| // |
| // Copyright 1997-2007 Sun Microsystems, Inc. All Rights Reserved. |
| // DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
| // |
| // This code is free software; you can redistribute it and/or modify it |
| // under the terms of the GNU General Public License version 2 only, as |
| // published by the Free Software Foundation. |
| // |
| // This code is distributed in the hope that it will be useful, but WITHOUT |
| // ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or |
| // FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License |
| // version 2 for more details (a copy is included in the LICENSE file that |
| // accompanied this code). |
| // |
| // You should have received a copy of the GNU General Public License version |
| // 2 along with this work; if not, write to the Free Software Foundation, |
| // Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. |
| // |
| // Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, |
| // CA 95054 USA or visit www.sun.com if you need additional information or |
| // have any questions. |
| // |
| // |
| |
| // X86 Architecture Description File |
| |
| //----------REGISTER DEFINITION BLOCK------------------------------------------ |
| // This information is used by the matcher and the register allocator to |
| // describe individual registers and classes of registers within the target |
| // archtecture. |
| |
| register %{ |
| //----------Architecture Description Register Definitions---------------------- |
| // General Registers |
| // "reg_def" name ( register save type, C convention save type, |
| // ideal register type, encoding ); |
| // Register Save Types: |
| // |
| // NS = No-Save: The register allocator assumes that these registers |
| // can be used without saving upon entry to the method, & |
| // that they do not need to be saved at call sites. |
| // |
| // SOC = Save-On-Call: The register allocator assumes that these registers |
| // can be used without saving upon entry to the method, |
| // but that they must be saved at call sites. |
| // |
| // SOE = Save-On-Entry: The register allocator assumes that these registers |
| // must be saved before using them upon entry to the |
| // method, but they do not need to be saved at call |
| // sites. |
| // |
| // AS = Always-Save: The register allocator assumes that these registers |
| // must be saved before using them upon entry to the |
| // method, & that they must be saved at call sites. |
| // |
| // Ideal Register Type is used to determine how to save & restore a |
| // register. Op_RegI will get spilled with LoadI/StoreI, Op_RegP will get |
| // spilled with LoadP/StoreP. If the register supports both, use Op_RegI. |
| // |
| // The encoding number is the actual bit-pattern placed into the opcodes. |
| |
| // General Registers |
| // Previously set EBX, ESI, and EDI as save-on-entry for java code |
| // Turn off SOE in java-code due to frequent use of uncommon-traps. |
| // Now that allocator is better, turn on ESI and EDI as SOE registers. |
| |
| reg_def EBX(SOC, SOE, Op_RegI, 3, rbx->as_VMReg()); |
| reg_def ECX(SOC, SOC, Op_RegI, 1, rcx->as_VMReg()); |
| reg_def ESI(SOC, SOE, Op_RegI, 6, rsi->as_VMReg()); |
| reg_def EDI(SOC, SOE, Op_RegI, 7, rdi->as_VMReg()); |
| // now that adapter frames are gone EBP is always saved and restored by the prolog/epilog code |
| reg_def EBP(NS, SOE, Op_RegI, 5, rbp->as_VMReg()); |
| reg_def EDX(SOC, SOC, Op_RegI, 2, rdx->as_VMReg()); |
| reg_def EAX(SOC, SOC, Op_RegI, 0, rax->as_VMReg()); |
| reg_def ESP( NS, NS, Op_RegI, 4, rsp->as_VMReg()); |
| |
| // Special Registers |
| reg_def EFLAGS(SOC, SOC, 0, 8, VMRegImpl::Bad()); |
| |
| // Float registers. We treat TOS/FPR0 special. It is invisible to the |
| // allocator, and only shows up in the encodings. |
| reg_def FPR0L( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); |
| reg_def FPR0H( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); |
| // Ok so here's the trick FPR1 is really st(0) except in the midst |
| // of emission of assembly for a machnode. During the emission the fpu stack |
| // is pushed making FPR1 == st(1) temporarily. However at any safepoint |
| // the stack will not have this element so FPR1 == st(0) from the |
| // oopMap viewpoint. This same weirdness with numbering causes |
| // instruction encoding to have to play games with the register |
| // encode to correct for this 0/1 issue. See MachSpillCopyNode::implementation |
| // where it does flt->flt moves to see an example |
| // |
| reg_def FPR1L( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()); |
| reg_def FPR1H( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()->next()); |
| reg_def FPR2L( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()); |
| reg_def FPR2H( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()->next()); |
| reg_def FPR3L( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()); |
| reg_def FPR3H( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()->next()); |
| reg_def FPR4L( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()); |
| reg_def FPR4H( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()->next()); |
| reg_def FPR5L( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()); |
| reg_def FPR5H( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()->next()); |
| reg_def FPR6L( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()); |
| reg_def FPR6H( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()->next()); |
| reg_def FPR7L( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()); |
| reg_def FPR7H( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()->next()); |
| |
| // XMM registers. 128-bit registers or 4 words each, labeled a-d. |
| // Word a in each register holds a Float, words ab hold a Double. |
| // We currently do not use the SIMD capabilities, so registers cd |
| // are unused at the moment. |
| reg_def XMM0a( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()); |
| reg_def XMM0b( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()->next()); |
| reg_def XMM1a( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()); |
| reg_def XMM1b( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()->next()); |
| reg_def XMM2a( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()); |
| reg_def XMM2b( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()->next()); |
| reg_def XMM3a( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()); |
| reg_def XMM3b( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()->next()); |
| reg_def XMM4a( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()); |
| reg_def XMM4b( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()->next()); |
| reg_def XMM5a( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()); |
| reg_def XMM5b( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()->next()); |
| reg_def XMM6a( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()); |
| reg_def XMM6b( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()->next()); |
| reg_def XMM7a( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()); |
| reg_def XMM7b( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()->next()); |
| |
| // Specify priority of register selection within phases of register |
| // allocation. Highest priority is first. A useful heuristic is to |
| // give registers a low priority when they are required by machine |
| // instructions, like EAX and EDX. Registers which are used as |
| // pairs must fall on an even boundry (witness the FPR#L's in this list). |
| // For the Intel integer registers, the equivalent Long pairs are |
| // EDX:EAX, EBX:ECX, and EDI:EBP. |
| alloc_class chunk0( ECX, EBX, EBP, EDI, EAX, EDX, ESI, ESP, |
| FPR0L, FPR0H, FPR1L, FPR1H, FPR2L, FPR2H, |
| FPR3L, FPR3H, FPR4L, FPR4H, FPR5L, FPR5H, |
| FPR6L, FPR6H, FPR7L, FPR7H ); |
| |
| alloc_class chunk1( XMM0a, XMM0b, |
| XMM1a, XMM1b, |
| XMM2a, XMM2b, |
| XMM3a, XMM3b, |
| XMM4a, XMM4b, |
| XMM5a, XMM5b, |
| XMM6a, XMM6b, |
| XMM7a, XMM7b, EFLAGS); |
| |
| |
| //----------Architecture Description Register Classes-------------------------- |
| // Several register classes are automatically defined based upon information in |
| // this architecture description. |
| // 1) reg_class inline_cache_reg ( /* as def'd in frame section */ ) |
| // 2) reg_class compiler_method_oop_reg ( /* as def'd in frame section */ ) |
| // 2) reg_class interpreter_method_oop_reg ( /* as def'd in frame section */ ) |
| // 3) reg_class stack_slots( /* one chunk of stack-based "registers" */ ) |
| // |
| // Class for all registers |
| reg_class any_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX, ESP); |
| // Class for general registers |
| reg_class e_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX); |
| // Class for general registers which may be used for implicit null checks on win95 |
| // Also safe for use by tailjump. We don't want to allocate in rbp, |
| reg_class e_reg_no_rbp(EAX, EDX, EDI, ESI, ECX, EBX); |
| // Class of "X" registers |
| reg_class x_reg(EBX, ECX, EDX, EAX); |
| // Class of registers that can appear in an address with no offset. |
| // EBP and ESP require an extra instruction byte for zero offset. |
| // Used in fast-unlock |
| reg_class p_reg(EDX, EDI, ESI, EBX); |
| // Class for general registers not including ECX |
| reg_class ncx_reg(EAX, EDX, EBP, EDI, ESI, EBX); |
| // Class for general registers not including EAX |
| reg_class nax_reg(EDX, EDI, ESI, ECX, EBX); |
| // Class for general registers not including EAX or EBX. |
| reg_class nabx_reg(EDX, EDI, ESI, ECX, EBP); |
| // Class of EAX (for multiply and divide operations) |
| reg_class eax_reg(EAX); |
| // Class of EBX (for atomic add) |
| reg_class ebx_reg(EBX); |
| // Class of ECX (for shift and JCXZ operations and cmpLTMask) |
| reg_class ecx_reg(ECX); |
| // Class of EDX (for multiply and divide operations) |
| reg_class edx_reg(EDX); |
| // Class of EDI (for synchronization) |
| reg_class edi_reg(EDI); |
| // Class of ESI (for synchronization) |
| reg_class esi_reg(ESI); |
| // Singleton class for interpreter's stack pointer |
| reg_class ebp_reg(EBP); |
| // Singleton class for stack pointer |
| reg_class sp_reg(ESP); |
| // Singleton class for instruction pointer |
| // reg_class ip_reg(EIP); |
| // Singleton class for condition codes |
| reg_class int_flags(EFLAGS); |
| // Class of integer register pairs |
| reg_class long_reg( EAX,EDX, ECX,EBX, EBP,EDI ); |
| // Class of integer register pairs that aligns with calling convention |
| reg_class eadx_reg( EAX,EDX ); |
| reg_class ebcx_reg( ECX,EBX ); |
| // Not AX or DX, used in divides |
| reg_class nadx_reg( EBX,ECX,ESI,EDI,EBP ); |
| |
| // Floating point registers. Notice FPR0 is not a choice. |
| // FPR0 is not ever allocated; we use clever encodings to fake |
| // a 2-address instructions out of Intels FP stack. |
| reg_class flt_reg( FPR1L,FPR2L,FPR3L,FPR4L,FPR5L,FPR6L,FPR7L ); |
| |
| // make a register class for SSE registers |
| reg_class xmm_reg(XMM0a, XMM1a, XMM2a, XMM3a, XMM4a, XMM5a, XMM6a, XMM7a); |
| |
| // make a double register class for SSE2 registers |
| reg_class xdb_reg(XMM0a,XMM0b, XMM1a,XMM1b, XMM2a,XMM2b, XMM3a,XMM3b, |
| XMM4a,XMM4b, XMM5a,XMM5b, XMM6a,XMM6b, XMM7a,XMM7b ); |
| |
| reg_class dbl_reg( FPR1L,FPR1H, FPR2L,FPR2H, FPR3L,FPR3H, |
| FPR4L,FPR4H, FPR5L,FPR5H, FPR6L,FPR6H, |
| FPR7L,FPR7H ); |
| |
| reg_class flt_reg0( FPR1L ); |
| reg_class dbl_reg0( FPR1L,FPR1H ); |
| reg_class dbl_reg1( FPR2L,FPR2H ); |
| reg_class dbl_notreg0( FPR2L,FPR2H, FPR3L,FPR3H, FPR4L,FPR4H, |
| FPR5L,FPR5H, FPR6L,FPR6H, FPR7L,FPR7H ); |
| |
| // XMM6 and XMM7 could be used as temporary registers for long, float and |
| // double values for SSE2. |
| reg_class xdb_reg6( XMM6a,XMM6b ); |
| reg_class xdb_reg7( XMM7a,XMM7b ); |
| %} |
| |
| |
| //----------SOURCE BLOCK------------------------------------------------------- |
| // This is a block of C++ code which provides values, functions, and |
| // definitions necessary in the rest of the architecture description |
| source %{ |
| #define RELOC_IMM32 Assembler::imm32_operand |
| #define RELOC_DISP32 Assembler::disp32_operand |
| |
| #define __ _masm. |
| |
| // How to find the high register of a Long pair, given the low register |
| #define HIGH_FROM_LOW(x) ((x)+2) |
| |
| // These masks are used to provide 128-bit aligned bitmasks to the XMM |
| // instructions, to allow sign-masking or sign-bit flipping. They allow |
| // fast versions of NegF/NegD and AbsF/AbsD. |
| |
| // Note: 'double' and 'long long' have 32-bits alignment on x86. |
| static jlong* double_quadword(jlong *adr, jlong lo, jlong hi) { |
| // Use the expression (adr)&(~0xF) to provide 128-bits aligned address |
| // of 128-bits operands for SSE instructions. |
| jlong *operand = (jlong*)(((uintptr_t)adr)&((uintptr_t)(~0xF))); |
| // Store the value to a 128-bits operand. |
| operand[0] = lo; |
| operand[1] = hi; |
| return operand; |
| } |
| |
| // Buffer for 128-bits masks used by SSE instructions. |
| static jlong fp_signmask_pool[(4+1)*2]; // 4*128bits(data) + 128bits(alignment) |
| |
| // Static initialization during VM startup. |
| static jlong *float_signmask_pool = double_quadword(&fp_signmask_pool[1*2], CONST64(0x7FFFFFFF7FFFFFFF), CONST64(0x7FFFFFFF7FFFFFFF)); |
| static jlong *double_signmask_pool = double_quadword(&fp_signmask_pool[2*2], CONST64(0x7FFFFFFFFFFFFFFF), CONST64(0x7FFFFFFFFFFFFFFF)); |
| static jlong *float_signflip_pool = double_quadword(&fp_signmask_pool[3*2], CONST64(0x8000000080000000), CONST64(0x8000000080000000)); |
| static jlong *double_signflip_pool = double_quadword(&fp_signmask_pool[4*2], CONST64(0x8000000000000000), CONST64(0x8000000000000000)); |
| |
| // !!!!! Special hack to get all type of calls to specify the byte offset |
| // from the start of the call to the point where the return address |
| // will point. |
| int MachCallStaticJavaNode::ret_addr_offset() { |
| return 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 5 bytes from start of call to where return address points |
| } |
| |
| int MachCallDynamicJavaNode::ret_addr_offset() { |
| return 10 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 10 bytes from start of call to where return address points |
| } |
| |
| static int sizeof_FFree_Float_Stack_All = -1; |
| |
| int MachCallRuntimeNode::ret_addr_offset() { |
| assert(sizeof_FFree_Float_Stack_All != -1, "must have been emitted already"); |
| return sizeof_FFree_Float_Stack_All + 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); |
| } |
| |
| // Indicate if the safepoint node needs the polling page as an input. |
| // Since x86 does have absolute addressing, it doesn't. |
| bool SafePointNode::needs_polling_address_input() { |
| return false; |
| } |
| |
| // |
| // Compute padding required for nodes which need alignment |
| // |
| |
| // The address of the call instruction needs to be 4-byte aligned to |
| // ensure that it does not span a cache line so that it can be patched. |
| int CallStaticJavaDirectNode::compute_padding(int current_offset) const { |
| if (Compile::current()->in_24_bit_fp_mode()) |
| current_offset += 6; // skip fldcw in pre_call_FPU, if any |
| current_offset += 1; // skip call opcode byte |
| return round_to(current_offset, alignment_required()) - current_offset; |
| } |
| |
| // The address of the call instruction needs to be 4-byte aligned to |
| // ensure that it does not span a cache line so that it can be patched. |
| int CallDynamicJavaDirectNode::compute_padding(int current_offset) const { |
| if (Compile::current()->in_24_bit_fp_mode()) |
| current_offset += 6; // skip fldcw in pre_call_FPU, if any |
| current_offset += 5; // skip MOV instruction |
| current_offset += 1; // skip call opcode byte |
| return round_to(current_offset, alignment_required()) - current_offset; |
| } |
| |
| #ifndef PRODUCT |
| void MachBreakpointNode::format( PhaseRegAlloc *, outputStream* st ) const { |
| st->print("INT3"); |
| } |
| #endif |
| |
| // EMIT_RM() |
| void emit_rm(CodeBuffer &cbuf, int f1, int f2, int f3) { |
| unsigned char c = (unsigned char)((f1 << 6) | (f2 << 3) | f3); |
| *(cbuf.code_end()) = c; |
| cbuf.set_code_end(cbuf.code_end() + 1); |
| } |
| |
| // EMIT_CC() |
| void emit_cc(CodeBuffer &cbuf, int f1, int f2) { |
| unsigned char c = (unsigned char)( f1 | f2 ); |
| *(cbuf.code_end()) = c; |
| cbuf.set_code_end(cbuf.code_end() + 1); |
| } |
| |
| // EMIT_OPCODE() |
| void emit_opcode(CodeBuffer &cbuf, int code) { |
| *(cbuf.code_end()) = (unsigned char)code; |
| cbuf.set_code_end(cbuf.code_end() + 1); |
| } |
| |
| // EMIT_OPCODE() w/ relocation information |
| void emit_opcode(CodeBuffer &cbuf, int code, relocInfo::relocType reloc, int offset = 0) { |
| cbuf.relocate(cbuf.inst_mark() + offset, reloc); |
| emit_opcode(cbuf, code); |
| } |
| |
| // EMIT_D8() |
| void emit_d8(CodeBuffer &cbuf, int d8) { |
| *(cbuf.code_end()) = (unsigned char)d8; |
| cbuf.set_code_end(cbuf.code_end() + 1); |
| } |
| |
| // EMIT_D16() |
| void emit_d16(CodeBuffer &cbuf, int d16) { |
| *((short *)(cbuf.code_end())) = d16; |
| cbuf.set_code_end(cbuf.code_end() + 2); |
| } |
| |
| // EMIT_D32() |
| void emit_d32(CodeBuffer &cbuf, int d32) { |
| *((int *)(cbuf.code_end())) = d32; |
| cbuf.set_code_end(cbuf.code_end() + 4); |
| } |
| |
| // emit 32 bit value and construct relocation entry from relocInfo::relocType |
| void emit_d32_reloc(CodeBuffer &cbuf, int d32, relocInfo::relocType reloc, |
| int format) { |
| cbuf.relocate(cbuf.inst_mark(), reloc, format); |
| |
| *((int *)(cbuf.code_end())) = d32; |
| cbuf.set_code_end(cbuf.code_end() + 4); |
| } |
| |
| // emit 32 bit value and construct relocation entry from RelocationHolder |
| void emit_d32_reloc(CodeBuffer &cbuf, int d32, RelocationHolder const& rspec, |
| int format) { |
| #ifdef ASSERT |
| if (rspec.reloc()->type() == relocInfo::oop_type && d32 != 0 && d32 != (int)Universe::non_oop_word()) { |
| assert(oop(d32)->is_oop() && oop(d32)->is_perm(), "cannot embed non-perm oops in code"); |
| } |
| #endif |
| cbuf.relocate(cbuf.inst_mark(), rspec, format); |
| |
| *((int *)(cbuf.code_end())) = d32; |
| cbuf.set_code_end(cbuf.code_end() + 4); |
| } |
| |
| // Access stack slot for load or store |
| void store_to_stackslot(CodeBuffer &cbuf, int opcode, int rm_field, int disp) { |
| emit_opcode( cbuf, opcode ); // (e.g., FILD [ESP+src]) |
| if( -128 <= disp && disp <= 127 ) { |
| emit_rm( cbuf, 0x01, rm_field, ESP_enc ); // R/M byte |
| emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte |
| emit_d8 (cbuf, disp); // Displacement // R/M byte |
| } else { |
| emit_rm( cbuf, 0x02, rm_field, ESP_enc ); // R/M byte |
| emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte |
| emit_d32(cbuf, disp); // Displacement // R/M byte |
| } |
| } |
| |
| // eRegI ereg, memory mem) %{ // emit_reg_mem |
| void encode_RegMem( CodeBuffer &cbuf, int reg_encoding, int base, int index, int scale, int displace, bool displace_is_oop ) { |
| // There is no index & no scale, use form without SIB byte |
| if ((index == 0x4) && |
| (scale == 0) && (base != ESP_enc)) { |
| // If no displacement, mode is 0x0; unless base is [EBP] |
| if ( (displace == 0) && (base != EBP_enc) ) { |
| emit_rm(cbuf, 0x0, reg_encoding, base); |
| } |
| else { // If 8-bit displacement, mode 0x1 |
| if ((displace >= -128) && (displace <= 127) |
| && !(displace_is_oop) ) { |
| emit_rm(cbuf, 0x1, reg_encoding, base); |
| emit_d8(cbuf, displace); |
| } |
| else { // If 32-bit displacement |
| if (base == -1) { // Special flag for absolute address |
| emit_rm(cbuf, 0x0, reg_encoding, 0x5); |
| // (manual lies; no SIB needed here) |
| if ( displace_is_oop ) { |
| emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); |
| } else { |
| emit_d32 (cbuf, displace); |
| } |
| } |
| else { // Normal base + offset |
| emit_rm(cbuf, 0x2, reg_encoding, base); |
| if ( displace_is_oop ) { |
| emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); |
| } else { |
| emit_d32 (cbuf, displace); |
| } |
| } |
| } |
| } |
| } |
| else { // Else, encode with the SIB byte |
| // If no displacement, mode is 0x0; unless base is [EBP] |
| if (displace == 0 && (base != EBP_enc)) { // If no displacement |
| emit_rm(cbuf, 0x0, reg_encoding, 0x4); |
| emit_rm(cbuf, scale, index, base); |
| } |
| else { // If 8-bit displacement, mode 0x1 |
| if ((displace >= -128) && (displace <= 127) |
| && !(displace_is_oop) ) { |
| emit_rm(cbuf, 0x1, reg_encoding, 0x4); |
| emit_rm(cbuf, scale, index, base); |
| emit_d8(cbuf, displace); |
| } |
| else { // If 32-bit displacement |
| if (base == 0x04 ) { |
| emit_rm(cbuf, 0x2, reg_encoding, 0x4); |
| emit_rm(cbuf, scale, index, 0x04); |
| } else { |
| emit_rm(cbuf, 0x2, reg_encoding, 0x4); |
| emit_rm(cbuf, scale, index, base); |
| } |
| if ( displace_is_oop ) { |
| emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); |
| } else { |
| emit_d32 (cbuf, displace); |
| } |
| } |
| } |
| } |
| } |
| |
| |
| void encode_Copy( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { |
| if( dst_encoding == src_encoding ) { |
| // reg-reg copy, use an empty encoding |
| } else { |
| emit_opcode( cbuf, 0x8B ); |
| emit_rm(cbuf, 0x3, dst_encoding, src_encoding ); |
| } |
| } |
| |
| void encode_CopyXD( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { |
| if( dst_encoding == src_encoding ) { |
| // reg-reg copy, use an empty encoding |
| } else { |
| MacroAssembler _masm(&cbuf); |
| |
| __ movdqa(as_XMMRegister(dst_encoding), as_XMMRegister(src_encoding)); |
| } |
| } |
| |
| |
| //============================================================================= |
| #ifndef PRODUCT |
| void MachPrologNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { |
| Compile* C = ra_->C; |
| if( C->in_24_bit_fp_mode() ) { |
| tty->print("FLDCW 24 bit fpu control word"); |
| tty->print_cr(""); tty->print("\t"); |
| } |
| |
| int framesize = C->frame_slots() << LogBytesPerInt; |
| assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); |
| // Remove two words for return addr and rbp, |
| framesize -= 2*wordSize; |
| |
| // Calls to C2R adapters often do not accept exceptional returns. |
| // We require that their callers must bang for them. But be careful, because |
| // some VM calls (such as call site linkage) can use several kilobytes of |
| // stack. But the stack safety zone should account for that. |
| // See bugs 4446381, 4468289, 4497237. |
| if (C->need_stack_bang(framesize)) { |
| tty->print_cr("# stack bang"); tty->print("\t"); |
| } |
| tty->print_cr("PUSHL EBP"); tty->print("\t"); |
| |
| if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth |
| tty->print("PUSH 0xBADB100D\t# Majik cookie for stack depth check"); |
| tty->print_cr(""); tty->print("\t"); |
| framesize -= wordSize; |
| } |
| |
| if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { |
| if (framesize) { |
| tty->print("SUB ESP,%d\t# Create frame",framesize); |
