check that they are put on IGVN worklist |
| void record_modified_node(Node* n) NOT_DEBUG_RETURN; |
| void remove_modified_node(Node* n) NOT_DEBUG_RETURN; |
| DEBUG_ONLY( Unique_Node_List* modified_nodes() const { return _modified_nodes; } ) |
| |
| // Constant table |
| ConstantTable& constant_table() { return _constant_table; } |
| |
| MachConstantBaseNode* mach_constant_base_node(); |
| bool has_mach_constant_base_node() const { return _mach_constant_base_node != NULL; } |
| // Generated by adlc, true if CallNode requires MachConstantBase. |
| bool needs_clone_jvms(); |
| |
| // Handy undefined Node |
| Node* top() const { return _top; } |
| |
| // these are used by guys who need to know about creation and transformation of top: |
| Node* cached_top_node() { return _top; } |
| void set_cached_top_node(Node* tn); |
| |
| GrowableArray<Node_Notes*>* node_note_array() const { return _node_note_array; } |
| void set_node_note_array(GrowableArray<Node_Notes*>* arr) { _node_note_array = arr; } |
| Node_Notes* default_node_notes() const { return _default_node_notes; } |
| void set_default_node_notes(Node_Notes* n) { _default_node_notes = n; } |
| |
| Node_Notes* node_notes_at(int idx) { |
| return locate_node_notes(_node_note_array, idx, false); |
| } |
| inline bool set_node_notes_at(int idx, Node_Notes* value); |
| |
| // Copy notes from source to dest, if they exist. |
| // Overwrite dest only if source provides something. |
| // Return true if information was moved. |
| bool copy_node_notes_to(Node* dest, Node* source); |
| |
| // Workhorse function to sort out the blocked Node_Notes array: |
| inline Node_Notes* locate_node_notes(GrowableArray<Node_Notes*>* arr, |
| int idx, bool can_grow = false); |
| |
| void grow_node_notes(GrowableArray<Node_Notes*>* arr, int grow_by); |
| |
| // Type management |
| Arena* type_arena() { return _type_arena; } |
| Dict* type_dict() { return _type_dict; } |
| void* type_hwm() { return _type_hwm; } |
| size_t type_last_size() { return _type_last_size; } |
| int num_alias_types() { return _num_alias_types; } |
| |
| void init_type_arena() { _type_arena = &_Compile_types; } |
| void set_type_arena(Arena* a) { _type_arena = a; } |
| void set_type_dict(Dict* d) { _type_dict = d; } |
| void set_type_hwm(void* p) { _type_hwm = p; } |
| void set_type_last_size(size_t sz) { _type_last_size = sz; } |
| |
| const TypeFunc* last_tf(ciMethod* m) { |
| return (m == _last_tf_m) ? _last_tf : NULL; |
| } |
| void set_last_tf(ciMethod* m, const TypeFunc* tf) { |
| assert(m != NULL || tf == NULL, ""); |
| _last_tf_m = m; |
| _last_tf = tf; |
| } |
| |
| AliasType* alias_type(int idx) { assert(idx < num_alias_types(), "oob"); return _alias_types[idx]; } |
| AliasType* alias_type(const TypePtr* adr_type, ciField* field = NULL) { return find_alias_type(adr_type, false, field); } |
| bool have_alias_type(const TypePtr* adr_type); |
| AliasType* alias_type(ciField* field); |
| |
| int get_alias_index(const TypePtr* at) { return alias_type(at)->index(); } |
| const TypePtr* get_adr_type(uint aidx) { return alias_type(aidx)->adr_type(); } |
| int get_general_index(uint aidx) { return alias_type(aidx)->general_index(); } |
| |
| // Building nodes |
| void rethrow_exceptions(JVMState* jvms); |
| void return_values(JVMState* jvms); |
| JVMState* build_start_state(StartNode* start, const TypeFunc* tf); |
| |
| // Decide how to build a call. |
| // The profile factor is a discount to apply to this site's interp. profile. |
| CallGenerator* call_generator(ciMethod* call_method, int vtable_index, bool call_does_dispatch, |
| JVMState* jvms, bool allow_inline, float profile_factor, ciKlass* speculative_receiver_type = NULL, |
| bool allow_intrinsics = true, bool delayed_forbidden = false); |
| bool should_delay_inlining(ciMethod* call_method, JVMState* jvms) { |
| return should_delay_string_inlining(call_method, jvms) || |
| should_delay_boxing_inlining(call_method, jvms); |
| } |
