| /* |
| * Copyright 1999-2007 Sun Microsystems, Inc. All Rights Reserved. |
| * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
| * |
| * This code is free software; you can redistribute it and/or modify it |
| * under the terms of the GNU General Public License version 2 only, as |
| * published by the Free Software Foundation. |
| * |
| * This code is distributed in the hope that it will be useful, but WITHOUT |
| * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or |
| * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License |
| * version 2 for more details (a copy is included in the LICENSE file that |
| * accompanied this code). |
| * |
| * You should have received a copy of the GNU General Public License version |
| * 2 along with this work; if not, write to the Free Software Foundation, |
| * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. |
| * |
| * Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, |
| * CA 95054 USA or visit www.sun.com if you need additional information or |
| * have any questions. |
| * |
| */ |
| |
| #include "incls/_precompiled.incl" |
| #include "incls/_c1_GraphBuilder.cpp.incl" |
| |
| class BlockListBuilder VALUE_OBJ_CLASS_SPEC { |
| private: |
| Compilation* _compilation; |
| IRScope* _scope; |
| |
| BlockList _blocks; // internal list of all blocks |
| BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder |
| |
| // fields used by mark_loops |
| BitMap _active; // for iteration of control flow graph |
| BitMap _visited; // for iteration of control flow graph |
| intArray _loop_map; // caches the information if a block is contained in a loop |
| int _next_loop_index; // next free loop number |
| int _next_block_number; // for reverse postorder numbering of blocks |
| |
| // accessors |
| Compilation* compilation() const { return _compilation; } |
| IRScope* scope() const { return _scope; } |
| ciMethod* method() const { return scope()->method(); } |
| XHandlers* xhandlers() const { return scope()->xhandlers(); } |
| |
| // unified bailout support |
| void bailout(const char* msg) const { compilation()->bailout(msg); } |
| bool bailed_out() const { return compilation()->bailed_out(); } |
| |
| // helper functions |
| BlockBegin* make_block_at(int bci, BlockBegin* predecessor); |
| void handle_exceptions(BlockBegin* current, int cur_bci); |
| void handle_jsr(BlockBegin* current, int sr_bci, int next_bci); |
| void store_one(BlockBegin* current, int local); |
| void store_two(BlockBegin* current, int local); |
| void set_entries(int osr_bci); |
| void set_leaders(); |
| |
| void make_loop_header(BlockBegin* block); |
| void mark_loops(); |
| int mark_loops(BlockBegin* b, bool in_subroutine); |
| |
| // debugging |
| #ifndef PRODUCT |
| void print(); |
| #endif |
| |
| public: |
| // creation |
| BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci); |
| |
| // accessors for GraphBuilder |
| BlockList* bci2block() const { return _bci2block; } |
| }; |
| |
| |
| // Implementation of BlockListBuilder |
| |
| BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci) |
| : _compilation(compilation) |
| , _scope(scope) |
| , _blocks(16) |
| , _bci2block(new BlockList(scope->method()->code_size(), NULL)) |
| , _next_block_number(0) |
| , _active() // size not known yet |
| , _visited() // size not known yet |
| , _next_loop_index(0) |
| , _loop_map() // size not known yet |
| { |
| set_entries(osr_bci); |
| set_leaders(); |
| CHECK_BAILOUT(); |
| |
| mark_loops(); |
| NOT_PRODUCT(if (PrintInitialBlockList) print()); |
| |
| #ifndef PRODUCT |
| if (PrintCFGToFile) { |
| stringStream title; |
| title.print("BlockListBuilder "); |
| scope->method()->print_name(&title); |
| CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false); |
| } |
| #endif |
| } |
| |
| |
| void BlockListBuilder::set_entries(int osr_bci) { |
| // generate start blocks |
| BlockBegin* std_entry = make_block_at(0, NULL); |
| if (scope()->caller() == NULL) { |
| std_entry->set(BlockBegin::std_entry_flag); |
| } |
| if (osr_bci != -1) { |
| BlockBegin* osr_entry = make_block_at(osr_bci, NULL); |
| osr_entry->set(BlockBegin::osr_entry_flag); |
| } |
| |
| // generate exception entry blocks |
| XHandlers* list = xhandlers(); |
| const int n = list->length(); |
| for (int i = 0; i < n; i++) { |
| XHandler* h = list->handler_at(i); |
| BlockBegin* entry = make_block_at(h->handler_bci(), NULL); |
| entry->set(BlockBegin::exception_entry_flag); |
| h->set_entry_block(entry); |
| } |
| } |
| |
| |
| BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) { |
| assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer"); |
| |
| BlockBegin* block = _bci2block->at(cur_bci); |
| if (block == NULL) { |
| block = new BlockBegin(cur_bci); |
| block->init_stores_to_locals(method()->max_locals()); |
| _bci2block->at_put(cur_bci, block); |
| _blocks.append(block); |
| |
| assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist"); |
| } |
| |
| if (predecessor != NULL) { |
| if (block->is_set(BlockBegin::exception_entry_flag)) { |
| BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block); |
| } |
| |
| predecessor->add_successor(block); |
| block->increment_total_preds(); |
| } |
| |
| return block; |
| } |
| |
| |
| inline void BlockListBuilder::store_one(BlockBegin* current, int local) { |
| current->stores_to_locals().set_bit(local); |
| } |
| inline void BlockListBuilder::store_two(BlockBegin* current, int local) { |
| store_one(current, local); |
| store_one(current, local + 1); |
| } |
| |
| |
| void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) { |
| // Draws edges from a block to its exception handlers |
| XHandlers* list = xhandlers(); |
| const int n = list->length(); |
| |
| for (int i = 0; i < n; i++) { |
| XHandler* h = list->handler_at(i); |
| |
| if (h->covers(cur_bci)) { |
| BlockBegin* entry = h->entry_block(); |
| assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set"); |
| assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set"); |
| |
| // add each exception handler only once |
| if (!current->is_successor(entry)) { |
| current->add_successor(entry); |
| entry->increment_total_preds(); |
| } |
| |
| // stop when reaching catchall |
| if (h->catch_type() == 0) break; |
| } |
| } |
| } |
| |
| void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) { |
| // start a new block after jsr-bytecode and link this block into cfg |
| make_block_at(next_bci, current); |
| |
| // start a new block at the subroutine entry at mark it with special flag |
| BlockBegin* sr_block = make_block_at(sr_bci, current); |
| if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) { |
| sr_block->set(BlockBegin::subroutine_entry_flag); |
| } |
| } |
| |
| |
| void BlockListBuilder::set_leaders() { |
| bool has_xhandlers = xhandlers()->has_handlers(); |
| BlockBegin* current = NULL; |
| |
| // The information which bci starts a new block simplifies the analysis |
| // Without it, backward branches could jump to a bci where no block was created |
| // during bytecode iteration. This would require the creation of a new block at the |
| // branch target and a modification of the successor lists. |
| BitMap bci_block_start = method()->bci_block_start(); |
| |
| ciBytecodeStream s(method()); |
| while (s.next() != ciBytecodeStream::EOBC()) { |
| int cur_bci = s.cur_bci(); |
| |
| if (bci_block_start.at(cur_bci)) { |
| current = make_block_at(cur_bci, current); |
| } |
| assert(current != NULL, "must have current block"); |
| |
| if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) { |
| handle_exceptions(current, cur_bci); |
| } |
| |
| switch (s.cur_bc()) { |
| // track stores to local variables for selective creation of phi functions |
| case Bytecodes::_iinc: store_one(current, s.get_index()); break; |
| case Bytecodes::_istore: store_one(current, s.get_index()); break; |
| case Bytecodes::_lstore: store_two(current, s.get_index()); break; |
| case Bytecodes::_fstore: store_one(current, s.get_index()); break; |
| case Bytecodes::_dstore: store_two(current, s.get_index()); break; |
| case Bytecodes::_astore: store_one(current, s.get_index()); break; |
| case Bytecodes::_istore_0: store_one(current, 0); break; |
| case Bytecodes::_istore_1: store_one(current, 1); break; |
| case Bytecodes::_istore_2: store_one(current, 2); break; |
| case Bytecodes::_istore_3: store_one(current, 3); break; |
| case Bytecodes::_lstore_0: store_two(current, 0); break; |
| case Bytecodes::_lstore_1: store_two(current, 1); break; |
| case Bytecodes::_lstore_2: store_two(current, 2); break; |
| case Bytecodes::_lstore_3: store_two(current, 3); break; |
| case Bytecodes::_fstore_0: store_one(current, 0); break; |
| case Bytecodes::_fstore_1: store_one(current, 1); break; |
| case Bytecodes::_fstore_2: store_one(current, 2); break; |
| case Bytecodes::_fstore_3: store_one(current, 3); break; |
| case Bytecodes::_dstore_0: store_two(current, 0); break; |
| case Bytecodes::_dstore_1: store_two(current, 1); break; |
| case Bytecodes::_dstore_2: store_two(current, 2); break; |
| case Bytecodes::_dstore_3: store_two(current, 3); break; |
| case Bytecodes::_astore_0: store_one(current, 0); break; |
| case Bytecodes::_astore_1: store_one(current, 1); break; |
| case Bytecodes::_astore_2: store_one(current, 2); break; |
| case Bytecodes::_astore_3: store_one(current, 3); break; |
| |
| // track bytecodes that affect the control flow |
| case Bytecodes::_athrow: // fall through |
| case Bytecodes::_ret: // fall through |
| case Bytecodes::_ireturn: // fall through |
| case Bytecodes::_lreturn: // fall through |
| case Bytecodes::_freturn: // fall through |
| case Bytecodes::_dreturn: // fall through |
| case Bytecodes::_areturn: // fall through |
| case Bytecodes::_return: |
| current = NULL; |
| break; |
| |
| case Bytecodes::_ifeq: // fall through |
| case Bytecodes::_ifne: // fall through |
| case Bytecodes::_iflt: // fall through |
| case Bytecodes::_ifge: // fall through |
| case Bytecodes::_ifgt: // fall through |
| case Bytecodes::_ifle: // fall through |
| case Bytecodes::_if_icmpeq: // fall through |
| case Bytecodes::_if_icmpne: // fall through |
| case Bytecodes::_if_icmplt: // fall through |
| case Bytecodes::_if_icmpge: // fall through |
| case Bytecodes::_if_icmpgt: // fall through |
| case Bytecodes::_if_icmple: // fall through |
| case Bytecodes::_if_acmpeq: // fall through |
| case Bytecodes::_if_acmpne: // fall through |
| case Bytecodes::_ifnull: // fall through |
| case Bytecodes::_ifnonnull: |
| make_block_at(s.next_bci(), current); |
| make_block_at(s.get_dest(), current); |
| current = NULL; |
| break; |
| |
| case Bytecodes::_goto: |
| make_block_at(s.get_dest(), current); |
| current = NULL; |
| break; |
| |
| case Bytecodes::_goto_w: |
| make_block_at(s.get_far_dest(), current); |
| current = NULL; |
| break; |
| |
| case Bytecodes::_jsr: |
| handle_jsr(current, s.get_dest(), s.next_bci()); |
| current = NULL; |
| break; |
| |
| case Bytecodes::_jsr_w: |
| handle_jsr(current, s.get_far_dest(), s.next_bci()); |
| current = NULL; |
| break; |
| |
| case Bytecodes::_tableswitch: { |
| // set block for each case |
| Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp()); |
| int l = switch_->length(); |
| for (int i = 0; i < l; i++) { |
| make_block_at(cur_bci + switch_->dest_offset_at(i), current); |
| } |
| make_block_at(cur_bci + switch_->default_offset(), current); |
| current = NULL; |
| break; |
| } |
| |
| case Bytecodes::_lookupswitch: { |
| // set block for each case |
| Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp()); |
| int l = switch_->number_of_pairs(); |
| for (int i = 0; i < l; i++) { |
| make_block_at(cur_bci + switch_->pair_at(i)->offset(), current); |
| } |
| make_block_at(cur_bci + switch_->default_offset(), current); |
| current = NULL; |
| break; |
| } |
| } |
| } |
| } |
| |
| |
| void BlockListBuilder::mark_loops() { |
| ResourceMark rm; |
| |
| _active = BitMap(BlockBegin::number_of_blocks()); _active.clear(); |
| _visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear(); |
| _loop_map = intArray(BlockBegin::number_of_blocks(), 0); |
| _next_loop_index = 0; |
| _next_block_number = _blocks.length(); |
| |
| // recursively iterate the control flow graph |
| mark_loops(_bci2block->at(0), false); |
| assert(_next_block_number >= 0, "invalid block numbers"); |
| } |
| |
| void BlockListBuilder::make_loop_header(BlockBegin* block) { |
| if (block->is_set(BlockBegin::exception_entry_flag)) { |
| // exception edges may look like loops but don't mark them as such |
| // since it screws up block ordering. |
| return; |
| } |
| if (!block->is_set(BlockBegin::parser_loop_header_flag)) { |
| block->set(BlockBegin::parser_loop_header_flag); |
| |
| assert(_loop_map.at(block->block_id()) == 0, "must not be set yet"); |
| assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer"); |
| _loop_map.at_put(block->block_id(), 1 << _next_loop_index); |
| if (_next_loop_index < 31) _next_loop_index++; |
| } else { |
| // block already marked as loop header |
| assert(is_power_of_2(_loop_map.at(block->block_id())), "exactly one bit must be set"); |
| } |
| } |
| |
| int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) { |
| int block_id = block->block_id(); |
| |
| if (_visited.at(block_id)) { |
| if (_active.at(block_id)) { |
| // reached block via backward branch |
| make_loop_header(block); |
| } |
| // return cached loop information for this block |
| return _loop_map.at(block_id); |
| } |
| |
| if (block->is_set(BlockBegin::subroutine_entry_flag)) { |
| in_subroutine = true; |
| } |
| |
| // set active and visited bits before successors are processed |
| _visited.set_bit(block_id); |
| _active.set_bit(block_id); |
| |
| intptr_t loop_state = 0; |
| for (int i = block->number_of_sux() - 1; i >= 0; i--) { |
| // recursively process all successors |
| loop_state |= mark_loops(block->sux_at(i), in_subroutine); |
| } |
| |
| // clear active-bit after all successors are processed |
| _active.clear_bit(block_id); |
| |
| // reverse-post-order numbering of all blocks |
| block->set_depth_first_number(_next_block_number); |
| _next_block_number--; |
| |
| if (loop_state != 0 || in_subroutine ) { |
| // block is contained at least in one loop, so phi functions are necessary |
| // phi functions are also necessary for all locals stored in a subroutine |
| scope()->requires_phi_function().set_union(block->stores_to_locals()); |
| } |
| |
| if (block->is_set(BlockBegin::parser_loop_header_flag)) { |
| int header_loop_state = _loop_map.at(block_id); |
| assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set"); |
| |
| // If the highest bit is set (i.e. when integer value is negative), the method |
| // has 32 or more loops. This bit is never cleared because it is used for multiple loops |
| if (header_loop_state >= 0) { |
| clear_bits(loop_state, header_loop_state); |
| } |
| } |
| |
| // cache and return loop information for this block |
| _loop_map.at_put(block_id, loop_state); |
| return loop_state; |
| } |
| |
| |
| #ifndef PRODUCT |
| |
| int compare_depth_first(BlockBegin** a, BlockBegin** b) { |
| return (*a)->depth_first_number() - (*b)->depth_first_number(); |
| } |
| |
| void BlockListBuilder::print() { |
| tty->print("----- initial block list of BlockListBuilder for method "); |
| method()->print_short_name(); |
| tty->cr(); |
| |
| // better readability if blocks are sorted in processing order |
| _blocks.sort(compare_depth_first); |
| |
| for (int i = 0; i < _blocks.length(); i++) { |
| BlockBegin* cur = _blocks.at(i); |
| tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds()); |
| |
| tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " "); |
| tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " "); |
| tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " "); |
| tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " "); |
| tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " "); |
| |
| if (cur->number_of_sux() > 0) { |
| tty->print(" sux: "); |
| for (int j = 0; j < cur->number_of_sux(); j++) { |
| BlockBegin* sux = cur->sux_at(j); |
| tty->print("B%d ", sux->block_id()); |
| } |
| } |
| tty->cr(); |
| } |
| } |
| |
| #endif |
| |
| |
| // A simple growable array of Values indexed by ciFields |
| class FieldBuffer: public CompilationResourceObj { |
| private: |
| GrowableArray<Value> _values; |
| |
| public: |
| FieldBuffer() {} |
| |
| void kill() { |
| _values.trunc_to(0); |
| } |
| |
| Value at(ciField* field) { |
| assert(field->holder()->is_loaded(), "must be a loaded field"); |
| int offset = field->offset(); |
| if (offset < _values.length()) { |
| return _values.at(offset); |
| } else { |
| return NULL; |
| } |
| } |
| |
| void at_put(ciField* field, Value value) { |
| assert(field->holder()->is_loaded(), "must be a loaded field"); |
| int offset = field->offset(); |
| _values.at_put_grow(offset, value, NULL); |
| } |
| |
| }; |
| |
| |
| // MemoryBuffer is fairly simple model of the current state of memory. |
| // It partitions memory into several pieces. The first piece is |