| } |
| } else { |
| tty->print("SUB ESP,%d\t# Create frame",framesize); |
| } |
| } |
| #endif |
| |
| |
| void MachPrologNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { |
| Compile* C = ra_->C; |
| |
| if (UseSSE >= 2 && VerifyFPU) { |
| MacroAssembler masm(&cbuf); |
| masm.verify_FPU(0, "FPU stack must be clean on entry"); |
| } |
| |
| // WARNING: Initial instruction MUST be 5 bytes or longer so that |
| // NativeJump::patch_verified_entry will be able to patch out the entry |
| // code safely. The fldcw is ok at 6 bytes, the push to verify stack |
| // depth is ok at 5 bytes, the frame allocation can be either 3 or |
| // 6 bytes. So if we don't do the fldcw or the push then we must |
| // use the 6 byte frame allocation even if we have no frame. :-( |
| // If method sets FPU control word do it now |
| if( C->in_24_bit_fp_mode() ) { |
| MacroAssembler masm(&cbuf); |
| masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); |
| } |
| |
| int framesize = C->frame_slots() << LogBytesPerInt; |
| assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); |
| // Remove two words for return addr and rbp, |
| framesize -= 2*wordSize; |
| |
| // Calls to C2R adapters often do not accept exceptional returns. |
| // We require that their callers must bang for them. But be careful, because |
| // some VM calls (such as call site linkage) can use several kilobytes of |
| // stack. But the stack safety zone should account for that. |
| // See bugs 4446381, 4468289, 4497237. |
| if (C->need_stack_bang(framesize)) { |
| MacroAssembler masm(&cbuf); |
| masm.generate_stack_overflow_check(framesize); |
| } |
| |
| // We always push rbp, so that on return to interpreter rbp, will be |
| // restored correctly and we can correct the stack. |
| emit_opcode(cbuf, 0x50 | EBP_enc); |
| |
| if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth |
| emit_opcode(cbuf, 0x68); // push 0xbadb100d |
| emit_d32(cbuf, 0xbadb100d); |
| framesize -= wordSize; |
| } |
| |
| if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { |
| if (framesize) { |
| emit_opcode(cbuf, 0x83); // sub SP,#framesize |
| emit_rm(cbuf, 0x3, 0x05, ESP_enc); |
| emit_d8(cbuf, framesize); |
| } |
| } else { |
| emit_opcode(cbuf, 0x81); // sub SP,#framesize |
| emit_rm(cbuf, 0x3, 0x05, ESP_enc); |
| emit_d32(cbuf, framesize); |
| } |
| C->set_frame_complete(cbuf.code_end() - cbuf.code_begin()); |
| |
| #ifdef ASSERT |
| if (VerifyStackAtCalls) { |
| Label L; |
| MacroAssembler masm(&cbuf); |
| masm.pushl(rax); |
| masm.movl(rax, rsp); |
| masm.andl(rax, StackAlignmentInBytes-1); |
| masm.cmpl(rax, StackAlignmentInBytes-wordSize); |
| masm.popl(rax); |
| masm.jcc(Assembler::equal, L); |
| masm.stop("Stack is not properly aligned!"); |
| masm.bind(L); |
| } |
| #endif |
| |
| } |
| |
| uint MachPrologNode::size(PhaseRegAlloc *ra_) const { |
| return MachNode::size(ra_); // too many variables; just compute it the hard way |
| } |
| |
| int MachPrologNode::reloc() const { |
| return 0; // a large enough number |
| } |
| |
| //============================================================================= |
| #ifndef PRODUCT |
| void MachEpilogNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { |
| Compile *C = ra_->C; |
| int framesize = C->frame_slots() << LogBytesPerInt; |
| assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); |
| // Remove two words for return addr and rbp, |
| framesize -= 2*wordSize; |
| |
| if( C->in_24_bit_fp_mode() ) { |
| st->print("FLDCW standard control word"); |
| st->cr(); st->print("\t"); |
| } |
| if( framesize ) { |
| st->print("ADD ESP,%d\t# Destroy frame",framesize); |
| st->cr(); st->print("\t"); |
| } |
| st->print_cr("POPL EBP"); st->print("\t"); |
| if( do_polling() && C->is_method_compilation() ) { |
| st->print("TEST PollPage,EAX\t! Poll Safepoint"); |
| st->cr(); st->print("\t"); |
| } |
| } |
| #endif |
| |
| void MachEpilogNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { |
| Compile *C = ra_->C; |
| |
| // If method set FPU control word, restore to standard control word |
| if( C->in_24_bit_fp_mode() ) { |
| MacroAssembler masm(&cbuf); |
| masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); |
| } |
| |
| int framesize = C->frame_slots() << LogBytesPerInt; |
| assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); |
| // Remove two words for return addr and rbp, |
| framesize -= 2*wordSize; |
| |
| // Note that VerifyStackAtCalls' Majik cookie does not change the frame size popped here |
| |
| if( framesize >= 128 ) { |
| emit_opcode(cbuf, 0x81); // add SP, #framesize |
| emit_rm(cbuf, 0x3, 0x00, ESP_enc); |
| emit_d32(cbuf, framesize); |
| } |
| else if( framesize ) { |
| emit_opcode(cbuf, 0x83); // add SP, #framesize |
| emit_rm(cbuf, 0x3, 0x00, ESP_enc); |
| emit_d8(cbuf, framesize); |
| } |
| |
| emit_opcode(cbuf, 0x58 | EBP_enc); |
| |
| if( do_polling() && C->is_method_compilation() ) { |
| cbuf.relocate(cbuf.code_end(), relocInfo::poll_return_type, 0); |
| emit_opcode(cbuf,0x85); |
| emit_rm(cbuf, 0x0, EAX_enc, 0x5); // EAX |
| emit_d32(cbuf, (intptr_t)os::get_polling_page()); |
| } |
| } |
| |
| uint MachEpilogNode::size(PhaseRegAlloc *ra_) const { |
| Compile *C = ra_->C; |
| // If method set FPU control word, restore to standard control word |
| int size = C->in_24_bit_fp_mode() ? 6 : 0; |
| if( do_polling() && C->is_method_compilation() ) size += 6; |
| |
| int framesize = C->frame_slots() << LogBytesPerInt; |
| assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); |
| // Remove two words for return addr and rbp, |
| framesize -= 2*wordSize; |
| |
| size++; // popl rbp, |
| |
| if( framesize >= 128 ) { |
| size += 6; |
| } else { |
| size += framesize ? 3 : 0; |
| } |
| return size; |
| } |
| |
| int MachEpilogNode::reloc() const { |
| return 0; // a large enough number |
| } |
| |
| const Pipeline * MachEpilogNode::pipeline() const { |
| return MachNode::pipeline_class(); |
| } |
| |
| int MachEpilogNode::safepoint_offset() const { return 0; } |
| |
| //============================================================================= |
| |
| enum RC { rc_bad, rc_int, rc_float, rc_xmm, rc_stack }; |
| static enum RC rc_class( OptoReg::Name reg ) { |
| |
| if( !OptoReg::is_valid(reg) ) return rc_bad; |
| if (OptoReg::is_stack(reg)) return rc_stack; |
| |
| VMReg r = OptoReg::as_VMReg(reg); |
| if (r->is_Register()) return rc_int; |
| if (r->is_FloatRegister()) { |
| assert(UseSSE < 2, "shouldn't be used in SSE2+ mode"); |
| return rc_float; |
| } |
| assert(r->is_XMMRegister(), "must be"); |
| return rc_xmm; |
| } |
| |
| static int impl_helper( CodeBuffer *cbuf, bool do_size, bool is_load, int offset, int reg, int opcode, const char *op_str, int size ) { |
| if( cbuf ) { |
| emit_opcode (*cbuf, opcode ); |
| encode_RegMem(*cbuf, Matcher::_regEncode[reg], ESP_enc, 0x4, 0, offset, false); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| if( opcode == 0x8B || opcode == 0x89 ) { // MOV |
| if( is_load ) tty->print("%s %s,[ESP + #%d]",op_str,Matcher::regName[reg],offset); |
| else tty->print("%s [ESP + #%d],%s",op_str,offset,Matcher::regName[reg]); |
| } else { // FLD, FST, PUSH, POP |
| tty->print("%s [ESP + #%d]",op_str,offset); |
| } |
| #endif |
| } |
| int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); |
| return size+3+offset_size; |
| } |
| |
| // Helper for XMM registers. Extra opcode bits, limited syntax. |
| static int impl_x_helper( CodeBuffer *cbuf, bool do_size, bool is_load, |
| int offset, int reg_lo, int reg_hi, int size ) { |
| if( cbuf ) { |
| if( reg_lo+1 == reg_hi ) { // double move? |
| if( is_load && !UseXmmLoadAndClearUpper ) |
| emit_opcode(*cbuf, 0x66 ); // use 'movlpd' for load |
| else |
| emit_opcode(*cbuf, 0xF2 ); // use 'movsd' otherwise |
| } else { |
| emit_opcode(*cbuf, 0xF3 ); |
| } |
| emit_opcode(*cbuf, 0x0F ); |
| if( reg_lo+1 == reg_hi && is_load && !UseXmmLoadAndClearUpper ) |
| emit_opcode(*cbuf, 0x12 ); // use 'movlpd' for load |
| else |
| emit_opcode(*cbuf, is_load ? 0x10 : 0x11 ); |
| encode_RegMem(*cbuf, Matcher::_regEncode[reg_lo], ESP_enc, 0x4, 0, offset, false); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| if( reg_lo+1 == reg_hi ) { // double move? |
| if( is_load ) tty->print("%s %s,[ESP + #%d]", |
| UseXmmLoadAndClearUpper ? "MOVSD " : "MOVLPD", |
| Matcher::regName[reg_lo], offset); |
| else tty->print("MOVSD [ESP + #%d],%s", |
| offset, Matcher::regName[reg_lo]); |
| } else { |
| if( is_load ) tty->print("MOVSS %s,[ESP + #%d]", |
| Matcher::regName[reg_lo], offset); |
| else tty->print("MOVSS [ESP + #%d],%s", |
| offset, Matcher::regName[reg_lo]); |
| } |
| #endif |
| } |
| int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); |
| return size+5+offset_size; |
| } |
| |
| |
| static int impl_movx_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int dst_lo, |
| int src_hi, int dst_hi, int size ) { |
| if( UseXmmRegToRegMoveAll ) {//Use movaps,movapd to move between xmm registers |
| if( cbuf ) { |
| if( (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ) { |
| emit_opcode(*cbuf, 0x66 ); |
| } |
| emit_opcode(*cbuf, 0x0F ); |
| emit_opcode(*cbuf, 0x28 ); |
| emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? |
| tty->print("MOVAPD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); |
| } else { |
| tty->print("MOVAPS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); |
| } |
| #endif |
| } |
| return size + ((src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 4 : 3); |
| } else { |
| if( cbuf ) { |
| emit_opcode(*cbuf, (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 0xF2 : 0xF3 ); |
| emit_opcode(*cbuf, 0x0F ); |
| emit_opcode(*cbuf, 0x10 ); |
| emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? |
| tty->print("MOVSD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); |
| } else { |
| tty->print("MOVSS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); |
| } |
| #endif |
| } |
| return size+4; |
| } |
| } |
| |
| static int impl_mov_helper( CodeBuffer *cbuf, bool do_size, int src, int dst, int size ) { |
| if( cbuf ) { |
| emit_opcode(*cbuf, 0x8B ); |
| emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst], Matcher::_regEncode[src] ); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| tty->print("MOV %s,%s",Matcher::regName[dst],Matcher::regName[src]); |
| #endif |
| } |
| return size+2; |
| } |
| |
| static int impl_fp_store_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int src_hi, int dst_lo, int dst_hi, int offset, int size ) { |
| if( src_lo != FPR1L_num ) { // Move value to top of FP stack, if not already there |
| if( cbuf ) { |
| emit_opcode( *cbuf, 0xD9 ); // FLD (i.e., push it) |
| emit_d8( *cbuf, 0xC0-1+Matcher::_regEncode[src_lo] ); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) tty->print("\n\t"); |
| tty->print("FLD %s",Matcher::regName[src_lo]); |
| #endif |
| } |
| size += 2; |
| } |
| |
| int st_op = (src_lo != FPR1L_num) ? EBX_num /*store & pop*/ : EDX_num /*store no pop*/; |
| const char *op_str; |
| int op; |
| if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double store? |
| op_str = (src_lo != FPR1L_num) ? "FSTP_D" : "FST_D "; |
| op = 0xDD; |
| } else { // 32-bit store |
| op_str = (src_lo != FPR1L_num) ? "FSTP_S" : "FST_S "; |
| op = 0xD9; |
| assert( !OptoReg::is_valid(src_hi) && !OptoReg::is_valid(dst_hi), "no non-adjacent float-stores" ); |
| } |
| |
| return impl_helper(cbuf,do_size,false,offset,st_op,op,op_str,size); |
| } |
| |
| uint MachSpillCopyNode::implementation( CodeBuffer *cbuf, PhaseRegAlloc *ra_, bool do_size, outputStream* st ) const { |
| // Get registers to move |
| OptoReg::Name src_second = ra_->get_reg_second(in(1)); |
| OptoReg::Name src_first = ra_->get_reg_first(in(1)); |
| OptoReg::Name dst_second = ra_->get_reg_second(this ); |
| OptoReg::Name dst_first = ra_->get_reg_first(this ); |
| |
| enum RC src_second_rc = rc_class(src_second); |
| enum RC src_first_rc = rc_class(src_first); |
| enum RC dst_second_rc = rc_class(dst_second); |
| enum RC dst_first_rc = rc_class(dst_first); |
| |
| assert( OptoReg::is_valid(src_first) && OptoReg::is_valid(dst_first), "must move at least 1 register" ); |
| |
| // Generate spill code! |
| int size = 0; |
| |
| if( src_first == dst_first && src_second == dst_second ) |
| return size; // Self copy, no move |
| |
| // -------------------------------------- |
| // Check for mem-mem move. push/pop to move. |
| if( src_first_rc == rc_stack && dst_first_rc == rc_stack ) { |
| if( src_second == dst_first ) { // overlapping stack copy ranges |
| assert( src_second_rc == rc_stack && dst_second_rc == rc_stack, "we only expect a stk-stk copy here" ); |
| size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); |
| size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); |
| src_second_rc = dst_second_rc = rc_bad; // flag as already moved the second bits |
| } |
| // move low bits |
| size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),ESI_num,0xFF,"PUSH ",size); |
| size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),EAX_num,0x8F,"POP ",size); |
| if( src_second_rc == rc_stack && dst_second_rc == rc_stack ) { // mov second bits |
| size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); |
| size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); |
| } |
| return size; |
| } |
| |
| // -------------------------------------- |
| // Check for integer reg-reg copy |
| if( src_first_rc == rc_int && dst_first_rc == rc_int ) |
| size = impl_mov_helper(cbuf,do_size,src_first,dst_first,size); |
| |
| // Check for integer store |
| if( src_first_rc == rc_int && dst_first_rc == rc_stack ) |
| size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first,0x89,"MOV ",size); |
| |
| // Check for integer load |
| if( dst_first_rc == rc_int && src_first_rc == rc_stack ) |
| size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first,0x8B,"MOV ",size); |
| |
| // -------------------------------------- |
| // Check for float reg-reg copy |
| if( src_first_rc == rc_float && dst_first_rc == rc_float ) { |
| assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || |
| (src_first+1 == src_second && dst_first+1 == dst_second), "no non-adjacent float-moves" ); |
| if( cbuf ) { |
| |
| // Note the mucking with the register encode to compensate for the 0/1 |
| // indexing issue mentioned in a comment in the reg_def sections |
| // for FPR registers many lines above here. |
| |
| if( src_first != FPR1L_num ) { |
| emit_opcode (*cbuf, 0xD9 ); // FLD ST(i) |
| emit_d8 (*cbuf, 0xC0+Matcher::_regEncode[src_first]-1 ); |
| emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) |
| emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); |
| } else { |
| emit_opcode (*cbuf, 0xDD ); // FST ST(i) |
| emit_d8 (*cbuf, 0xD0+Matcher::_regEncode[dst_first]-1 ); |
| } |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) st->print("\n\t"); |
| if( src_first != FPR1L_num ) st->print("FLD %s\n\tFSTP %s",Matcher::regName[src_first],Matcher::regName[dst_first]); |
| else st->print( "FST %s", Matcher::regName[dst_first]); |
| #endif |
| } |
| return size + ((src_first != FPR1L_num) ? 2+2 : 2); |
| } |
| |
| // Check for float store |
| if( src_first_rc == rc_float && dst_first_rc == rc_stack ) { |
| return impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,ra_->reg2offset(dst_first),size); |
| } |
| |
| // Check for float load |
| if( dst_first_rc == rc_float && src_first_rc == rc_stack ) { |
| int offset = ra_->reg2offset(src_first); |
| const char *op_str; |
| int op; |
| if( src_first+1 == src_second && dst_first+1 == dst_second ) { // double load? |
| op_str = "FLD_D"; |
| op = 0xDD; |
| } else { // 32-bit load |
| op_str = "FLD_S"; |
| op = 0xD9; |
| assert( src_second_rc == rc_bad && dst_second_rc == rc_bad, "no non-adjacent float-loads" ); |
| } |
| if( cbuf ) { |
| emit_opcode (*cbuf, op ); |
| encode_RegMem(*cbuf, 0x0, ESP_enc, 0x4, 0, offset, false); |
| emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) |
| emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) st->print("\n\t"); |
| st->print("%s ST,[ESP + #%d]\n\tFSTP %s",op_str, offset,Matcher::regName[dst_first]); |
| #endif |
| } |
| int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); |
| return size + 3+offset_size+2; |
| } |
| |
| // Check for xmm reg-reg copy |
| if( src_first_rc == rc_xmm && dst_first_rc == rc_xmm ) { |
| assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || |
| (src_first+1 == src_second && dst_first+1 == dst_second), |
| "no non-adjacent float-moves" ); |
| return impl_movx_helper(cbuf,do_size,src_first,dst_first,src_second, dst_second, size); |
| } |
| |
| // Check for xmm store |
| if( src_first_rc == rc_xmm && dst_first_rc == rc_stack ) { |
| return impl_x_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first, src_second, size); |
| } |
| |
| // Check for float xmm load |
| if( dst_first_rc == rc_xmm && src_first_rc == rc_stack ) { |
| return impl_x_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first, dst_second, size); |
| } |
| |
| // Copy from float reg to xmm reg |
| if( dst_first_rc == rc_xmm && src_first_rc == rc_float ) { |
| // copy to the top of stack from floating point reg |
| // and use LEA to preserve flags |
| if( cbuf ) { |
| emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP-8] |
| emit_rm(*cbuf, 0x1, ESP_enc, 0x04); |
| emit_rm(*cbuf, 0x0, 0x04, ESP_enc); |
| emit_d8(*cbuf,0xF8); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) st->print("\n\t"); |
| st->print("LEA ESP,[ESP-8]"); |
| #endif |
| } |
| size += 4; |
| |
| size = impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,0,size); |
| |
| // Copy from the temp memory to the xmm reg. |
| size = impl_x_helper(cbuf,do_size,true ,0,dst_first, dst_second, size); |
| |
| if( cbuf ) { |
| emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP+8] |
| emit_rm(*cbuf, 0x1, ESP_enc, 0x04); |
| emit_rm(*cbuf, 0x0, 0x04, ESP_enc); |
| emit_d8(*cbuf,0x08); |
| #ifndef PRODUCT |
| } else if( !do_size ) { |
| if( size != 0 ) st->print("\n\t"); |
| st->print("LEA ESP,[ESP+8]"); |
| #endif |
| } |
| size += 4; |
| return size; |
| } |
| |
| assert( size > 0, "missed a case" ); |
| |
| // -------------------------------------------------------------------- |
| // Check for second bits still needing moving. |
| if( src_second == dst_second ) |
| return size; // Self copy; no move |
| assert( src_second_rc != rc_bad && dst_second_rc != rc_bad, "src_second & dst_second cannot be Bad" ); |
| |
| // Check for second word int-int move |
| if( src_second_rc == rc_int && dst_second_rc == rc_int ) |
| return impl_mov_helper(cbuf,do_size,src_second,dst_second,size); |
| |
| // Check for second word integer store |
| if( src_second_rc == rc_int && dst_second_rc == rc_stack ) |
| return impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),src_second,0x89,"MOV ",size); |
| |
| // Check for second word integer load |
| if( dst_second_rc == rc_int && src_second_rc == rc_stack ) |
| return impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),dst_second,0x8B,"MOV ",size); |
| |
| |
| Unimplemented(); |
| } |
| |
| #ifndef PRODUCT |
| void MachSpillCopyNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { |
| implementation( NULL, ra_, false, st ); |
| } |
| #endif |
| |
| void MachSpillCopyNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { |
| implementation( &cbuf, ra_, false, NULL ); |
| } |
| |
| uint MachSpillCopyNode::size(PhaseRegAlloc *ra_) const { |
| return implementation( NULL, ra_, true, NULL ); |
| } |
| |
| //============================================================================= |
| #ifndef PRODUCT |
| void MachNopNode::format( PhaseRegAlloc *, outputStream* st ) const { |
| st->print("NOP \t# %d bytes pad for loops and calls", _count); |
| } |
| #endif |
| |
| void MachNopNode::emit(CodeBuffer &cbuf, PhaseRegAlloc * ) const { |
| MacroAssembler _masm(&cbuf); |
| __ nop(_count); |
| } |
| |
| uint MachNopNode::size(PhaseRegAlloc *) const { |
| return _count; |
| } |
| |
| |
| //============================================================================= |
| #ifndef PRODUCT |
| void BoxLockNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { |
| int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); |
| int reg = ra_->get_reg_first(this); |
| st->print("LEA %s,[ESP + #%d]",Matcher::regName[reg],offset); |
| } |
| #endif |
| |
| void BoxLockNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { |
| int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); |
| int reg = ra_->get_encode(this); |
| if( offset >= 128 ) { |
| emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] |
| emit_rm(cbuf, 0x2, reg, 0x04); |
| emit_rm(cbuf, 0x0, 0x04, ESP_enc); |
| emit_d32(cbuf, offset); |
| } |
| else { |
| emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] |
| emit_rm(cbuf, 0x1, reg, 0x04); |
| emit_rm(cbuf, 0x0, 0x04, ESP_enc); |
| emit_d8(cbuf, offset); |
| } |
| } |
| |
| uint BoxLockNode::size(PhaseRegAlloc *ra_) const { |
| int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); |
| if( offset >= 128 ) { |
| return 7; |
| } |
| else { |
| return 4; |
| } |
| } |
| |
| //============================================================================= |
| |
| // emit call stub, compiled java to interpreter |
| void emit_java_to_interp(CodeBuffer &cbuf ) { |
| // Stub is fixed up when the corresponding call is converted from calling |
| // compiled code to calling interpreted code. |
| // mov rbx,0 |
| // jmp -1 |
| |
| address mark = cbuf.inst_mark(); // get mark within main instrs section |
| |
| // Note that the code buffer's inst_mark is always relative to insts. |
| // That's why we must use the macroassembler to generate a stub. |
| MacroAssembler _masm(&cbuf); |
| |
| address base = |
| __ start_a_stub(Compile::MAX_stubs_size); |
| if (base == NULL) return; // CodeBuffer::expand failed |
| // static stub relocation stores the instruction address of the call |
| __ relocate(static_stub_Relocation::spec(mark), RELOC_IMM32); |
| // static stub relocation also tags the methodOop in the code-stream. |
| __ movoop(rbx, (jobject)NULL); // method is zapped till fixup time |
| __ jump(RuntimeAddress((address)-1)); |
| |
| __ end_a_stub(); |
| // Update current stubs pointer and restore code_end. |
| } |
| // size of call stub, compiled java to interpretor |
| uint size_java_to_interp() { |
| return 10; // movl; jmp |
| } |
| // relocation entries for call stub, compiled java to interpretor |
| uint reloc_java_to_interp() { |
| return 4; // 3 in emit_java_to_interp + 1 in Java_Static_Call |
| } |
| |
| //============================================================================= |
| #ifndef PRODUCT |
| void MachUEPNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { |
| st->print_cr( "CMP EAX,[ECX+4]\t# Inline cache check"); |
| st->print_cr("\tJNE SharedRuntime::handle_ic_miss_stub"); |