| bool should_delay_string_inlining(ciMethod* call_method, JVMState* jvms); |
| bool should_delay_boxing_inlining(ciMethod* call_method, JVMState* jvms); |
| |
| // Helper functions to identify inlining potential at call-site |
| ciMethod* optimize_virtual_call(ciMethod* caller, int bci, ciInstanceKlass* klass, |
| ciKlass* holder, ciMethod* callee, |
| const TypeOopPtr* receiver_type, bool is_virtual, |
| bool &call_does_dispatch, int &vtable_index, |
| bool check_access = true); |
| ciMethod* optimize_inlining(ciMethod* caller, int bci, ciInstanceKlass* klass, |
| ciMethod* callee, const TypeOopPtr* receiver_type, |
| bool check_access = true); |
| |
| // Report if there were too many traps at a current method and bci. |
| // Report if a trap was recorded, and/or PerMethodTrapLimit was exceeded. |
| // If there is no MDO at all, report no trap unless told to assume it. |
| bool too_many_traps(ciMethod* method, int bci, Deoptimization::DeoptReason reason); |
| // This version, unspecific to a particular bci, asks if |
| // PerMethodTrapLimit was exceeded for all inlined methods seen so far. |
| bool too_many_traps(Deoptimization::DeoptReason reason, |
| // Privately used parameter for logging: |
| ciMethodData* logmd = NULL); |
| // Report if there were too many recompiles at a method and bci. |
| bool too_many_recompiles(ciMethod* method, int bci, Deoptimization::DeoptReason reason); |
| // Return a bitset with the reasons where deoptimization is allowed, |
| // i.e., where there were not too many uncommon traps. |
| int _allowed_reasons; |
| int allowed_deopt_reasons() { return _allowed_reasons; } |
| void set_allowed_deopt_reasons(); |
| |
| // Parsing, optimization |
| PhaseGVN* initial_gvn() { return _initial_gvn; } |
| Unique_Node_List* for_igvn() { return _for_igvn; } |
| inline void record_for_igvn(Node* n); // Body is after class Unique_Node_List. |
| void set_initial_gvn(PhaseGVN *gvn) { _initial_gvn = gvn; } |
| void set_for_igvn(Unique_Node_List *for_igvn) { _for_igvn = for_igvn; } |
| |
| // Replace n by nn using initial_gvn, calling hash_delete and |
| // record_for_igvn as needed. |
| void gvn_replace_by(Node* n, Node* nn); |
| |
| |
| void identify_useful_nodes(Unique_Node_List &useful); |
| void update_dead_node_list(Unique_Node_List &useful); |
| void remove_useless_nodes (Unique_Node_List &useful); |
| |
| WarmCallInfo* warm_calls() const { return _warm_calls; } |
| void set_warm_calls(WarmCallInfo* l) { _warm_calls = l; } |
| WarmCallInfo* pop_warm_call(); |
| |
| // Record this CallGenerator for inlining at the end of parsing. |
| void add_late_inline(CallGenerator* cg) { |
| _late_inlines.insert_before(_late_inlines_pos, cg); |
| _late_inlines_pos++; |
| } |
| |
| void prepend_late_inline(CallGenerator* cg) { |
| _late_inlines.insert_before(0, cg); |
| } |
| |
| void add_string_late_inline(CallGenerator* cg) { |
| _string_late_inlines.push(cg); |
| } |
| |
| void add_boxing_late_inline(CallGenerator* cg) { |
| _boxing_late_inlines.push(cg); |
| } |
| |
| void remove_useless_late_inlines(GrowableArray<CallGenerator*>* inlines, Unique_Node_List &useful); |
| |
| void process_print_inlining(); |
| void dump_print_inlining(); |
| |
| bool over_inlining_cutoff() const { |
| if (!inlining_incrementally()) { |
| return unique() > (uint)NodeCountInliningCutoff; |
| } else { |
| return live_nodes() > (uint)LiveNodeCountInliningCutoff; |
| } |
| } |
| |
| void inc_number_of_mh_late_inlines() { _number_of_mh_late_inlines++; } |
| void dec_number_of_mh_late_inlines() { assert(_number_of_mh_late_inlines > 0, "_number_of_mh_late_inlines < 0 !"); _number_of_mh_late_inlines--; } |
| bool has_mh_late_inlines() const { return _number_of_mh_late_inlines > 0; } |
| |
| void inline_incrementally_one(PhaseIterGVN& igvn); |
| void inline_incrementally(PhaseIterGVN& igvn); |
| void inline_string_calls(bool parse_time); |
| void inline_boxing_calls(PhaseIterGVN& igvn); |
| |
| // Matching, CFG layout, allocation, code generation |