| // generic memory where little is known about the owner of the memory. |
| // This is conceptually represented by the tuple <O, F, V> which says |
| // that the field F of object O has value V. This is flattened so |
| // that F is represented by the offset of the field and the parallel |
| // arrays _objects and _values are used for O and V. Loads of O.F can |
| // simply use V. Newly allocated objects are kept in a separate list |
| // along with a parallel array for each object which represents the |
| // current value of its fields. Stores of the default value to fields |
| // which have never been stored to before are eliminated since they |
| // are redundant. Once newly allocated objects are stored into |
| // another object or they are passed out of the current compile they |
| // are treated like generic memory. |
| |
| class MemoryBuffer: public CompilationResourceObj { |
| private: |
| FieldBuffer _values; |
| GrowableArray<Value> _objects; |
| GrowableArray<Value> _newobjects; |
| GrowableArray<FieldBuffer*> _fields; |
| |
| public: |
| MemoryBuffer() {} |
| |
| StoreField* store(StoreField* st) { |
| if (!EliminateFieldAccess) { |
| return st; |
| } |
| |
| Value object = st->obj(); |
| Value value = st->value(); |
| ciField* field = st->field(); |
| if (field->holder()->is_loaded()) { |
| int offset = field->offset(); |
| int index = _newobjects.find(object); |
| if (index != -1) { |
| // newly allocated object with no other stores performed on this field |
| FieldBuffer* buf = _fields.at(index); |
| if (buf->at(field) == NULL && is_default_value(value)) { |
| #ifndef PRODUCT |
| if (PrintIRDuringConstruction && Verbose) { |
| tty->print_cr("Eliminated store for object %d:", index); |
| st->print_line(); |
| } |
| #endif |
| return NULL; |
| } else { |
| buf->at_put(field, value); |
| } |
| } else { |
| _objects.at_put_grow(offset, object, NULL); |
| _values.at_put(field, value); |
| } |
| |
| store_value(value); |
| } else { |
| // if we held onto field names we could alias based on names but |
| // we don't know what's being stored to so kill it all. |
| kill(); |
| } |
| return st; |
| } |
| |
| |
| // return true if this value correspond to the default value of a field. |
| bool is_default_value(Value value) { |
| Constant* con = value->as_Constant(); |
| if (con) { |
| switch (con->type()->tag()) { |
| case intTag: return con->type()->as_IntConstant()->value() == 0; |
| case longTag: return con->type()->as_LongConstant()->value() == 0; |
| case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0; |
| case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0); |
| case objectTag: return con->type() == objectNull; |
| default: ShouldNotReachHere(); |
| } |
| } |
| return false; |
| } |
| |
| |
| // return either the actual value of a load or the load itself |
| Value load(LoadField* load) { |
| if (!EliminateFieldAccess) { |
| return load; |
| } |
| |
| if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) { |
| // can't skip load since value might get rounded as a side effect |
| return load; |
| } |
| |
| ciField* field = load->field(); |
| Value object = load->obj(); |
| if (field->holder()->is_loaded() && !field->is_volatile()) { |
| int offset = field->offset(); |
| Value result = NULL; |
| int index = _newobjects.find(object); |
| if (index != -1) { |
| result = _fields.at(index)->at(field); |
| } else if (_objects.at_grow(offset, NULL) == object) { |
| result = _values.at(field); |
| } |
| if (result != NULL) { |
| #ifndef PRODUCT |
| if (PrintIRDuringConstruction && Verbose) { |
| tty->print_cr("Eliminated load: "); |
| load->print_line(); |
| } |
| #endif |
| assert(result->type()->tag() == load->type()->tag(), "wrong types"); |
| return result; |
| } |
| } |
| return load; |
| } |
| |
| // Record this newly allocated object |
| void new_instance(NewInstance* object) { |
| int index = _newobjects.length(); |
| _newobjects.append(object); |
| if (_fields.at_grow(index, NULL) == NULL) { |
| _fields.at_put(index, new FieldBuffer()); |
| } else { |
| _fields.at(index)->kill(); |
| } |
| } |
| |
| void store_value(Value value) { |
| int index = _newobjects.find(value); |
| if (index != -1) { |
| // stored a newly allocated object into another object. |
| // Assume we've lost track of it as separate slice of memory. |
| // We could do better by keeping track of whether individual |
| // fields could alias each other. |
| _newobjects.remove_at(index); |
| // pull out the field info and store it at the end up the list |
| // of field info list to be reused later. |
| _fields.append(_fields.at(index)); |
| _fields.remove_at(index); |
| } |
| } |
| |
| void kill() { |
| _newobjects.trunc_to(0); |
| _objects.trunc_to(0); |
| _values.kill(); |
| } |
| }; |
| |
| |
| // Implementation of GraphBuilder's ScopeData |
| |
| GraphBuilder::ScopeData::ScopeData(ScopeData* parent) |
| : _parent(parent) |
| , _bci2block(NULL) |
| , _scope(NULL) |
| , _has_handler(false) |
| , _stream(NULL) |
| , _work_list(NULL) |
| , _parsing_jsr(false) |
| , _jsr_xhandlers(NULL) |
| , _caller_stack_size(-1) |
| , _continuation(NULL) |
| , _continuation_state(NULL) |
| , _num_returns(0) |
| , _cleanup_block(NULL) |
| , _cleanup_return_prev(NULL) |
| , _cleanup_state(NULL) |
| { |
| if (parent != NULL) { |
| _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f); |
| } else { |
| _max_inline_size = MaxInlineSize; |
| } |
| if (_max_inline_size < MaxTrivialSize) { |
| _max_inline_size = MaxTrivialSize; |
| } |
| } |
| |
| |
| void GraphBuilder::kill_field(ciField* field) { |
| if (UseLocalValueNumbering) { |
| vmap()->kill_field(field); |
| } |
| } |
| |
| |
| void GraphBuilder::kill_array(Value value) { |
| if (UseLocalValueNumbering) { |
| vmap()->kill_array(value->type()); |
| } |
| _memory->store_value(value); |
| } |
| |
| |
| void GraphBuilder::kill_all() { |
| if (UseLocalValueNumbering) { |
| vmap()->kill_all(); |
| } |
| _memory->kill(); |
| } |
| |
| |
| BlockBegin* GraphBuilder::ScopeData::block_at(int bci) { |
| if (parsing_jsr()) { |
| // It is necessary to clone all blocks associated with a |
| // subroutine, including those for exception handlers in the scope |
| // of the method containing the jsr (because those exception |
| // handlers may contain ret instructions in some cases). |
| BlockBegin* block = bci2block()->at(bci); |
| if (block != NULL && block == parent()->bci2block()->at(bci)) { |
| BlockBegin* new_block = new BlockBegin(block->bci()); |
| #ifndef PRODUCT |
| if (PrintInitialBlockList) { |
| tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr", |
| block->block_id(), block->bci(), new_block->block_id()); |
| } |
| #endif |
| // copy data from cloned blocked |
| new_block->set_depth_first_number(block->depth_first_number()); |
| if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag); |
| // Preserve certain flags for assertion checking |
| if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag); |
| if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag); |
| |
| // copy was_visited_flag to allow early detection of bailouts |
| // if a block that is used in a jsr has already been visited before, |
| // it is shared between the normal control flow and a subroutine |
| // BlockBegin::try_merge returns false when the flag is set, this leads |
| // to a compilation bailout |
| if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag); |
| |
| bci2block()->at_put(bci, new_block); |
| block = new_block; |
| } |
| return block; |
| } else { |
| return bci2block()->at(bci); |
| } |
| } |
| |
| |
| XHandlers* GraphBuilder::ScopeData::xhandlers() const { |
| if (_jsr_xhandlers == NULL) { |
| assert(!parsing_jsr(), ""); |
| return scope()->xhandlers(); |
| } |
| assert(parsing_jsr(), ""); |
| return _jsr_xhandlers; |
| } |
| |
| |
| void GraphBuilder::ScopeData::set_scope(IRScope* scope) { |
| _scope = scope; |
| bool parent_has_handler = false; |
| if (parent() != NULL) { |
| parent_has_handler = parent()->has_handler(); |
| } |
| _has_handler = parent_has_handler || scope->xhandlers()->has_handlers(); |
| } |
| |
| |
| void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block, |
| Instruction* return_prev, |
| ValueStack* return_state) { |
| _cleanup_block = block; |
| _cleanup_return_prev = return_prev; |
| _cleanup_state = return_state; |
| } |
| |
| |
| void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) { |
| if (_work_list == NULL) { |
| _work_list = new BlockList(); |
| } |
| |
| if (!block->is_set(BlockBegin::is_on_work_list_flag)) { |
| // Do not start parsing the continuation block while in a |
| // sub-scope |
| if (parsing_jsr()) { |
| if (block == jsr_continuation()) { |
| return; |
| } |
| } else { |
| if (block == continuation()) { |
| return; |
| } |
| } |
| block->set(BlockBegin::is_on_work_list_flag); |
| _work_list->push(block); |
| |
| sort_top_into_worklist(_work_list, block); |
| } |
| } |
| |
| |
| void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) { |
| assert(worklist->top() == top, ""); |
| // sort block descending into work list |
| const int dfn = top->depth_first_number(); |
| assert(dfn != -1, "unknown depth first number"); |
| int i = worklist->length()-2; |
| while (i >= 0) { |
| BlockBegin* b = worklist->at(i); |
| if (b->depth_first_number() < dfn) { |
| worklist->at_put(i+1, b); |
| } else { |
| break; |
| } |
| i --; |
| } |
| if (i >= -1) worklist->at_put(i + 1, top); |
| } |
| |
| int GraphBuilder::ScopeData::caller_stack_size() const { |
| ValueStack* state = scope()->caller_state(); |
| if (state == NULL) { |
| return 0; |
| } |
| return state->stack_size(); |
| } |
| |
| |
| BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() { |
| if (is_work_list_empty()) { |
| return NULL; |
| } |
| return _work_list->pop(); |
| } |
| |
| |
| bool GraphBuilder::ScopeData::is_work_list_empty() const { |
| return (_work_list == NULL || _work_list->length() == 0); |
| } |
| |
| |
| void GraphBuilder::ScopeData::setup_jsr_xhandlers() { |
| assert(parsing_jsr(), ""); |
| // clone all the exception handlers from the scope |
| XHandlers* handlers = new XHandlers(scope()->xhandlers()); |
| const int n = handlers->length(); |
| for (int i = 0; i < n; i++) { |
| // The XHandlers need to be adjusted to dispatch to the cloned |
| // handler block instead of the default one but the synthetic |
| // unlocker needs to be handled specially. The synthetic unlocker |
| // should be left alone since there can be only one and all code |
| // should dispatch to the same one. |
| XHandler* h = handlers->handler_at(i); |
| if (h->handler_bci() != SynchronizationEntryBCI) { |
| h->set_entry_block(block_at(h->handler_bci())); |
| } else { |
| assert(h->entry_block()->is_set(BlockBegin::default_exception_handler_flag), |
| "should be the synthetic unlock block"); |
| } |
| } |
| _jsr_xhandlers = handlers; |
| } |
| |
| |
| int GraphBuilder::ScopeData::num_returns() { |
| if (parsing_jsr()) { |
| return parent()->num_returns(); |
| } |
| return _num_returns; |
| } |
| |
| |
| void GraphBuilder::ScopeData::incr_num_returns() { |
| if (parsing_jsr()) { |
| parent()->incr_num_returns(); |
| } else { |
| ++_num_returns; |
| } |
| } |
| |
| |
| // Implementation of GraphBuilder |
| |
| #define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; } |
| |
| |
| void GraphBuilder::load_constant() { |
| ciConstant con = stream()->get_constant(); |
| if (con.basic_type() == T_ILLEGAL) { |
| BAILOUT("could not resolve a constant"); |
| } else { |
| ValueType* t = illegalType; |
| ValueStack* patch_state = NULL; |
| switch (con.basic_type()) { |
| case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break; |
| case T_BYTE : t = new IntConstant (con.as_byte ()); break; |
| case T_CHAR : t = new IntConstant (con.as_char ()); break; |
| case T_SHORT : t = new IntConstant (con.as_short ()); break; |
| case T_INT : t = new IntConstant (con.as_int ()); break; |
| case T_LONG : t = new LongConstant (con.as_long ()); break; |
| case T_FLOAT : t = new FloatConstant (con.as_float ()); break; |
| case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break; |
| case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break; |
| case T_OBJECT : |
| { |
| ciObject* obj = con.as_object(); |
| if (obj->is_klass()) { |
| ciKlass* klass = obj->as_klass(); |
| if (!klass->is_loaded() || PatchALot) { |
| patch_state = state()->copy(); |
| t = new ObjectConstant(obj); |
| } else { |
| t = new InstanceConstant(klass->java_mirror()); |
| } |
| } else { |
| t = new InstanceConstant(obj->as_instance()); |
| } |
| break; |
| } |
| default : ShouldNotReachHere(); |
| } |
| Value x; |
| if (patch_state != NULL) { |
| x = new Constant(t, patch_state); |
| } else { |
| x = new Constant(t); |
| } |
| push(t, append(x)); |
| } |
| } |
| |
| |
| void GraphBuilder::load_local(ValueType* type, int index) { |
| Value x = state()->load_local(index); |
| push(type, x); |
| } |
| |
| |
| void GraphBuilder::store_local(ValueType* type, int index) { |
| Value x = pop(type); |
| store_local(state(), x, type, index); |
| } |
| |
| |
| void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) { |
| if (parsing_jsr()) { |
| // We need to do additional tracking of the location of the return |
| // address for jsrs since we don't handle arbitrary jsr/ret |
| // constructs. Here we are figuring out in which circumstances we |
| // need to bail out. |
| if (x->type()->is_address()) { |
| scope_data()->set_jsr_return_address_local(index); |
| |
| // Also check parent jsrs (if any) at this time to see whether |
| // they are using this local. We don't handle skipping over a |
| // ret. |
| for (ScopeData* cur_scope_data = scope_data()->parent(); |
| cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); |
| cur_scope_data = cur_scope_data->parent()) { |
| if (cur_scope_data->jsr_return_address_local() == index) { |
| BAILOUT("subroutine overwrites return address from previous subroutine"); |
| } |
| } |
| } else if (index == scope_data()->jsr_return_address_local()) { |
| scope_data()->set_jsr_return_address_local(-1); |
| } |
| } |
| |
| state->store_local(index, round_fp(x)); |
| } |
| |
| |
| void GraphBuilder::load_indexed(BasicType type) { |
| Value index = ipop(); |
| Value array = apop(); |
| Value length = NULL; |
| if (CSEArrayLength || |
| (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || |
| (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { |
| length = append(new ArrayLength(array, lock_stack())); |
| } |
| push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack()))); |
| } |
| |
| |
| void GraphBuilder::store_indexed(BasicType type) { |
| Value value = pop(as_ValueType(type)); |
| Value index = ipop(); |
| Value array = apop(); |
| Value length = NULL; |
| if (CSEArrayLength || |
| (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || |
| (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { |
| length = append(new ArrayLength(array, lock_stack())); |
| } |
| StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack()); |
| kill_array(value); // invalidate all CSEs that are memory accesses of the same type |
| append(result); |
| } |
| |
| |
| void GraphBuilder::stack_op(Bytecodes::Code code) { |
| switch (code) { |
| case Bytecodes::_pop: |
| { state()->raw_pop(); |
| } |
| break; |
| case Bytecodes::_pop2: |
| { state()->raw_pop(); |
| state()->raw_pop(); |
| } |
| break; |
| case Bytecodes::_dup: |
| { Value w = state()->raw_pop(); |
| state()->raw_push(w); |
| state()->raw_push(w); |
| } |
| break; |
| case Bytecodes::_dup_x1: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| state()->raw_push(w1); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| } |
| break; |
| case Bytecodes::_dup_x2: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| Value w3 = state()->raw_pop(); |
| state()->raw_push(w1); |
| state()->raw_push(w3); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| } |
| break; |
| case Bytecodes::_dup2: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| } |
| break; |
| case Bytecodes::_dup2_x1: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| Value w3 = state()->raw_pop(); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| state()->raw_push(w3); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| } |
| break; |
| case Bytecodes::_dup2_x2: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| Value w3 = state()->raw_pop(); |
| Value w4 = state()->raw_pop(); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| state()->raw_push(w4); |
| state()->raw_push(w3); |
| state()->raw_push(w2); |
| state()->raw_push(w1); |
| } |
| break; |
| case Bytecodes::_swap: |
| { Value w1 = state()->raw_pop(); |
| Value w2 = state()->raw_pop(); |
| state()->raw_push(w1); |
| state()->raw_push(w2); |
| } |
| break; |
| default: |
| ShouldNotReachHere(); |
| break; |
| } |
| } |
| |
| |
| void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) { |
| Value y = pop(type); |
| Value x = pop(type); |
| // NOTE: strictfp can be queried from current method since we don't |
| // inline methods with differing strictfp bits |
| Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack); |
| // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level |
| res = append(res); |
| if (method()->is_strict()) { |
| res = round_fp(res); |
| } |
| push(type, res); |
| } |
| |
| |
| void GraphBuilder::negate_op(ValueType* type) { |
| push(type, append(new NegateOp(pop(type)))); |
| } |
| |
| |
| void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) { |
| Value s = ipop(); |
| Value x = pop(type); |
| // try to simplify |
| // Note: This code should go into the canonicalizer as soon as it can |
| // can handle canonicalized forms that contain more than one node. |
| if (CanonicalizeNodes && code == Bytecodes::_iushr) { |
| // pattern: x >>> s |
| IntConstant* s1 = s->type()->as_IntConstant(); |
| if (s1 != NULL) { |
| // pattern: x >>> s1, with s1 constant |
| ShiftOp* l = x->as_ShiftOp(); |
| if (l != NULL && l->op() == Bytecodes::_ishl) { |
| // pattern: (a << b) >>> s1 |
| IntConstant* s0 = l->y()->type()->as_IntConstant(); |
| if (s0 != NULL) { |
| // pattern: (a << s0) >>> s1 |
| const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts |
| const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts |
| if (s0c == s1c) { |
| if (s0c == 0) { |
| // pattern: (a << 0) >>> 0 => simplify to: a |
| ipush(l->x()); |
| } else { |
| // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant |
| assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases"); |
| const int m = (1 << (BitsPerInt - s0c)) - 1; |
| Value s = append(new Constant(new IntConstant(m))); |
| ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s))); |
| } |
| return; |
| } |
| } |
| } |
| } |
| } |
| // could not simplify |
| push(type, append(new ShiftOp(code, x, s))); |
| } |
| |
| |
| void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) { |
| Value y = pop(type); |
| Value x = pop(type); |
| push(type, append(new LogicOp(code, x, y))); |
| } |
| |
| |
| void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) { |
| ValueStack* state_before = state()->copy(); |
| Value y = pop(type); |
| Value x = pop(type); |
| ipush(append(new CompareOp(code, x, y, state_before))); |
| } |
| |
| |
| void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) { |
| push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to)))); |
| } |
| |
| |
| void GraphBuilder::increment() { |
| int index = stream()->get_index(); |
| int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]); |
| load_local(intType, index); |
| ipush(append(new Constant(new IntConstant(delta)))); |
| arithmetic_op(intType, Bytecodes::_iadd); |
| store_local(intType, index); |
| } |
| |
| |
| void GraphBuilder::_goto(int from_bci, int to_bci) { |
| profile_bci(from_bci); |
| append(new Goto(block_at(to_bci), to_bci <= from_bci)); |
| } |
| |
| |
| void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) { |
| BlockBegin* tsux = block_at(stream()->get_dest()); |
| BlockBegin* fsux = block_at(stream()->next_bci()); |
| bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci(); |
| If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If(); |
| if (profile_branches() && (if_node != NULL)) { |
| if_node->set_profiled_method(method()); |
| if_node->set_profiled_bci(bci()); |
| if_node->set_should_profile(true); |
| } |
| } |
| |
| |
| void GraphBuilder::if_zero(ValueType* type, If::Condition cond) { |
| Value y = append(new Constant(intZero)); |
| ValueStack* state_before = state()->copy(); |
| Value x = ipop(); |
| if_node(x, cond, y, state_before); |
| } |
| |
| |
| void GraphBuilder::if_null(ValueType* type, If::Condition cond) { |
| Value y = append(new Constant(objectNull)); |
| ValueStack* state_before = state()->copy(); |
| Value x = apop(); |
| if_node(x, cond, y, state_before); |
| } |
| |
| |
| void GraphBuilder::if_same(ValueType* type, If::Condition cond) { |
| ValueStack* state_before = state()->copy(); |
| Value y = pop(type); |
| Value x = pop(type); |
| if_node(x, cond, y, state_before); |
| } |
| |
| |
| void GraphBuilder::jsr(int dest) { |
| // We only handle well-formed jsrs (those which are "block-structured"). |
| // If the bytecodes are strange (jumping out of a jsr block) then we |
| // might end up trying to re-parse a block containing a jsr which |
| // has already been activated. Watch for this case and bail out. |
| for (ScopeData* cur_scope_data = scope_data(); |
| cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); |
| cur_scope_data = cur_scope_data->parent()) { |
| if (cur_scope_data->jsr_entry_bci() == dest) { |
| BAILOUT("too-complicated jsr/ret structure"); |
| } |
| } |
| |
| push(addressType, append(new Constant(new AddressConstant(next_bci())))); |
| if (!try_inline_jsr(dest)) { |
| return; // bailed out while parsing and inlining subroutine |
| } |
| } |
| |
| |
| void GraphBuilder::ret(int local_index) { |
| if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine"); |
| |
| if (local_index != scope_data()->jsr_return_address_local()) { |
| BAILOUT("can not handle complicated jsr/ret constructs"); |
| } |
| |
| // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation |
| append(new Goto(scope_data()->jsr_continuation(), false)); |
| } |
| |
| |
| void GraphBuilder::table_switch() { |
| Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci()); |
| const int l = switch_->length(); |
| if (CanonicalizeNodes && l == 1) { |
| // total of 2 successors => use If instead of switch |
| // Note: This code should go into the canonicalizer as soon as it can |
| // can handle canonicalized forms that contain more than one node. |
| Value key = append(new Constant(new IntConstant(switch_->low_key()))); |
| BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0)); |
| BlockBegin* fsux = block_at(bci() + switch_->default_offset()); |
| bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); |
| ValueStack* state_before = is_bb ? state() : NULL; |
| append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); |
| } else { |
| // collect successors |
| BlockList* sux = new BlockList(l + 1, NULL); |
| int i; |
| bool has_bb = false; |
| for (i = 0; i < l; i++) { |
| sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i))); |
| if (switch_->dest_offset_at(i) < 0) has_bb = true; |
| } |
| // add default successor |
| sux->at_put(i, block_at(bci() + switch_->default_offset())); |
| ValueStack* state_before = has_bb ? state() : NULL; |
| append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb)); |
| } |
| } |
| |
| |
| void GraphBuilder::lookup_switch() { |
| Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci()); |
| const int l = switch_->number_of_pairs(); |
| if (CanonicalizeNodes && l == 1) { |
| // total of 2 successors => use If instead of switch |
| // Note: This code should go into the canonicalizer as soon as it can |
| // can handle canonicalized forms that contain more than one node. |
| // simplify to If |
| LookupswitchPair* pair = switch_->pair_at(0); |
| Value key = append(new Constant(new IntConstant(pair->match()))); |
| BlockBegin* tsux = block_at(bci() + pair->offset()); |
| BlockBegin* fsux = block_at(bci() + switch_->default_offset()); |
| bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); |
| ValueStack* state_before = is_bb ? state() : NULL; |
| append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); |
| } else { |
| // collect successors & keys |
| BlockList* sux = new BlockList(l + 1, NULL); |
| intArray* keys = new intArray(l, 0); |
| int i; |
| bool has_bb = false; |
| for (i = 0; i < l; i++) { |
| LookupswitchPair* pair = switch_->pair_at(i); |
| if (pair->offset() < 0) has_bb = true; |
| sux->at_put(i, block_at(bci() + pair->offset())); |
| keys->at_put(i, pair->match()); |
| } |
| // add default successor |
| sux->at_put(i, block_at(bci() + switch_->default_offset())); |
| ValueStack* state_before = has_bb ? state() : NULL; |
| append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb)); |
| } |
| } |
| |
| void GraphBuilder::call_register_finalizer() { |
| // If the receiver requires finalization then emit code to perform |
| // the registration on return. |
| |
| // Gather some type information about the receiver |
| Value receiver = state()->load_local(0); |
| assert(receiver != NULL, "must have a receiver"); |
| ciType* declared_type = receiver->declared_type(); |
| ciType* exact_type = receiver->exact_type(); |
| if (exact_type == NULL && |
| receiver->as_Local() && |
| receiver->as_Local()->java_index() == 0) { |
| ciInstanceKlass* ik = compilation()->method()->holder(); |
| if (ik->is_final()) { |
| exact_type = ik; |
| } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) { |
| // test class is leaf class |
| compilation()->dependency_recorder()->assert_leaf_type(ik); |
| exact_type = ik; |
| } else { |
| declared_type = ik; |
| } |
| } |
| |
| // see if we know statically that registration isn't required |
| bool needs_check = true; |
| if (exact_type != NULL) { |
| needs_check = exact_type->as_instance_klass()->has_finalizer(); |
| } else if (declared_type != NULL) { |
| ciInstanceKlass* ik = declared_type->as_instance_klass(); |
| if (!Dependencies::has_finalizable_subclass(ik)) { |
| compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik); |
| needs_check = false; |
| } |
| } |
| |
| if (needs_check) { |
| // Perform the registration of finalizable objects. |
| load_local(objectType, 0); |
| append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init, |
| state()->pop_arguments(1), |
| true, lock_stack(), true)); |
| } |
| } |
| |
| |
| void GraphBuilder::method_return(Value x) { |
| if (RegisterFinalizersAtInit && |
| method()->intrinsic_id() == vmIntrinsics::_Object_init) { |
| call_register_finalizer(); |
| } |
| |
| // Check to see whether we are inlining. If so, Return |
| // instructions become Gotos to the continuation point. |
| if (continuation() != NULL) { |
| assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet"); |
| |
| // If the inlined method is synchronized, the monitor must be |
| // released before we jump to the continuation block. |
| if (method()->is_synchronized()) { |
| int i = state()->caller_state()->locks_size(); |
| assert(state()->locks_size() == i + 1, "receiver must be locked here"); |
| monitorexit(state()->lock_at(i), SynchronizationEntryBCI); |
| } |
| |
| state()->truncate_stack(caller_stack_size()); |
| if (x != NULL) { |
| state()->push(x->type(), x); |
| } |
| Goto* goto_callee = new Goto(continuation(), false); |
| |
| // See whether this is the first return; if so, store off some |
| // of the state for later examination |
| if (num_returns() == 0) { |
| set_inline_cleanup_info(_block, _last, state()); |
| } |
| |
| // State at end of inlined method is the state of the caller |
| // without the method parameters on stack, including the |
| // return value, if any, of the inlined method on operand stack. |
| set_state(scope_data()->continuation_state()->copy()); |
| if (x) { |
| state()->push(x->type(), x); |
| } |
| |
| // The current bci() is in the wrong scope, so use the bci() of |
| // the continuation point. |
| append_with_bci(goto_callee, scope_data()->continuation()->bci()); |
| incr_num_returns(); |
| |
| return; |
| } |
| |
| state()->truncate_stack(0); |
| if (method()->is_synchronized()) { |
| // perform the unlocking before exiting the method |
| Value receiver; |
| if (!method()->is_static()) { |
| receiver = _initial_state->local_at(0); |
| } else { |
| receiver = append(new Constant(new ClassConstant(method()->holder()))); |
| } |
| append_split(new MonitorExit(receiver, state()->unlock())); |
| } |
| |
| append(new Return(x)); |
| } |
| |
| |
| void GraphBuilder::access_field(Bytecodes::Code code) { |
| bool will_link; |
| ciField* field = stream()->get_field(will_link); |
| ciInstanceKlass* holder = field->holder(); |
| BasicType field_type = field->type()->basic_type(); |
| ValueType* type = as_ValueType(field_type); |
| // call will_link again to determine if the field is valid. |
| const bool is_loaded = holder->is_loaded() && |
| field->will_link(method()->holder(), code); |
| const bool is_initialized = is_loaded && holder->is_initialized(); |
| |
| ValueStack* state_copy = NULL; |
| if (!is_initialized || PatchALot) { |
| // save state before instruction for debug info when |
| // deoptimization happens during patching |
| state_copy = state()->copy(); |
| } |
| |
| Value obj = NULL; |
| if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) { |
| // commoning of class constants should only occur if the class is |
| // fully initialized and resolved in this constant pool. The will_link test |
| // above essentially checks if this class is resolved in this constant pool |
| // so, the is_initialized flag should be suffiect. |
| if (state_copy != NULL) { |
| // build a patching constant |
| obj = new Constant(new ClassConstant(holder), state_copy); |
| } else { |
| obj = new Constant(new ClassConstant(holder)); |
| } |
| } |
| |
| |
| const int offset = is_loaded ? field->offset() : -1; |
| switch (code) { |
| case Bytecodes::_getstatic: { |
| // check for compile-time constants, i.e., initialized static final fields |
| Instruction* constant = NULL; |
| if (field->is_constant() && !PatchALot) { |
| ciConstant field_val = field->constant_value(); |
| BasicType field_type = field_val.basic_type(); |
| switch (field_type) { |
| case T_ARRAY: |
| case T_OBJECT: |
| if (field_val.as_object()->has_encoding()) { |
| constant = new Constant(as_ValueType(field_val)); |
| } |
| break; |
| |
| default: |
| constant = new Constant(as_ValueType(field_val)); |
| } |
| } |
| if (constant != NULL) { |
| push(type, append(constant)); |
| state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below) |
| } else { |
| push(type, append(new LoadField(append(obj), offset, field, true, |
| lock_stack(), state_copy, is_loaded, is_initialized))); |
| } |
| break; |
| } |
| case Bytecodes::_putstatic: |
| { Value val = pop(type); |
| append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized)); |
| if (UseLocalValueNumbering) { |
| vmap()->kill_field(field); // invalidate all CSEs that are memory accesses |
| } |
| } |
| break; |
| case Bytecodes::_getfield : |
| { |
| LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true); |
| Value replacement = is_loaded ? _memory->load(load) : load; |
| if (replacement != load) { |
| assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(), |
| "should already by linked"); |
| push(type, replacement); |
| } else { |
| push(type, append(load)); |
| } |
| break; |
| } |
| |
| case Bytecodes::_putfield : |
| { Value val = pop(type); |
| StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true); |
| if (is_loaded) store = _memory->store(store); |
| if (store != NULL) { |
| append(store); |
| kill_field(field); // invalidate all CSEs that are accesses of this field |
| } |
| } |
| break; |
| default : |
| ShouldNotReachHere(); |
| break; |
| } |
| } |
| |
| |
| Dependencies* GraphBuilder::dependency_recorder() const { |
| assert(DeoptC1, "need debug information"); |
| compilation()->set_needs_debug_information(true); |
| return compilation()->dependency_recorder(); |
| } |
| |
| |
| void GraphBuilder::invoke(Bytecodes::Code code) { |
| bool will_link; |
| ciMethod* target = stream()->get_method(will_link); |
| // we have to make sure the argument size (incl. the receiver) |
| // is correct for compilation (the call would fail later during |
| // linkage anyway) - was bug (gri 7/28/99) |
| if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error"); |
| ciInstanceKlass* klass = target->holder(); |
| |
| // check if CHA possible: if so, change the code to invoke_special |
| ciInstanceKlass* calling_klass = method()->holder(); |
| ciKlass* holder = stream()->get_declared_method_holder(); |
| ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder); |
| ciInstanceKlass* actual_recv = callee_holder; |
| |
| // some methods are obviously bindable without any type checks so |
| // convert them directly to an invokespecial. |
| if (target->is_loaded() && !target->is_abstract() && |
| target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) { |
| code = Bytecodes::_invokespecial; |
| } |
| |
| // NEEDS_CLEANUP |
| // I've added the target-is_loaded() test below but I don't really understand |
| // how klass->is_loaded() can be true and yet target->is_loaded() is false. |
| // this happened while running the JCK invokevirtual tests under doit. TKR |
| ciMethod* cha_monomorphic_target = NULL; |
| ciMethod* exact_target = NULL; |
| if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded()) { |
| Value receiver = NULL; |
| ciInstanceKlass* receiver_klass = NULL; |
| bool type_is_exact = false; |
| // try to find a precise receiver type |
| if (will_link && !target->is_static()) { |
| int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); |
| receiver = state()->stack_at(index); |
| ciType* type = receiver->exact_type(); |
| if (type != NULL && type->is_loaded() && |
| type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { |
| receiver_klass = (ciInstanceKlass*) type; |