| st->print_cr("\tNOP"); |
| st->print_cr("\tNOP"); |
| if( !OptoBreakpoint ) |
| st->print_cr("\tNOP"); |
| } |
| #endif |
| |
| void MachUEPNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { |
| MacroAssembler masm(&cbuf); |
| #ifdef ASSERT |
| uint code_size = cbuf.code_size(); |
| #endif |
| masm.cmpl(rax, Address(rcx, oopDesc::klass_offset_in_bytes())); |
| masm.jump_cc(Assembler::notEqual, |
| RuntimeAddress(SharedRuntime::get_ic_miss_stub())); |
| /* WARNING these NOPs are critical so that verified entry point is properly |
| aligned for patching by NativeJump::patch_verified_entry() */ |
| int nops_cnt = 2; |
| if( !OptoBreakpoint ) // Leave space for int3 |
| nops_cnt += 1; |
| masm.nop(nops_cnt); |
| |
| assert(cbuf.code_size() - code_size == size(ra_), "checking code size of inline cache node"); |
| } |
| |
| uint MachUEPNode::size(PhaseRegAlloc *ra_) const { |
| return OptoBreakpoint ? 11 : 12; |
| } |
| |
| |
| //============================================================================= |
| uint size_exception_handler() { |
| // NativeCall instruction size is the same as NativeJump. |
| // exception handler starts out as jump and can be patched to |
| // a call be deoptimization. (4932387) |
| // Note that this value is also credited (in output.cpp) to |
| // the size of the code section. |
| return NativeJump::instruction_size; |
| } |
| |
| // Emit exception handler code. Stuff framesize into a register |
| // and call a VM stub routine. |
| int emit_exception_handler(CodeBuffer& cbuf) { |
| |
| // Note that the code buffer's inst_mark is always relative to insts. |
| // That's why we must use the macroassembler to generate a handler. |
| MacroAssembler _masm(&cbuf); |
| address base = |
| __ start_a_stub(size_exception_handler()); |
| if (base == NULL) return 0; // CodeBuffer::expand failed |
| int offset = __ offset(); |
| __ jump(RuntimeAddress(OptoRuntime::exception_blob()->instructions_begin())); |
| assert(__ offset() - offset <= (int) size_exception_handler(), "overflow"); |
| __ end_a_stub(); |
| return offset; |
| } |
| |
| uint size_deopt_handler() { |
| // NativeCall instruction size is the same as NativeJump. |
| // exception handler starts out as jump and can be patched to |
| // a call be deoptimization. (4932387) |
| // Note that this value is also credited (in output.cpp) to |
| // the size of the code section. |
| return 5 + NativeJump::instruction_size; // pushl(); jmp; |
| } |
| |
| // Emit deopt handler code. |
| int emit_deopt_handler(CodeBuffer& cbuf) { |
| |
| // Note that the code buffer's inst_mark is always relative to insts. |
| // That's why we must use the macroassembler to generate a handler. |
| MacroAssembler _masm(&cbuf); |
| address base = |
| __ start_a_stub(size_exception_handler()); |
| if (base == NULL) return 0; // CodeBuffer::expand failed |
| int offset = __ offset(); |
| InternalAddress here(__ pc()); |
| __ pushptr(here.addr()); |
| |
| __ jump(RuntimeAddress(SharedRuntime::deopt_blob()->unpack())); |
| assert(__ offset() - offset <= (int) size_deopt_handler(), "overflow"); |
| __ end_a_stub(); |
| return offset; |
| } |
| |
| |
| static void emit_double_constant(CodeBuffer& cbuf, double x) { |
| int mark = cbuf.insts()->mark_off(); |
| MacroAssembler _masm(&cbuf); |
| address double_address = __ double_constant(x); |
| cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift |
| emit_d32_reloc(cbuf, |
| (int)double_address, |
| internal_word_Relocation::spec(double_address), |
| RELOC_DISP32); |
| } |
| |
| static void emit_float_constant(CodeBuffer& cbuf, float x) { |
| int mark = cbuf.insts()->mark_off(); |
| MacroAssembler _masm(&cbuf); |
| address float_address = __ float_constant(x); |
| cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift |
| emit_d32_reloc(cbuf, |
| (int)float_address, |
| internal_word_Relocation::spec(float_address), |
| RELOC_DISP32); |
| } |
| |
| |
| int Matcher::regnum_to_fpu_offset(int regnum) { |
| return regnum - 32; // The FP registers are in the second chunk |
| } |
| |
| bool is_positive_zero_float(jfloat f) { |
| return jint_cast(f) == jint_cast(0.0F); |
| } |
| |
| bool is_positive_one_float(jfloat f) { |
| return jint_cast(f) == jint_cast(1.0F); |
| } |
| |
| bool is_positive_zero_double(jdouble d) { |
| return jlong_cast(d) == jlong_cast(0.0); |
| } |
| |
| bool is_positive_one_double(jdouble d) { |
| return jlong_cast(d) == jlong_cast(1.0); |
| } |
| |
| // This is UltraSparc specific, true just means we have fast l2f conversion |
| const bool Matcher::convL2FSupported(void) { |
| return true; |
| } |
| |
| // Vector width in bytes |
| const uint Matcher::vector_width_in_bytes(void) { |
| return UseSSE >= 2 ? 8 : 0; |
| } |
| |
| // Vector ideal reg |
| const uint Matcher::vector_ideal_reg(void) { |
| return Op_RegD; |
| } |
| |
| // Is this branch offset short enough that a short branch can be used? |
| // |
| // NOTE: If the platform does not provide any short branch variants, then |
| // this method should return false for offset 0. |
| bool Matcher::is_short_branch_offset(int offset) { |
| return (-128 <= offset && offset <= 127); |
| } |
| |
| const bool Matcher::isSimpleConstant64(jlong value) { |
| // Will one (StoreL ConL) be cheaper than two (StoreI ConI)?. |
| return false; |
| } |
| |
| // The ecx parameter to rep stos for the ClearArray node is in dwords. |
| const bool Matcher::init_array_count_is_in_bytes = false; |
| |
| // Threshold size for cleararray. |
| const int Matcher::init_array_short_size = 8 * BytesPerLong; |
| |
| // Should the Matcher clone shifts on addressing modes, expecting them to |
| // be subsumed into complex addressing expressions or compute them into |
| // registers? True for Intel but false for most RISCs |
| const bool Matcher::clone_shift_expressions = true; |
| |
| // Is it better to copy float constants, or load them directly from memory? |
| // Intel can load a float constant from a direct address, requiring no |
| // extra registers. Most RISCs will have to materialize an address into a |
| // register first, so they would do better to copy the constant from stack. |
| const bool Matcher::rematerialize_float_constants = true; |
| |
| // If CPU can load and store mis-aligned doubles directly then no fixup is |
| // needed. Else we split the double into 2 integer pieces and move it |
| // piece-by-piece. Only happens when passing doubles into C code as the |
| // Java calling convention forces doubles to be aligned. |
| const bool Matcher::misaligned_doubles_ok = true; |
| |
| |
| void Matcher::pd_implicit_null_fixup(MachNode *node, uint idx) { |
| // Get the memory operand from the node |
| uint numopnds = node->num_opnds(); // Virtual call for number of operands |
| uint skipped = node->oper_input_base(); // Sum of leaves skipped so far |
| assert( idx >= skipped, "idx too low in pd_implicit_null_fixup" ); |
| uint opcnt = 1; // First operand |
| uint num_edges = node->_opnds[1]->num_edges(); // leaves for first operand |
| while( idx >= skipped+num_edges ) { |
| skipped += num_edges; |
| opcnt++; // Bump operand count |
| assert( opcnt < numopnds, "Accessing non-existent operand" ); |
| num_edges = node->_opnds[opcnt]->num_edges(); // leaves for next operand |
| } |
| |
| MachOper *memory = node->_opnds[opcnt]; |
| MachOper *new_memory = NULL; |
| switch (memory->opcode()) { |
| case DIRECT: |
| case INDOFFSET32X: |
| // No transformation necessary. |
| return; |
| case INDIRECT: |
| new_memory = new (C) indirect_win95_safeOper( ); |
| break; |
| case INDOFFSET8: |
| new_memory = new (C) indOffset8_win95_safeOper(memory->disp(NULL, NULL, 0)); |
| break; |
| case INDOFFSET32: |
| new_memory = new (C) indOffset32_win95_safeOper(memory->disp(NULL, NULL, 0)); |
| break; |
| case INDINDEXOFFSET: |
| new_memory = new (C) indIndexOffset_win95_safeOper(memory->disp(NULL, NULL, 0)); |
| break; |
| case INDINDEXSCALE: |
| new_memory = new (C) indIndexScale_win95_safeOper(memory->scale()); |
| break; |
| case INDINDEXSCALEOFFSET: |
| new_memory = new (C) indIndexScaleOffset_win95_safeOper(memory->scale(), memory->disp(NULL, NULL, 0)); |
| break; |
| case LOAD_LONG_INDIRECT: |
| case LOAD_LONG_INDOFFSET32: |
| // Does not use EBP as address register, use { EDX, EBX, EDI, ESI} |
| return; |
| default: |
| assert(false, "unexpected memory operand in pd_implicit_null_fixup()"); |
| return; |
| } |
| node->_opnds[opcnt] = new_memory; |
| } |
| |
| // Advertise here if the CPU requires explicit rounding operations |
| // to implement the UseStrictFP mode. |
| const bool Matcher::strict_fp_requires_explicit_rounding = true; |
| |
| // Do floats take an entire double register or just half? |
| const bool Matcher::float_in_double = true; |
| // Do ints take an entire long register or just half? |
| const bool Matcher::int_in_long = false; |
| |
| // Return whether or not this register is ever used as an argument. This |
| // function is used on startup to build the trampoline stubs in generateOptoStub. |
| // Registers not mentioned will be killed by the VM call in the trampoline, and |
| // arguments in those registers not be available to the callee. |
| bool Matcher::can_be_java_arg( int reg ) { |
| if( reg == ECX_num || reg == EDX_num ) return true; |
| if( (reg == XMM0a_num || reg == XMM1a_num) && UseSSE>=1 ) return true; |
| if( (reg == XMM0b_num || reg == XMM1b_num) && UseSSE>=2 ) return true; |
| return false; |
| } |
| |
| bool Matcher::is_spillable_arg( int reg ) { |
| return can_be_java_arg(reg); |
| } |
| |
| // Register for DIVI projection of divmodI |
| RegMask Matcher::divI_proj_mask() { |
| return EAX_REG_mask; |
| } |
| |
| // Register for MODI projection of divmodI |
| RegMask Matcher::modI_proj_mask() { |
| return EDX_REG_mask; |
| } |
| |
| // Register for DIVL projection of divmodL |
| RegMask Matcher::divL_proj_mask() { |
| ShouldNotReachHere(); |
| return RegMask(); |
| } |
| |
| // Register for MODL projection of divmodL |
| RegMask Matcher::modL_proj_mask() { |
| ShouldNotReachHere(); |
| return RegMask(); |
| } |
| |
| %} |
| |
| //----------ENCODING BLOCK----------------------------------------------------- |
| // This block specifies the encoding classes used by the compiler to output |
| // byte streams. Encoding classes generate functions which are called by |
| // Machine Instruction Nodes in order to generate the bit encoding of the |
| // instruction. Operands specify their base encoding interface with the |
| // interface keyword. There are currently supported four interfaces, |
| // REG_INTER, CONST_INTER, MEMORY_INTER, & COND_INTER. REG_INTER causes an |
| // operand to generate a function which returns its register number when |
| // queried. CONST_INTER causes an operand to generate a function which |
| // returns the value of the constant when queried. MEMORY_INTER causes an |
| // operand to generate four functions which return the Base Register, the |
| // Index Register, the Scale Value, and the Offset Value of the operand when |
| // queried. COND_INTER causes an operand to generate six functions which |
| // return the encoding code (ie - encoding bits for the instruction) |
| // associated with each basic boolean condition for a conditional instruction. |
| // Instructions specify two basic values for encoding. They use the |
| // ins_encode keyword to specify their encoding class (which must be one of |
| // the class names specified in the encoding block), and they use the |
| // opcode keyword to specify, in order, their primary, secondary, and |
| // tertiary opcode. Only the opcode sections which a particular instruction |
| // needs for encoding need to be specified. |
| encode %{ |
| // Build emit functions for each basic byte or larger field in the intel |
| // encoding scheme (opcode, rm, sib, immediate), and call them from C++ |
| // code in the enc_class source block. Emit functions will live in the |
| // main source block for now. In future, we can generalize this by |
| // adding a syntax that specifies the sizes of fields in an order, |
| // so that the adlc can build the emit functions automagically |
| enc_class OpcP %{ // Emit opcode |
| emit_opcode(cbuf,$primary); |
| %} |
| |
| enc_class OpcS %{ // Emit opcode |
| emit_opcode(cbuf,$secondary); |
| %} |
| |
| enc_class Opcode(immI d8 ) %{ // Emit opcode |
| emit_opcode(cbuf,$d8$$constant); |
| %} |
| |
| enc_class SizePrefix %{ |
| emit_opcode(cbuf,0x66); |
| %} |
| |
| enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class OpcRegReg (immI opcode, eRegI dst, eRegI src) %{ // OpcRegReg(Many) |
| emit_opcode(cbuf,$opcode$$constant); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class mov_r32_imm0( eRegI dst ) %{ |
| emit_opcode( cbuf, 0xB8 + $dst$$reg ); // 0xB8+ rd -- MOV r32 ,imm32 |
| emit_d32 ( cbuf, 0x0 ); // imm32==0x0 |
| %} |
| |
| enc_class cdq_enc %{ |
| // Full implementation of Java idiv and irem; checks for |
| // special case as described in JVM spec., p.243 & p.271. |
| // |
| // normal case special case |
| // |
| // input : rax,: dividend min_int |
| // reg: divisor -1 |
| // |
| // output: rax,: quotient (= rax, idiv reg) min_int |
| // rdx: remainder (= rax, irem reg) 0 |
| // |
| // Code sequnce: |
| // |
| // 81 F8 00 00 00 80 cmp rax,80000000h |
| // 0F 85 0B 00 00 00 jne normal_case |
| // 33 D2 xor rdx,edx |
| // 83 F9 FF cmp rcx,0FFh |
| // 0F 84 03 00 00 00 je done |
| // normal_case: |
| // 99 cdq |
| // F7 F9 idiv rax,ecx |
| // done: |
| // |
| emit_opcode(cbuf,0x81); emit_d8(cbuf,0xF8); |
| emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); |
| emit_opcode(cbuf,0x00); emit_d8(cbuf,0x80); // cmp rax,80000000h |
| emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x85); |
| emit_opcode(cbuf,0x0B); emit_d8(cbuf,0x00); |
| emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // jne normal_case |
| emit_opcode(cbuf,0x33); emit_d8(cbuf,0xD2); // xor rdx,edx |
| emit_opcode(cbuf,0x83); emit_d8(cbuf,0xF9); emit_d8(cbuf,0xFF); // cmp rcx,0FFh |
| emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x84); |
| emit_opcode(cbuf,0x03); emit_d8(cbuf,0x00); |
| emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // je done |
| // normal_case: |
| emit_opcode(cbuf,0x99); // cdq |
| // idiv (note: must be emitted by the user of this rule) |
| // normal: |
| %} |
| |
| // Dense encoding for older common ops |
| enc_class Opc_plus(immI opcode, eRegI reg) %{ |
| emit_opcode(cbuf, $opcode$$constant + $reg$$reg); |
| %} |
| |
| |
| // Opcde enc_class for 8/32 bit immediate instructions with sign-extension |
| enc_class OpcSE (immI imm) %{ // Emit primary opcode and set sign-extend bit |
| // Check for 8-bit immediate, and set sign extend bit in opcode |
| if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { |
| emit_opcode(cbuf, $primary | 0x02); |
| } |
| else { // If 32-bit immediate |
| emit_opcode(cbuf, $primary); |
| } |
| %} |
| |
| enc_class OpcSErm (eRegI dst, immI imm) %{ // OpcSEr/m |
| // Emit primary opcode and set sign-extend bit |
| // Check for 8-bit immediate, and set sign extend bit in opcode |
| if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { |
| emit_opcode(cbuf, $primary | 0x02); } |
| else { // If 32-bit immediate |
| emit_opcode(cbuf, $primary); |
| } |
| // Emit r/m byte with secondary opcode, after primary opcode. |
| emit_rm(cbuf, 0x3, $secondary, $dst$$reg); |
| %} |
| |
| enc_class Con8or32 (immI imm) %{ // Con8or32(storeImmI), 8 or 32 bits |
| // Check for 8-bit immediate, and set sign extend bit in opcode |
| if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { |
| $$$emit8$imm$$constant; |
| } |
| else { // If 32-bit immediate |
| // Output immediate |
| $$$emit32$imm$$constant; |
| } |
| %} |
| |
| enc_class Long_OpcSErm_Lo(eRegL dst, immL imm) %{ |
| // Emit primary opcode and set sign-extend bit |
| // Check for 8-bit immediate, and set sign extend bit in opcode |
| int con = (int)$imm$$constant; // Throw away top bits |
| emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); |
| // Emit r/m byte with secondary opcode, after primary opcode. |
| emit_rm(cbuf, 0x3, $secondary, $dst$$reg); |
| if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); |
| else emit_d32(cbuf,con); |
| %} |
| |
| enc_class Long_OpcSErm_Hi(eRegL dst, immL imm) %{ |
| // Emit primary opcode and set sign-extend bit |
| // Check for 8-bit immediate, and set sign extend bit in opcode |
| int con = (int)($imm$$constant >> 32); // Throw away bottom bits |
| emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); |
| // Emit r/m byte with tertiary opcode, after primary opcode. |
| emit_rm(cbuf, 0x3, $tertiary, HIGH_FROM_LOW($dst$$reg)); |
| if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); |
| else emit_d32(cbuf,con); |
| %} |
| |
| enc_class Lbl (label labl) %{ // JMP, CALL |
| Label *l = $labl$$label; |
| emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); |
| %} |
| |
| enc_class LblShort (label labl) %{ // JMP, CALL |
| Label *l = $labl$$label; |
| int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; |
| assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); |
| emit_d8(cbuf, disp); |
| %} |
| |
| enc_class OpcSReg (eRegI dst) %{ // BSWAP |
| emit_cc(cbuf, $secondary, $dst$$reg ); |
| %} |
| |
| enc_class bswap_long_bytes(eRegL dst) %{ // BSWAP |
| int destlo = $dst$$reg; |
| int desthi = HIGH_FROM_LOW(destlo); |
| // bswap lo |
| emit_opcode(cbuf, 0x0F); |
| emit_cc(cbuf, 0xC8, destlo); |
| // bswap hi |
| emit_opcode(cbuf, 0x0F); |
| emit_cc(cbuf, 0xC8, desthi); |
| // xchg lo and hi |
| emit_opcode(cbuf, 0x87); |
| emit_rm(cbuf, 0x3, destlo, desthi); |
| %} |
| |
| enc_class RegOpc (eRegI div) %{ // IDIV, IMOD, JMP indirect, ... |
| emit_rm(cbuf, 0x3, $secondary, $div$$reg ); |
| %} |
| |
| enc_class Jcc (cmpOp cop, label labl) %{ // JCC |
| Label *l = $labl$$label; |
| $$$emit8$primary; |
| emit_cc(cbuf, $secondary, $cop$$cmpcode); |
| emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); |
| %} |
| |
| enc_class JccShort (cmpOp cop, label labl) %{ // JCC |
| Label *l = $labl$$label; |
| emit_cc(cbuf, $primary, $cop$$cmpcode); |
| int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; |
| assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); |
| emit_d8(cbuf, disp); |
| %} |
| |
| enc_class enc_cmov(cmpOp cop ) %{ // CMOV |
| $$$emit8$primary; |
| emit_cc(cbuf, $secondary, $cop$$cmpcode); |
| %} |
| |
| enc_class enc_cmov_d(cmpOp cop, regD src ) %{ // CMOV |
| int op = 0xDA00 + $cop$$cmpcode + ($src$$reg-1); |
| emit_d8(cbuf, op >> 8 ); |
| emit_d8(cbuf, op & 255); |
| %} |
| |
| // emulate a CMOV with a conditional branch around a MOV |
| enc_class enc_cmov_branch( cmpOp cop, immI brOffs ) %{ // CMOV |
| // Invert sense of branch from sense of CMOV |
| emit_cc( cbuf, 0x70, ($cop$$cmpcode^1) ); |
| emit_d8( cbuf, $brOffs$$constant ); |
| %} |
| |
| enc_class enc_PartialSubtypeCheck( ) %{ |
| Register Redi = as_Register(EDI_enc); // result register |
| Register Reax = as_Register(EAX_enc); // super class |
| Register Recx = as_Register(ECX_enc); // killed |
| Register Resi = as_Register(ESI_enc); // sub class |
| Label hit, miss; |
| |
| MacroAssembler _masm(&cbuf); |
| // Compare super with sub directly, since super is not in its own SSA. |
| // The compiler used to emit this test, but we fold it in here, |
| // to allow platform-specific tweaking on sparc. |
| __ cmpl(Reax, Resi); |
| __ jcc(Assembler::equal, hit); |
| #ifndef PRODUCT |
| __ increment(ExternalAddress((address)&SharedRuntime::_partial_subtype_ctr)); |
| #endif //PRODUCT |
| __ movl(Redi,Address(Resi,sizeof(oopDesc) + Klass::secondary_supers_offset_in_bytes())); |
| __ movl(Recx,Address(Redi,arrayOopDesc::length_offset_in_bytes())); |
| __ addl(Redi,arrayOopDesc::base_offset_in_bytes(T_OBJECT)); |
| __ repne_scan(); |
| __ jcc(Assembler::notEqual, miss); |
| __ movl(Address(Resi,sizeof(oopDesc) + Klass::secondary_super_cache_offset_in_bytes()),Reax); |
| __ bind(hit); |
| if( $primary ) |
| __ xorl(Redi,Redi); |
| __ bind(miss); |
| %} |
| |
| enc_class FFree_Float_Stack_All %{ // Free_Float_Stack_All |
| MacroAssembler masm(&cbuf); |
| int start = masm.offset(); |
| if (UseSSE >= 2) { |
| if (VerifyFPU) { |
| masm.verify_FPU(0, "must be empty in SSE2+ mode"); |
| } |
| } else { |
| // External c_calling_convention expects the FPU stack to be 'clean'. |
| // Compiled code leaves it dirty. Do cleanup now. |
| masm.empty_FPU_stack(); |
| } |
| if (sizeof_FFree_Float_Stack_All == -1) { |
| sizeof_FFree_Float_Stack_All = masm.offset() - start; |
| } else { |
| assert(masm.offset() - start == sizeof_FFree_Float_Stack_All, "wrong size"); |
| } |
| %} |
| |
| enc_class Verify_FPU_For_Leaf %{ |
| if( VerifyFPU ) { |
| MacroAssembler masm(&cbuf); |
| masm.verify_FPU( -3, "Returning from Runtime Leaf call"); |
| } |
| %} |
| |
| enc_class Java_To_Runtime (method meth) %{ // CALL Java_To_Runtime, Java_To_Runtime_Leaf |
| // This is the instruction starting address for relocation info. |
| cbuf.set_inst_mark(); |
| $$$emit8$primary; |
| // CALL directly to the runtime |
| emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), |
| runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| |
| if (UseSSE >= 2) { |
| MacroAssembler _masm(&cbuf); |
| BasicType rt = tf()->return_type(); |
| |
| if ((rt == T_FLOAT || rt == T_DOUBLE) && !return_value_is_used()) { |
| // A C runtime call where the return value is unused. In SSE2+ |
| // mode the result needs to be removed from the FPU stack. It's |
| // likely that this function call could be removed by the |
| // optimizer if the C function is a pure function. |
| __ ffree(0); |
| } else if (rt == T_FLOAT) { |
| __ leal(rsp, Address(rsp, -4)); |
| __ fstp_s(Address(rsp, 0)); |
| __ movflt(xmm0, Address(rsp, 0)); |
| __ leal(rsp, Address(rsp, 4)); |
| } else if (rt == T_DOUBLE) { |
| __ leal(rsp, Address(rsp, -8)); |
| __ fstp_d(Address(rsp, 0)); |
| __ movdbl(xmm0, Address(rsp, 0)); |
| __ leal(rsp, Address(rsp, 8)); |
| } |
| } |
| %} |
| |
| |
| enc_class pre_call_FPU %{ |
| // If method sets FPU control word restore it here |
| if( Compile::current()->in_24_bit_fp_mode() ) { |
| MacroAssembler masm(&cbuf); |
| masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); |
| } |
| %} |
| |
| enc_class post_call_FPU %{ |
| // If method sets FPU control word do it here also |
| if( Compile::current()->in_24_bit_fp_mode() ) { |
| MacroAssembler masm(&cbuf); |
| masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); |
| } |
| %} |
| |
| enc_class Java_Static_Call (method meth) %{ // JAVA STATIC CALL |
| // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine |
| // who we intended to call. |
| cbuf.set_inst_mark(); |
| $$$emit8$primary; |
| if ( !_method ) { |
| emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), |
| runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| } else if(_optimized_virtual) { |
| emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), |
| opt_virtual_call_Relocation::spec(), RELOC_IMM32 ); |
| } else { |
| emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), |
| static_call_Relocation::spec(), RELOC_IMM32 ); |
| } |
| if( _method ) { // Emit stub for static call |
| emit_java_to_interp(cbuf); |
| } |
| %} |
| |
| enc_class Java_Dynamic_Call (method meth) %{ // JAVA DYNAMIC CALL |
| // !!!!! |
| // Generate "Mov EAX,0x00", placeholder instruction to load oop-info |
| // emit_call_dynamic_prologue( cbuf ); |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf, 0xB8 + EAX_enc); // mov EAX,-1 |
| emit_d32_reloc(cbuf, (int)Universe::non_oop_word(), oop_Relocation::spec_for_immediate(), RELOC_IMM32); |
| address virtual_call_oop_addr = cbuf.inst_mark(); |
| // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine |
| // who we intended to call. |
| cbuf.set_inst_mark(); |
| $$$emit8$primary; |
| emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), |
| virtual_call_Relocation::spec(virtual_call_oop_addr), RELOC_IMM32 ); |
| %} |
| |
| enc_class Java_Compiled_Call (method meth) %{ // JAVA COMPILED CALL |
| int disp = in_bytes(methodOopDesc::from_compiled_offset()); |
| assert( -128 <= disp && disp <= 127, "compiled_code_offset isn't small"); |
| |
| // CALL *[EAX+in_bytes(methodOopDesc::from_compiled_code_entry_point_offset())] |
| cbuf.set_inst_mark(); |
| $$$emit8$primary; |
| emit_rm(cbuf, 0x01, $secondary, EAX_enc ); // R/M byte |
| emit_d8(cbuf, disp); // Displacement |
| |
| %} |
| |
| enc_class Xor_Reg (eRegI dst) %{ |
| emit_opcode(cbuf, 0x33); |
| emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); |
| %} |
| |
| // Following encoding is no longer used, but may be restored if calling |
| // convention changes significantly. |
| // Became: Xor_Reg(EBP), Java_To_Runtime( labl ) |
| // |
| // enc_class Java_Interpreter_Call (label labl) %{ // JAVA INTERPRETER CALL |
| // // int ic_reg = Matcher::inline_cache_reg(); |
| // // int ic_encode = Matcher::_regEncode[ic_reg]; |
| // // int imo_reg = Matcher::interpreter_method_oop_reg(); |
| // // int imo_encode = Matcher::_regEncode[imo_reg]; |
| // |
| // // // Interpreter expects method_oop in EBX, currently a callee-saved register, |
| // // // so we load it immediately before the call |
| // // emit_opcode(cbuf, 0x8B); // MOV imo_reg,ic_reg # method_oop |
| // // emit_rm(cbuf, 0x03, imo_encode, ic_encode ); // R/M byte |
| // |
| // // xor rbp,ebp |
| // emit_opcode(cbuf, 0x33); |
| // emit_rm(cbuf, 0x3, EBP_enc, EBP_enc); |
| // |
| // // CALL to interpreter. |
| // cbuf.set_inst_mark(); |
| // $$$emit8$primary; |
| // emit_d32_reloc(cbuf, ($labl$$label - (int)(cbuf.code_end()) - 4), |
| // runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // %} |
| |
| enc_class RegOpcImm (eRegI dst, immI8 shift) %{ // SHL, SAR, SHR |
| $$$emit8$primary; |
| emit_rm(cbuf, 0x3, $secondary, $dst$$reg); |
| $$$emit8$shift$$constant; |
| %} |
| |
| enc_class LdImmI (eRegI dst, immI src) %{ // Load Immediate |
| // Load immediate does not have a zero or sign extended version |
| // for 8-bit immediates |
| emit_opcode(cbuf, 0xB8 + $dst$$reg); |
| $$$emit32$src$$constant; |
| %} |
| |
| enc_class LdImmP (eRegI dst, immI src) %{ // Load Immediate |
| // Load immediate does not have a zero or sign extended version |
| // for 8-bit immediates |
| emit_opcode(cbuf, $primary + $dst$$reg); |
| $$$emit32$src$$constant; |
| %} |
| |
| enc_class LdImmL_Lo( eRegL dst, immL src) %{ // Load Immediate |
| // Load immediate does not have a zero or sign extended version |
| // for 8-bit immediates |
| int dst_enc = $dst$$reg; |
| int src_con = $src$$constant & 0x0FFFFFFFFL; |
| if (src_con == 0) { |
| // xor dst, dst |
| emit_opcode(cbuf, 0x33); |
| emit_rm(cbuf, 0x3, dst_enc, dst_enc); |
| } else { |
| emit_opcode(cbuf, $primary + dst_enc); |
| emit_d32(cbuf, src_con); |
| } |
| %} |
| |
| enc_class LdImmL_Hi( eRegL dst, immL src) %{ // Load Immediate |
| // Load immediate does not have a zero or sign extended version |
| // for 8-bit immediates |
| int dst_enc = $dst$$reg + 2; |
| int src_con = ((julong)($src$$constant)) >> 32; |
| if (src_con == 0) { |
| // xor dst, dst |
| emit_opcode(cbuf, 0x33); |
| emit_rm(cbuf, 0x3, dst_enc, dst_enc); |
| } else { |
| emit_opcode(cbuf, $primary + dst_enc); |
| emit_d32(cbuf, src_con); |
| } |
| %} |
| |
| |
| enc_class LdImmD (immD src) %{ // Load Immediate |
| if( is_positive_zero_double($src$$constant)) { |
| // FLDZ |
| emit_opcode(cbuf,0xD9); |
| emit_opcode(cbuf,0xEE); |
| } else if( is_positive_one_double($src$$constant)) { |
| // FLD1 |
| emit_opcode(cbuf,0xD9); |
| emit_opcode(cbuf,0xE8); |
| } else { |
| emit_opcode(cbuf,0xDD); |
| emit_rm(cbuf, 0x0, 0x0, 0x5); |
| emit_double_constant(cbuf, $src$$constant); |
| } |
| %} |
| |
| |
| enc_class LdImmF (immF src) %{ // Load Immediate |
| if( is_positive_zero_float($src$$constant)) { |
| emit_opcode(cbuf,0xD9); |
| emit_opcode(cbuf,0xEE); |
| } else if( is_positive_one_float($src$$constant)) { |
| emit_opcode(cbuf,0xD9); |
| emit_opcode(cbuf,0xE8); |
| } else { |
| $$$emit8$primary; |
| // Load immediate does not have a zero or sign extended version |
| // for 8-bit immediates |
| // First load to TOS, then move to dst |
| emit_rm(cbuf, 0x0, 0x0, 0x5); |
| emit_float_constant(cbuf, $src$$constant); |
| } |
| %} |
| |
| enc_class LdImmX (regX dst, immXF con) %{ // Load Immediate |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_float_constant(cbuf, $con$$constant); |
| %} |
| |
| enc_class LdImmXD (regXD dst, immXD con) %{ // Load Immediate |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_double_constant(cbuf, $con$$constant); |
| %} |
| |
| enc_class load_conXD (regXD dst, immXD con) %{ // Load double constant |
| // UseXmmLoadAndClearUpper ? movsd(dst, con) : movlpd(dst, con) |
| emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); |
| emit_opcode(cbuf, 0x0F); |
| emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_double_constant(cbuf, $con$$constant); |
| %} |
| |
| enc_class Opc_MemImm_F(immF src) %{ |
| cbuf.set_inst_mark(); |
| $$$emit8$primary; |
| emit_rm(cbuf, 0x0, $secondary, 0x5); |
| emit_float_constant(cbuf, $src$$constant); |
| %} |
| |
| |
| enc_class MovI2X_reg(regX dst, eRegI src) %{ |
| emit_opcode(cbuf, 0x66 ); // MOVD dst,src |
| emit_opcode(cbuf, 0x0F ); |
| emit_opcode(cbuf, 0x6E ); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class MovX2I_reg(eRegI dst, regX src) %{ |
| emit_opcode(cbuf, 0x66 ); // MOVD dst,src |
| emit_opcode(cbuf, 0x0F ); |
| emit_opcode(cbuf, 0x7E ); |
| emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); |
| %} |
| |
| enc_class MovL2XD_reg(regXD dst, eRegL src, regXD tmp) %{ |
| { // MOVD $dst,$src.lo |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x6E); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| } |
| { // MOVD $tmp,$src.hi |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x6E); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); |
| } |
| { // PUNPCKLDQ $dst,$tmp |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x62); |
| emit_rm(cbuf, 0x3, $dst$$reg, $tmp$$reg); |
| } |
| %} |
| |
| enc_class MovXD2L_reg(eRegL dst, regXD src, regXD tmp) %{ |
| { // MOVD $dst.lo,$src |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x7E); |
| emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); |
| } |
| { // PSHUFLW $tmp,$src,0x4E (01001110b) |
| emit_opcode(cbuf,0xF2); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x70); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); |
| emit_d8(cbuf, 0x4E); |
| } |
| { // MOVD $dst.hi,$tmp |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x7E); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); |
| } |
| %} |
| |
| |
| // Encode a reg-reg copy. If it is useless, then empty encoding. |
| enc_class enc_Copy( eRegI dst, eRegI src ) %{ |
| encode_Copy( cbuf, $dst$$reg, $src$$reg ); |
| %} |
| |
| enc_class enc_CopyL_Lo( eRegI dst, eRegL src ) %{ |
| encode_Copy( cbuf, $dst$$reg, $src$$reg ); |
| %} |
| |
| // Encode xmm reg-reg copy. If it is useless, then empty encoding. |
| enc_class enc_CopyXD( RegXD dst, RegXD src ) %{ |
| encode_CopyXD( cbuf, $dst$$reg, $src$$reg ); |
| %} |
| |
| enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class RegReg_Lo(eRegL dst, eRegL src) %{ // RegReg(Many) |
| $$$emit8$primary; |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class RegReg_Hi(eRegL dst, eRegL src) %{ // RegReg(Many) |
| $$$emit8$secondary; |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); |
| %} |
| |
| enc_class RegReg_Lo2(eRegL dst, eRegL src) %{ // RegReg(Many) |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class RegReg_Hi2(eRegL dst, eRegL src) %{ // RegReg(Many) |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); |
| %} |
| |
| enc_class RegReg_HiLo( eRegL src, eRegI dst ) %{ |
| emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($src$$reg)); |
| %} |
| |
| enc_class Con32 (immI src) %{ // Con32(storeImmI) |
| // Output immediate |
| $$$emit32$src$$constant; |
| %} |
| |
| enc_class Con32F_as_bits(immF src) %{ // storeF_imm |
| // Output Float immediate bits |
| jfloat jf = $src$$constant; |
| int jf_as_bits = jint_cast( jf ); |
| emit_d32(cbuf, jf_as_bits); |
| %} |
| |
| enc_class Con32XF_as_bits(immXF src) %{ // storeX_imm |
| // Output Float immediate bits |
| jfloat jf = $src$$constant; |
| int jf_as_bits = jint_cast( jf ); |
| emit_d32(cbuf, jf_as_bits); |
| %} |
| |
| enc_class Con16 (immI src) %{ // Con16(storeImmI) |
| // Output immediate |
| $$$emit16$src$$constant; |
| %} |
| |
| enc_class Con_d32(immI src) %{ |
| emit_d32(cbuf,$src$$constant); |
| %} |
| |
| enc_class conmemref (eRegP t1) %{ // Con32(storeImmI) |
| // Output immediate memory reference |
| emit_rm(cbuf, 0x00, $t1$$reg, 0x05 ); |
| emit_d32(cbuf, 0x00); |
| %} |
| |
| enc_class lock_prefix( ) %{ |
| if( os::is_MP() ) |
| emit_opcode(cbuf,0xF0); // [Lock] |
| %} |
| |
| // Cmp-xchg long value. |
| // Note: we need to swap rbx, and rcx before and after the |
| // cmpxchg8 instruction because the instruction uses |
| // rcx as the high order word of the new value to store but |
| // our register encoding uses rbx,. |
| enc_class enc_cmpxchg8(eSIRegP mem_ptr) %{ |
| |
| // XCHG rbx,ecx |
| emit_opcode(cbuf,0x87); |
| emit_opcode(cbuf,0xD9); |
| // [Lock] |
| if( os::is_MP() ) |
| emit_opcode(cbuf,0xF0); |
| // CMPXCHG8 [Eptr] |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0xC7); |
| emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); |
| // XCHG rbx,ecx |
| emit_opcode(cbuf,0x87); |
| emit_opcode(cbuf,0xD9); |
| %} |
| |
| enc_class enc_cmpxchg(eSIRegP mem_ptr) %{ |
| // [Lock] |
| if( os::is_MP() ) |
| emit_opcode(cbuf,0xF0); |
| |
| // CMPXCHG [Eptr] |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0xB1); |
| emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); |
| %} |
| |
| enc_class enc_flags_ne_to_boolean( iRegI res ) %{ |
| int res_encoding = $res$$reg; |
| |
| // MOV res,0 |
| emit_opcode( cbuf, 0xB8 + res_encoding); |
| emit_d32( cbuf, 0 ); |
| // JNE,s fail |
| emit_opcode(cbuf,0x75); |
| emit_d8(cbuf, 5 ); |
| // MOV res,1 |
| emit_opcode( cbuf, 0xB8 + res_encoding); |
| emit_d32( cbuf, 1 ); |
| // fail: |
| %} |
| |
| enc_class set_instruction_start( ) %{ |
| cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand |
| %} |
| |
| enc_class RegMem (eRegI ereg, memory mem) %{ // emit_reg_mem |
| int reg_encoding = $ereg$$reg; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| enc_class RegMem_Hi(eRegL ereg, memory mem) %{ // emit_reg_mem |
| int reg_encoding = HIGH_FROM_LOW($ereg$$reg); // Hi register of pair, computed from lo |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp + 4; // Offset is 4 further in memory |
| assert( !$mem->disp_is_oop(), "Cannot add 4 to oop" ); |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, false/*disp_is_oop*/); |
| %} |
| |
| enc_class move_long_small_shift( eRegL dst, immI_1_31 cnt ) %{ |
| int r1, r2; |
| if( $tertiary == 0xA4 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } |
| else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,$tertiary); |
| emit_rm(cbuf, 0x3, r1, r2); |
| emit_d8(cbuf,$cnt$$constant); |
| emit_d8(cbuf,$primary); |
| emit_rm(cbuf, 0x3, $secondary, r1); |
| emit_d8(cbuf,$cnt$$constant); |
| %} |
| |
| enc_class move_long_big_shift_sign( eRegL dst, immI_32_63 cnt ) %{ |
| emit_opcode( cbuf, 0x8B ); // Move |
| emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); |
| emit_d8(cbuf,$primary); |
| emit_rm(cbuf, 0x3, $secondary, $dst$$reg); |
| emit_d8(cbuf,$cnt$$constant-32); |
| emit_d8(cbuf,$primary); |
| emit_rm(cbuf, 0x3, $secondary, HIGH_FROM_LOW($dst$$reg)); |
| emit_d8(cbuf,31); |
| %} |
| |
| enc_class move_long_big_shift_clr( eRegL dst, immI_32_63 cnt ) %{ |
| int r1, r2; |
| if( $secondary == 0x5 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } |
| else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } |
| |
| emit_opcode( cbuf, 0x8B ); // Move r1,r2 |
| emit_rm(cbuf, 0x3, r1, r2); |
| if( $cnt$$constant > 32 ) { // Shift, if not by zero |
| emit_opcode(cbuf,$primary); |
| emit_rm(cbuf, 0x3, $secondary, r1); |
| emit_d8(cbuf,$cnt$$constant-32); |
| } |
| emit_opcode(cbuf,0x33); // XOR r2,r2 |
| emit_rm(cbuf, 0x3, r2, r2); |
| %} |
| |
| // Clone of RegMem but accepts an extra parameter to access each |
| // half of a double in memory; it never needs relocation info. |
| enc_class Mov_MemD_half_to_Reg (immI opcode, memory mem, immI disp_for_half, eRegI rm_reg) %{ |
| emit_opcode(cbuf,$opcode$$constant); |
| int reg_encoding = $rm_reg$$reg; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp + $disp_for_half$$constant; |
| bool disp_is_oop = false; |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| // !!!!! Special Custom Code used by MemMove, and stack access instructions !!!!! |
| // |
| // Clone of RegMem except the RM-byte's reg/opcode field is an ADLC-time constant |
| // and it never needs relocation information. |
| // Frequently used to move data between FPU's Stack Top and memory. |
| enc_class RMopc_Mem_no_oop (immI rm_opcode, memory mem) %{ |
| int rm_byte_opcode = $rm_opcode$$constant; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| assert( !$mem->disp_is_oop(), "No oops here because no relo info allowed" ); |
| encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, false); |
| %} |
| |
| enc_class RMopc_Mem (immI rm_opcode, memory mem) %{ |
| int rm_byte_opcode = $rm_opcode$$constant; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| enc_class RegLea (eRegI dst, eRegI src0, immI src1 ) %{ // emit_reg_lea |
| int reg_encoding = $dst$$reg; |
| int base = $src0$$reg; // 0xFFFFFFFF indicates no base |
| int index = 0x04; // 0x04 indicates no index |
| int scale = 0x00; // 0x00 indicates no scale |
| int displace = $src1$$constant; // 0x00 indicates no displacement |
| bool disp_is_oop = false; |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| enc_class min_enc (eRegI dst, eRegI src) %{ // MIN |
| // Compare dst,src |
| emit_opcode(cbuf,0x3B); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| // jmp dst < src around move |
| emit_opcode(cbuf,0x7C); |
| emit_d8(cbuf,2); |
| // move dst,src |
| emit_opcode(cbuf,0x8B); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class max_enc (eRegI dst, eRegI src) %{ // MAX |
| // Compare dst,src |
| emit_opcode(cbuf,0x3B); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| // jmp dst > src around move |
| emit_opcode(cbuf,0x7F); |
| emit_d8(cbuf,2); |
| // move dst,src |
| emit_opcode(cbuf,0x8B); |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| %} |
| |
| enc_class enc_FP_store(memory mem, regD src) %{ |
| // If src is FPR1, we can just FST to store it. |
| // Else we need to FLD it to FPR1, then FSTP to store/pop it. |
| int reg_encoding = 0x2; // Just store |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| if( $src$$reg != FPR1L_enc ) { |
| reg_encoding = 0x3; // Store & pop |
| emit_opcode( cbuf, 0xD9 ); // FLD (i.e., push it) |
| emit_d8( cbuf, 0xC0-1+$src$$reg ); |
| } |
| cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand |
| emit_opcode(cbuf,$primary); |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| enc_class neg_reg(eRegI dst) %{ |
| // NEG $dst |
| emit_opcode(cbuf,0xF7); |
| emit_rm(cbuf, 0x3, 0x03, $dst$$reg ); |
| %} |
| |
| enc_class setLT_reg(eCXRegI dst) %{ |
| // SETLT $dst |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x9C); |
| emit_rm( cbuf, 0x3, 0x4, $dst$$reg ); |
| %} |
| |
| enc_class enc_cmpLTP(ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp) %{ // cadd_cmpLT |
| int tmpReg = $tmp$$reg; |
| |
| // SUB $p,$q |
| emit_opcode(cbuf,0x2B); |
| emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); |
| // SBB $tmp,$tmp |
| emit_opcode(cbuf,0x1B); |
| emit_rm(cbuf, 0x3, tmpReg, tmpReg); |
| // AND $tmp,$y |
| emit_opcode(cbuf,0x23); |
| emit_rm(cbuf, 0x3, tmpReg, $y$$reg); |
| // ADD $p,$tmp |
| emit_opcode(cbuf,0x03); |
| emit_rm(cbuf, 0x3, $p$$reg, tmpReg); |
| %} |
| |
| enc_class enc_cmpLTP_mem(eRegI p, eRegI q, memory mem, eCXRegI tmp) %{ // cadd_cmpLT |
| int tmpReg = $tmp$$reg; |
| |
| // SUB $p,$q |
| emit_opcode(cbuf,0x2B); |
| emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); |
| // SBB $tmp,$tmp |
| emit_opcode(cbuf,0x1B); |
| emit_rm(cbuf, 0x3, tmpReg, tmpReg); |
| // AND $tmp,$y |
| cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand |
| emit_opcode(cbuf,0x23); |
| int reg_encoding = tmpReg; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); |
| encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); |
| // ADD $p,$tmp |
| emit_opcode(cbuf,0x03); |
| emit_rm(cbuf, 0x3, $p$$reg, tmpReg); |
| %} |
| |
| enc_class shift_left_long( eRegL dst, eCXRegI shift ) %{ |
| // TEST shift,32 |
| emit_opcode(cbuf,0xF7); |
| emit_rm(cbuf, 0x3, 0, ECX_enc); |
| emit_d32(cbuf,0x20); |
| // JEQ,s small |
| emit_opcode(cbuf, 0x74); |
| emit_d8(cbuf, 0x04); |
| // MOV $dst.hi,$dst.lo |
| emit_opcode( cbuf, 0x8B ); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); |
| // CLR $dst.lo |
| emit_opcode(cbuf, 0x33); |
| emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); |
| // small: |
| // SHLD $dst.hi,$dst.lo,$shift |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0xA5); |
| emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); |
| // SHL $dst.lo,$shift" |
| emit_opcode(cbuf,0xD3); |
| emit_rm(cbuf, 0x3, 0x4, $dst$$reg ); |
| %} |
| |
| enc_class shift_right_long( eRegL dst, eCXRegI shift ) %{ |
| // TEST shift,32 |
| emit_opcode(cbuf,0xF7); |
| emit_rm(cbuf, 0x3, 0, ECX_enc); |
| emit_d32(cbuf,0x20); |
| // JEQ,s small |
| emit_opcode(cbuf, 0x74); |
| emit_d8(cbuf, 0x04); |
| // MOV $dst.lo,$dst.hi |
| emit_opcode( cbuf, 0x8B ); |
| emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); |
| // CLR $dst.hi |
| emit_opcode(cbuf, 0x33); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($dst$$reg)); |
| // small: |
| // SHRD $dst.lo,$dst.hi,$shift |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0xAD); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); |
| // SHR $dst.hi,$shift" |
| emit_opcode(cbuf,0xD3); |
| emit_rm(cbuf, 0x3, 0x5, HIGH_FROM_LOW($dst$$reg) ); |
| %} |
| |
| enc_class shift_right_arith_long( eRegL dst, eCXRegI shift ) %{ |
| // TEST shift,32 |
| emit_opcode(cbuf,0xF7); |
| emit_rm(cbuf, 0x3, 0, ECX_enc); |
| emit_d32(cbuf,0x20); |
| // JEQ,s small |
| emit_opcode(cbuf, 0x74); |
| emit_d8(cbuf, 0x05); |
| // MOV $dst.lo,$dst.hi |
| emit_opcode( cbuf, 0x8B ); |
| emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); |
| // SAR $dst.hi,31 |
| emit_opcode(cbuf, 0xC1); |
| emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW($dst$$reg) ); |
| emit_d8(cbuf, 0x1F ); |
| // small: |
| // SHRD $dst.lo,$dst.hi,$shift |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0xAD); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); |
| // SAR $dst.hi,$shift" |
| emit_opcode(cbuf,0xD3); |
| emit_rm(cbuf, 0x3, 0x7, HIGH_FROM_LOW($dst$$reg) ); |
| %} |
| |
| |
| // ----------------- Encodings for floating point unit ----------------- |
| // May leave result in FPU-TOS or FPU reg depending on opcodes |
| enc_class OpcReg_F (regF src) %{ // FMUL, FDIV |
| $$$emit8$primary; |
| emit_rm(cbuf, 0x3, $secondary, $src$$reg ); |
| %} |
| |
| // Pop argument in FPR0 with FSTP ST(0) |
| enc_class PopFPU() %{ |
| emit_opcode( cbuf, 0xDD ); |
| emit_d8( cbuf, 0xD8 ); |
| %} |
| |
| // !!!!! equivalent to Pop_Reg_F |
| enc_class Pop_Reg_D( regD dst ) %{ |
| emit_opcode( cbuf, 0xDD ); // FSTP ST(i) |
| emit_d8( cbuf, 0xD8+$dst$$reg ); |
| %} |
| |
| enc_class Push_Reg_D( regD dst ) %{ |
| emit_opcode( cbuf, 0xD9 ); |
| emit_d8( cbuf, 0xC0-1+$dst$$reg ); // FLD ST(i-1) |
| %} |
| |
| enc_class strictfp_bias1( regD dst ) %{ |
| emit_opcode( cbuf, 0xDB ); // FLD m80real |
| emit_opcode( cbuf, 0x2D ); |
| emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias1() ); |
| emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 |
| emit_opcode( cbuf, 0xC8+$dst$$reg ); |
| %} |
| |
| enc_class strictfp_bias2( regD dst ) %{ |
| emit_opcode( cbuf, 0xDB ); // FLD m80real |
| emit_opcode( cbuf, 0x2D ); |
| emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias2() ); |
| emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 |
| emit_opcode( cbuf, 0xC8+$dst$$reg ); |
| %} |
| |
| // Special case for moving an integer register to a stack slot. |
| enc_class OpcPRegSS( stackSlotI dst, eRegI src ) %{ // RegSS |
| store_to_stackslot( cbuf, $primary, $src$$reg, $dst$$disp ); |
| %} |
| |
| // Special case for moving a register to a stack slot. |
| enc_class RegSS( stackSlotI dst, eRegI src ) %{ // RegSS |
| // Opcode already emitted |
| emit_rm( cbuf, 0x02, $src$$reg, ESP_enc ); // R/M byte |
| emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte |
| emit_d32(cbuf, $dst$$disp); // Displacement |
| %} |
| |
| // Push the integer in stackSlot 'src' onto FP-stack |
| enc_class Push_Mem_I( memory src ) %{ // FILD [ESP+src] |
| store_to_stackslot( cbuf, $primary, $secondary, $src$$disp ); |
| %} |
| |
| // Push the float in stackSlot 'src' onto FP-stack |
| enc_class Push_Mem_F( memory src ) %{ // FLD_S [ESP+src] |
| store_to_stackslot( cbuf, 0xD9, 0x00, $src$$disp ); |
| %} |
| |
| // Push the double in stackSlot 'src' onto FP-stack |
| enc_class Push_Mem_D( memory src ) %{ // FLD_D [ESP+src] |
| store_to_stackslot( cbuf, 0xDD, 0x00, $src$$disp ); |
| %} |
| |
| // Push FPU's TOS float to a stack-slot, and pop FPU-stack |
| enc_class Pop_Mem_F( stackSlotF dst ) %{ // FSTP_S [ESP+dst] |
| store_to_stackslot( cbuf, 0xD9, 0x03, $dst$$disp ); |
| %} |
| |
| // Same as Pop_Mem_F except for opcode |
| // Push FPU's TOS double to a stack-slot, and pop FPU-stack |
| enc_class Pop_Mem_D( stackSlotD dst ) %{ // FSTP_D [ESP+dst] |
| store_to_stackslot( cbuf, 0xDD, 0x03, $dst$$disp ); |