| PhaseCFG* cfg() { return _cfg; } |
| bool select_24_bit_instr() const { return _select_24_bit_instr; } |
| bool in_24_bit_fp_mode() const { return _in_24_bit_fp_mode; } |
| bool has_java_calls() const { return _java_calls > 0; } |
| int java_calls() const { return _java_calls; } |
| int inner_loops() const { return _inner_loops; } |
| Matcher* matcher() { return _matcher; } |
| PhaseRegAlloc* regalloc() { return _regalloc; } |
| int frame_slots() const { return _frame_slots; } |
| int frame_size_in_words() const; // frame_slots in units of the polymorphic 'words' |
| int frame_size_in_bytes() const { return _frame_slots << LogBytesPerInt; } |
| RegMask& FIRST_STACK_mask() { return _FIRST_STACK_mask; } |
| Arena* indexSet_arena() { return _indexSet_arena; } |
| void* indexSet_free_block_list() { return _indexSet_free_block_list; } |
| uint node_bundling_limit() { return _node_bundling_limit; } |
| Bundle* node_bundling_base() { return _node_bundling_base; } |
| void set_node_bundling_limit(uint n) { _node_bundling_limit = n; } |
| void set_node_bundling_base(Bundle* b) { _node_bundling_base = b; } |
| bool starts_bundle(const Node *n) const; |
| bool need_stack_bang(int frame_size_in_bytes) const; |
| bool need_register_stack_bang() const; |
| |
| void update_interpreter_frame_size(int size) { |
| if (_interpreter_frame_size < size) { |
| _interpreter_frame_size = size; |
| } |
| } |
| int bang_size_in_bytes() const; |
| |
| void set_matcher(Matcher* m) { _matcher = m; } |
| //void set_regalloc(PhaseRegAlloc* ra) { _regalloc = ra; } |
| void set_indexSet_arena(Arena* a) { _indexSet_arena = a; } |
| void set_indexSet_free_block_list(void* p) { _indexSet_free_block_list = p; } |
| |
| // Remember if this compilation changes hardware mode to 24-bit precision |
| void set_24_bit_selection_and_mode(bool selection, bool mode) { |
| _select_24_bit_instr = selection; |
| _in_24_bit_fp_mode = mode; |
| } |
| |
| void set_java_calls(int z) { _java_calls = z; } |
| void set_inner_loops(int z) { _inner_loops = z; } |
| |
| // Instruction bits passed off to the VM |
| int code_size() { return _method_size; } |
| CodeBuffer* code_buffer() { return &_code_buffer; } |
| int first_block_size() { return _first_block_size; } |
| void set_frame_complete(int off) { _code_offsets.set_value(CodeOffsets::Frame_Complete, off); } |
| ExceptionHandlerTable* handler_table() { return &_handler_table; } |
| ImplicitExceptionTable* inc_table() { return &_inc_table; } |
| OopMapSet* oop_map_set() { return _oop_map_set; } |
| DebugInformationRecorder* debug_info() { return env()->debug_info(); } |
| Dependencies* dependencies() { return env()->dependencies(); } |
| static int CompiledZap_count() { return _CompiledZap_count; } |
| BufferBlob* scratch_buffer_blob() { return _scratch_buffer_blob; } |
| void init_scratch_buffer_blob(int const_size); |
| void clear_scratch_buffer_blob(); |
| void set_scratch_buffer_blob(BufferBlob* b) { _scratch_buffer_blob = b; } |
| relocInfo* scratch_locs_memory() { return _scratch_locs_memory; } |
| void set_scratch_locs_memory(relocInfo* b) { _scratch_locs_memory = b; } |
| |
| // emit to scratch blob, report resulting size |
| uint scratch_emit_size(const Node* n); |
| void set_in_scratch_emit_size(bool x) { _in_scratch_emit_size = x; } |
| bool in_scratch_emit_size() const { return _in_scratch_emit_size; } |
| |
| enum ScratchBufferBlob { |
| MAX_inst_size = 1024, |
| MAX_locs_size = 128, // number of relocInfo elements |
| MAX_const_size = 128, |
| MAX_stubs_size = 128 |
| }; |
| |
| // Major entry point. Given a Scope, compile the associated method. |
| // For normal compilations, entry_bci is InvocationEntryBci. For on stack |
| // replacement, entry_bci indicates the bytecode for which to compile a |
| // continuation. |
| Compile(ciEnv* ci_env, C2Compiler* compiler, ciMethod* target, |
| int entry_bci, bool subsume_loads, bool do_escape_analysis, |
| bool eliminate_boxing); |