| type_is_exact = true; |
| } |
| if (type == NULL) { |
| type = receiver->declared_type(); |
| if (type != NULL && type->is_loaded() && |
| type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { |
| receiver_klass = (ciInstanceKlass*) type; |
| if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) { |
| // Insert a dependency on this type since |
| // find_monomorphic_target may assume it's already done. |
| dependency_recorder()->assert_leaf_type(receiver_klass); |
| type_is_exact = true; |
| } |
| } |
| } |
| } |
| if (receiver_klass != NULL && type_is_exact && |
| receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) { |
| // If we have the exact receiver type we can bind directly to |
| // the method to call. |
| exact_target = target->resolve_invoke(calling_klass, receiver_klass); |
| if (exact_target != NULL) { |
| target = exact_target; |
| code = Bytecodes::_invokespecial; |
| } |
| } |
| if (receiver_klass != NULL && |
| receiver_klass->is_subtype_of(actual_recv) && |
| actual_recv->is_initialized()) { |
| actual_recv = receiver_klass; |
| } |
| |
| if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) || |
| (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) { |
| // Use CHA on the receiver to select a more precise method. |
| cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv); |
| } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) { |
| // if there is only one implementor of this interface then we |
| // may be able bind this invoke directly to the implementing |
| // klass but we need both a dependence on the single interface |
| // and on the method we bind to. Additionally since all we know |
| // about the receiver type is the it's supposed to implement the |
| // interface we have to insert a check that it's the class we |
| // expect. Interface types are not checked by the verifier so |
| // they are roughly equivalent to Object. |
| ciInstanceKlass* singleton = NULL; |
| if (target->holder()->nof_implementors() == 1) { |
| singleton = target->holder()->implementor(0); |
| } |
| if (singleton) { |
| cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton); |
| if (cha_monomorphic_target != NULL) { |
| // If CHA is able to bind this invoke then update the class |
| // to match that class, otherwise klass will refer to the |
| // interface. |
| klass = cha_monomorphic_target->holder(); |
| actual_recv = target->holder(); |
| |
| // insert a check it's really the expected class. |
| CheckCast* c = new CheckCast(klass, receiver, NULL); |
| c->set_incompatible_class_change_check(); |
| c->set_direct_compare(klass->is_final()); |
| append_split(c); |
| } |
| } |
| } |
| } |
| |
| if (cha_monomorphic_target != NULL) { |
| if (cha_monomorphic_target->is_abstract()) { |
| // Do not optimize for abstract methods |
| cha_monomorphic_target = NULL; |
| } |
| } |
| |
| if (cha_monomorphic_target != NULL) { |
| if (!(target->is_final_method())) { |
| // If we inlined because CHA revealed only a single target method, |
| // then we are dependent on that target method not getting overridden |
| // by dynamic class loading. Be sure to test the "static" receiver |
| // dest_method here, as opposed to the actual receiver, which may |
| // falsely lead us to believe that the receiver is final or private. |
| dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target); |
| } |
| code = Bytecodes::_invokespecial; |
| } |
| // check if we could do inlining |
| if (!PatchALot && Inline && klass->is_loaded() && |
| (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized()) |
| && target->will_link(klass, callee_holder, code)) { |
| // callee is known => check if we have static binding |
| assert(target->is_loaded(), "callee must be known"); |
| if (code == Bytecodes::_invokestatic |
| || code == Bytecodes::_invokespecial |
| || code == Bytecodes::_invokevirtual && target->is_final_method() |
| ) { |
| // static binding => check if callee is ok |
| ciMethod* inline_target = (cha_monomorphic_target != NULL) |
| ? cha_monomorphic_target |
| : target; |
| bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL)); |
| CHECK_BAILOUT(); |
| |
| #ifndef PRODUCT |
| // printing |
| if (PrintInlining && !res) { |
| // if it was successfully inlined, then it was already printed. |
| print_inline_result(inline_target, res); |
| } |
| #endif |
| clear_inline_bailout(); |
| if (res) { |
| // Register dependence if JVMTI has either breakpoint |
| // setting or hotswapping of methods capabilities since they may |
| // cause deoptimization. |
| if (JvmtiExport::can_hotswap_or_post_breakpoint()) { |
| dependency_recorder()->assert_evol_method(inline_target); |
| } |
| return; |
| } |
| } |
| } |
| // If we attempted an inline which did not succeed because of a |
| // bailout during construction of the callee graph, the entire |
| // compilation has to be aborted. This is fairly rare and currently |
| // seems to only occur for jasm-generated classes which contain |
| // jsr/ret pairs which are not associated with finally clauses and |
| // do not have exception handlers in the containing method, and are |
| // therefore not caught early enough to abort the inlining without |
| // corrupting the graph. (We currently bail out with a non-empty |
| // stack at a ret in these situations.) |
| CHECK_BAILOUT(); |
| |
| // inlining not successful => standard invoke |
| bool is_static = code == Bytecodes::_invokestatic; |
| ValueType* result_type = as_ValueType(target->return_type()); |
| Values* args = state()->pop_arguments(target->arg_size_no_receiver()); |
| Value recv = is_static ? NULL : apop(); |
| bool is_loaded = target->is_loaded(); |
| int vtable_index = methodOopDesc::invalid_vtable_index; |
| |
| #ifdef SPARC |
| // Currently only supported on Sparc. |
| // The UseInlineCaches only controls dispatch to invokevirtuals for |
| // loaded classes which we weren't able to statically bind. |
| if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual |
| && !target->can_be_statically_bound()) { |
| // Find a vtable index if one is available |
| vtable_index = target->resolve_vtable_index(calling_klass, callee_holder); |
| } |
| #endif |
| |
| if (recv != NULL && |
| (code == Bytecodes::_invokespecial || |
| !is_loaded || target->is_final() || |
| profile_calls())) { |
| // invokespecial always needs a NULL check. invokevirtual where |
| // the target is final or where it's not known that whether the |
| // target is final requires a NULL check. Otherwise normal |
| // invokevirtual will perform the null check during the lookup |
| // logic or the unverified entry point. Profiling of calls |
| // requires that the null check is performed in all cases. |
| null_check(recv); |
| } |
| |
| if (profile_calls()) { |
| assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set"); |
| ciKlass* target_klass = NULL; |
| if (cha_monomorphic_target != NULL) { |
| target_klass = cha_monomorphic_target->holder(); |
| } else if (exact_target != NULL) { |
| target_klass = exact_target->holder(); |
| } |
| profile_call(recv, target_klass); |
| } |
| |
| Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target); |
| // push result |
| append_split(result); |
| |
| if (result_type != voidType) { |
| if (method()->is_strict()) { |
| push(result_type, round_fp(result)); |
| } else { |
| push(result_type, result); |
| } |
| } |
| } |
| |
| |
| void GraphBuilder::new_instance(int klass_index) { |
| bool will_link; |
| ciKlass* klass = stream()->get_klass(will_link); |
| assert(klass->is_instance_klass(), "must be an instance klass"); |
| NewInstance* new_instance = new NewInstance(klass->as_instance_klass()); |
| _memory->new_instance(new_instance); |
| apush(append_split(new_instance)); |
| } |
| |
| |
| void GraphBuilder::new_type_array() { |
| apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index()))); |
| } |
| |
| |
| void GraphBuilder::new_object_array() { |
| bool will_link; |
| ciKlass* klass = stream()->get_klass(will_link); |
| ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; |
| NewArray* n = new NewObjectArray(klass, ipop(), state_before); |
| apush(append_split(n)); |
| } |
| |
| |
| bool GraphBuilder::direct_compare(ciKlass* k) { |
| if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) { |
| ciInstanceKlass* ik = k->as_instance_klass(); |
| if (ik->is_final()) { |
| return true; |
| } else { |
| if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) { |
| // test class is leaf class |
| dependency_recorder()->assert_leaf_type(ik); |
| return true; |
| } |
| } |
| } |
| return false; |
| } |
| |
| |
| void GraphBuilder::check_cast(int klass_index) { |
| bool will_link; |
| ciKlass* klass = stream()->get_klass(will_link); |
| ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; |
| CheckCast* c = new CheckCast(klass, apop(), state_before); |
| apush(append_split(c)); |
| c->set_direct_compare(direct_compare(klass)); |
| if (profile_checkcasts()) { |
| c->set_profiled_method(method()); |
| c->set_profiled_bci(bci()); |
| c->set_should_profile(true); |
| } |
| } |
| |
| |
| void GraphBuilder::instance_of(int klass_index) { |
| bool will_link; |
| ciKlass* klass = stream()->get_klass(will_link); |
| ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; |
| InstanceOf* i = new InstanceOf(klass, apop(), state_before); |
| ipush(append_split(i)); |
| i->set_direct_compare(direct_compare(klass)); |
| } |
| |
| |
| void GraphBuilder::monitorenter(Value x, int bci) { |
| // save state before locking in case of deoptimization after a NullPointerException |
| ValueStack* lock_stack_before = lock_stack(); |
| append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci); |
| kill_all(); |
| } |
| |
| |
| void GraphBuilder::monitorexit(Value x, int bci) { |
| // Note: the comment below is only relevant for the case where we do |
| // not deoptimize due to asynchronous exceptions (!(DeoptC1 && |
| // DeoptOnAsyncException), which is not used anymore) |
| |
| // Note: Potentially, the monitor state in an exception handler |
| // can be wrong due to wrong 'initialization' of the handler |
| // via a wrong asynchronous exception path. This can happen, |
| // if the exception handler range for asynchronous exceptions |
| // is too long (see also java bug 4327029, and comment in |
| // GraphBuilder::handle_exception()). This may cause 'under- |
| // flow' of the monitor stack => bailout instead. |
| if (state()->locks_size() < 1) BAILOUT("monitor stack underflow"); |
| append_with_bci(new MonitorExit(x, state()->unlock()), bci); |
| kill_all(); |
| } |
| |
| |
| void GraphBuilder::new_multi_array(int dimensions) { |
| bool will_link; |
| ciKlass* klass = stream()->get_klass(will_link); |
| ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; |
| |
| Values* dims = new Values(dimensions, NULL); |
| // fill in all dimensions |
| int i = dimensions; |
| while (i-- > 0) dims->at_put(i, ipop()); |
| // create array |
| NewArray* n = new NewMultiArray(klass, dims, state_before); |
| apush(append_split(n)); |
| } |
| |
| |
| void GraphBuilder::throw_op(int bci) { |
| // We require that the debug info for a Throw be the "state before" |
| // the Throw (i.e., exception oop is still on TOS) |
| ValueStack* state_before = state()->copy(); |
| Throw* t = new Throw(apop(), state_before); |
| append_with_bci(t, bci); |
| } |
| |
| |
| Value GraphBuilder::round_fp(Value fp_value) { |
| // no rounding needed if SSE2 is used |
| if (RoundFPResults && UseSSE < 2) { |
| // Must currently insert rounding node for doubleword values that |
| // are results of expressions (i.e., not loads from memory or |
| // constants) |
| if (fp_value->type()->tag() == doubleTag && |
| fp_value->as_Constant() == NULL && |
| fp_value->as_Local() == NULL && // method parameters need no rounding |
| fp_value->as_RoundFP() == NULL) { |
| return append(new RoundFP(fp_value)); |
| } |
| } |
| return fp_value; |
| } |
| |
| |
| Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) { |
| Canonicalizer canon(instr, bci); |
| Instruction* i1 = canon.canonical(); |
| if (i1->bci() != -99) { |
| // Canonicalizer returned an instruction which was already |
| // appended so simply return it. |
| return i1; |
| } else if (UseLocalValueNumbering) { |
| // Lookup the instruction in the ValueMap and add it to the map if |
| // it's not found. |
| Instruction* i2 = vmap()->find_insert(i1); |
| if (i2 != i1) { |
| // found an entry in the value map, so just return it. |
| assert(i2->bci() != -1, "should already be linked"); |
| return i2; |
| } |
| } |
| |
| if (i1->as_Phi() == NULL && i1->as_Local() == NULL) { |
| // i1 was not eliminated => append it |
| assert(i1->next() == NULL, "shouldn't already be linked"); |
| _last = _last->set_next(i1, canon.bci()); |
| if (++_instruction_count >= InstructionCountCutoff |
| && !bailed_out()) { |
| // set the bailout state but complete normal processing. We |
| // might do a little more work before noticing the bailout so we |
| // want processing to continue normally until it's noticed. |
| bailout("Method and/or inlining is too large"); |
| } |
| |
| #ifndef PRODUCT |
| if (PrintIRDuringConstruction) { |
| InstructionPrinter ip; |
| ip.print_line(i1); |
| if (Verbose) { |
| state()->print(); |
| } |
| } |
| #endif |
| assert(_last == i1, "adjust code below"); |
| StateSplit* s = i1->as_StateSplit(); |
| if (s != NULL && i1->as_BlockEnd() == NULL) { |
| // Continue CSE across certain intrinsics |
| Intrinsic* intrinsic = s->as_Intrinsic(); |
| if (UseLocalValueNumbering) { |
| if (intrinsic == NULL || !intrinsic->preserves_state()) { |
| vmap()->kill_all(); // for now, hopefully we need this only for calls eventually |
| } |
| } |
| if (EliminateFieldAccess) { |
| if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) { |
| _memory->kill(); |
| } |
| } |
| s->set_state(state()->copy()); |
| } |
| // set up exception handlers for this instruction if necessary |
| if (i1->can_trap()) { |
| assert(exception_state() != NULL || !has_handler(), "must have setup exception state"); |
| i1->set_exception_handlers(handle_exception(bci)); |
| } |
| } |
| return i1; |
| } |
| |
| |
| Instruction* GraphBuilder::append(Instruction* instr) { |
| assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used"); |
| return append_with_bci(instr, bci()); |
| } |
| |
| |
| Instruction* GraphBuilder::append_split(StateSplit* instr) { |
| return append_with_bci(instr, bci()); |
| } |
| |
| |
| void GraphBuilder::null_check(Value value) { |
| if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) { |
| return; |
| } else { |
| Constant* con = value->as_Constant(); |
| if (con) { |
| ObjectType* c = con->type()->as_ObjectType(); |
| if (c && c->is_loaded()) { |
| ObjectConstant* oc = c->as_ObjectConstant(); |
| if (!oc || !oc->value()->is_null_object()) { |
| return; |
| } |
| } |
| } |
| } |
| append(new NullCheck(value, lock_stack())); |
| } |
| |
| |
| |
| XHandlers* GraphBuilder::handle_exception(int cur_bci) { |
| // fast path if it is guaranteed that no exception handlers are present |
| if (!has_handler()) { |
| // TODO: check if return NULL is possible (avoids empty lists) |
| return new XHandlers(); |
| } |
| |
| XHandlers* exception_handlers = new XHandlers(); |
| ScopeData* cur_scope_data = scope_data(); |
| ValueStack* s = exception_state(); |
| int scope_count = 0; |
| |
| assert(s != NULL, "exception state must be set"); |
| do { |
| assert(cur_scope_data->scope() == s->scope(), "scopes do not match"); |
| assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci"); |
| |
| // join with all potential exception handlers |
| XHandlers* list = cur_scope_data->xhandlers(); |
| const int n = list->length(); |
| for (int i = 0; i < n; i++) { |
| XHandler* h = list->handler_at(i); |
| if (h->covers(cur_bci)) { |
| // h is a potential exception handler => join it |
| compilation()->set_has_exception_handlers(true); |
| |
| BlockBegin* entry = h->entry_block(); |
| if (entry == block()) { |
| // It's acceptable for an exception handler to cover itself |
| // but we don't handle that in the parser currently. It's |
| // very rare so we bailout instead of trying to handle it. |
| BAILOUT_("exception handler covers itself", exception_handlers); |
| } |
| assert(entry->bci() == h->handler_bci(), "must match"); |
| assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond"); |
| |
| // previously this was a BAILOUT, but this is not necessary |
| // now because asynchronous exceptions are not handled this way. |
| assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match"); |
| |
| // xhandler start with an empty expression stack |
| s->truncate_stack(cur_scope_data->caller_stack_size()); |
| |
| // Note: Usually this join must work. However, very |
| // complicated jsr-ret structures where we don't ret from |
| // the subroutine can cause the objects on the monitor |
| // stacks to not match because blocks can be parsed twice. |
| // The only test case we've seen so far which exhibits this |
| // problem is caught by the infinite recursion test in |
| // GraphBuilder::jsr() if the join doesn't work. |