| %} |
| |
| enc_class Pop_Reg_F( regF dst ) %{ |
| emit_opcode( cbuf, 0xDD ); // FSTP ST(i) |
| emit_d8( cbuf, 0xD8+$dst$$reg ); |
| %} |
| |
| enc_class Push_Reg_F( regF dst ) %{ |
| emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) |
| emit_d8( cbuf, 0xC0-1+$dst$$reg ); |
| %} |
| |
| // Push FPU's float to a stack-slot, and pop FPU-stack |
| enc_class Pop_Mem_Reg_F( stackSlotF dst, regF src ) %{ |
| int pop = 0x02; |
| if ($src$$reg != FPR1L_enc) { |
| emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) |
| emit_d8( cbuf, 0xC0-1+$src$$reg ); |
| pop = 0x03; |
| } |
| store_to_stackslot( cbuf, 0xD9, pop, $dst$$disp ); // FST<P>_S [ESP+dst] |
| %} |
| |
| // Push FPU's double to a stack-slot, and pop FPU-stack |
| enc_class Pop_Mem_Reg_D( stackSlotD dst, regD src ) %{ |
| int pop = 0x02; |
| if ($src$$reg != FPR1L_enc) { |
| emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) |
| emit_d8( cbuf, 0xC0-1+$src$$reg ); |
| pop = 0x03; |
| } |
| store_to_stackslot( cbuf, 0xDD, pop, $dst$$disp ); // FST<P>_D [ESP+dst] |
| %} |
| |
| // Push FPU's double to a FPU-stack-slot, and pop FPU-stack |
| enc_class Pop_Reg_Reg_D( regD dst, regF src ) %{ |
| int pop = 0xD0 - 1; // -1 since we skip FLD |
| if ($src$$reg != FPR1L_enc) { |
| emit_opcode( cbuf, 0xD9 ); // FLD ST(src-1) |
| emit_d8( cbuf, 0xC0-1+$src$$reg ); |
| pop = 0xD8; |
| } |
| emit_opcode( cbuf, 0xDD ); |
| emit_d8( cbuf, pop+$dst$$reg ); // FST<P> ST(i) |
| %} |
| |
| |
| enc_class Mul_Add_F( regF dst, regF src, regF src1, regF src2 ) %{ |
| MacroAssembler masm(&cbuf); |
| masm.fld_s( $src1$$reg-1); // nothing at TOS, load TOS from src1.reg |
| masm.fmul( $src2$$reg+0); // value at TOS |
| masm.fadd( $src$$reg+0); // value at TOS |
| masm.fstp_d( $dst$$reg+0); // value at TOS, popped off after store |
| %} |
| |
| |
| enc_class Push_Reg_Mod_D( regD dst, regD src) %{ |
| // load dst in FPR0 |
| emit_opcode( cbuf, 0xD9 ); |
| emit_d8( cbuf, 0xC0-1+$dst$$reg ); |
| if ($src$$reg != FPR1L_enc) { |
| // fincstp |
| emit_opcode (cbuf, 0xD9); |
| emit_opcode (cbuf, 0xF7); |
| // swap src with FPR1: |
| // FXCH FPR1 with src |
| emit_opcode(cbuf, 0xD9); |
| emit_d8(cbuf, 0xC8-1+$src$$reg ); |
| // fdecstp |
| emit_opcode (cbuf, 0xD9); |
| emit_opcode (cbuf, 0xF6); |
| } |
| %} |
| |
| enc_class Push_ModD_encoding( regXD src0, regXD src1) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src1 |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src0 |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| %} |
| |
| enc_class Push_ModX_encoding( regX src0, regX src1) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x04); |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src1 |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9 ); // FLD [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src0 |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9 ); // FLD [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| %} |
| |
| enc_class Push_ResultXD(regXD dst) %{ |
| store_to_stackslot( cbuf, 0xDD, 0x03, 0 ); //FSTP [ESP] |
| |
| // UseXmmLoadAndClearUpper ? movsd dst,[esp] : movlpd dst,[esp] |
| emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); |
| encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,8 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,0x08); |
| %} |
| |
| enc_class Push_ResultX(regX dst, immI d8) %{ |
| store_to_stackslot( cbuf, 0xD9, 0x03, 0 ); //FSTP_S [ESP] |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x10 ); |
| encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,d8 (4 or 8) |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,$d8$$constant); |
| %} |
| |
| enc_class Push_SrcXD(regXD src) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| %} |
| |
| enc_class push_stack_temp_qword() %{ |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8 (cbuf,0x08); |
| %} |
| |
| enc_class pop_stack_temp_qword() %{ |
| emit_opcode(cbuf,0x83); // ADD ESP,8 |
| emit_opcode(cbuf,0xC4); |
| emit_d8 (cbuf,0x08); |
| %} |
| |
| enc_class push_xmm_to_fpr1( regXD xmm_src ) %{ |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], xmm_src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $xmm_src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| %} |
| |
| // Compute X^Y using Intel's fast hardware instructions, if possible. |
| // Otherwise return a NaN. |
| enc_class pow_exp_core_encoding %{ |
| // FPR1 holds Y*ln2(X). Compute FPR1 = 2^(Y*ln2(X)) |
| emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xC0); // fdup = fld st(0) Q Q |
| emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xFC); // frndint int(Q) Q |
| emit_opcode(cbuf,0xDC); emit_opcode(cbuf,0xE9); // fsub st(1) -= st(0); int(Q) frac(Q) |
| emit_opcode(cbuf,0xDB); // FISTP [ESP] frac(Q) |
| emit_opcode(cbuf,0x1C); |
| emit_d8(cbuf,0x24); |
| emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xF0); // f2xm1 2^frac(Q)-1 |
| emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xE8); // fld1 1 2^frac(Q)-1 |
| emit_opcode(cbuf,0xDE); emit_opcode(cbuf,0xC1); // faddp 2^frac(Q) |
| emit_opcode(cbuf,0x8B); // mov rax,[esp+0]=int(Q) |
| encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 0, false); |
| emit_opcode(cbuf,0xC7); // mov rcx,0xFFFFF800 - overflow mask |
| emit_rm(cbuf, 0x3, 0x0, ECX_enc); |
| emit_d32(cbuf,0xFFFFF800); |
| emit_opcode(cbuf,0x81); // add rax,1023 - the double exponent bias |
| emit_rm(cbuf, 0x3, 0x0, EAX_enc); |
| emit_d32(cbuf,1023); |
| emit_opcode(cbuf,0x8B); // mov rbx,eax |
| emit_rm(cbuf, 0x3, EBX_enc, EAX_enc); |
| emit_opcode(cbuf,0xC1); // shl rax,20 - Slide to exponent position |
| emit_rm(cbuf,0x3,0x4,EAX_enc); |
| emit_d8(cbuf,20); |
| emit_opcode(cbuf,0x85); // test rbx,ecx - check for overflow |
| emit_rm(cbuf, 0x3, EBX_enc, ECX_enc); |
| emit_opcode(cbuf,0x0F); emit_opcode(cbuf,0x45); // CMOVne rax,ecx - overflow; stuff NAN into EAX |
| emit_rm(cbuf, 0x3, EAX_enc, ECX_enc); |
| emit_opcode(cbuf,0x89); // mov [esp+4],eax - Store as part of double word |
| encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 4, false); |
| emit_opcode(cbuf,0xC7); // mov [esp+0],0 - [ESP] = (double)(1<<int(Q)) = 2^int(Q) |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| emit_d32(cbuf,0); |
| emit_opcode(cbuf,0xDC); // fmul dword st(0),[esp+0]; FPR1 = 2^int(Q)*2^frac(Q) = 2^Q |
| encode_RegMem(cbuf, 0x1, ESP_enc, 0x4, 0, 0, false); |
| %} |
| |
| // enc_class Pop_Reg_Mod_D( regD dst, regD src) |
| // was replaced by Push_Result_Mod_D followed by Pop_Reg_X() or Pop_Mem_X() |
| |
| enc_class Push_Result_Mod_D( regD src) %{ |
| if ($src$$reg != FPR1L_enc) { |
| // fincstp |
| emit_opcode (cbuf, 0xD9); |
| emit_opcode (cbuf, 0xF7); |
| // FXCH FPR1 with src |
| emit_opcode(cbuf, 0xD9); |
| emit_d8(cbuf, 0xC8-1+$src$$reg ); |
| // fdecstp |
| emit_opcode (cbuf, 0xD9); |
| emit_opcode (cbuf, 0xF6); |
| } |
| // // following asm replaced with Pop_Reg_F or Pop_Mem_F |
| // // FSTP FPR$dst$$reg |
| // emit_opcode( cbuf, 0xDD ); |
| // emit_d8( cbuf, 0xD8+$dst$$reg ); |
| %} |
| |
| enc_class fnstsw_sahf_skip_parity() %{ |
| // fnstsw ax |
| emit_opcode( cbuf, 0xDF ); |
| emit_opcode( cbuf, 0xE0 ); |
| // sahf |
| emit_opcode( cbuf, 0x9E ); |
| // jnp ::skip |
| emit_opcode( cbuf, 0x7B ); |
| emit_opcode( cbuf, 0x05 ); |
| %} |
| |
| enc_class emitModD() %{ |
| // fprem must be iterative |
| // :: loop |
| // fprem |
| emit_opcode( cbuf, 0xD9 ); |
| emit_opcode( cbuf, 0xF8 ); |
| // wait |
| emit_opcode( cbuf, 0x9b ); |
| // fnstsw ax |
| emit_opcode( cbuf, 0xDF ); |
| emit_opcode( cbuf, 0xE0 ); |
| // sahf |
| emit_opcode( cbuf, 0x9E ); |
| // jp ::loop |
| emit_opcode( cbuf, 0x0F ); |
| emit_opcode( cbuf, 0x8A ); |
| emit_opcode( cbuf, 0xF4 ); |
| emit_opcode( cbuf, 0xFF ); |
| emit_opcode( cbuf, 0xFF ); |
| emit_opcode( cbuf, 0xFF ); |
| %} |
| |
| enc_class fpu_flags() %{ |
| // fnstsw_ax |
| emit_opcode( cbuf, 0xDF); |
| emit_opcode( cbuf, 0xE0); |
| // test ax,0x0400 |
| emit_opcode( cbuf, 0x66 ); // operand-size prefix for 16-bit immediate |
| emit_opcode( cbuf, 0xA9 ); |
| emit_d16 ( cbuf, 0x0400 ); |
| // // // This sequence works, but stalls for 12-16 cycles on PPro |
| // // test rax,0x0400 |
| // emit_opcode( cbuf, 0xA9 ); |
| // emit_d32 ( cbuf, 0x00000400 ); |
| // |
| // jz exit (no unordered comparison) |
| emit_opcode( cbuf, 0x74 ); |
| emit_d8 ( cbuf, 0x02 ); |
| // mov ah,1 - treat as LT case (set carry flag) |
| emit_opcode( cbuf, 0xB4 ); |
| emit_d8 ( cbuf, 0x01 ); |
| // sahf |
| emit_opcode( cbuf, 0x9E); |
| %} |
| |
| enc_class cmpF_P6_fixup() %{ |
| // Fixup the integer flags in case comparison involved a NaN |
| // |
| // JNP exit (no unordered comparison, P-flag is set by NaN) |
| emit_opcode( cbuf, 0x7B ); |
| emit_d8 ( cbuf, 0x03 ); |
| // MOV AH,1 - treat as LT case (set carry flag) |
| emit_opcode( cbuf, 0xB4 ); |
| emit_d8 ( cbuf, 0x01 ); |
| // SAHF |
| emit_opcode( cbuf, 0x9E); |
| // NOP // target for branch to avoid branch to branch |
| emit_opcode( cbuf, 0x90); |
| %} |
| |
| // fnstsw_ax(); |
| // sahf(); |
| // movl(dst, nan_result); |
| // jcc(Assembler::parity, exit); |
| // movl(dst, less_result); |
| // jcc(Assembler::below, exit); |
| // movl(dst, equal_result); |
| // jcc(Assembler::equal, exit); |
| // movl(dst, greater_result); |
| |
| // less_result = 1; |
| // greater_result = -1; |
| // equal_result = 0; |
| // nan_result = -1; |
| |
| enc_class CmpF_Result(eRegI dst) %{ |
| // fnstsw_ax(); |
| emit_opcode( cbuf, 0xDF); |
| emit_opcode( cbuf, 0xE0); |
| // sahf |
| emit_opcode( cbuf, 0x9E); |
| // movl(dst, nan_result); |
| emit_opcode( cbuf, 0xB8 + $dst$$reg); |
| emit_d32( cbuf, -1 ); |
| // jcc(Assembler::parity, exit); |
| emit_opcode( cbuf, 0x7A ); |
| emit_d8 ( cbuf, 0x13 ); |
| // movl(dst, less_result); |
| emit_opcode( cbuf, 0xB8 + $dst$$reg); |
| emit_d32( cbuf, -1 ); |
| // jcc(Assembler::below, exit); |
| emit_opcode( cbuf, 0x72 ); |
| emit_d8 ( cbuf, 0x0C ); |
| // movl(dst, equal_result); |
| emit_opcode( cbuf, 0xB8 + $dst$$reg); |
| emit_d32( cbuf, 0 ); |
| // jcc(Assembler::equal, exit); |
| emit_opcode( cbuf, 0x74 ); |
| emit_d8 ( cbuf, 0x05 ); |
| // movl(dst, greater_result); |
| emit_opcode( cbuf, 0xB8 + $dst$$reg); |
| emit_d32( cbuf, 1 ); |
| %} |
| |
| |
| // XMM version of CmpF_Result. Because the XMM compare |
| // instructions set the EFLAGS directly. It becomes simpler than |
| // the float version above. |
| enc_class CmpX_Result(eRegI dst) %{ |
| MacroAssembler _masm(&cbuf); |
| Label nan, inc, done; |
| |
| __ jccb(Assembler::parity, nan); |
| __ jccb(Assembler::equal, done); |
| __ jccb(Assembler::above, inc); |
| __ bind(nan); |
| __ decrement(as_Register($dst$$reg)); |
| __ jmpb(done); |
| __ bind(inc); |
| __ increment(as_Register($dst$$reg)); |
| __ bind(done); |
| %} |
| |
| // Compare the longs and set flags |
| // BROKEN! Do Not use as-is |
| enc_class cmpl_test( eRegL src1, eRegL src2 ) %{ |
| // CMP $src1.hi,$src2.hi |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); |
| // JNE,s done |
| emit_opcode(cbuf,0x75); |
| emit_d8(cbuf, 2 ); |
| // CMP $src1.lo,$src2.lo |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); |
| // done: |
| %} |
| |
| enc_class convert_int_long( regL dst, eRegI src ) %{ |
| // mov $dst.lo,$src |
| int dst_encoding = $dst$$reg; |
| int src_encoding = $src$$reg; |
| encode_Copy( cbuf, dst_encoding , src_encoding ); |
| // mov $dst.hi,$src |
| encode_Copy( cbuf, HIGH_FROM_LOW(dst_encoding), src_encoding ); |
| // sar $dst.hi,31 |
| emit_opcode( cbuf, 0xC1 ); |
| emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW(dst_encoding) ); |
| emit_d8(cbuf, 0x1F ); |
| %} |
| |
| enc_class convert_long_double( eRegL src ) %{ |
| // push $src.hi |
| emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); |
| // push $src.lo |
| emit_opcode(cbuf, 0x50+$src$$reg ); |
| // fild 64-bits at [SP] |
| emit_opcode(cbuf,0xdf); |
| emit_d8(cbuf, 0x6C); |
| emit_d8(cbuf, 0x24); |
| emit_d8(cbuf, 0x00); |
| // pop stack |
| emit_opcode(cbuf, 0x83); // add SP, #8 |
| emit_rm(cbuf, 0x3, 0x00, ESP_enc); |
| emit_d8(cbuf, 0x8); |
| %} |
| |
| enc_class multiply_con_and_shift_high( eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr ) %{ |
| // IMUL EDX:EAX,$src1 |
| emit_opcode( cbuf, 0xF7 ); |
| emit_rm( cbuf, 0x3, 0x5, $src1$$reg ); |
| // SAR EDX,$cnt-32 |
| int shift_count = ((int)$cnt$$constant) - 32; |
| if (shift_count > 0) { |
| emit_opcode(cbuf, 0xC1); |
| emit_rm(cbuf, 0x3, 7, $dst$$reg ); |
| emit_d8(cbuf, shift_count); |
| } |
| %} |
| |
| // this version doesn't have add sp, 8 |
| enc_class convert_long_double2( eRegL src ) %{ |
| // push $src.hi |
| emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); |
| // push $src.lo |
| emit_opcode(cbuf, 0x50+$src$$reg ); |
| // fild 64-bits at [SP] |
| emit_opcode(cbuf,0xdf); |
| emit_d8(cbuf, 0x6C); |
| emit_d8(cbuf, 0x24); |
| emit_d8(cbuf, 0x00); |
| %} |
| |
| enc_class long_int_multiply( eADXRegL dst, nadxRegI src) %{ |
| // Basic idea: long = (long)int * (long)int |
| // IMUL EDX:EAX, src |
| emit_opcode( cbuf, 0xF7 ); |
| emit_rm( cbuf, 0x3, 0x5, $src$$reg); |
| %} |
| |
| enc_class long_uint_multiply( eADXRegL dst, nadxRegI src) %{ |
| // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) |
| // MUL EDX:EAX, src |
| emit_opcode( cbuf, 0xF7 ); |
| emit_rm( cbuf, 0x3, 0x4, $src$$reg); |
| %} |
| |
| enc_class long_multiply( eADXRegL dst, eRegL src, eRegI tmp ) %{ |
| // Basic idea: lo(result) = lo(x_lo * y_lo) |
| // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) |
| // MOV $tmp,$src.lo |
| encode_Copy( cbuf, $tmp$$reg, $src$$reg ); |
| // IMUL $tmp,EDX |
| emit_opcode( cbuf, 0x0F ); |
| emit_opcode( cbuf, 0xAF ); |
| emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); |
| // MOV EDX,$src.hi |
| encode_Copy( cbuf, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg) ); |
| // IMUL EDX,EAX |
| emit_opcode( cbuf, 0x0F ); |
| emit_opcode( cbuf, 0xAF ); |
| emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); |
| // ADD $tmp,EDX |
| emit_opcode( cbuf, 0x03 ); |
| emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); |
| // MUL EDX:EAX,$src.lo |
| emit_opcode( cbuf, 0xF7 ); |
| emit_rm( cbuf, 0x3, 0x4, $src$$reg ); |
| // ADD EDX,ESI |
| emit_opcode( cbuf, 0x03 ); |
| emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $tmp$$reg ); |
| %} |
| |
| enc_class long_multiply_con( eADXRegL dst, immL_127 src, eRegI tmp ) %{ |
| // Basic idea: lo(result) = lo(src * y_lo) |
| // hi(result) = hi(src * y_lo) + lo(src * y_hi) |
| // IMUL $tmp,EDX,$src |
| emit_opcode( cbuf, 0x6B ); |
| emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); |
| emit_d8( cbuf, (int)$src$$constant ); |
| // MOV EDX,$src |
| emit_opcode(cbuf, 0xB8 + EDX_enc); |
| emit_d32( cbuf, (int)$src$$constant ); |
| // MUL EDX:EAX,EDX |
| emit_opcode( cbuf, 0xF7 ); |
| emit_rm( cbuf, 0x3, 0x4, EDX_enc ); |
| // ADD EDX,ESI |
| emit_opcode( cbuf, 0x03 ); |
| emit_rm( cbuf, 0x3, EDX_enc, $tmp$$reg ); |
| %} |
| |
| enc_class long_div( eRegL src1, eRegL src2 ) %{ |
| // PUSH src1.hi |
| emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); |
| // PUSH src1.lo |
| emit_opcode(cbuf, 0x50+$src1$$reg ); |
| // PUSH src2.hi |
| emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); |
| // PUSH src2.lo |
| emit_opcode(cbuf, 0x50+$src2$$reg ); |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::ldiv) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Restore stack |
| emit_opcode(cbuf, 0x83); // add SP, #framesize |
| emit_rm(cbuf, 0x3, 0x00, ESP_enc); |
| emit_d8(cbuf, 4*4); |
| %} |
| |
| enc_class long_mod( eRegL src1, eRegL src2 ) %{ |
| // PUSH src1.hi |
| emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); |
| // PUSH src1.lo |
| emit_opcode(cbuf, 0x50+$src1$$reg ); |
| // PUSH src2.hi |
| emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); |
| // PUSH src2.lo |
| emit_opcode(cbuf, 0x50+$src2$$reg ); |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::lrem ) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Restore stack |
| emit_opcode(cbuf, 0x83); // add SP, #framesize |
| emit_rm(cbuf, 0x3, 0x00, ESP_enc); |
| emit_d8(cbuf, 4*4); |
| %} |
| |
| enc_class long_cmp_flags0( eRegL src, eRegI tmp ) %{ |
| // MOV $tmp,$src.lo |
| emit_opcode(cbuf, 0x8B); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); |
| // OR $tmp,$src.hi |
| emit_opcode(cbuf, 0x0B); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); |
| %} |
| |
| enc_class long_cmp_flags1( eRegL src1, eRegL src2 ) %{ |
| // CMP $src1.lo,$src2.lo |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); |
| // JNE,s skip |
| emit_cc(cbuf, 0x70, 0x5); |
| emit_d8(cbuf,2); |
| // CMP $src1.hi,$src2.hi |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); |
| %} |
| |
| enc_class long_cmp_flags2( eRegL src1, eRegL src2, eRegI tmp ) %{ |
| // CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); |
| // MOV $tmp,$src1.hi |
| emit_opcode( cbuf, 0x8B ); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src1$$reg) ); |
| // SBB $tmp,$src2.hi\t! Compute flags for long compare |
| emit_opcode( cbuf, 0x1B ); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src2$$reg) ); |
| %} |
| |
| enc_class long_cmp_flags3( eRegL src, eRegI tmp ) %{ |
| // XOR $tmp,$tmp |
| emit_opcode(cbuf,0x33); // XOR |
| emit_rm(cbuf,0x3, $tmp$$reg, $tmp$$reg); |
| // CMP $tmp,$src.lo |
| emit_opcode( cbuf, 0x3B ); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg ); |
| // SBB $tmp,$src.hi |
| emit_opcode( cbuf, 0x1B ); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg) ); |
| %} |
| |
| // Sniff, sniff... smells like Gnu Superoptimizer |
| enc_class neg_long( eRegL dst ) %{ |
| emit_opcode(cbuf,0xF7); // NEG hi |
| emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); |
| emit_opcode(cbuf,0xF7); // NEG lo |
| emit_rm (cbuf,0x3, 0x3, $dst$$reg ); |
| emit_opcode(cbuf,0x83); // SBB hi,0 |
| emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); |
| emit_d8 (cbuf,0 ); |
| %} |
| |
| enc_class movq_ld(regXD dst, memory mem) %{ |
| MacroAssembler _masm(&cbuf); |
| Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); |
| __ movq(as_XMMRegister($dst$$reg), madr); |
| %} |
| |
| enc_class movq_st(memory mem, regXD src) %{ |
| MacroAssembler _masm(&cbuf); |
| Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); |
| __ movq(madr, as_XMMRegister($src$$reg)); |
| %} |
| |
| enc_class pshufd_8x8(regX dst, regX src) %{ |
| MacroAssembler _masm(&cbuf); |
| |
| encode_CopyXD(cbuf, $dst$$reg, $src$$reg); |
| __ punpcklbw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg)); |
| __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg), 0x00); |
| %} |
| |
| enc_class pshufd_4x16(regX dst, regX src) %{ |
| MacroAssembler _masm(&cbuf); |
| |
| __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), 0x00); |
| %} |
| |
| enc_class pshufd(regXD dst, regXD src, int mode) %{ |
| MacroAssembler _masm(&cbuf); |
| |
| __ pshufd(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), $mode); |
| %} |
| |
| enc_class pxor(regXD dst, regXD src) %{ |
| MacroAssembler _masm(&cbuf); |
| |
| __ pxor(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg)); |
| %} |
| |
| enc_class mov_i2x(regXD dst, eRegI src) %{ |
| MacroAssembler _masm(&cbuf); |
| |
| __ movd(as_XMMRegister($dst$$reg), as_Register($src$$reg)); |
| %} |
| |
| |
| // Because the transitions from emitted code to the runtime |
| // monitorenter/exit helper stubs are so slow it's critical that |
| // we inline both the stack-locking fast-path and the inflated fast path. |
| // |
| // See also: cmpFastLock and cmpFastUnlock. |
| // |
| // What follows is a specialized inline transliteration of the code |
| // in slow_enter() and slow_exit(). If we're concerned about I$ bloat |
| // another option would be to emit TrySlowEnter and TrySlowExit methods |
| // at startup-time. These methods would accept arguments as |
| // (rax,=Obj, rbx=Self, rcx=box, rdx=Scratch) and return success-failure |
| // indications in the icc.ZFlag. Fast_Lock and Fast_Unlock would simply |
| // marshal the arguments and emit calls to TrySlowEnter and TrySlowExit. |
| // In practice, however, the # of lock sites is bounded and is usually small. |
| // Besides the call overhead, TrySlowEnter and TrySlowExit might suffer |
| // if the processor uses simple bimodal branch predictors keyed by EIP |
| // Since the helper routines would be called from multiple synchronization |
| // sites. |
| // |
| // An even better approach would be write "MonitorEnter()" and "MonitorExit()" |
| // in java - using j.u.c and unsafe - and just bind the lock and unlock sites |
| // to those specialized methods. That'd give us a mostly platform-independent |
| // implementation that the JITs could optimize and inline at their pleasure. |
| // Done correctly, the only time we'd need to cross to native could would be |
| // to park() or unpark() threads. We'd also need a few more unsafe operators |
| // to (a) prevent compiler-JIT reordering of non-volatile accesses, and |
| // (b) explicit barriers or fence operations. |
| // |
| // TODO: |
| // |
| // * Arrange for C2 to pass "Self" into Fast_Lock and Fast_Unlock in one of the registers (scr). |
| // This avoids manifesting the Self pointer in the Fast_Lock and Fast_Unlock terminals. |
| // Given TLAB allocation, Self is usually manifested in a register, so passing it into |
| // the lock operators would typically be faster than reifying Self. |
| // |
| // * Ideally I'd define the primitives as: |
| // fast_lock (nax Obj, nax box, EAX tmp, nax scr) where box, tmp and scr are KILLED. |
| // fast_unlock (nax Obj, EAX box, nax tmp) where box and tmp are KILLED |
| // Unfortunately ADLC bugs prevent us from expressing the ideal form. |
| // Instead, we're stuck with a rather awkward and brittle register assignments below. |
| // Furthermore the register assignments are overconstrained, possibly resulting in |
| // sub-optimal code near the synchronization site. |
| // |
| // * Eliminate the sp-proximity tests and just use "== Self" tests instead. |
| // Alternately, use a better sp-proximity test. |
| // |
| // * Currently ObjectMonitor._Owner can hold either an sp value or a (THREAD *) value. |
| // Either one is sufficient to uniquely identify a thread. |
| // TODO: eliminate use of sp in _owner and use get_thread(tr) instead. |
| // |
| // * Intrinsify notify() and notifyAll() for the common cases where the |
| // object is locked by the calling thread but the waitlist is empty. |
| // avoid the expensive JNI call to JVM_Notify() and JVM_NotifyAll(). |
| // |
| // * use jccb and jmpb instead of jcc and jmp to improve code density. |
| // But beware of excessive branch density on AMD Opterons. |
| // |
| // * Both Fast_Lock and Fast_Unlock set the ICC.ZF to indicate success |
| // or failure of the fast-path. If the fast-path fails then we pass |
| // control to the slow-path, typically in C. In Fast_Lock and |