| |
| // Second major entry point. From the TypeFunc signature, generate code |
| // to pass arguments from the Java calling convention to the C calling |
| // convention. |
| Compile(ciEnv* ci_env, const TypeFunc *(*gen)(), |
| address stub_function, const char *stub_name, |
| int is_fancy_jump, bool pass_tls, |
| bool save_arg_registers, bool return_pc); |
| |
| // From the TypeFunc signature, generate code to pass arguments |
| // from Compiled calling convention to Interpreter's calling convention |
| void Generate_Compiled_To_Interpreter_Graph(const TypeFunc *tf, address interpreter_entry); |
| |
| // From the TypeFunc signature, generate code to pass arguments |
| // from Interpreter's calling convention to Compiler's calling convention |
| void Generate_Interpreter_To_Compiled_Graph(const TypeFunc *tf); |
| |
| // Are we compiling a method? |
| bool has_method() { return method() != NULL; } |
| |
| // Maybe print some information about this compile. |
| void print_compile_messages(); |
| |
| // Final graph reshaping, a post-pass after the regular optimizer is done. |
| bool final_graph_reshaping(); |
| |
| // returns true if adr is completely contained in the given alias category |
| bool must_alias(const TypePtr* adr, int alias_idx); |
| |
| // returns true if adr overlaps with the given alias category |
| bool can_alias(const TypePtr* adr, int alias_idx); |
| |
| // Driver for converting compiler's IR into machine code bits |
| void Output(); |
| |
| // Accessors for node bundling info. |
| Bundle* node_bundling(const Node *n); |
| bool valid_bundle_info(const Node *n); |
| |
| // Schedule and Bundle the instructions |
| void ScheduleAndBundle(); |
| |
| // Build OopMaps for each GC point |
| void BuildOopMaps(); |
| |
| // Append debug info for the node "local" at safepoint node "sfpt" to the |
| // "array", May also consult and add to "objs", which describes the |
| // scalar-replaced objects. |
| void FillLocArray( int idx, MachSafePointNode* sfpt, |
| Node *local, GrowableArray<ScopeValue*> *array, |
| GrowableArray<ScopeValue*> *objs ); |
| |
| // If "objs" contains an ObjectValue whose id is "id", returns it, else NULL. |
| static ObjectValue* sv_for_node_id(GrowableArray<ScopeValue*> *objs, int id); |
| // Requres that "objs" does not contains an ObjectValue whose id matches |
| // that of "sv. Appends "sv". |
| static void set_sv_for_object_node(GrowableArray<ScopeValue*> *objs, |
| ObjectValue* sv ); |
| |
| // Process an OopMap Element while emitting nodes |
| void Process_OopMap_Node(MachNode *mach, int code_offset); |
| |
| // Initialize code buffer |
| CodeBuffer* init_buffer(uint* blk_starts); |
| |
| // Write out basic block data to code buffer |
| void fill_buffer(CodeBuffer* cb, uint* blk_starts); |
| |
| // Determine which variable sized branches can be shortened |
| void shorten_branches(uint* blk_starts, int& code_size, int& reloc_size, int& stub_size); |
| |
| // Compute the size of first NumberOfLoopInstrToAlign instructions |
| // at the head of a loop. |
| void compute_loop_first_inst_sizes(); |
| |
| // Compute the information for the exception tables |
| void FillExceptionTables(uint cnt, uint *call_returns, uint *inct_starts, Label *blk_labels); |
| |
| // Stack slots that may be unused by the calling convention but must |
| // otherwise be preserved. On Intel this includes the return address. |
| // On PowerPC it includes the 4 words holding the old TOC & LR glue. |
| uint in_preserve_stack_slots(); |
| |
| // "Top of Stack" slots that may be unused by the calling convention but must |
| // otherwise be preserved. |
| // On Intel these are not necessary and the value can be zero. |
| // On Sparc this describes the words reserved for storing a register window |
| // when an interrupt occurs. |
| static uint out_preserve_stack_slots(); |
| |
| // Number of outgoing stack slots killed above the out_preserve_stack_slots |