| if (!entry->try_merge(s)) { |
| BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers); |
| } |
| |
| // add current state for correct handling of phi functions at begin of xhandler |
| int phi_operand = entry->add_exception_state(s); |
| |
| // add entry to the list of xhandlers of this block |
| _block->add_exception_handler(entry); |
| |
| // add back-edge from xhandler entry to this block |
| if (!entry->is_predecessor(_block)) { |
| entry->add_predecessor(_block); |
| } |
| |
| // clone XHandler because phi_operand and scope_count can not be shared |
| XHandler* new_xhandler = new XHandler(h); |
| new_xhandler->set_phi_operand(phi_operand); |
| new_xhandler->set_scope_count(scope_count); |
| exception_handlers->append(new_xhandler); |
| |
| // fill in exception handler subgraph lazily |
| assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet"); |
| cur_scope_data->add_to_work_list(entry); |
| |
| // stop when reaching catchall |
| if (h->catch_type() == 0) { |
| return exception_handlers; |
| } |
| } |
| } |
| |
| // Set up iteration for next time. |
| // If parsing a jsr, do not grab exception handlers from the |
| // parent scopes for this method (already got them, and they |
| // needed to be cloned) |
| if (cur_scope_data->parsing_jsr()) { |
| IRScope* tmp_scope = cur_scope_data->scope(); |
| while (cur_scope_data->parent() != NULL && |
| cur_scope_data->parent()->scope() == tmp_scope) { |
| cur_scope_data = cur_scope_data->parent(); |
| } |
| } |
| if (cur_scope_data != NULL) { |
| if (cur_scope_data->parent() != NULL) { |
| // must use pop_scope instead of caller_state to preserve all monitors |
| s = s->pop_scope(); |
| } |
| cur_bci = cur_scope_data->scope()->caller_bci(); |
| cur_scope_data = cur_scope_data->parent(); |
| scope_count++; |
| } |
| } while (cur_scope_data != NULL); |
| |
| return exception_handlers; |
| } |
| |
| |
| // Helper class for simplifying Phis. |
| class PhiSimplifier : public BlockClosure { |
| private: |
| bool _has_substitutions; |
| Value simplify(Value v); |
| |
| public: |
| PhiSimplifier(BlockBegin* start) : _has_substitutions(false) { |
| start->iterate_preorder(this); |
| if (_has_substitutions) { |
| SubstitutionResolver sr(start); |
| } |
| } |
| void block_do(BlockBegin* b); |
| bool has_substitutions() const { return _has_substitutions; } |
| }; |
| |
| |
| Value PhiSimplifier::simplify(Value v) { |
| Phi* phi = v->as_Phi(); |
| |
| if (phi == NULL) { |
| // no phi function |
| return v; |
| } else if (v->has_subst()) { |
| // already substituted; subst can be phi itself -> simplify |
| return simplify(v->subst()); |
| } else if (phi->is_set(Phi::cannot_simplify)) { |
| // already tried to simplify phi before |
| return phi; |
| } else if (phi->is_set(Phi::visited)) { |
| // break cycles in phi functions |
| return phi; |
| } else if (phi->type()->is_illegal()) { |
| // illegal phi functions are ignored anyway |
| return phi; |
| |
| } else { |
| // mark phi function as processed to break cycles in phi functions |
| phi->set(Phi::visited); |
| |
| // simplify x = [y, x] and x = [y, y] to y |
| Value subst = NULL; |
| int opd_count = phi->operand_count(); |
| for (int i = 0; i < opd_count; i++) { |
| Value opd = phi->operand_at(i); |
| assert(opd != NULL, "Operand must exist!"); |
| |
| if (opd->type()->is_illegal()) { |
| // if one operand is illegal, the entire phi function is illegal |
| phi->make_illegal(); |
| phi->clear(Phi::visited); |
| return phi; |
| } |
| |
| Value new_opd = simplify(opd); |
| assert(new_opd != NULL, "Simplified operand must exist!"); |
| |
| if (new_opd != phi && new_opd != subst) { |
| if (subst == NULL) { |
| subst = new_opd; |
| } else { |
| // no simplification possible |
| phi->set(Phi::cannot_simplify); |
| phi->clear(Phi::visited); |
| return phi; |
| } |
| } |
| } |
| |
| // sucessfully simplified phi function |
| assert(subst != NULL, "illegal phi function"); |
| _has_substitutions = true; |
| phi->clear(Phi::visited); |
| phi->set_subst(subst); |
| |
| #ifndef PRODUCT |
| if (PrintPhiFunctions) { |
| tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id()); |
| } |
| #endif |
| |
| return subst; |
| } |
| } |
| |
| |
| void PhiSimplifier::block_do(BlockBegin* b) { |
| for_each_phi_fun(b, phi, |
| simplify(phi); |
| ); |
| |
| #ifdef ASSERT |
| for_each_phi_fun(b, phi, |
| assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification"); |
| ); |
| |
| ValueStack* state = b->state()->caller_state(); |
| int index; |
| Value value; |
| for_each_state(state) { |
| for_each_local_value(state, index, value) { |
| Phi* phi = value->as_Phi(); |
| assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state"); |
| } |
| } |
| #endif |
| } |
| |
| // This method is called after all blocks are filled with HIR instructions |
| // It eliminates all Phi functions of the form x = [y, y] and x = [y, x] |
| void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) { |
| PhiSimplifier simplifier(start); |
| } |
| |
| |
| void GraphBuilder::connect_to_end(BlockBegin* beg) { |
| // setup iteration |
| kill_all(); |
| _block = beg; |
| _state = beg->state()->copy(); |
| _last = beg; |
| iterate_bytecodes_for_block(beg->bci()); |
| } |
| |
| |
| BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) { |
| #ifndef PRODUCT |
| if (PrintIRDuringConstruction) { |
| tty->cr(); |
| InstructionPrinter ip; |
| ip.print_instr(_block); tty->cr(); |
| ip.print_stack(_block->state()); tty->cr(); |
| ip.print_inline_level(_block); |
| ip.print_head(); |
| tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size()); |
| } |
| #endif |
| _skip_block = false; |
| assert(state() != NULL, "ValueStack missing!"); |
| ciBytecodeStream s(method()); |
| s.reset_to_bci(bci); |
| int prev_bci = bci; |
| scope_data()->set_stream(&s); |
| // iterate |
| Bytecodes::Code code = Bytecodes::_illegal; |
| bool push_exception = false; |
| |
| if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) { |
| // first thing in the exception entry block should be the exception object. |
| push_exception = true; |
| } |
| |
| while (!bailed_out() && last()->as_BlockEnd() == NULL && |
| (code = stream()->next()) != ciBytecodeStream::EOBC() && |
| (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) { |
| |
| if (has_handler() && can_trap(method(), code)) { |
| // copy the state because it is modified before handle_exception is called |
| set_exception_state(state()->copy()); |
| } else { |
| // handle_exception is not called for this bytecode |
| set_exception_state(NULL); |
| } |
| |
| // Check for active jsr during OSR compilation |
| if (compilation()->is_osr_compile() |
| && scope()->is_top_scope() |
| && parsing_jsr() |
| && s.cur_bci() == compilation()->osr_bci()) { |
| bailout("OSR not supported while a jsr is active"); |
| } |
| |
| if (push_exception) { |
| apush(append(new ExceptionObject())); |
| push_exception = false; |
| } |
| |
| // handle bytecode |
| switch (code) { |
| case Bytecodes::_nop : /* nothing to do */ break; |
| case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break; |
| case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break; |
| case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break; |
| case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break; |
| case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break; |
| case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break; |
| case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break; |
| case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break; |
| case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break; |
| case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break; |
| case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break; |
| case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break; |
| case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break; |
| case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break; |
| case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break; |
| case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break; |
| case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break; |
| case Bytecodes::_ldc : // fall through |
| case Bytecodes::_ldc_w : // fall through |
| case Bytecodes::_ldc2_w : load_constant(); break; |
| case Bytecodes::_iload : load_local(intType , s.get_index()); break; |
| case Bytecodes::_lload : load_local(longType , s.get_index()); break; |
| case Bytecodes::_fload : load_local(floatType , s.get_index()); break; |
| case Bytecodes::_dload : load_local(doubleType , s.get_index()); break; |
| case Bytecodes::_aload : load_local(instanceType, s.get_index()); break; |
| case Bytecodes::_iload_0 : load_local(intType , 0); break; |
| case Bytecodes::_iload_1 : load_local(intType , 1); break; |
| case Bytecodes::_iload_2 : load_local(intType , 2); break; |
| case Bytecodes::_iload_3 : load_local(intType , 3); break; |
| case Bytecodes::_lload_0 : load_local(longType , 0); break; |
| case Bytecodes::_lload_1 : load_local(longType , 1); break; |
| case Bytecodes::_lload_2 : load_local(longType , 2); break; |
| case Bytecodes::_lload_3 : load_local(longType , 3); break; |
| case Bytecodes::_fload_0 : load_local(floatType , 0); break; |
| case Bytecodes::_fload_1 : load_local(floatType , 1); break; |
| case Bytecodes::_fload_2 : load_local(floatType , 2); break; |
| case Bytecodes::_fload_3 : load_local(floatType , 3); break; |
| case Bytecodes::_dload_0 : load_local(doubleType, 0); break; |
| case Bytecodes::_dload_1 : load_local(doubleType, 1); break; |
| case Bytecodes::_dload_2 : load_local(doubleType, 2); break; |
| case Bytecodes::_dload_3 : load_local(doubleType, 3); break; |
| case Bytecodes::_aload_0 : load_local(objectType, 0); break; |
| case Bytecodes::_aload_1 : load_local(objectType, 1); break; |
| case Bytecodes::_aload_2 : load_local(objectType, 2); break; |
| case Bytecodes::_aload_3 : load_local(objectType, 3); break; |
| case Bytecodes::_iaload : load_indexed(T_INT ); break; |
| case Bytecodes::_laload : load_indexed(T_LONG ); break; |
| case Bytecodes::_faload : load_indexed(T_FLOAT ); break; |
| case Bytecodes::_daload : load_indexed(T_DOUBLE); break; |
| case Bytecodes::_aaload : load_indexed(T_OBJECT); break; |
| case Bytecodes::_baload : load_indexed(T_BYTE ); break; |
| case Bytecodes::_caload : load_indexed(T_CHAR ); break; |
| case Bytecodes::_saload : load_indexed(T_SHORT ); break; |
| case Bytecodes::_istore : store_local(intType , s.get_index()); break; |
| case Bytecodes::_lstore : store_local(longType , s.get_index()); break; |
| case Bytecodes::_fstore : store_local(floatType , s.get_index()); break; |
| case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break; |
| case Bytecodes::_astore : store_local(objectType, s.get_index()); break; |
| case Bytecodes::_istore_0 : store_local(intType , 0); break; |
| case Bytecodes::_istore_1 : store_local(intType , 1); break; |
| case Bytecodes::_istore_2 : store_local(intType , 2); break; |
| case Bytecodes::_istore_3 : store_local(intType , 3); break; |
| case Bytecodes::_lstore_0 : store_local(longType , 0); break; |
| case Bytecodes::_lstore_1 : store_local(longType , 1); break; |
| case Bytecodes::_lstore_2 : store_local(longType , 2); break; |
| case Bytecodes::_lstore_3 : store_local(longType , 3); break; |
| case Bytecodes::_fstore_0 : store_local(floatType , 0); break; |
| case Bytecodes::_fstore_1 : store_local(floatType , 1); break; |
| case Bytecodes::_fstore_2 : store_local(floatType , 2); break; |
| case Bytecodes::_fstore_3 : store_local(floatType , 3); break; |
| case Bytecodes::_dstore_0 : store_local(doubleType, 0); break; |
| case Bytecodes::_dstore_1 : store_local(doubleType, 1); break; |
| case Bytecodes::_dstore_2 : store_local(doubleType, 2); break; |
| case Bytecodes::_dstore_3 : store_local(doubleType, 3); break; |
| case Bytecodes::_astore_0 : store_local(objectType, 0); break; |
| case Bytecodes::_astore_1 : store_local(objectType, 1); break; |
| case Bytecodes::_astore_2 : store_local(objectType, 2); break; |
| case Bytecodes::_astore_3 : store_local(objectType, 3); break; |
| case Bytecodes::_iastore : store_indexed(T_INT ); break; |
| case Bytecodes::_lastore : store_indexed(T_LONG ); break; |
| case Bytecodes::_fastore : store_indexed(T_FLOAT ); break; |
| case Bytecodes::_dastore : store_indexed(T_DOUBLE); break; |
| case Bytecodes::_aastore : store_indexed(T_OBJECT); break; |
| case Bytecodes::_bastore : store_indexed(T_BYTE ); break; |
| case Bytecodes::_castore : store_indexed(T_CHAR ); break; |
| case Bytecodes::_sastore : store_indexed(T_SHORT ); break; |
| case Bytecodes::_pop : // fall through |
| case Bytecodes::_pop2 : // fall through |
| case Bytecodes::_dup : // fall through |
| case Bytecodes::_dup_x1 : // fall through |
| case Bytecodes::_dup_x2 : // fall through |
| case Bytecodes::_dup2 : // fall through |
| case Bytecodes::_dup2_x1 : // fall through |
| case Bytecodes::_dup2_x2 : // fall through |
| case Bytecodes::_swap : stack_op(code); break; |
| case Bytecodes::_iadd : arithmetic_op(intType , code); break; |
| case Bytecodes::_ladd : arithmetic_op(longType , code); break; |
| case Bytecodes::_fadd : arithmetic_op(floatType , code); break; |
| case Bytecodes::_dadd : arithmetic_op(doubleType, code); break; |
| case Bytecodes::_isub : arithmetic_op(intType , code); break; |
| case Bytecodes::_lsub : arithmetic_op(longType , code); break; |
| case Bytecodes::_fsub : arithmetic_op(floatType , code); break; |
| case Bytecodes::_dsub : arithmetic_op(doubleType, code); break; |
| case Bytecodes::_imul : arithmetic_op(intType , code); break; |
| case Bytecodes::_lmul : arithmetic_op(longType , code); break; |
| case Bytecodes::_fmul : arithmetic_op(floatType , code); break; |
| case Bytecodes::_dmul : arithmetic_op(doubleType, code); break; |
| case Bytecodes::_idiv : arithmetic_op(intType , code, lock_stack()); break; |
| case Bytecodes::_ldiv : arithmetic_op(longType , code, lock_stack()); break; |
| case Bytecodes::_fdiv : arithmetic_op(floatType , code); break; |
| case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break; |
| case Bytecodes::_irem : arithmetic_op(intType , code, lock_stack()); break; |
| case Bytecodes::_lrem : arithmetic_op(longType , code, lock_stack()); break; |
| case Bytecodes::_frem : arithmetic_op(floatType , code); break; |
| case Bytecodes::_drem : arithmetic_op(doubleType, code); break; |
| case Bytecodes::_ineg : negate_op(intType ); break; |
| case Bytecodes::_lneg : negate_op(longType ); break; |
| case Bytecodes::_fneg : negate_op(floatType ); break; |
| case Bytecodes::_dneg : negate_op(doubleType); break; |
| case Bytecodes::_ishl : shift_op(intType , code); break; |
| case Bytecodes::_lshl : shift_op(longType, code); break; |
| case Bytecodes::_ishr : shift_op(intType , code); break; |
| case Bytecodes::_lshr : shift_op(longType, code); break; |
| case Bytecodes::_iushr : shift_op(intType , code); break; |
| case Bytecodes::_lushr : shift_op(longType, code); break; |
| case Bytecodes::_iand : logic_op(intType , code); break; |
| case Bytecodes::_land : logic_op(longType, code); break; |
| case Bytecodes::_ior : logic_op(intType , code); break; |
| case Bytecodes::_lor : logic_op(longType, code); break; |
| case Bytecodes::_ixor : logic_op(intType , code); break; |
| case Bytecodes::_lxor : logic_op(longType, code); break; |
| case Bytecodes::_iinc : increment(); break; |
| case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break; |
| case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break; |
| case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break; |
| case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break; |
| case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break; |
| case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break; |
| case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break; |
| case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break; |
| case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break; |
| case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break; |
| case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break; |
| case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break; |
| case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break; |
| case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break; |
| case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break; |
| case Bytecodes::_lcmp : compare_op(longType , code); break; |
| case Bytecodes::_fcmpl : compare_op(floatType , code); break; |
| case Bytecodes::_fcmpg : compare_op(floatType , code); break; |
| case Bytecodes::_dcmpl : compare_op(doubleType, code); break; |
| case Bytecodes::_dcmpg : compare_op(doubleType, code); break; |
| case Bytecodes::_ifeq : if_zero(intType , If::eql); break; |
| case Bytecodes::_ifne : if_zero(intType , If::neq); break; |
| case Bytecodes::_iflt : if_zero(intType , If::lss); break; |
| case Bytecodes::_ifge : if_zero(intType , If::geq); break; |