| // Fast_Unlock we often branch to DONE_LABEL, just to find that C2 |
| // will emit a conditional branch immediately after the node. |
| // So we have branches to branches and lots of ICC.ZF games. |
| // Instead, it might be better to have C2 pass a "FailureLabel" |
| // into Fast_Lock and Fast_Unlock. In the case of success, control |
| // will drop through the node. ICC.ZF is undefined at exit. |
| // In the case of failure, the node will branch directly to the |
| // FailureLabel |
| |
| |
| // obj: object to lock |
| // box: on-stack box address (displaced header location) - KILLED |
| // rax,: tmp -- KILLED |
| // scr: tmp -- KILLED |
| enc_class Fast_Lock( eRegP obj, eRegP box, eAXRegI tmp, eRegP scr ) %{ |
| |
| Register objReg = as_Register($obj$$reg); |
| Register boxReg = as_Register($box$$reg); |
| Register tmpReg = as_Register($tmp$$reg); |
| Register scrReg = as_Register($scr$$reg); |
| |
| // Ensure the register assignents are disjoint |
| guarantee (objReg != boxReg, "") ; |
| guarantee (objReg != tmpReg, "") ; |
| guarantee (objReg != scrReg, "") ; |
| guarantee (boxReg != tmpReg, "") ; |
| guarantee (boxReg != scrReg, "") ; |
| guarantee (tmpReg == as_Register(EAX_enc), "") ; |
| |
| MacroAssembler masm(&cbuf); |
| |
| if (_counters != NULL) { |
| masm.atomic_incl(ExternalAddress((address) _counters->total_entry_count_addr())); |
| } |
| if (EmitSync & 1) { |
| // set box->dhw = unused_mark (3) |
| // Force all sync thru slow-path: slow_enter() and slow_exit() |
| masm.movl (Address(boxReg, 0), intptr_t(markOopDesc::unused_mark())) ; |
| masm.cmpl (rsp, 0) ; |
| } else |
| if (EmitSync & 2) { |
| Label DONE_LABEL ; |
| if (UseBiasedLocking) { |
| // Note: tmpReg maps to the swap_reg argument and scrReg to the tmp_reg argument. |
| masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); |
| } |
| |
| masm.movl (tmpReg, Address(objReg, 0)) ; // fetch markword |
| masm.orl (tmpReg, 0x1); |
| masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg |
| masm.jcc(Assembler::equal, DONE_LABEL); |
| // Recursive locking |
| masm.subl(tmpReg, rsp); |
| masm.andl(tmpReg, 0xFFFFF003 ); |
| masm.movl(Address(boxReg, 0), tmpReg); |
| masm.bind(DONE_LABEL) ; |
| } else { |
| // Possible cases that we'll encounter in fast_lock |
| // ------------------------------------------------ |
| // * Inflated |
| // -- unlocked |
| // -- Locked |
| // = by self |
| // = by other |
| // * biased |
| // -- by Self |
| // -- by other |
| // * neutral |
| // * stack-locked |
| // -- by self |
| // = sp-proximity test hits |
| // = sp-proximity test generates false-negative |
| // -- by other |
| // |
| |
| Label IsInflated, DONE_LABEL, PopDone ; |
| |
| // TODO: optimize away redundant LDs of obj->mark and improve the markword triage |
| // order to reduce the number of conditional branches in the most common cases. |
| // Beware -- there's a subtle invariant that fetch of the markword |
| // at [FETCH], below, will never observe a biased encoding (*101b). |
| // If this invariant is not held we risk exclusion (safety) failure. |
| if (UseBiasedLocking) { |
| masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); |
| } |
| |
| masm.movl (tmpReg, Address(objReg, 0)) ; // [FETCH] |
| masm.testl (tmpReg, 0x02) ; // Inflated v (Stack-locked or neutral) |
| masm.jccb (Assembler::notZero, IsInflated) ; |
| |
| // Attempt stack-locking ... |
| masm.orl (tmpReg, 0x1); |
| masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg |
| if (_counters != NULL) { |
| masm.cond_inc32(Assembler::equal, |
| ExternalAddress((address)_counters->fast_path_entry_count_addr())); |
| } |
| masm.jccb (Assembler::equal, DONE_LABEL); |
| |
| // Recursive locking |
| masm.subl(tmpReg, rsp); |
| masm.andl(tmpReg, 0xFFFFF003 ); |
| masm.movl(Address(boxReg, 0), tmpReg); |
| if (_counters != NULL) { |
| masm.cond_inc32(Assembler::equal, |
| ExternalAddress((address)_counters->fast_path_entry_count_addr())); |
| } |
| masm.jmp (DONE_LABEL) ; |
| |
| masm.bind (IsInflated) ; |
| |
| // The object is inflated. |
| // |
| // TODO-FIXME: eliminate the ugly use of manifest constants: |
| // Use markOopDesc::monitor_value instead of "2". |
| // use markOop::unused_mark() instead of "3". |
| // The tmpReg value is an objectMonitor reference ORed with |
| // markOopDesc::monitor_value (2). We can either convert tmpReg to an |
| // objectmonitor pointer by masking off the "2" bit or we can just |
| // use tmpReg as an objectmonitor pointer but bias the objectmonitor |
| // field offsets with "-2" to compensate for and annul the low-order tag bit. |
| // |
| // I use the latter as it avoids AGI stalls. |
| // As such, we write "mov r, [tmpReg+OFFSETOF(Owner)-2]" |
| // instead of "mov r, [tmpReg+OFFSETOF(Owner)]". |
| // |
| #define OFFSET_SKEWED(f) ((ObjectMonitor::f ## _offset_in_bytes())-2) |
| |
| // boxReg refers to the on-stack BasicLock in the current frame. |
| // We'd like to write: |
| // set box->_displaced_header = markOop::unused_mark(). Any non-0 value suffices. |
| // This is convenient but results a ST-before-CAS penalty. The following CAS suffers |
| // additional latency as we have another ST in the store buffer that must drain. |
| |
| if (EmitSync & 8192) { |
| masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty |
| masm.get_thread (scrReg) ; |
| masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] |
| masm.movl (tmpReg, 0); // consider: xor vs mov |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; |
| } else |
| if ((EmitSync & 128) == 0) { // avoid ST-before-CAS |
| masm.movl (scrReg, boxReg) ; |
| masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] |
| |
| // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes |
| if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { |
| // prefetchw [eax + Offset(_owner)-2] |
| masm.emit_raw (0x0F) ; |
| masm.emit_raw (0x0D) ; |
| masm.emit_raw (0x48) ; |
| masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; |
| } |
| |
| if ((EmitSync & 64) == 0) { |
| // Optimistic form: consider XORL tmpReg,tmpReg |
| masm.movl (tmpReg, 0 ) ; |
| } else { |
| // Can suffer RTS->RTO upgrades on shared or cold $ lines |
| // Test-And-CAS instead of CAS |
| masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner |
| masm.testl (tmpReg, tmpReg) ; // Locked ? |
| masm.jccb (Assembler::notZero, DONE_LABEL) ; |
| } |
| |
| // Appears unlocked - try to swing _owner from null to non-null. |
| // Ideally, I'd manifest "Self" with get_thread and then attempt |
| // to CAS the register containing Self into m->Owner. |
| // But we don't have enough registers, so instead we can either try to CAS |
| // rsp or the address of the box (in scr) into &m->owner. If the CAS succeeds |
| // we later store "Self" into m->Owner. Transiently storing a stack address |
| // (rsp or the address of the box) into m->owner is harmless. |
| // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; |
| masm.movl (Address(scrReg, 0), 3) ; // box->_displaced_header = 3 |
| masm.jccb (Assembler::notZero, DONE_LABEL) ; |
| masm.get_thread (scrReg) ; // beware: clobbers ICCs |
| masm.movl (Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2), scrReg) ; |
| masm.xorl (boxReg, boxReg) ; // set icc.ZFlag = 1 to indicate success |
| |
| // If the CAS fails we can either retry or pass control to the slow-path. |
| // We use the latter tactic. |
| // Pass the CAS result in the icc.ZFlag into DONE_LABEL |
| // If the CAS was successful ... |
| // Self has acquired the lock |
| // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. |
| // Intentional fall-through into DONE_LABEL ... |
| } else { |
| masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty |
| masm.movl (boxReg, tmpReg) ; |
| |
| // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes |
| if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { |
| // prefetchw [eax + Offset(_owner)-2] |
| masm.emit_raw (0x0F) ; |
| masm.emit_raw (0x0D) ; |
| masm.emit_raw (0x48) ; |
| masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; |
| } |
| |
| if ((EmitSync & 64) == 0) { |
| // Optimistic form |
| masm.xorl (tmpReg, tmpReg) ; |
| } else { |
| // Can suffer RTS->RTO upgrades on shared or cold $ lines |
| masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner |
| masm.testl (tmpReg, tmpReg) ; // Locked ? |
| masm.jccb (Assembler::notZero, DONE_LABEL) ; |
| } |
| |
| // Appears unlocked - try to swing _owner from null to non-null. |
| // Use either "Self" (in scr) or rsp as thread identity in _owner. |
| // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. |
| masm.get_thread (scrReg) ; |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; |
| |
| // If the CAS fails we can either retry or pass control to the slow-path. |
| // We use the latter tactic. |
| // Pass the CAS result in the icc.ZFlag into DONE_LABEL |
| // If the CAS was successful ... |
| // Self has acquired the lock |
| // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. |
| // Intentional fall-through into DONE_LABEL ... |
| } |
| |
| // DONE_LABEL is a hot target - we'd really like to place it at the |
| // start of cache line by padding with NOPs. |
| // See the AMD and Intel software optimization manuals for the |
| // most efficient "long" NOP encodings. |
| // Unfortunately none of our alignment mechanisms suffice. |
| masm.bind(DONE_LABEL); |
| |
| // Avoid branch-to-branch on AMD processors |
| // This appears to be superstition. |
| if (EmitSync & 32) masm.nop() ; |
| |
| |
| // At DONE_LABEL the icc ZFlag is set as follows ... |
| // Fast_Unlock uses the same protocol. |
| // ZFlag == 1 -> Success |
| // ZFlag == 0 -> Failure - force control through the slow-path |
| } |
| %} |
| |
| // obj: object to unlock |
| // box: box address (displaced header location), killed. Must be EAX. |
| // rbx,: killed tmp; cannot be obj nor box. |
| // |
| // Some commentary on balanced locking: |
| // |
| // Fast_Lock and Fast_Unlock are emitted only for provably balanced lock sites. |
| // Methods that don't have provably balanced locking are forced to run in the |
| // interpreter - such methods won't be compiled to use fast_lock and fast_unlock. |
| // The interpreter provides two properties: |
| // I1: At return-time the interpreter automatically and quietly unlocks any |
| // objects acquired the current activation (frame). Recall that the |
| // interpreter maintains an on-stack list of locks currently held by |
| // a frame. |
| // I2: If a method attempts to unlock an object that is not held by the |
| // the frame the interpreter throws IMSX. |
| // |
| // Lets say A(), which has provably balanced locking, acquires O and then calls B(). |
| // B() doesn't have provably balanced locking so it runs in the interpreter. |
| // Control returns to A() and A() unlocks O. By I1 and I2, above, we know that O |
| // is still locked by A(). |
| // |
| // The only other source of unbalanced locking would be JNI. The "Java Native Interface: |
| // Programmer's Guide and Specification" claims that an object locked by jni_monitorenter |
| // should not be unlocked by "normal" java-level locking and vice-versa. The specification |
| // doesn't specify what will occur if a program engages in such mixed-mode locking, however. |
| |
| enc_class Fast_Unlock( nabxRegP obj, eAXRegP box, eRegP tmp) %{ |
| |
| Register objReg = as_Register($obj$$reg); |
| Register boxReg = as_Register($box$$reg); |
| Register tmpReg = as_Register($tmp$$reg); |
| |
| guarantee (objReg != boxReg, "") ; |
| guarantee (objReg != tmpReg, "") ; |
| guarantee (boxReg != tmpReg, "") ; |
| guarantee (boxReg == as_Register(EAX_enc), "") ; |
| MacroAssembler masm(&cbuf); |
| |
| if (EmitSync & 4) { |
| // Disable - inhibit all inlining. Force control through the slow-path |
| masm.cmpl (rsp, 0) ; |
| } else |
| if (EmitSync & 8) { |
| Label DONE_LABEL ; |
| if (UseBiasedLocking) { |
| masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); |
| } |
| // classic stack-locking code ... |
| masm.movl (tmpReg, Address(boxReg, 0)) ; |
| masm.testl (tmpReg, tmpReg) ; |
| masm.jcc (Assembler::zero, DONE_LABEL) ; |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box |
| masm.bind(DONE_LABEL); |
| } else { |
| Label DONE_LABEL, Stacked, CheckSucc, Inflated ; |
| |
| // Critically, the biased locking test must have precedence over |
| // and appear before the (box->dhw == 0) recursive stack-lock test. |
| if (UseBiasedLocking) { |
| masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); |
| } |
| |
| masm.cmpl (Address(boxReg, 0), 0) ; // Examine the displaced header |
| masm.movl (tmpReg, Address(objReg, 0)) ; // Examine the object's markword |
| masm.jccb (Assembler::zero, DONE_LABEL) ; // 0 indicates recursive stack-lock |
| |
| masm.testl (tmpReg, 0x02) ; // Inflated? |
| masm.jccb (Assembler::zero, Stacked) ; |
| |
| masm.bind (Inflated) ; |
| // It's inflated. |
| // Despite our balanced locking property we still check that m->_owner == Self |
| // as java routines or native JNI code called by this thread might |
| // have released the lock. |
| // Refer to the comments in synchronizer.cpp for how we might encode extra |
| // state in _succ so we can avoid fetching EntryList|cxq. |
| // |
| // I'd like to add more cases in fast_lock() and fast_unlock() -- |
| // such as recursive enter and exit -- but we have to be wary of |
| // I$ bloat, T$ effects and BP$ effects. |
| // |
| // If there's no contention try a 1-0 exit. That is, exit without |
| // a costly MEMBAR or CAS. See synchronizer.cpp for details on how |
| // we detect and recover from the race that the 1-0 exit admits. |
| // |
| // Conceptually Fast_Unlock() must execute a STST|LDST "release" barrier |
| // before it STs null into _owner, releasing the lock. Updates |
| // to data protected by the critical section must be visible before |
| // we drop the lock (and thus before any other thread could acquire |
| // the lock and observe the fields protected by the lock). |
| // IA32's memory-model is SPO, so STs are ordered with respect to |
| // each other and there's no need for an explicit barrier (fence). |
| // See also http://gee.cs.oswego.edu/dl/jmm/cookbook.html. |
| |
| masm.get_thread (boxReg) ; |
| if ((EmitSync & 4096) && VM_Version::supports_3dnow() && os::is_MP()) { |
| // prefetchw [ebx + Offset(_owner)-2] |
| masm.emit_raw (0x0F) ; |
| masm.emit_raw (0x0D) ; |
| masm.emit_raw (0x4B) ; |
| masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; |
| } |
| |
| // Note that we could employ various encoding schemes to reduce |
| // the number of loads below (currently 4) to just 2 or 3. |
| // Refer to the comments in synchronizer.cpp. |
| // In practice the chain of fetches doesn't seem to impact performance, however. |
| if ((EmitSync & 65536) == 0 && (EmitSync & 256)) { |
| // Attempt to reduce branch density - AMD's branch predictor. |
| masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; |
| masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; |
| masm.orl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; |
| masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; |
| masm.jccb (Assembler::notZero, DONE_LABEL) ; |
| masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; |
| masm.jmpb (DONE_LABEL) ; |
| } else { |
| masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; |
| masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; |
| masm.jccb (Assembler::notZero, DONE_LABEL) ; |
| masm.movl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; |
| masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; |
| masm.jccb (Assembler::notZero, CheckSucc) ; |
| masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; |
| masm.jmpb (DONE_LABEL) ; |
| } |
| |
| // The Following code fragment (EmitSync & 65536) improves the performance of |
| // contended applications and contended synchronization microbenchmarks. |
| // Unfortunately the emission of the code - even though not executed - causes regressions |
| // in scimark and jetstream, evidently because of $ effects. Replacing the code |
| // with an equal number of never-executed NOPs results in the same regression. |
| // We leave it off by default. |
| |
| if ((EmitSync & 65536) != 0) { |
| Label LSuccess, LGoSlowPath ; |
| |
| masm.bind (CheckSucc) ; |
| |
| // Optional pre-test ... it's safe to elide this |
| if ((EmitSync & 16) == 0) { |
| masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; |
| masm.jccb (Assembler::zero, LGoSlowPath) ; |
| } |
| |
| // We have a classic Dekker-style idiom: |
| // ST m->_owner = 0 ; MEMBAR; LD m->_succ |
| // There are a number of ways to implement the barrier: |
| // (1) lock:andl &m->_owner, 0 |
| // is fast, but mask doesn't currently support the "ANDL M,IMM32" form. |
| // LOCK: ANDL [ebx+Offset(_Owner)-2], 0 |
| // Encodes as 81 31 OFF32 IMM32 or 83 63 OFF8 IMM8 |
| // (2) If supported, an explicit MFENCE is appealing. |
| // In older IA32 processors MFENCE is slower than lock:add or xchg |
| // particularly if the write-buffer is full as might be the case if |
| // if stores closely precede the fence or fence-equivalent instruction. |
| // In more modern implementations MFENCE appears faster, however. |
| // (3) In lieu of an explicit fence, use lock:addl to the top-of-stack |
| // The $lines underlying the top-of-stack should be in M-state. |
| // The locked add instruction is serializing, of course. |
| // (4) Use xchg, which is serializing |
| // mov boxReg, 0; xchgl boxReg, [tmpReg + Offset(_owner)-2] also works |
| // (5) ST m->_owner = 0 and then execute lock:orl &m->_succ, 0. |
| // The integer condition codes will tell us if succ was 0. |
| // Since _succ and _owner should reside in the same $line and |
| // we just stored into _owner, it's likely that the $line |
| // remains in M-state for the lock:orl. |
| // |
| // We currently use (3), although it's likely that switching to (2) |
| // is correct for the future. |
| |
| masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; |
| if (os::is_MP()) { |
| if (VM_Version::supports_sse2() && 1 == FenceInstruction) { |
| masm.emit_raw (0x0F) ; // MFENCE ... |
| masm.emit_raw (0xAE) ; |
| masm.emit_raw (0xF0) ; |
| } else { |
| masm.lock () ; masm.addl (Address(rsp, 0), 0) ; |
| } |
| } |
| // Ratify _succ remains non-null |
| masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; |
| masm.jccb (Assembler::notZero, LSuccess) ; |
| |
| masm.xorl (boxReg, boxReg) ; // box is really EAX |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg(rsp, Address(tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)); |
| masm.jccb (Assembler::notEqual, LSuccess) ; |
| // Since we're low on registers we installed rsp as a placeholding in _owner. |
| // Now install Self over rsp. This is safe as we're transitioning from |
| // non-null to non=null |
| masm.get_thread (boxReg) ; |
| masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), boxReg) ; |
| // Intentional fall-through into LGoSlowPath ... |
| |
| masm.bind (LGoSlowPath) ; |
| masm.orl (boxReg, 1) ; // set ICC.ZF=0 to indicate failure |
| masm.jmpb (DONE_LABEL) ; |
| |
| masm.bind (LSuccess) ; |
| masm.xorl (boxReg, boxReg) ; // set ICC.ZF=1 to indicate success |
| masm.jmpb (DONE_LABEL) ; |
| } |
| |
| masm.bind (Stacked) ; |
| // It's not inflated and it's not recursively stack-locked and it's not biased. |
| // It must be stack-locked. |
| // Try to reset the header to displaced header. |
| // The "box" value on the stack is stable, so we can reload |
| // and be assured we observe the same value as above. |
| masm.movl (tmpReg, Address(boxReg, 0)) ; |
| if (os::is_MP()) { masm.lock(); } |
| masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box |
| // Intention fall-thru into DONE_LABEL |
| |
| |
| // DONE_LABEL is a hot target - we'd really like to place it at the |
| // start of cache line by padding with NOPs. |
| // See the AMD and Intel software optimization manuals for the |
| // most efficient "long" NOP encodings. |
| // Unfortunately none of our alignment mechanisms suffice. |
| if ((EmitSync & 65536) == 0) { |
| masm.bind (CheckSucc) ; |
| } |
| masm.bind(DONE_LABEL); |
| |
| // Avoid branch to branch on AMD processors |
| if (EmitSync & 32768) { masm.nop() ; } |
| } |
| %} |
| |
| enc_class enc_String_Compare() %{ |
| Label ECX_GOOD_LABEL, LENGTH_DIFF_LABEL, |
| POP_LABEL, DONE_LABEL, CONT_LABEL, |
| WHILE_HEAD_LABEL; |
| MacroAssembler masm(&cbuf); |
| |
| // Get the first character position in both strings |
| // [8] char array, [12] offset, [16] count |
| int value_offset = java_lang_String::value_offset_in_bytes(); |
| int offset_offset = java_lang_String::offset_offset_in_bytes(); |
| int count_offset = java_lang_String::count_offset_in_bytes(); |
| int base_offset = arrayOopDesc::base_offset_in_bytes(T_CHAR); |
| |
| masm.movl(rax, Address(rsi, value_offset)); |
| masm.movl(rcx, Address(rsi, offset_offset)); |
| masm.leal(rax, Address(rax, rcx, Address::times_2, base_offset)); |
| masm.movl(rbx, Address(rdi, value_offset)); |
| masm.movl(rcx, Address(rdi, offset_offset)); |
| masm.leal(rbx, Address(rbx, rcx, Address::times_2, base_offset)); |
| |
| // Compute the minimum of the string lengths(rsi) and the |
| // difference of the string lengths (stack) |
| |
| |
| if (VM_Version::supports_cmov()) { |
| masm.movl(rdi, Address(rdi, count_offset)); |
| masm.movl(rsi, Address(rsi, count_offset)); |
| masm.movl(rcx, rdi); |
| masm.subl(rdi, rsi); |
| masm.pushl(rdi); |
| masm.cmovl(Assembler::lessEqual, rsi, rcx); |
| } else { |
| masm.movl(rdi, Address(rdi, count_offset)); |
| masm.movl(rcx, Address(rsi, count_offset)); |
| masm.movl(rsi, rdi); |
| masm.subl(rdi, rcx); |
| masm.pushl(rdi); |
| masm.jcc(Assembler::lessEqual, ECX_GOOD_LABEL); |
| masm.movl(rsi, rcx); |
| // rsi holds min, rcx is unused |
| } |
| |
| // Is the minimum length zero? |
| masm.bind(ECX_GOOD_LABEL); |
| masm.testl(rsi, rsi); |
| masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); |
| |
| // Load first characters |
| masm.load_unsigned_word(rcx, Address(rbx, 0)); |
| masm.load_unsigned_word(rdi, Address(rax, 0)); |
| |
| // Compare first characters |
| masm.subl(rcx, rdi); |
| masm.jcc(Assembler::notZero, POP_LABEL); |
| masm.decrement(rsi); |
| masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); |
| |
| { |
| // Check after comparing first character to see if strings are equivalent |
| Label LSkip2; |
| // Check if the strings start at same location |
| masm.cmpl(rbx,rax); |
| masm.jcc(Assembler::notEqual, LSkip2); |
| |
| // Check if the length difference is zero (from stack) |
| masm.cmpl(Address(rsp, 0), 0x0); |
| masm.jcc(Assembler::equal, LENGTH_DIFF_LABEL); |
| |
| // Strings might not be equivalent |
| masm.bind(LSkip2); |
| } |
| |
| // Shift rax, and rbx, to the end of the arrays, negate min |
| masm.leal(rax, Address(rax, rsi, Address::times_2, 2)); |