| // for calls to C. Supports the var-args backing area for register parms. |
| uint varargs_C_out_slots_killed() const; |
| |
| // Number of Stack Slots consumed by a synchronization entry |
| int sync_stack_slots() const; |
| |
| // Compute the name of old_SP. See <arch>.ad for frame layout. |
| OptoReg::Name compute_old_SP(); |
| |
| private: |
| // Phase control: |
| void Init(int aliaslevel); // Prepare for a single compilation |
| int Inline_Warm(); // Find more inlining work. |
| void Finish_Warm(); // Give up on further inlines. |
| void Optimize(); // Given a graph, optimize it |
| void Code_Gen(); // Generate code from a graph |
| |
| // Management of the AliasType table. |
| void grow_alias_types(); |
| AliasCacheEntry* probe_alias_cache(const TypePtr* adr_type); |
| const TypePtr *flatten_alias_type(const TypePtr* adr_type) const; |
| AliasType* find_alias_type(const TypePtr* adr_type, bool no_create, ciField* field); |
| |
| void verify_top(Node*) const PRODUCT_RETURN; |
| |
| // Intrinsic setup. |
| void register_library_intrinsics(); // initializer |
| CallGenerator* make_vm_intrinsic(ciMethod* m, bool is_virtual); // constructor |
| int intrinsic_insertion_index(ciMethod* m, bool is_virtual); // helper |
| CallGenerator* find_intrinsic(ciMethod* m, bool is_virtual); // query fn |
| void register_intrinsic(CallGenerator* cg); // update fn |
| |
| #ifndef PRODUCT |
| static juint _intrinsic_hist_count[vmIntrinsics::ID_LIMIT]; |
| static jubyte _intrinsic_hist_flags[vmIntrinsics::ID_LIMIT]; |
| #endif |
| // Function calls made by the public function final_graph_reshaping. |
| // No need to be made public as they are not called elsewhere. |
| void final_graph_reshaping_impl( Node *n, Final_Reshape_Counts &frc); |
| void final_graph_reshaping_walk( Node_Stack &nstack, Node *root, Final_Reshape_Counts &frc ); |
| void eliminate_redundant_card_marks(Node* n); |
| |
| public: |
| |
| // Note: Histogram array size is about 1 Kb. |
| enum { // flag bits: |
| _intrinsic_worked = 1, // succeeded at least once |
| _intrinsic_failed = 2, // tried it but it failed |
| _intrinsic_disabled = 4, // was requested but disabled (e.g., -XX:-InlineUnsafeOps) |
| _intrinsic_virtual = 8, // was seen in the virtual form (rare) |
| _intrinsic_both = 16 // was seen in the non-virtual form (usual) |
| }; |
| // Update histogram. Return boolean if this is a first-time occurrence. |
| static bool gather_intrinsic_statistics(vmIntrinsics::ID id, |
| bool is_virtual, int flags) PRODUCT_RETURN0; |
| static void print_intrinsic_statistics() PRODUCT_RETURN; |
| |
| // Graph verification code |
| // Walk the node list, verifying that there is a one-to-one |
| // correspondence between Use-Def edges and Def-Use edges |
| // The option no_dead_code enables stronger checks that the |
| // graph is strongly connected from root in both directions. |
| void verify_graph_edges(bool no_dead_code = false) PRODUCT_RETURN; |
| |
| // Verify GC barrier patterns |
| void verify_barriers() PRODUCT_RETURN; |
| |
| // End-of-run dumps. |
| static void print_statistics() PRODUCT_RETURN; |
| |
| // Dump formatted assembly |
| void dump_asm(int *pcs = NULL, uint pc_limit = 0) PRODUCT_RETURN; |
| void dump_pc(int *pcs, int pc_limit, Node *n); |
| |
| // Verify ADLC assumptions during startup |
| static void adlc_verification() PRODUCT_RETURN; |
| |
| // Definitions of pd methods |
| static void pd_compiler2_init(); |
| |
| // Static parse-time type checking logic for gen_subtype_check: |
| enum { SSC_always_false, SSC_always_true, SSC_easy_test, SSC_full_test }; |
| int static_subtype_check(ciKlass* superk, ciKlass* subk); |
| |
| static Node* conv_I2X_index(PhaseGVN *phase, Node* offset, const TypeInt* sizetype); |
| |
| // Auxiliary method for randomized fuzzing/stressing |
| static bool randomized_select(int count); |
| |
| // supporting clone_map |
| CloneMap& clone_map(); |
| void set_clone_map(Dict* d); |
| |
| }; |
| |
| #endif // SHARE_VM_OPTO_COMPILE_HPP |