| case Bytecodes::_ifgt : if_zero(intType , If::gtr); break; |
| case Bytecodes::_ifle : if_zero(intType , If::leq); break; |
| case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break; |
| case Bytecodes::_if_icmpne : if_same(intType , If::neq); break; |
| case Bytecodes::_if_icmplt : if_same(intType , If::lss); break; |
| case Bytecodes::_if_icmpge : if_same(intType , If::geq); break; |
| case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break; |
| case Bytecodes::_if_icmple : if_same(intType , If::leq); break; |
| case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break; |
| case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break; |
| case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break; |
| case Bytecodes::_jsr : jsr(s.get_dest()); break; |
| case Bytecodes::_ret : ret(s.get_index()); break; |
| case Bytecodes::_tableswitch : table_switch(); break; |
| case Bytecodes::_lookupswitch : lookup_switch(); break; |
| case Bytecodes::_ireturn : method_return(ipop()); break; |
| case Bytecodes::_lreturn : method_return(lpop()); break; |
| case Bytecodes::_freturn : method_return(fpop()); break; |
| case Bytecodes::_dreturn : method_return(dpop()); break; |
| case Bytecodes::_areturn : method_return(apop()); break; |
| case Bytecodes::_return : method_return(NULL ); break; |
| case Bytecodes::_getstatic : // fall through |
| case Bytecodes::_putstatic : // fall through |
| case Bytecodes::_getfield : // fall through |
| case Bytecodes::_putfield : access_field(code); break; |
| case Bytecodes::_invokevirtual : // fall through |
| case Bytecodes::_invokespecial : // fall through |
| case Bytecodes::_invokestatic : // fall through |
| case Bytecodes::_invokeinterface: invoke(code); break; |
| case Bytecodes::_xxxunusedxxx : ShouldNotReachHere(); break; |
| case Bytecodes::_new : new_instance(s.get_index_big()); break; |
| case Bytecodes::_newarray : new_type_array(); break; |
| case Bytecodes::_anewarray : new_object_array(); break; |
| case Bytecodes::_arraylength : ipush(append(new ArrayLength(apop(), lock_stack()))); break; |
| case Bytecodes::_athrow : throw_op(s.cur_bci()); break; |
| case Bytecodes::_checkcast : check_cast(s.get_index_big()); break; |
| case Bytecodes::_instanceof : instance_of(s.get_index_big()); break; |
| // Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException |
| case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break; |
| case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break; |
| case Bytecodes::_wide : ShouldNotReachHere(); break; |
| case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break; |
| case Bytecodes::_ifnull : if_null(objectType, If::eql); break; |
| case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break; |
| case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break; |
| case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break; |
| case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL); |
| default : ShouldNotReachHere(); break; |
| } |
| // save current bci to setup Goto at the end |
| prev_bci = s.cur_bci(); |
| } |
| CHECK_BAILOUT_(NULL); |
| // stop processing of this block (see try_inline_full) |
| if (_skip_block) { |
| _skip_block = false; |
| assert(_last && _last->as_BlockEnd(), ""); |
| return _last->as_BlockEnd(); |
| } |
| // if there are any, check if last instruction is a BlockEnd instruction |
| BlockEnd* end = last()->as_BlockEnd(); |
| if (end == NULL) { |
| // all blocks must end with a BlockEnd instruction => add a Goto |
| end = new Goto(block_at(s.cur_bci()), false); |
| _last = _last->set_next(end, prev_bci); |
| } |
| assert(end == last()->as_BlockEnd(), "inconsistency"); |
| |
| // if the method terminates, we don't need the stack anymore |
| if (end->as_Return() != NULL) { |
| state()->clear_stack(); |
| } else if (end->as_Throw() != NULL) { |
| // May have exception handler in caller scopes |
| state()->truncate_stack(scope()->lock_stack_size()); |
| } |
| |
| // connect to begin & set state |
| // NOTE that inlining may have changed the block we are parsing |
| block()->set_end(end); |
| end->set_state(state()); |
| // propagate state |
| for (int i = end->number_of_sux() - 1; i >= 0; i--) { |
| BlockBegin* sux = end->sux_at(i); |
| assert(sux->is_predecessor(block()), "predecessor missing"); |
| // be careful, bailout if bytecodes are strange |
| if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL); |
| scope_data()->add_to_work_list(end->sux_at(i)); |
| } |
| |
| scope_data()->set_stream(NULL); |
| |
| // done |
| return end; |
| } |
| |
| |
| void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) { |
| do { |
| if (start_in_current_block_for_inlining && !bailed_out()) { |
| iterate_bytecodes_for_block(0); |
| start_in_current_block_for_inlining = false; |
| } else { |
| BlockBegin* b; |
| while ((b = scope_data()->remove_from_work_list()) != NULL) { |
| if (!b->is_set(BlockBegin::was_visited_flag)) { |
| if (b->is_set(BlockBegin::osr_entry_flag)) { |
| // we're about to parse the osr entry block, so make sure |
| // we setup the OSR edge leading into this block so that |
| // Phis get setup correctly. |
| setup_osr_entry_block(); |
| // this is no longer the osr entry block, so clear it. |
| b->clear(BlockBegin::osr_entry_flag); |
| } |
| b->set(BlockBegin::was_visited_flag); |
| connect_to_end(b); |
| } |
| } |
| } |
| } while (!bailed_out() && !scope_data()->is_work_list_empty()); |
| } |
| |
| |
| bool GraphBuilder::_is_initialized = false; |
| bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes]; |
| bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes]; |
| |
| void GraphBuilder::initialize() { |
| // make sure initialization happens only once (need a |
| // lock here, if we allow the compiler to be re-entrant) |
| if (is_initialized()) return; |
| _is_initialized = true; |
| |
| // the following bytecodes are assumed to potentially |
| // throw exceptions in compiled code - note that e.g. |
| // monitorexit & the return bytecodes do not throw |
| // exceptions since monitor pairing proved that they |
| // succeed (if monitor pairing succeeded) |
| Bytecodes::Code can_trap_list[] = |
| { Bytecodes::_ldc |
| , Bytecodes::_ldc_w |
| , Bytecodes::_ldc2_w |
| , Bytecodes::_iaload |
| , Bytecodes::_laload |
| , Bytecodes::_faload |
| , Bytecodes::_daload |
| , Bytecodes::_aaload |
| , Bytecodes::_baload |
| , Bytecodes::_caload |
| , Bytecodes::_saload |
| , Bytecodes::_iastore |
| , Bytecodes::_lastore |
| , Bytecodes::_fastore |
| , Bytecodes::_dastore |
| , Bytecodes::_aastore |
| , Bytecodes::_bastore |
| , Bytecodes::_castore |
| , Bytecodes::_sastore |
| , Bytecodes::_idiv |
| , Bytecodes::_ldiv |
| , Bytecodes::_irem |
| , Bytecodes::_lrem |
| , Bytecodes::_getstatic |
| , Bytecodes::_putstatic |
| , Bytecodes::_getfield |
| , Bytecodes::_putfield |
| , Bytecodes::_invokevirtual |
| , Bytecodes::_invokespecial |
| , Bytecodes::_invokestatic |
| , Bytecodes::_invokeinterface |
| , Bytecodes::_new |
| , Bytecodes::_newarray |
| , Bytecodes::_anewarray |
| , Bytecodes::_arraylength |
| , Bytecodes::_athrow |
| , Bytecodes::_checkcast |
| , Bytecodes::_instanceof |
| , Bytecodes::_monitorenter |
| , Bytecodes::_multianewarray |
| }; |
| |
| // the following bytecodes are assumed to potentially |
| // throw asynchronous exceptions in compiled code due |
| // to safepoints (note: these entries could be merged |
| // with the can_trap_list - however, we need to know |
| // which ones are asynchronous for now - see also the |
| // comment in GraphBuilder::handle_exception) |
| Bytecodes::Code is_async_list[] = |
| { Bytecodes::_ifeq |
| , Bytecodes::_ifne |
| , Bytecodes::_iflt |
| , Bytecodes::_ifge |
| , Bytecodes::_ifgt |
| , Bytecodes::_ifle |
| , Bytecodes::_if_icmpeq |
| , Bytecodes::_if_icmpne |
| , Bytecodes::_if_icmplt |
| , Bytecodes::_if_icmpge |
| , Bytecodes::_if_icmpgt |
| , Bytecodes::_if_icmple |
| , Bytecodes::_if_acmpeq |
| , Bytecodes::_if_acmpne |
| , Bytecodes::_goto |
| , Bytecodes::_jsr |
| , Bytecodes::_ret |
| , Bytecodes::_tableswitch |
| , Bytecodes::_lookupswitch |
| , Bytecodes::_ireturn |
| , Bytecodes::_lreturn |
| , Bytecodes::_freturn |
| , Bytecodes::_dreturn |
| , Bytecodes::_areturn |
| , Bytecodes::_return |
| , Bytecodes::_ifnull |
| , Bytecodes::_ifnonnull |
| , Bytecodes::_goto_w |
| , Bytecodes::_jsr_w |
| }; |
| |
| // inititialize trap tables |
| for (int i = 0; i < Bytecodes::number_of_java_codes; i++) { |
| _can_trap[i] = false; |
| _is_async[i] = false; |
| } |
| // set standard trap info |
| for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) { |
| _can_trap[can_trap_list[j]] = true; |
| } |
| |
| // We now deoptimize if an asynchronous exception is thrown. This |
| // considerably cleans up corner case issues related to javac's |
| // incorrect exception handler ranges for async exceptions and |
| // allows us to precisely analyze the types of exceptions from |
| // certain bytecodes. |
| if (!(DeoptC1 && DeoptOnAsyncException)) { |
| // set asynchronous trap info |
| for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) { |
| assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint"); |
| _can_trap[is_async_list[k]] = true; |
| _is_async[is_async_list[k]] = true; |
| } |
| } |
| } |
| |
| |
| BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) { |
| assert(entry->is_set(f), "entry/flag mismatch"); |
| // create header block |
| BlockBegin* h = new BlockBegin(entry->bci()); |
| h->set_depth_first_number(0); |
| |
| Value l = h; |
| if (profile_branches()) { |
| // Increment the invocation count on entry to the method. We |
| // can't use profile_invocation here because append isn't setup to |
| // work properly at this point. The instruction have to be |
| // appended to the instruction stream by hand. |
| Value m = new Constant(new ObjectConstant(compilation()->method())); |
| h->set_next(m, 0); |
| Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1); |
| m->set_next(p, 0); |
| l = p; |
| } |
| |
| BlockEnd* g = new Goto(entry, false); |
| l->set_next(g, entry->bci()); |
| h->set_end(g); |
| h->set(f); |
| // setup header block end state |
| ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis) |
| assert(s->stack_is_empty(), "must have empty stack at entry point"); |
| g->set_state(s); |
| return h; |
| } |
| |
| |
| |
| BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) { |
| BlockBegin* start = new BlockBegin(0); |
| |
| // This code eliminates the empty start block at the beginning of |
| // each method. Previously, each method started with the |
| // start-block created below, and this block was followed by the |
| // header block that was always empty. This header block is only |
| // necesary if std_entry is also a backward branch target because |
| // then phi functions may be necessary in the header block. It's |
| // also necessary when profiling so that there's a single block that |
| // can increment the interpreter_invocation_count. |
| BlockBegin* new_header_block; |
| if (std_entry->number_of_preds() == 0 && !profile_branches()) { |
| new_header_block = std_entry; |
| } else { |
| new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state); |
| } |
| |
| // setup start block (root for the IR graph) |
| Base* base = |
| new Base( |
| new_header_block, |
| osr_entry |
| ); |
| start->set_next(base, 0); |
| start->set_end(base); |
| // create & setup state for start block |
| start->set_state(state->copy()); |
| base->set_state(state->copy()); |
| |
| if (base->std_entry()->state() == NULL) { |
| // setup states for header blocks |
| base->std_entry()->merge(state); |
| } |
| |
| assert(base->std_entry()->state() != NULL, ""); |
| return start; |
| } |
| |
| |
| void GraphBuilder::setup_osr_entry_block() { |
| assert(compilation()->is_osr_compile(), "only for osrs"); |
| |
| int osr_bci = compilation()->osr_bci(); |
| ciBytecodeStream s(method()); |
| s.reset_to_bci(osr_bci); |
| s.next(); |
| scope_data()->set_stream(&s); |
| |
| // create a new block to be the osr setup code |
| _osr_entry = new BlockBegin(osr_bci); |
| _osr_entry->set(BlockBegin::osr_entry_flag); |
| _osr_entry->set_depth_first_number(0); |
| BlockBegin* target = bci2block()->at(osr_bci); |
| assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there"); |
| // the osr entry has no values for locals |
| ValueStack* state = target->state()->copy(); |
| _osr_entry->set_state(state); |
| |
| kill_all(); |
| _block = _osr_entry; |
| _state = _osr_entry->state()->copy(); |
| _last = _osr_entry; |
| Value e = append(new OsrEntry()); |
| e->set_needs_null_check(false); |
| |
| // OSR buffer is |
| // |
| // locals[nlocals-1..0] |
| // monitors[number_of_locks-1..0] |
| // |
| // locals is a direct copy of the interpreter frame so in the osr buffer |
| // so first slot in the local array is the last local from the interpreter |
| // and last slot is local[0] (receiver) from the interpreter |
| // |
| // Similarly with locks. The first lock slot in the osr buffer is the nth lock |
| // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock |
| // in the interpreter frame (the method lock if a sync method) |
| |
| // Initialize monitors in the compiled activation. |
| |
| int index; |
| Value local; |
| |
| // find all the locals that the interpreter thinks contain live oops |
| const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci); |
| |
| // compute the offset into the locals so that we can treat the buffer |
| // as if the locals were still in the interpreter frame |
| int locals_offset = BytesPerWord * (method()->max_locals() - 1); |
| for_each_local_value(state, index, local) { |
| int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord; |
| Value get; |
| if (local->type()->is_object_kind() && !live_oops.at(index)) { |
| // The interpreter thinks this local is dead but the compiler |
| // doesn't so pretend that the interpreter passed in null. |
| get = append(new Constant(objectNull)); |
| } else { |
| get = append(new UnsafeGetRaw(as_BasicType(local->type()), e, |
| append(new Constant(new IntConstant(offset))), |
| 0, |
| true)); |
| } |
| _state->store_local(index, get); |
| } |
| |
| // the storage for the OSR buffer is freed manually in the LIRGenerator. |
| |
| assert(state->caller_state() == NULL, "should be top scope"); |
| state->clear_locals(); |
| Goto* g = new Goto(target, false); |
| g->set_state(_state->copy()); |
| append(g); |
| _osr_entry->set_end(g); |
| target->merge(_osr_entry->end()->state()); |
| |
| scope_data()->set_stream(NULL); |
| } |
| |
| |
| ValueStack* GraphBuilder::state_at_entry() { |
| ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack()); |
| |
| // Set up locals for receiver |
| int idx = 0; |
| if (!method()->is_static()) { |
| // we should always see the receiver |
| state->store_local(idx, new Local(objectType, idx)); |
| idx = 1; |
| } |
| |
| // Set up locals for incoming arguments |
| ciSignature* sig = method()->signature(); |
| for (int i = 0; i < sig->count(); i++) { |
| ciType* type = sig->type_at(i); |
| BasicType basic_type = type->basic_type(); |
| // don't allow T_ARRAY to propagate into locals types |
| if (basic_type == T_ARRAY) basic_type = T_OBJECT; |
| ValueType* vt = as_ValueType(basic_type); |
| state->store_local(idx, new Local(vt, idx)); |
| idx += type->size(); |
| } |
| |
| // lock synchronized method |
| if (method()->is_synchronized()) { |
| state->lock(scope(), NULL); |
| } |
| |
| return state; |
| } |
| |
| |
| GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope) |
| : _scope_data(NULL) |
| , _exception_state(NULL) |
| , _instruction_count(0) |
| , _osr_entry(NULL) |
| , _memory(new MemoryBuffer()) |
| , _compilation(compilation) |
| , _inline_bailout_msg(NULL) |
| { |
| int osr_bci = compilation->osr_bci(); |
| |
| // determine entry points and bci2block mapping |
| BlockListBuilder blm(compilation, scope, osr_bci); |
| CHECK_BAILOUT(); |
| |
| BlockList* bci2block = blm.bci2block(); |
| BlockBegin* start_block = bci2block->at(0); |
| |
| assert(is_initialized(), "GraphBuilder must have been initialized"); |
| push_root_scope(scope, bci2block, start_block); |
| |
| // setup state for std entry |
| _initial_state = state_at_entry(); |
| start_block->merge(_initial_state); |
| |
| BlockBegin* sync_handler = NULL; |
| if (method()->is_synchronized() || DTraceMethodProbes) { |
| // setup an exception handler to do the unlocking and/or notification |
| sync_handler = new BlockBegin(-1); |
| sync_handler->set(BlockBegin::exception_entry_flag); |
| sync_handler->set(BlockBegin::is_on_work_list_flag); |
| sync_handler->set(BlockBegin::default_exception_handler_flag); |
| |
| ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); |
| XHandler* h = new XHandler(desc); |
| h->set_entry_block(sync_handler); |
| scope_data()->xhandlers()->append(h); |
| scope_data()->set_has_handler(); |
| } |
| |
| // complete graph |
| _vmap = new ValueMap(); |
| scope->compute_lock_stack_size(); |
| switch (scope->method()->intrinsic_id()) { |
| case vmIntrinsics::_dabs : // fall through |