| masm.leal(rbx, Address(rbx, rsi, Address::times_2, 2)); |
| masm.negl(rsi); |
| |
| // Compare the rest of the characters |
| masm.bind(WHILE_HEAD_LABEL); |
| masm.load_unsigned_word(rcx, Address(rbx, rsi, Address::times_2, 0)); |
| masm.load_unsigned_word(rdi, Address(rax, rsi, Address::times_2, 0)); |
| masm.subl(rcx, rdi); |
| masm.jcc(Assembler::notZero, POP_LABEL); |
| masm.increment(rsi); |
| masm.jcc(Assembler::notZero, WHILE_HEAD_LABEL); |
| |
| // Strings are equal up to min length. Return the length difference. |
| masm.bind(LENGTH_DIFF_LABEL); |
| masm.popl(rcx); |
| masm.jmp(DONE_LABEL); |
| |
| // Discard the stored length difference |
| masm.bind(POP_LABEL); |
| masm.addl(rsp, 4); |
| |
| // That's it |
| masm.bind(DONE_LABEL); |
| %} |
| |
| enc_class enc_pop_rdx() %{ |
| emit_opcode(cbuf,0x5A); |
| %} |
| |
| enc_class enc_rethrow() %{ |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf, 0xE9); // jmp entry |
| emit_d32_reloc(cbuf, (int)OptoRuntime::rethrow_stub() - ((int)cbuf.code_end())-4, |
| runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| %} |
| |
| |
| // Convert a double to an int. Java semantics require we do complex |
| // manglelations in the corner cases. So we set the rounding mode to |
| // 'zero', store the darned double down as an int, and reset the |
| // rounding mode to 'nearest'. The hardware throws an exception which |
| // patches up the correct value directly to the stack. |
| enc_class D2I_encoding( regD src ) %{ |
| // Flip to round-to-zero mode. We attempted to allow invalid-op |
| // exceptions here, so that a NAN or other corner-case value will |
| // thrown an exception (but normal values get converted at full speed). |
| // However, I2C adapters and other float-stack manglers leave pending |
| // invalid-op exceptions hanging. We would have to clear them before |
| // enabling them and that is more expensive than just testing for the |
| // invalid value Intel stores down in the corner cases. |
| emit_opcode(cbuf,0xD9); // FLDCW trunc |
| emit_opcode(cbuf,0x2D); |
| emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x04); |
| // Encoding assumes a double has been pushed into FPR0. |
| // Store down the double as an int, popping the FPU stack |
| emit_opcode(cbuf,0xDB); // FISTP [ESP] |
| emit_opcode(cbuf,0x1C); |
| emit_d8(cbuf,0x24); |
| // Restore the rounding mode; mask the exception |
| emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode |
| emit_opcode(cbuf,0x2D); |
| emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() |
| ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() |
| : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); |
| |
| // Load the converted int; adjust CPU stack |
| emit_opcode(cbuf,0x58); // POP EAX |
| emit_opcode(cbuf,0x3D); // CMP EAX,imm |
| emit_d32 (cbuf,0x80000000); // 0x80000000 |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x07); // Size of slow_call |
| // Push src onto stack slow-path |
| emit_opcode(cbuf,0xD9 ); // FLD ST(i) |
| emit_d8 (cbuf,0xC0-1+$src$$reg ); |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Carry on here... |
| %} |
| |
| enc_class D2L_encoding( regD src ) %{ |
| emit_opcode(cbuf,0xD9); // FLDCW trunc |
| emit_opcode(cbuf,0x2D); |
| emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| // Encoding assumes a double has been pushed into FPR0. |
| // Store down the double as a long, popping the FPU stack |
| emit_opcode(cbuf,0xDF); // FISTP [ESP] |
| emit_opcode(cbuf,0x3C); |
| emit_d8(cbuf,0x24); |
| // Restore the rounding mode; mask the exception |
| emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode |
| emit_opcode(cbuf,0x2D); |
| emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() |
| ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() |
| : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); |
| |
| // Load the converted int; adjust CPU stack |
| emit_opcode(cbuf,0x58); // POP EAX |
| emit_opcode(cbuf,0x5A); // POP EDX |
| emit_opcode(cbuf,0x81); // CMP EDX,imm |
| emit_d8 (cbuf,0xFA); // rdx |
| emit_d32 (cbuf,0x80000000); // 0x80000000 |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x07+4); // Size of slow_call |
| emit_opcode(cbuf,0x85); // TEST EAX,EAX |
| emit_opcode(cbuf,0xC0); // 2/rax,/rax, |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x07); // Size of slow_call |
| // Push src onto stack slow-path |
| emit_opcode(cbuf,0xD9 ); // FLD ST(i) |
| emit_d8 (cbuf,0xC0-1+$src$$reg ); |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Carry on here... |
| %} |
| |
| enc_class X2L_encoding( regX src ) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9); // FLDCW trunc |
| emit_opcode(cbuf,0x2D); |
| emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); |
| |
| // Encoding assumes a double has been pushed into FPR0. |
| // Store down the double as a long, popping the FPU stack |
| emit_opcode(cbuf,0xDF); // FISTP [ESP] |
| emit_opcode(cbuf,0x3C); |
| emit_d8(cbuf,0x24); |
| |
| // Restore the rounding mode; mask the exception |
| emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode |
| emit_opcode(cbuf,0x2D); |
| emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() |
| ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() |
| : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); |
| |
| // Load the converted int; adjust CPU stack |
| emit_opcode(cbuf,0x58); // POP EAX |
| |
| emit_opcode(cbuf,0x5A); // POP EDX |
| |
| emit_opcode(cbuf,0x81); // CMP EDX,imm |
| emit_d8 (cbuf,0xFA); // rdx |
| emit_d32 (cbuf,0x80000000);// 0x80000000 |
| |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x13+4); // Size of slow_call |
| |
| emit_opcode(cbuf,0x85); // TEST EAX,EAX |
| emit_opcode(cbuf,0xC0); // 2/rax,/rax, |
| |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x13); // Size of slow_call |
| |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x04); |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,4 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,0x04); |
| |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Carry on here... |
| %} |
| |
| enc_class XD2L_encoding( regXD src ) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9); // FLDCW trunc |
| emit_opcode(cbuf,0x2D); |
| emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); |
| |
| // Encoding assumes a double has been pushed into FPR0. |
| // Store down the double as a long, popping the FPU stack |
| emit_opcode(cbuf,0xDF); // FISTP [ESP] |
| emit_opcode(cbuf,0x3C); |
| emit_d8(cbuf,0x24); |
| |
| // Restore the rounding mode; mask the exception |
| emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode |
| emit_opcode(cbuf,0x2D); |
| emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() |
| ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() |
| : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); |
| |
| // Load the converted int; adjust CPU stack |
| emit_opcode(cbuf,0x58); // POP EAX |
| |
| emit_opcode(cbuf,0x5A); // POP EDX |
| |
| emit_opcode(cbuf,0x81); // CMP EDX,imm |
| emit_d8 (cbuf,0xFA); // rdx |
| emit_d32 (cbuf,0x80000000); // 0x80000000 |
| |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x13+4); // Size of slow_call |
| |
| emit_opcode(cbuf,0x85); // TEST EAX,EAX |
| emit_opcode(cbuf,0xC0); // 2/rax,/rax, |
| |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x13); // Size of slow_call |
| |
| // Push src onto stack slow-path |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,8 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x08); |
| |
| emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xDD ); // FLD_D [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,8 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,0x08); |
| |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| // Carry on here... |
| %} |
| |
| enc_class D2X_encoding( regX dst, regD src ) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x04); |
| int pop = 0x02; |
| if ($src$$reg != FPR1L_enc) { |
| emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) |
| emit_d8( cbuf, 0xC0-1+$src$$reg ); |
| pop = 0x03; |
| } |
| store_to_stackslot( cbuf, 0xD9, pop, 0 ); // FST<P>_S [ESP] |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x10 ); |
| encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,4 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,0x04); |
| // Carry on here... |
| %} |
| |
| enc_class FX2I_encoding( regX src, eRegI dst ) %{ |
| emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); |
| |
| // Compare the result to see if we need to go to the slow path |
| emit_opcode(cbuf,0x81); // CMP dst,imm |
| emit_rm (cbuf,0x3,0x7,$dst$$reg); |
| emit_d32 (cbuf,0x80000000); // 0x80000000 |
| |
| emit_opcode(cbuf,0x75); // JNE around_slow_call |
| emit_d8 (cbuf,0x13); // Size of slow_call |
| // Store xmm to a temp memory |
| // location and push it onto stack. |
| |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf, $primary ? 0x8 : 0x4); |
| |
| emit_opcode (cbuf, $primary ? 0xF2 : 0xF3 ); // MOVSS [ESP], xmm |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf, $primary ? 0xDD : 0xD9 ); // FLD [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,4 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf, $primary ? 0x8 : 0x4); |
| |
| // CALL directly to the runtime |
| cbuf.set_inst_mark(); |
| emit_opcode(cbuf,0xE8); // Call into runtime |
| emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); |
| |
| // Carry on here... |
| %} |
| |
| enc_class X2D_encoding( regD dst, regX src ) %{ |
| // Allocate a word |
| emit_opcode(cbuf,0x83); // SUB ESP,4 |
| emit_opcode(cbuf,0xEC); |
| emit_d8(cbuf,0x04); |
| |
| emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], xmm |
| emit_opcode (cbuf, 0x0F ); |
| emit_opcode (cbuf, 0x11 ); |
| encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] |
| encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); |
| |
| emit_opcode(cbuf,0x83); // ADD ESP,4 |
| emit_opcode(cbuf,0xC4); |
| emit_d8(cbuf,0x04); |
| |
| // Carry on here... |
| %} |
| |
| enc_class AbsXF_encoding(regX dst) %{ |
| address signmask_address=(address)float_signmask_pool; |
| // andpd:\tANDPS $dst,[signconst] |
| emit_opcode(cbuf, 0x0F); |
| emit_opcode(cbuf, 0x54); |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_d32(cbuf, (int)signmask_address); |
| %} |
| |
| enc_class AbsXD_encoding(regXD dst) %{ |
| address signmask_address=(address)double_signmask_pool; |
| // andpd:\tANDPD $dst,[signconst] |
| emit_opcode(cbuf, 0x66); |
| emit_opcode(cbuf, 0x0F); |
| emit_opcode(cbuf, 0x54); |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_d32(cbuf, (int)signmask_address); |
| %} |
| |
| enc_class NegXF_encoding(regX dst) %{ |
| address signmask_address=(address)float_signflip_pool; |
| // andpd:\tXORPS $dst,[signconst] |
| emit_opcode(cbuf, 0x0F); |
| emit_opcode(cbuf, 0x57); |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_d32(cbuf, (int)signmask_address); |
| %} |
| |
| enc_class NegXD_encoding(regXD dst) %{ |
| address signmask_address=(address)double_signflip_pool; |
| // andpd:\tXORPD $dst,[signconst] |
| emit_opcode(cbuf, 0x66); |
| emit_opcode(cbuf, 0x0F); |
| emit_opcode(cbuf, 0x57); |
| emit_rm(cbuf, 0x0, $dst$$reg, 0x5); |
| emit_d32(cbuf, (int)signmask_address); |
| %} |
| |
| enc_class FMul_ST_reg( eRegF src1 ) %{ |
| // Operand was loaded from memory into fp ST (stack top) |
| // FMUL ST,$src /* D8 C8+i */ |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xC8 + $src1$$reg); |
| %} |
| |
| enc_class FAdd_ST_reg( eRegF src2 ) %{ |
| // FADDP ST,src2 /* D8 C0+i */ |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xC0 + $src2$$reg); |
| //could use FADDP src2,fpST /* DE C0+i */ |
| %} |
| |
| enc_class FAddP_reg_ST( eRegF src2 ) %{ |
| // FADDP src2,ST /* DE C0+i */ |
| emit_opcode(cbuf, 0xDE); |
| emit_opcode(cbuf, 0xC0 + $src2$$reg); |
| %} |
| |
| enc_class subF_divF_encode( eRegF src1, eRegF src2) %{ |
| // Operand has been loaded into fp ST (stack top) |
| // FSUB ST,$src1 |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xE0 + $src1$$reg); |
| |
| // FDIV |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xF0 + $src2$$reg); |
| %} |
| |
| enc_class MulFAddF (eRegF src1, eRegF src2) %{ |
| // Operand was loaded from memory into fp ST (stack top) |
| // FADD ST,$src /* D8 C0+i */ |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xC0 + $src1$$reg); |
| |
| // FMUL ST,src2 /* D8 C*+i */ |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xC8 + $src2$$reg); |
| %} |
| |
| |
| enc_class MulFAddFreverse (eRegF src1, eRegF src2) %{ |
| // Operand was loaded from memory into fp ST (stack top) |
| // FADD ST,$src /* D8 C0+i */ |
| emit_opcode(cbuf, 0xD8); |
| emit_opcode(cbuf, 0xC0 + $src1$$reg); |
| |
| // FMULP src2,ST /* DE C8+i */ |
| emit_opcode(cbuf, 0xDE); |
| emit_opcode(cbuf, 0xC8 + $src2$$reg); |
| %} |
| |
| enc_class enc_membar_acquire %{ |
| // Doug Lea believes this is not needed with current Sparcs and TSO. |
| // MacroAssembler masm(&cbuf); |
| // masm.membar(); |
| %} |
| |
| enc_class enc_membar_release %{ |
| // Doug Lea believes this is not needed with current Sparcs and TSO. |
| // MacroAssembler masm(&cbuf); |
| // masm.membar(); |
| %} |
| |
| enc_class enc_membar_volatile %{ |
| MacroAssembler masm(&cbuf); |
| masm.membar(); |
| %} |
| |
| // Atomically load the volatile long |
| enc_class enc_loadL_volatile( memory mem, stackSlotL dst ) %{ |
| emit_opcode(cbuf,0xDF); |
| int rm_byte_opcode = 0x05; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); |
| store_to_stackslot( cbuf, 0x0DF, 0x07, $dst$$disp ); |
| %} |
| |
| enc_class enc_loadLX_volatile( memory mem, stackSlotL dst, regXD tmp ) %{ |
| { // Atomic long load |
| // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| { // MOVSD $dst,$tmp ! atomic long store |
| emit_opcode(cbuf,0xF2); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x11); |
| int base = $dst$$base; |
| int index = $dst$$index; |
| int scale = $dst$$scale; |
| int displace = $dst$$disp; |
| bool disp_is_oop = $dst->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| %} |
| |
| enc_class enc_loadLX_reg_volatile( memory mem, eRegL dst, regXD tmp ) %{ |
| { // Atomic long load |
| // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| { // MOVD $dst.lo,$tmp |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x7E); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $dst$$reg); |
| } |
| { // PSRLQ $tmp,32 |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x73); |
| emit_rm(cbuf, 0x3, 0x02, $tmp$$reg); |
| emit_d8(cbuf, 0x20); |
| } |
| { // MOVD $dst.hi,$tmp |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x7E); |
| emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); |
| } |
| %} |
| |
| // Volatile Store Long. Must be atomic, so move it into |
| // the FP TOS and then do a 64-bit FIST. Has to probe the |
| // target address before the store (for null-ptr checks) |
| // so the memory operand is used twice in the encoding. |
| enc_class enc_storeL_volatile( memory mem, stackSlotL src ) %{ |
| store_to_stackslot( cbuf, 0x0DF, 0x05, $src$$disp ); |
| cbuf.set_inst_mark(); // Mark start of FIST in case $mem has an oop |
| emit_opcode(cbuf,0xDF); |
| int rm_byte_opcode = 0x07; |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); |
| %} |
| |
| enc_class enc_storeLX_volatile( memory mem, stackSlotL src, regXD tmp) %{ |
| { // Atomic long load |
| // UseXmmLoadAndClearUpper ? movsd $tmp,[$src] : movlpd $tmp,[$src] |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); |
| int base = $src$$base; |
| int index = $src$$index; |
| int scale = $src$$scale; |
| int displace = $src$$disp; |
| bool disp_is_oop = $src->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop |
| { // MOVSD $mem,$tmp ! atomic long store |
| emit_opcode(cbuf,0xF2); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x11); |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| %} |
| |
| enc_class enc_storeLX_reg_volatile( memory mem, eRegL src, regXD tmp, regXD tmp2) %{ |
| { // MOVD $tmp,$src.lo |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x6E); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); |
| } |
| { // MOVD $tmp2,$src.hi |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x6E); |
| emit_rm(cbuf, 0x3, $tmp2$$reg, HIGH_FROM_LOW($src$$reg)); |
| } |
| { // PUNPCKLDQ $tmp,$tmp2 |
| emit_opcode(cbuf,0x66); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x62); |
| emit_rm(cbuf, 0x3, $tmp$$reg, $tmp2$$reg); |
| } |
| cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop |
| { // MOVSD $mem,$tmp ! atomic long store |
| emit_opcode(cbuf,0xF2); |
| emit_opcode(cbuf,0x0F); |
| emit_opcode(cbuf,0x11); |
| int base = $mem$$base; |
| int index = $mem$$index; |
| int scale = $mem$$scale; |
| int displace = $mem$$disp; |
| bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals |
| encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); |
| } |
| %} |
| |
| // Safepoint Poll. This polls the safepoint page, and causes an |
| // exception if it is not readable. Unfortunately, it kills the condition code |
| // in the process |
| // We current use TESTL [spp],EDI |
| // A better choice might be TESTB [spp + pagesize() - CacheLineSize()],0 |
| |
| enc_class Safepoint_Poll() %{ |
| cbuf.relocate(cbuf.inst_mark(), relocInfo::poll_type, 0); |
| emit_opcode(cbuf,0x85); |
| emit_rm (cbuf, 0x0, 0x7, 0x5); |
| emit_d32(cbuf, (intptr_t)os::get_polling_page()); |
| %} |
| %} |
| |
| |
| //----------FRAME-------------------------------------------------------------- |
| // Definition of frame structure and management information. |
| // |
| // S T A C K L A Y O U T Allocators stack-slot number |
| // | (to get allocators register number |
| // G Owned by | | v add OptoReg::stack0()) |
| // r CALLER | | |
| // o | +--------+ pad to even-align allocators stack-slot |
| // w V | pad0 | numbers; owned by CALLER |
| // t -----------+--------+----> Matcher::_in_arg_limit, unaligned |
| // h ^ | in | 5 |
| // | | args | 4 Holes in incoming args owned by SELF |
| // | | | | 3 |
| // | | +--------+ |
| // V | | old out| Empty on Intel, window on Sparc |
| // | old |preserve| Must be even aligned. |
| // | SP-+--------+----> Matcher::_old_SP, even aligned |
| // | | in | 3 area for Intel ret address |
| // Owned by |preserve| Empty on Sparc. |
| // SELF +--------+ |
| // | | pad2 | 2 pad to align old SP |
| // | +--------+ 1 |
| // | | locks | 0 |
| // | +--------+----> OptoReg::stack0(), even aligned |
| // | | pad1 | 11 pad to align new SP |
| // | +--------+ |
| // | | | 10 |
| // | | spills | 9 spills |
| // V | | 8 (pad0 slot for callee) |
| // -----------+--------+----> Matcher::_out_arg_limit, unaligned |
| // ^ | out | 7 |
| // | | args | 6 Holes in outgoing args owned by CALLEE |
| // Owned by +--------+ |
| // CALLEE | new out| 6 Empty on Intel, window on Sparc |
| // | new |preserve| Must be even-aligned. |
| // | SP-+--------+----> Matcher::_new_SP, even aligned |
| // | | | |
| // |
| // Note 1: Only region 8-11 is determined by the allocator. Region 0-5 is |
| // known from SELF's arguments and the Java calling convention. |
| // Region 6-7 is determined per call site. |
| // Note 2: If the calling convention leaves holes in the incoming argument |
| // area, those holes are owned by SELF. Holes in the outgoing area |
| // are owned by the CALLEE. Holes should not be nessecary in the |
| // incoming area, as the Java calling convention is completely under |
| // the control of the AD file. Doubles can be sorted and packed to |
| // avoid holes. Holes in the outgoing arguments may be nessecary for |
| // varargs C calling conventions. |
| // Note 3: Region 0-3 is even aligned, with pad2 as needed. Region 3-5 is |
| // even aligned with pad0 as needed. |
| // Region 6 is even aligned. Region 6-7 is NOT even aligned; |
| // region 6-11 is even aligned; it may be padded out more so that |
| // the region from SP to FP meets the minimum stack alignment. |
| |
| frame %{ |
| // What direction does stack grow in (assumed to be same for C & Java) |
| stack_direction(TOWARDS_LOW); |
| |
| // These three registers define part of the calling convention |
| // between compiled code and the interpreter. |
| inline_cache_reg(EAX); // Inline Cache Register |
| interpreter_method_oop_reg(EBX); // Method Oop Register when calling interpreter |
| |
| // Optional: name the operand used by cisc-spilling to access [stack_pointer + offset] |
| cisc_spilling_operand_name(indOffset32); |
| |
| // Number of stack slots consumed by locking an object |
| sync_stack_slots(1); |
| |
| // Compiled code's Frame Pointer |
| frame_pointer(ESP); |
| // Interpreter stores its frame pointer in a register which is |
| // stored to the stack by I2CAdaptors. |
| // I2CAdaptors convert from interpreted java to compiled java. |
| interpreter_frame_pointer(EBP); |
| |
| // Stack alignment requirement |
| // Alignment size in bytes (128-bit -> 16 bytes) |
| stack_alignment(StackAlignmentInBytes); |
| |
| // Number of stack slots between incoming argument block and the start of |
| // a new frame. The PROLOG must add this many slots to the stack. The |
| // EPILOG must remove this many slots. Intel needs one slot for |
| // return address and one for rbp, (must save rbp) |
| in_preserve_stack_slots(2+VerifyStackAtCalls); |
| |
| // Number of outgoing stack slots killed above the out_preserve_stack_slots |
| // for calls to C. Supports the var-args backing area for register parms. |
| varargs_C_out_slots_killed(0); |
| |
| // The after-PROLOG location of the return address. Location of |
| // return address specifies a type (REG or STACK) and a number |
| // representing the register number (i.e. - use a register name) or |
| // stack slot. |
| // Ret Addr is on stack in slot 0 if no locks or verification or alignment. |
| // Otherwise, it is above the locks and verification slot and alignment word |
| return_addr(STACK - 1 + |
| round_to(1+VerifyStackAtCalls+ |
| Compile::current()->fixed_slots(), |
| (StackAlignmentInBytes/wordSize))); |
| |
| // Body of function which returns an integer array locating |
| // arguments either in registers or in stack slots. Passed an array |
| // of ideal registers called "sig" and a "length" count. Stack-slot |
| // offsets are based on outgoing arguments, i.e. a CALLER setting up |
| // arguments for a CALLEE. Incoming stack arguments are |
| // automatically biased by the preserve_stack_slots field above. |
| calling_convention %{ |
| // No difference between ingoing/outgoing just pass false |
| SharedRuntime::java_calling_convention(sig_bt, regs, length, false); |
| %} |
| |
| |
| // Body of function which returns an integer array locating |
| // arguments either in registers or in stack slots. Passed an array |
| // of ideal registers called "sig" and a "length" count. Stack-slot |
| // offsets are based on outgoing arguments, i.e. a CALLER setting up |