| case vmIntrinsics::_dsqrt : // fall through |
| case vmIntrinsics::_dsin : // fall through |
| case vmIntrinsics::_dcos : // fall through |
| case vmIntrinsics::_dtan : // fall through |
| case vmIntrinsics::_dlog : // fall through |
| case vmIntrinsics::_dlog10 : // fall through |
| { |
| // Compiles where the root method is an intrinsic need a special |
| // compilation environment because the bytecodes for the method |
| // shouldn't be parsed during the compilation, only the special |
| // Intrinsic node should be emitted. If this isn't done the the |
| // code for the inlined version will be different than the root |
| // compiled version which could lead to monotonicity problems on |
| // intel. |
| |
| // Set up a stream so that appending instructions works properly. |
| ciBytecodeStream s(scope->method()); |
| s.reset_to_bci(0); |
| scope_data()->set_stream(&s); |
| s.next(); |
| |
| // setup the initial block state |
| _block = start_block; |
| _state = start_block->state()->copy(); |
| _last = start_block; |
| load_local(doubleType, 0); |
| |
| // Emit the intrinsic node. |
| bool result = try_inline_intrinsics(scope->method()); |
| if (!result) BAILOUT("failed to inline intrinsic"); |
| method_return(dpop()); |
| |
| // connect the begin and end blocks and we're all done. |
| BlockEnd* end = last()->as_BlockEnd(); |
| block()->set_end(end); |
| end->set_state(state()); |
| break; |
| } |
| default: |
| scope_data()->add_to_work_list(start_block); |
| iterate_all_blocks(); |
| break; |
| } |
| CHECK_BAILOUT(); |
| |
| if (sync_handler && sync_handler->state() != NULL) { |
| Value lock = NULL; |
| if (method()->is_synchronized()) { |
| lock = method()->is_static() ? new Constant(new InstanceConstant(method()->holder()->java_mirror())) : |
| _initial_state->local_at(0); |
| |
| sync_handler->state()->unlock(); |
| sync_handler->state()->lock(scope, lock); |
| |
| } |
| fill_sync_handler(lock, sync_handler, true); |
| } |
| |
| _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state); |
| |
| eliminate_redundant_phis(_start); |
| |
| NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats()); |
| // for osr compile, bailout if some requirements are not fulfilled |
| if (osr_bci != -1) { |
| BlockBegin* osr_block = blm.bci2block()->at(osr_bci); |
| assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile"); |
| |
| // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points |
| if (!osr_block->state()->stack_is_empty()) { |
| BAILOUT("stack not empty at OSR entry point"); |
| } |
| } |
| #ifndef PRODUCT |
| if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count); |
| #endif |
| } |
| |
| |
| ValueStack* GraphBuilder::lock_stack() { |
| // return a new ValueStack representing just the current lock stack |
| // (for debug info at safepoints in exception throwing or handling) |
| ValueStack* new_stack = state()->copy_locks(); |
| return new_stack; |
| } |
| |
| |
| int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const { |
| int recur_level = 0; |
| for (IRScope* s = scope(); s != NULL; s = s->caller()) { |
| if (s->method() == cur_callee) { |
| ++recur_level; |
| } |
| } |
| return recur_level; |
| } |
| |
| |
| bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) { |
| // Clear out any existing inline bailout condition |
| clear_inline_bailout(); |
| |
| if (callee->should_exclude()) { |
| // callee is excluded |
| INLINE_BAILOUT("excluded by CompilerOracle") |
| } else if (!callee->can_be_compiled()) { |
| // callee is not compilable (prob. has breakpoints) |
| INLINE_BAILOUT("not compilable") |
| } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) { |
| // intrinsics can be native or not |
| return true; |
| } else if (callee->is_native()) { |
| // non-intrinsic natives cannot be inlined |
| INLINE_BAILOUT("non-intrinsic native") |
| } else if (callee->is_abstract()) { |
| INLINE_BAILOUT("abstract") |
| } else { |
| return try_inline_full(callee, holder_known); |
| } |
| } |
| |
| |
| bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) { |
| if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled"); |
| if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized"); |
| // callee seems like a good candidate |
| // determine id |
| bool preserves_state = false; |
| bool cantrap = true; |
| vmIntrinsics::ID id = callee->intrinsic_id(); |
| switch (id) { |
| case vmIntrinsics::_arraycopy : |
| if (!InlineArrayCopy) return false; |
| break; |
| |
| case vmIntrinsics::_currentTimeMillis: |
| case vmIntrinsics::_nanoTime: |
| preserves_state = true; |
| cantrap = false; |
| break; |
| |
| case vmIntrinsics::_floatToRawIntBits : |
| case vmIntrinsics::_intBitsToFloat : |
| case vmIntrinsics::_doubleToRawLongBits : |
| case vmIntrinsics::_longBitsToDouble : |
| if (!InlineMathNatives) return false; |
| preserves_state = true; |
| cantrap = false; |
| break; |
| |
| case vmIntrinsics::_getClass : |
| if (!InlineClassNatives) return false; |
| preserves_state = true; |
| break; |
| |
| case vmIntrinsics::_currentThread : |
| if (!InlineThreadNatives) return false; |
| preserves_state = true; |
| cantrap = false; |
| break; |
| |
| case vmIntrinsics::_dabs : // fall through |
| case vmIntrinsics::_dsqrt : // fall through |
| case vmIntrinsics::_dsin : // fall through |
| case vmIntrinsics::_dcos : // fall through |
| case vmIntrinsics::_dtan : // fall through |
| case vmIntrinsics::_dlog : // fall through |
| case vmIntrinsics::_dlog10 : // fall through |
| if (!InlineMathNatives) return false; |
| cantrap = false; |
| preserves_state = true; |
| break; |
| |
| // sun/misc/AtomicLong.attemptUpdate |
| case vmIntrinsics::_attemptUpdate : |
| if (!VM_Version::supports_cx8()) return false; |
| if (!InlineAtomicLong) return false; |
| preserves_state = true; |
| break; |
| |
| // Use special nodes for Unsafe instructions so we can more easily |
| // perform an address-mode optimization on the raw variants |
| case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false); |
| case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false); |
| case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false); |
| case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false); |
| case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false); |
| case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false); |
| case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false); |
| case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false); |
| case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false); |
| |
| case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false); |
| case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false); |
| case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false); |
| case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false); |
| case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false); |
| case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false); |
| case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false); |
| case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false); |
| case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false); |
| |
| case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true); |
| case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true); |
| case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true); |
| case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true); |
| case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true); |
| case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true); |
| case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true); |
| case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true); |
| case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true); |
| |
| case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true); |
| case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true); |
| case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true); |
| case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true); |
| case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true); |
| case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true); |
| case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true); |
| case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true); |
| case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true); |
| |
| case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE); |
| case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT); |
| case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR); |
| case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT); |
| case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG); |
| case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT); |
| case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE); |
| |
| case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE); |
| case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT); |
| case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR); |
| case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT); |
| case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG); |
| case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT); |
| case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE); |
| |
| case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false); |
| case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true); |
| case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false); |
| case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true); |
| |
| case vmIntrinsics::_checkIndex : |
| if (!InlineNIOCheckIndex) return false; |
| preserves_state = true; |
| break; |
| case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true); |
| case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true); |
| case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true); |
| |
| case vmIntrinsics::_compareAndSwapLong: |
| if (!VM_Version::supports_cx8()) return false; |
| // fall through |
| case vmIntrinsics::_compareAndSwapInt: |
| case vmIntrinsics::_compareAndSwapObject: |
| append_unsafe_CAS(callee); |
| return true; |
| |
| default : return false; // do not inline |
| } |
| // create intrinsic node |
| const bool has_receiver = !callee->is_static(); |
| ValueType* result_type = as_ValueType(callee->return_type()); |
| |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| ValueStack* locks = lock_stack(); |
| if (profile_calls()) { |
| // Don't profile in the special case where the root method |
| // is the intrinsic |
| if (callee != method()) { |
| Value recv = NULL; |
| if (has_receiver) { |
| recv = args->at(0); |
| null_check(recv); |
| } |
| profile_call(recv, NULL); |
| } |
| } |
| |
| Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(), |
| preserves_state, cantrap); |
| // append instruction & push result |
| Value value = append_split(result); |
| if (result_type != voidType) push(result_type, value); |
| |
| #ifndef PRODUCT |
| // printing |
| if (PrintInlining) { |
| print_inline_result(callee, true); |
| } |
| #endif |
| |
| // done |
| return true; |
| } |
| |
| |
| bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) { |
| // Introduce a new callee continuation point - all Ret instructions |
| // will be replaced with Gotos to this point. |
| BlockBegin* cont = block_at(next_bci()); |
| assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr"); |
| |
| // Note: can not assign state to continuation yet, as we have to |
| // pick up the state from the Ret instructions. |
| |
| // Push callee scope |
| push_scope_for_jsr(cont, jsr_dest_bci); |
| |
| // Temporarily set up bytecode stream so we can append instructions |
| // (only using the bci of this stream) |
| scope_data()->set_stream(scope_data()->parent()->stream()); |
| |
| BlockBegin* jsr_start_block = block_at(jsr_dest_bci); |
| assert(jsr_start_block != NULL, "jsr start block must exist"); |
| assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet"); |
| Goto* goto_sub = new Goto(jsr_start_block, false); |
| goto_sub->set_state(state()); |
| // Must copy state to avoid wrong sharing when parsing bytecodes |
| assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block"); |
| jsr_start_block->set_state(state()->copy()); |
| append(goto_sub); |
| _block->set_end(goto_sub); |
| _last = _block = jsr_start_block; |
| |
| // Clear out bytecode stream |
| scope_data()->set_stream(NULL); |
| |
| scope_data()->add_to_work_list(jsr_start_block); |
| |
| // Ready to resume parsing in subroutine |
| iterate_all_blocks(); |
| |
| // If we bailed out during parsing, return immediately (this is bad news) |
| CHECK_BAILOUT_(false); |
| |
| // Detect whether the continuation can actually be reached. If not, |
| // it has not had state set by the join() operations in |
| // iterate_bytecodes_for_block()/ret() and we should not touch the |
| // iteration state. The calling activation of |
| // iterate_bytecodes_for_block will then complete normally. |
| if (cont->state() != NULL) { |
| if (!cont->is_set(BlockBegin::was_visited_flag)) { |
| // add continuation to work list instead of parsing it immediately |
| scope_data()->parent()->add_to_work_list(cont); |
| } |
| } |
| |
| assert(jsr_continuation() == cont, "continuation must not have changed"); |
| assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) || |
| jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag), |
| "continuation can only be visited in case of backward branches"); |
| assert(_last && _last->as_BlockEnd(), "block must have end"); |
| |
| // continuation is in work list, so end iteration of current block |
| _skip_block = true; |
| pop_scope_for_jsr(); |
| |
| return true; |
| } |
| |
| |
| // Inline the entry of a synchronized method as a monitor enter and |
| // register the exception handler which releases the monitor if an |
| // exception is thrown within the callee. Note that the monitor enter |
| // cannot throw an exception itself, because the receiver is |
| // guaranteed to be non-null by the explicit null check at the |
| // beginning of inlining. |
| void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) { |
| assert(lock != NULL && sync_handler != NULL, "lock or handler missing"); |
| |
| set_exception_state(state()->copy()); |
| monitorenter(lock, SynchronizationEntryBCI); |
| assert(_last->as_MonitorEnter() != NULL, "monitor enter expected"); |
| _last->set_needs_null_check(false); |
| |
| sync_handler->set(BlockBegin::exception_entry_flag); |
| sync_handler->set(BlockBegin::is_on_work_list_flag); |
| |
| ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); |
| XHandler* h = new XHandler(desc); |
| h->set_entry_block(sync_handler); |
| scope_data()->xhandlers()->append(h); |
| scope_data()->set_has_handler(); |
| } |
| |
| |
| // If an exception is thrown and not handled within an inlined |
| // synchronized method, the monitor must be released before the |
| // exception is rethrown in the outer scope. Generate the appropriate |
| // instructions here. |
| void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) { |
| BlockBegin* orig_block = _block; |
| ValueStack* orig_state = _state; |
| Instruction* orig_last = _last; |
| _last = _block = sync_handler; |
| _state = sync_handler->state()->copy(); |
| |
| assert(sync_handler != NULL, "handler missing"); |
| assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here"); |
| |
| assert(lock != NULL || default_handler, "lock or handler missing"); |
| |
| XHandler* h = scope_data()->xhandlers()->remove_last(); |
| assert(h->entry_block() == sync_handler, "corrupt list of handlers"); |
| |
| block()->set(BlockBegin::was_visited_flag); |
| Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI); |
| assert(exception->is_pinned(), "must be"); |
| |
| int bci = SynchronizationEntryBCI; |
| if (lock) { |
| assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing"); |
| if (lock->bci() == -99) { |
| lock = append_with_bci(lock, -1); |
| } |
| |
| // exit the monitor in the context of the synchronized method |
| monitorexit(lock, SynchronizationEntryBCI); |
| |
| // exit the context of the synchronized method |
| if (!default_handler) { |
| pop_scope(); |
| _state = _state->copy(); |
| bci = _state->scope()->caller_bci(); |
| _state = _state->pop_scope()->copy(); |
| } |
| } |
| |
| // perform the throw as if at the the call site |
| apush(exception); |
| |
| set_exception_state(state()->copy()); |
| throw_op(bci); |
| |
| BlockEnd* end = last()->as_BlockEnd(); |
| block()->set_end(end); |
| end->set_state(state()); |
| |
| _block = orig_block; |
| _state = orig_state; |
| _last = orig_last; |
| } |
| |
| |
| bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) { |
| assert(!callee->is_native(), "callee must not be native"); |
| |
| // first perform tests of things it's not possible to inline |
| if (callee->has_exception_handlers() && |
| !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers"); |
| if (callee->is_synchronized() && |
| !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized"); |
| if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet"); |
| if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match"); |
| |
| // Proper inlining of methods with jsrs requires a little more work. |
| if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet"); |
| |
| // now perform tests that are based on flag settings |
| if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining"); |
| if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining"); |
| if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large"); |
| |
| // don't inline throwable methods unless the inlining tree is rooted in a throwable class |
| if (callee->name() == ciSymbol::object_initializer_name() && |
| callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { |
| // Throwable constructor call |
| IRScope* top = scope(); |
| while (top->caller() != NULL) { |
| top = top->caller(); |
| } |
| if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { |
| INLINE_BAILOUT("don't inline Throwable constructors"); |
| } |
| } |
| |
| // When SSE2 is used on intel, then no special handling is needed |
| // for strictfp because the enum-constant is fixed at compile time, |
| // the check for UseSSE2 is needed here |
| if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) { |
| INLINE_BAILOUT("caller and callee have different strict fp requirements"); |
| } |
| |
| if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) { |
| INLINE_BAILOUT("total inlining greater than DesiredMethodLimit"); |
| } |
| |
| #ifndef PRODUCT |
| // printing |
| if (PrintInlining) { |
| print_inline_result(callee, true); |
| } |
| #endif |
| |
| // NOTE: Bailouts from this point on, which occur at the |
| // GraphBuilder level, do not cause bailout just of the inlining but |
| // in fact of the entire compilation. |
| |
| BlockBegin* orig_block = block(); |
| |
| const int args_base = state()->stack_size() - callee->arg_size(); |
| assert(args_base >= 0, "stack underflow during inlining"); |
| |
| // Insert null check if necessary |
| Value recv = NULL; |
| if (code() != Bytecodes::_invokestatic) { |
| // note: null check must happen even if first instruction of callee does |
| // an implicit null check since the callee is in a different scope |
| // and we must make sure exception handling does the right thing |
| assert(!callee->is_static(), "callee must not be static"); |
| assert(callee->arg_size() > 0, "must have at least a receiver"); |
| recv = state()->stack_at(args_base); |
| null_check(recv); |
| } |
| |
| if (profile_inlined_calls()) { |
| profile_call(recv, holder_known ? callee->holder() : NULL); |
| } |
| |
| profile_invocation(callee); |
| |
| // Introduce a new callee continuation point - if the callee has |
| // more than one return instruction or the return does not allow |
| // fall-through of control flow, all return instructions of the |
| // callee will need to be replaced by Goto's pointing to this |
| // continuation point. |
| BlockBegin* cont = block_at(next_bci()); |
| bool continuation_existed = true; |
| if (cont == NULL) { |
| cont = new BlockBegin(next_bci()); |
| // low number so that continuation gets parsed as early as possible |
| cont->set_depth_first_number(0); |
| #ifndef PRODUCT |
| if (PrintInitialBlockList) { |
| tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d", |
| cont->block_id(), cont->bci(), bci()); |
| } |
| #endif |
| continuation_existed = false; |
| } |
| // Record number of predecessors of continuation block before |
| // inlining, to detect if inlined method has edges to its |
| // continuation after inlining. |
| int continuation_preds = cont->number_of_preds(); |
| |
| // Push callee scope |
| push_scope(callee, cont); |
| |
| // the BlockListBuilder for the callee could have bailed out |
| CHECK_BAILOUT_(false); |
| |
| // Temporarily set up bytecode stream so we can append instructions |
| // (only using the bci of this stream) |
| scope_data()->set_stream(scope_data()->parent()->stream()); |
| |
| // Pass parameters into callee state: add assignments |
| // note: this will also ensure that all arguments are computed before being passed |
| ValueStack* callee_state = state(); |
| ValueStack* caller_state = scope()->caller_state(); |
| { int i = args_base; |
| while (i < caller_state->stack_size()) { |
| const int par_no = i - args_base; |
| Value arg = caller_state->stack_at_inc(i); |
| // NOTE: take base() of arg->type() to avoid problems storing |
| // constants |
| store_local(callee_state, arg, arg->type()->base(), par_no); |
| } |
| } |
| |
| // Remove args from stack. |
| // Note that we preserve locals state in case we can use it later |
| // (see use of pop_scope() below) |
| caller_state->truncate_stack(args_base); |
| callee_state->truncate_stack(args_base); |
| |
| // Setup state that is used at returns form the inlined method. |
| // This is essentially the state of the continuation block, |
| // but without the return value on stack, if any, this will |
| // be pushed at the return instruction (see method_return). |
| scope_data()->set_continuation_state(caller_state->copy()); |
| |
| // Compute lock stack size for callee scope now that args have been passed |
| scope()->compute_lock_stack_size(); |
| |
| Value lock; |
| BlockBegin* sync_handler; |
| |
| // Inline the locking of the receiver if the callee is synchronized |
| if (callee->is_synchronized()) { |
| lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror()))) |
| : state()->local_at(0); |
| sync_handler = new BlockBegin(-1); |
| inline_sync_entry(lock, sync_handler); |
| |
| // recompute the lock stack size |
| scope()->compute_lock_stack_size(); |
| } |
| |
| |
| BlockBegin* callee_start_block = block_at(0); |
| if (callee_start_block != NULL) { |
| assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header"); |
| Goto* goto_callee = new Goto(callee_start_block, false); |
| goto_callee->set_state(state()); |
| // The state for this goto is in the scope of the callee, so use |
| // the entry bci for the callee instead of the call site bci. |
| append_with_bci(goto_callee, 0); |
| _block->set_end(goto_callee); |
| callee_start_block->merge(callee_state); |
| |
| _last = _block = callee_start_block; |
| |
| scope_data()->add_to_work_list(callee_start_block); |
| } |
| |
| // Clear out bytecode stream |
| scope_data()->set_stream(NULL); |
| |
| // Ready to resume parsing in callee (either in the same block we |
| // were in before or in the callee's start block) |
| iterate_all_blocks(callee_start_block == NULL); |
| |
| // If we bailed out during parsing, return immediately (this is bad news) |
| if (bailed_out()) return false; |
| |
| // iterate_all_blocks theoretically traverses in random order; in |
| // practice, we have only traversed the continuation if we are |
| // inlining into a subroutine |
| assert(continuation_existed || |
| !continuation()->is_set(BlockBegin::was_visited_flag), |
| "continuation should not have been parsed yet if we created it"); |
| |
| // If we bailed out during parsing, return immediately (this is bad news) |
| CHECK_BAILOUT_(false); |
| |
| // At this point we are almost ready to return and resume parsing of |
| // the caller back in the GraphBuilder. The only thing we want to do |
| // first is an optimization: during parsing of the callee we |
| // generated at least one Goto to the continuation block. If we |
| // generated exactly one, and if the inlined method spanned exactly |
| // one block (and we didn't have to Goto its entry), then we snip |
| // off the Goto to the continuation, allowing control to fall |
| // through back into the caller block and effectively performing |
| // block merging. This allows load elimination and CSE to take place |
| // across multiple callee scopes if they are relatively simple, and |
| // is currently essential to making inlining profitable. |
| if ( num_returns() == 1 |
| && block() == orig_block |
| && block() == inline_cleanup_block()) { |
| _last = inline_cleanup_return_prev(); |
| _state = inline_cleanup_state()->pop_scope(); |
| } else if (continuation_preds == cont->number_of_preds()) { |
| // Inlining caused that the instructions after the invoke in the |
| // caller are not reachable any more. So skip filling this block |
| // with instructions! |
| assert (cont == continuation(), ""); |
| assert(_last && _last->as_BlockEnd(), ""); |
| _skip_block = true; |
| } else { |
| // Resume parsing in continuation block unless it was already parsed. |
| // Note that if we don't change _last here, iteration in |
| // iterate_bytecodes_for_block will stop when we return. |
| if (!continuation()->is_set(BlockBegin::was_visited_flag)) { |
| // add continuation to work list instead of parsing it immediately |
| assert(_last && _last->as_BlockEnd(), ""); |
| scope_data()->parent()->add_to_work_list(continuation()); |
| _skip_block = true; |
| } |
| } |
| |
| // Fill the exception handler for synchronized methods with instructions |
| if (callee->is_synchronized() && sync_handler->state() != NULL) { |
| fill_sync_handler(lock, sync_handler); |
| } else { |
| pop_scope(); |
| } |
| |
| compilation()->notice_inlined_method(callee); |
| |
| return true; |
| } |
| |
| |
| void GraphBuilder::inline_bailout(const char* msg) { |
| assert(msg != NULL, "inline bailout msg must exist"); |
| _inline_bailout_msg = msg; |
| } |
| |
| |
| void GraphBuilder::clear_inline_bailout() { |
| _inline_bailout_msg = NULL; |
| } |
| |
| |
| void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) { |
| ScopeData* data = new ScopeData(NULL); |
| data->set_scope(scope); |
| data->set_bci2block(bci2block); |
| _scope_data = data; |
| _block = start; |
| } |
| |
| |
| void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) { |
| IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false); |
| scope()->add_callee(callee_scope); |
| |
| BlockListBuilder blb(compilation(), callee_scope, -1); |
| CHECK_BAILOUT(); |
| |
| if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) { |
| // this scope can be inlined directly into the caller so remove |
| // the block at bci 0. |
| blb.bci2block()->at_put(0, NULL); |
| } |
| |
| callee_scope->set_caller_state(state()); |
| set_state(state()->push_scope(callee_scope)); |
| |
| ScopeData* data = new ScopeData(scope_data()); |
| data->set_scope(callee_scope); |
| data->set_bci2block(blb.bci2block()); |
| data->set_continuation(continuation); |
| _scope_data = data; |
| } |
| |
| |
| void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) { |
| ScopeData* data = new ScopeData(scope_data()); |
| data->set_parsing_jsr(); |
| data->set_jsr_entry_bci(jsr_dest_bci); |
| data->set_jsr_return_address_local(-1); |
| // Must clone bci2block list as we will be mutating it in order to |
| // properly clone all blocks in jsr region as well as exception |
| // handlers containing rets |
| BlockList* new_bci2block = new BlockList(bci2block()->length()); |
| new_bci2block->push_all(bci2block()); |
| data->set_bci2block(new_bci2block); |
| data->set_scope(scope()); |
| data->setup_jsr_xhandlers(); |
| data->set_continuation(continuation()); |
| if (continuation() != NULL) { |
| assert(continuation_state() != NULL, ""); |
| data->set_continuation_state(continuation_state()->copy()); |
| } |
| data->set_jsr_continuation(jsr_continuation); |
| _scope_data = data; |
| } |
| |
| |
| void GraphBuilder::pop_scope() { |
| int number_of_locks = scope()->number_of_locks(); |
| _scope_data = scope_data()->parent(); |
| // accumulate minimum number of monitor slots to be reserved |
| scope()->set_min_number_of_locks(number_of_locks); |
| } |
| |
| |
| void GraphBuilder::pop_scope_for_jsr() { |
| _scope_data = scope_data()->parent(); |
| } |
| |
| bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) { |
| if (InlineUnsafeOps) { |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| null_check(args->at(0)); |
| Instruction* offset = args->at(2); |
| #ifndef _LP64 |
| offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); |
| #endif |
| Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile)); |
| push(op->type(), op); |
| compilation()->set_has_unsafe_access(true); |
| } |
| return InlineUnsafeOps; |
| } |
| |
| |
| bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) { |
| if (InlineUnsafeOps) { |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| null_check(args->at(0)); |
| Instruction* offset = args->at(2); |
| #ifndef _LP64 |
| offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); |
| #endif |
| Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile)); |
| compilation()->set_has_unsafe_access(true); |
| kill_all(); |
| } |
| return InlineUnsafeOps; |
| } |
| |
| |
| bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) { |
| if (InlineUnsafeOps) { |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| null_check(args->at(0)); |
| Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false)); |
| push(op->type(), op); |
| compilation()->set_has_unsafe_access(true); |
| } |
| return InlineUnsafeOps; |
| } |
| |
| |
| bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) { |
| if (InlineUnsafeOps) { |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| null_check(args->at(0)); |
| Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2))); |
| compilation()->set_has_unsafe_access(true); |
| } |
| return InlineUnsafeOps; |
| } |
| |
| |
| bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) { |
| if (InlineUnsafeOps) { |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| int obj_arg_index = 1; // Assume non-static case |
| if (is_static) { |
| obj_arg_index = 0; |
| } else { |
| null_check(args->at(0)); |
| } |
| Instruction* offset = args->at(obj_arg_index + 1); |
| #ifndef _LP64 |
| offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); |
| #endif |
| Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset)) |
| : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset)); |
| compilation()->set_has_unsafe_access(true); |
| } |
| return InlineUnsafeOps; |
| } |
| |
| |
| void GraphBuilder::append_unsafe_CAS(ciMethod* callee) { |
| ValueType* result_type = as_ValueType(callee->return_type()); |
| assert(result_type->is_int(), "int result"); |
| Values* args = state()->pop_arguments(callee->arg_size()); |
| |
| // Pop off some args to speically handle, then push back |
| Value newval = args->pop(); |
| Value cmpval = args->pop(); |
| Value offset = args->pop(); |
| Value src = args->pop(); |
| Value unsafe_obj = args->pop(); |
| |
| // Separately handle the unsafe arg. It is not needed for code |
| // generation, but must be null checked |
| null_check(unsafe_obj); |
| |
| #ifndef _LP64 |
| offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); |
| #endif |
| |
| args->push(src); |
| args->push(offset); |
| args->push(cmpval); |
| args->push(newval); |
| |
| // An unsafe CAS can alias with other field accesses, but we don't |
| // know which ones so mark the state as no preserved. This will |
| // cause CSE to invalidate memory across it. |
| bool preserves_state = false; |
| Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state); |
| append_split(result); |
| push(result_type, result); |
| compilation()->set_has_unsafe_access(true); |
| } |
| |
| |
| #ifndef PRODUCT |
| void GraphBuilder::print_inline_result(ciMethod* callee, bool res) { |
| const char sync_char = callee->is_synchronized() ? 's' : ' '; |
| const char exception_char = callee->has_exception_handlers() ? '!' : ' '; |
| const char monitors_char = callee->has_monitor_bytecodes() ? 'm' : ' '; |
| tty->print(" %c%c%c ", sync_char, exception_char, monitors_char); |
| for (int i = 0; i < scope()->level(); i++) tty->print(" "); |
| if (res) { |
| tty->print(" "); |
| } else { |
| tty->print("- "); |
| } |
| tty->print("@ %d ", bci()); |
| callee->print_short_name(); |
| tty->print(" (%d bytes)", callee->code_size()); |
| if (_inline_bailout_msg) { |
| tty->print(" %s", _inline_bailout_msg); |
| } |
| tty->cr(); |
| |
| if (res && CIPrintMethodCodes) { |
| callee->print_codes(); |
| } |
| } |
| |
| |
| void GraphBuilder::print_stats() { |
| vmap()->print(); |
| } |
| #endif // PRODUCT |
| |
| |
| void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) { |
| append(new ProfileCall(method(), bci(), recv, known_holder)); |
| } |
| |
| |
| void GraphBuilder::profile_invocation(ciMethod* callee) { |
| if (profile_calls()) { |
| // increment the interpreter_invocation_count for the inlinee |
| Value m = append(new Constant(new ObjectConstant(callee))); |
| append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1)); |
| } |
| } |
| |
| |
| void GraphBuilder::profile_bci(int bci) { |
| if (profile_branches()) { |
| ciMethodData* md = method()->method_data(); |
| if (md == NULL) { |
| BAILOUT("out of memory building methodDataOop"); |
| } |
| ciProfileData* data = md->bci_to_data(bci); |
| assert(data != NULL && data->is_JumpData(), "need JumpData for goto"); |
| Value mdo = append(new Constant(new ObjectConstant(md))); |
| append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1)); |
| } |
| } |