| // arguments for a CALLEE. Incoming stack arguments are |
| // automatically biased by the preserve_stack_slots field above. |
| c_calling_convention %{ |
| // This is obviously always outgoing |
| (void) SharedRuntime::c_calling_convention(sig_bt, regs, length); |
| %} |
| |
| // Location of C & interpreter return values |
| c_return_value %{ |
| assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); |
| static int lo[Op_RegL+1] = { 0, 0, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; |
| static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; |
| |
| // in SSE2+ mode we want to keep the FPU stack clean so pretend |
| // that C functions return float and double results in XMM0. |
| if( ideal_reg == Op_RegD && UseSSE>=2 ) |
| return OptoRegPair(XMM0b_num,XMM0a_num); |
| if( ideal_reg == Op_RegF && UseSSE>=2 ) |
| return OptoRegPair(OptoReg::Bad,XMM0a_num); |
| |
| return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); |
| %} |
| |
| // Location of return values |
| return_value %{ |
| assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); |
| static int lo[Op_RegL+1] = { 0, 0, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; |
| static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; |
| if( ideal_reg == Op_RegD && UseSSE>=2 ) |
| return OptoRegPair(XMM0b_num,XMM0a_num); |
| if( ideal_reg == Op_RegF && UseSSE>=1 ) |
| return OptoRegPair(OptoReg::Bad,XMM0a_num); |
| return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); |
| %} |
| |
| %} |
| |
| //----------ATTRIBUTES--------------------------------------------------------- |
| //----------Operand Attributes------------------------------------------------- |
| op_attrib op_cost(0); // Required cost attribute |
| |
| //----------Instruction Attributes--------------------------------------------- |
| ins_attrib ins_cost(100); // Required cost attribute |
| ins_attrib ins_size(8); // Required size attribute (in bits) |
| ins_attrib ins_pc_relative(0); // Required PC Relative flag |
| ins_attrib ins_short_branch(0); // Required flag: is this instruction a |
| // non-matching short branch variant of some |
| // long branch? |
| ins_attrib ins_alignment(1); // Required alignment attribute (must be a power of 2) |
| // specifies the alignment that some part of the instruction (not |
| // necessarily the start) requires. If > 1, a compute_padding() |
| // function must be provided for the instruction |
| |
| //----------OPERANDS----------------------------------------------------------- |
| // Operand definitions must precede instruction definitions for correct parsing |
| // in the ADLC because operands constitute user defined types which are used in |
| // instruction definitions. |
| |
| //----------Simple Operands---------------------------------------------------- |
| // Immediate Operands |
| // Integer Immediate |
| operand immI() %{ |
| match(ConI); |
| |
| op_cost(10); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Constant for test vs zero |
| operand immI0() %{ |
| predicate(n->get_int() == 0); |
| match(ConI); |
| |
| op_cost(0); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Constant for increment |
| operand immI1() %{ |
| predicate(n->get_int() == 1); |
| match(ConI); |
| |
| op_cost(0); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Constant for decrement |
| operand immI_M1() %{ |
| predicate(n->get_int() == -1); |
| match(ConI); |
| |
| op_cost(0); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Valid scale values for addressing modes |
| operand immI2() %{ |
| predicate(0 <= n->get_int() && (n->get_int() <= 3)); |
| match(ConI); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immI8() %{ |
| predicate((-128 <= n->get_int()) && (n->get_int() <= 127)); |
| match(ConI); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immI16() %{ |
| predicate((-32768 <= n->get_int()) && (n->get_int() <= 32767)); |
| match(ConI); |
| |
| op_cost(10); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Constant for long shifts |
| operand immI_32() %{ |
| predicate( n->get_int() == 32 ); |
| match(ConI); |
| |
| op_cost(0); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immI_1_31() %{ |
| predicate( n->get_int() >= 1 && n->get_int() <= 31 ); |
| match(ConI); |
| |
| op_cost(0); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immI_32_63() %{ |
| predicate( n->get_int() >= 32 && n->get_int() <= 63 ); |
| match(ConI); |
| op_cost(0); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Pointer Immediate |
| operand immP() %{ |
| match(ConP); |
| |
| op_cost(10); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // NULL Pointer Immediate |
| operand immP0() %{ |
| predicate( n->get_ptr() == 0 ); |
| match(ConP); |
| op_cost(0); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Long Immediate |
| operand immL() %{ |
| match(ConL); |
| |
| op_cost(20); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Long Immediate zero |
| operand immL0() %{ |
| predicate( n->get_long() == 0L ); |
| match(ConL); |
| op_cost(0); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Long immediate from 0 to 127. |
| // Used for a shorter form of long mul by 10. |
| operand immL_127() %{ |
| predicate((0 <= n->get_long()) && (n->get_long() <= 127)); |
| match(ConL); |
| op_cost(0); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Long Immediate: low 32-bit mask |
| operand immL_32bits() %{ |
| predicate(n->get_long() == 0xFFFFFFFFL); |
| match(ConL); |
| op_cost(0); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Long Immediate: low 32-bit mask |
| operand immL32() %{ |
| predicate(n->get_long() == (int)(n->get_long())); |
| match(ConL); |
| op_cost(20); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| //Double Immediate zero |
| operand immD0() %{ |
| // Do additional (and counter-intuitive) test against NaN to work around VC++ |
| // bug that generates code such that NaNs compare equal to 0.0 |
| predicate( UseSSE<=1 && n->getd() == 0.0 && !g_isnan(n->getd()) ); |
| match(ConD); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Double Immediate |
| operand immD1() %{ |
| predicate( UseSSE<=1 && n->getd() == 1.0 ); |
| match(ConD); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Double Immediate |
| operand immD() %{ |
| predicate(UseSSE<=1); |
| match(ConD); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immXD() %{ |
| predicate(UseSSE>=2); |
| match(ConD); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Double Immediate zero |
| operand immXD0() %{ |
| // Do additional (and counter-intuitive) test against NaN to work around VC++ |
| // bug that generates code such that NaNs compare equal to 0.0 AND do not |
| // compare equal to -0.0. |
| predicate( UseSSE>=2 && jlong_cast(n->getd()) == 0 ); |
| match(ConD); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Float Immediate zero |
| operand immF0() %{ |
| predicate( UseSSE == 0 && n->getf() == 0.0 ); |
| match(ConF); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Float Immediate |
| operand immF() %{ |
| predicate( UseSSE == 0 ); |
| match(ConF); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Float Immediate |
| operand immXF() %{ |
| predicate(UseSSE >= 1); |
| match(ConF); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Float Immediate zero. Zero and not -0.0 |
| operand immXF0() %{ |
| predicate( UseSSE >= 1 && jint_cast(n->getf()) == 0 ); |
| match(ConF); |
| |
| op_cost(5); |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Immediates for special shifts (sign extend) |
| |
| // Constants for increment |
| operand immI_16() %{ |
| predicate( n->get_int() == 16 ); |
| match(ConI); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| operand immI_24() %{ |
| predicate( n->get_int() == 24 ); |
| match(ConI); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Constant for byte-wide masking |
| operand immI_255() %{ |
| predicate( n->get_int() == 255 ); |
| match(ConI); |
| |
| format %{ %} |
| interface(CONST_INTER); |
| %} |
| |
| // Register Operands |
| // Integer Register |
| operand eRegI() %{ |
| constraint(ALLOC_IN_RC(e_reg)); |
| match(RegI); |
| match(xRegI); |
| match(eAXRegI); |
| match(eBXRegI); |
| match(eCXRegI); |
| match(eDXRegI); |
| match(eDIRegI); |
| match(eSIRegI); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // Subset of Integer Register |
| operand xRegI(eRegI reg) %{ |
| constraint(ALLOC_IN_RC(x_reg)); |
| match(reg); |
| match(eAXRegI); |
| match(eBXRegI); |
| match(eCXRegI); |
| match(eDXRegI); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // Special Registers |
| operand eAXRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(eax_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "EAX" %} |
| interface(REG_INTER); |
| %} |
| |
| // Special Registers |
| operand eBXRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(ebx_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "EBX" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eCXRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(ecx_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "ECX" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eDXRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(edx_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "EDX" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eDIRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(edi_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "EDI" %} |
| interface(REG_INTER); |
| %} |
| |
| operand naxRegI() %{ |
| constraint(ALLOC_IN_RC(nax_reg)); |
| match(RegI); |
| match(eCXRegI); |
| match(eDXRegI); |
| match(eSIRegI); |
| match(eDIRegI); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand nadxRegI() %{ |
| constraint(ALLOC_IN_RC(nadx_reg)); |
| match(RegI); |
| match(eBXRegI); |
| match(eCXRegI); |
| match(eSIRegI); |
| match(eDIRegI); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand ncxRegI() %{ |
| constraint(ALLOC_IN_RC(ncx_reg)); |
| match(RegI); |
| match(eAXRegI); |
| match(eDXRegI); |
| match(eSIRegI); |
| match(eDIRegI); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // // This operand was used by cmpFastUnlock, but conflicted with 'object' reg |
| // // |
| operand eSIRegI(xRegI reg) %{ |
| constraint(ALLOC_IN_RC(esi_reg)); |
| match(reg); |
| match(eRegI); |
| |
| format %{ "ESI" %} |
| interface(REG_INTER); |
| %} |
| |
| // Pointer Register |
| operand anyRegP() %{ |
| constraint(ALLOC_IN_RC(any_reg)); |
| match(RegP); |
| match(eAXRegP); |
| match(eBXRegP); |
| match(eCXRegP); |
| match(eDIRegP); |
| match(eRegP); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand eRegP() %{ |
| constraint(ALLOC_IN_RC(e_reg)); |
| match(RegP); |
| match(eAXRegP); |
| match(eBXRegP); |
| match(eCXRegP); |
| match(eDIRegP); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // On windows95, EBP is not safe to use for implicit null tests. |
| operand eRegP_no_EBP() %{ |
| constraint(ALLOC_IN_RC(e_reg_no_rbp)); |
| match(RegP); |
| match(eAXRegP); |
| match(eBXRegP); |
| match(eCXRegP); |
| match(eDIRegP); |
| |
| op_cost(100); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand naxRegP() %{ |
| constraint(ALLOC_IN_RC(nax_reg)); |
| match(RegP); |
| match(eBXRegP); |
| match(eDXRegP); |
| match(eCXRegP); |
| match(eSIRegP); |
| match(eDIRegP); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand nabxRegP() %{ |
| constraint(ALLOC_IN_RC(nabx_reg)); |
| match(RegP); |
| match(eCXRegP); |
| match(eDXRegP); |
| match(eSIRegP); |
| match(eDIRegP); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand pRegP() %{ |
| constraint(ALLOC_IN_RC(p_reg)); |
| match(RegP); |
| match(eBXRegP); |
| match(eDXRegP); |
| match(eSIRegP); |
| match(eDIRegP); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // Special Registers |
| // Return a pointer value |
| operand eAXRegP(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(eax_reg)); |
| match(reg); |
| format %{ "EAX" %} |
| interface(REG_INTER); |
| %} |
| |
| // Used in AtomicAdd |
| operand eBXRegP(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(ebx_reg)); |
| match(reg); |
| format %{ "EBX" %} |
| interface(REG_INTER); |
| %} |
| |
| // Tail-call (interprocedural jump) to interpreter |
| operand eCXRegP(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(ecx_reg)); |
| match(reg); |
| format %{ "ECX" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eSIRegP(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(esi_reg)); |
| match(reg); |
| format %{ "ESI" %} |
| interface(REG_INTER); |
| %} |
| |
| // Used in rep stosw |
| operand eDIRegP(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(edi_reg)); |
| match(reg); |
| format %{ "EDI" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eBPRegP() %{ |
| constraint(ALLOC_IN_RC(ebp_reg)); |
| match(RegP); |
| format %{ "EBP" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eRegL() %{ |
| constraint(ALLOC_IN_RC(long_reg)); |
| match(RegL); |
| match(eADXRegL); |
| |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand eADXRegL( eRegL reg ) %{ |
| constraint(ALLOC_IN_RC(eadx_reg)); |
| match(reg); |
| |
| format %{ "EDX:EAX" %} |
| interface(REG_INTER); |
| %} |
| |
| operand eBCXRegL( eRegL reg ) %{ |
| constraint(ALLOC_IN_RC(ebcx_reg)); |
| match(reg); |
| |
| format %{ "EBX:ECX" %} |
| interface(REG_INTER); |
| %} |
| |
| // Special case for integer high multiply |
| operand eADXRegL_low_only() %{ |
| constraint(ALLOC_IN_RC(eadx_reg)); |
| match(RegL); |
| |
| format %{ "EAX" %} |
| interface(REG_INTER); |
| %} |
| |
| // Flags register, used as output of compare instructions |
| operand eFlagsReg() %{ |
| constraint(ALLOC_IN_RC(int_flags)); |
| match(RegFlags); |
| |
| format %{ "EFLAGS" %} |
| interface(REG_INTER); |
| %} |
| |
| // Flags register, used as output of FLOATING POINT compare instructions |
| operand eFlagsRegU() %{ |
| constraint(ALLOC_IN_RC(int_flags)); |
| match(RegFlags); |
| |
| format %{ "EFLAGS_U" %} |
| interface(REG_INTER); |
| %} |
| |
| // Condition Code Register used by long compare |
| operand flagsReg_long_LTGE() %{ |
| constraint(ALLOC_IN_RC(int_flags)); |
| match(RegFlags); |
| format %{ "FLAGS_LTGE" %} |
| interface(REG_INTER); |
| %} |
| operand flagsReg_long_EQNE() %{ |
| constraint(ALLOC_IN_RC(int_flags)); |
| match(RegFlags); |
| format %{ "FLAGS_EQNE" %} |
| interface(REG_INTER); |
| %} |
| operand flagsReg_long_LEGT() %{ |
| constraint(ALLOC_IN_RC(int_flags)); |
| match(RegFlags); |
| format %{ "FLAGS_LEGT" %} |
| interface(REG_INTER); |
| %} |
| |
| // Float register operands |
| operand regD() %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(dbl_reg)); |
| match(RegD); |
| match(regDPR1); |
| match(regDPR2); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| operand regDPR1(regD reg) %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(dbl_reg0)); |
| match(reg); |
| format %{ "FPR1" %} |
| interface(REG_INTER); |
| %} |
| |
| operand regDPR2(regD reg) %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(dbl_reg1)); |
| match(reg); |
| format %{ "FPR2" %} |
| interface(REG_INTER); |
| %} |
| |
| operand regnotDPR1(regD reg) %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(dbl_notreg0)); |
| match(reg); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // XMM Double register operands |
| operand regXD() %{ |
| predicate( UseSSE>=2 ); |
| constraint(ALLOC_IN_RC(xdb_reg)); |
| match(RegD); |
| match(regXD6); |
| match(regXD7); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // XMM6 double register operands |
| operand regXD6(regXD reg) %{ |
| predicate( UseSSE>=2 ); |
| constraint(ALLOC_IN_RC(xdb_reg6)); |
| match(reg); |
| format %{ "XMM6" %} |
| interface(REG_INTER); |
| %} |
| |
| // XMM7 double register operands |
| operand regXD7(regXD reg) %{ |
| predicate( UseSSE>=2 ); |
| constraint(ALLOC_IN_RC(xdb_reg7)); |
| match(reg); |
| format %{ "XMM7" %} |
| interface(REG_INTER); |
| %} |
| |
| // Float register operands |
| operand regF() %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(flt_reg)); |
| match(RegF); |
| match(regFPR1); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // Float register operands |
| operand regFPR1(regF reg) %{ |
| predicate( UseSSE < 2 ); |
| constraint(ALLOC_IN_RC(flt_reg0)); |
| match(reg); |
| format %{ "FPR1" %} |
| interface(REG_INTER); |
| %} |
| |
| // XMM register operands |
| operand regX() %{ |
| predicate( UseSSE>=1 ); |
| constraint(ALLOC_IN_RC(xmm_reg)); |
| match(RegF); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| |
| //----------Memory Operands---------------------------------------------------- |
| // Direct Memory Operand |
| operand direct(immP addr) %{ |
| match(addr); |
| |
| format %{ "[$addr]" %} |
| interface(MEMORY_INTER) %{ |
| base(0xFFFFFFFF); |
| index(0x4); |
| scale(0x0); |
| disp($addr); |
| %} |
| %} |
| |
| // Indirect Memory Operand |
| operand indirect(eRegP reg) %{ |
| constraint(ALLOC_IN_RC(e_reg)); |
| match(reg); |
| |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp(0x0); |
| %} |
| %} |
| |
| // Indirect Memory Plus Short Offset Operand |
| operand indOffset8(eRegP reg, immI8 off) %{ |
| match(AddP reg off); |
| |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Long Offset Operand |
| operand indOffset32(eRegP reg, immI off) %{ |
| match(AddP reg off); |
| |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Long Offset Operand |
| operand indOffset32X(eRegI reg, immP off) %{ |
| match(AddP off reg); |
| |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Index Register Plus Offset Operand |
| operand indIndexOffset(eRegP reg, eRegI ireg, immI off) %{ |
| match(AddP (AddP reg ireg) off); |
| |
| op_cost(10); |
| format %{"[$reg + $off + $ireg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Index Register Plus Offset Operand |
| operand indIndex(eRegP reg, eRegI ireg) %{ |
| match(AddP reg ireg); |
| |
| op_cost(10); |
| format %{"[$reg + $ireg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale(0x0); |
| disp(0x0); |
| %} |
| %} |
| |
| // // ------------------------------------------------------------------------- |
| // // 486 architecture doesn't support "scale * index + offset" with out a base |
| // // ------------------------------------------------------------------------- |
| // // Scaled Memory Operands |
| // // Indirect Memory Times Scale Plus Offset Operand |
| // operand indScaleOffset(immP off, eRegI ireg, immI2 scale) %{ |
| // match(AddP off (LShiftI ireg scale)); |
| // |
| // op_cost(10); |
| // format %{"[$off + $ireg << $scale]" %} |
| // interface(MEMORY_INTER) %{ |
| // base(0x4); |
| // index($ireg); |
| // scale($scale); |
| // disp($off); |
| // %} |
| // %} |
| |
| // Indirect Memory Times Scale Plus Index Register |
| operand indIndexScale(eRegP reg, eRegI ireg, immI2 scale) %{ |
| match(AddP reg (LShiftI ireg scale)); |
| |
| op_cost(10); |
| format %{"[$reg + $ireg << $scale]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale($scale); |
| disp(0x0); |
| %} |
| %} |
| |
| // Indirect Memory Times Scale Plus Index Register Plus Offset Operand |
| operand indIndexScaleOffset(eRegP reg, immI off, eRegI ireg, immI2 scale) %{ |
| match(AddP (AddP reg (LShiftI ireg scale)) off); |
| |
| op_cost(10); |
| format %{"[$reg + $off + $ireg << $scale]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale($scale); |
| disp($off); |
| %} |
| %} |
| |
| //----------Load Long Memory Operands------------------------------------------ |
| // The load-long idiom will use it's address expression again after loading |
| // the first word of the long. If the load-long destination overlaps with |
| // registers used in the addressing expression, the 2nd half will be loaded |
| // from a clobbered address. Fix this by requiring that load-long use |
| // address registers that do not overlap with the load-long target. |
| |
| // load-long support |
| operand load_long_RegP() %{ |
| constraint(ALLOC_IN_RC(esi_reg)); |
| match(RegP); |
| match(eSIRegP); |
| op_cost(100); |
| format %{ %} |
| interface(REG_INTER); |
| %} |
| |
| // Indirect Memory Operand Long |
| operand load_long_indirect(load_long_RegP reg) %{ |
| constraint(ALLOC_IN_RC(esi_reg)); |
| match(reg); |
| |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp(0x0); |
| %} |
| %} |
| |
| // Indirect Memory Plus Long Offset Operand |
| operand load_long_indOffset32(load_long_RegP reg, immI off) %{ |
| match(AddP reg off); |
| |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| opclass load_long_memory(load_long_indirect, load_long_indOffset32); |
| |
| |
| //----------Special Memory Operands-------------------------------------------- |
| // Stack Slot Operand - This operand is used for loading and storing temporary |
| // values on the stack where a match requires a value to |
| // flow through memory. |
| operand stackSlotP(sRegP reg) %{ |
| constraint(ALLOC_IN_RC(stack_slots)); |
| // No match rule because this operand is only generated in matching |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base(0x4); // ESP |
| index(0x4); // No Index |
| scale(0x0); // No Scale |
| disp($reg); // Stack Offset |
| %} |
| %} |
| |
| operand stackSlotI(sRegI reg) %{ |
| constraint(ALLOC_IN_RC(stack_slots)); |
| // No match rule because this operand is only generated in matching |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base(0x4); // ESP |
| index(0x4); // No Index |
| scale(0x0); // No Scale |
| disp($reg); // Stack Offset |
| %} |
| %} |
| |
| operand stackSlotF(sRegF reg) %{ |
| constraint(ALLOC_IN_RC(stack_slots)); |
| // No match rule because this operand is only generated in matching |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base(0x4); // ESP |
| index(0x4); // No Index |
| scale(0x0); // No Scale |
| disp($reg); // Stack Offset |
| %} |
| %} |
| |
| operand stackSlotD(sRegD reg) %{ |
| constraint(ALLOC_IN_RC(stack_slots)); |
| // No match rule because this operand is only generated in matching |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base(0x4); // ESP |
| index(0x4); // No Index |
| scale(0x0); // No Scale |
| disp($reg); // Stack Offset |
| %} |
| %} |
| |
| operand stackSlotL(sRegL reg) %{ |
| constraint(ALLOC_IN_RC(stack_slots)); |
| // No match rule because this operand is only generated in matching |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base(0x4); // ESP |
| index(0x4); // No Index |
| scale(0x0); // No Scale |
| disp($reg); // Stack Offset |
| %} |
| %} |
| |
| //----------Memory Operands - Win95 Implicit Null Variants---------------- |
| // Indirect Memory Operand |
| operand indirect_win95_safe(eRegP_no_EBP reg) |
| %{ |
| constraint(ALLOC_IN_RC(e_reg)); |
| match(reg); |
| |
| op_cost(100); |
| format %{ "[$reg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp(0x0); |
| %} |
| %} |
| |
| // Indirect Memory Plus Short Offset Operand |
| operand indOffset8_win95_safe(eRegP_no_EBP reg, immI8 off) |
| %{ |
| match(AddP reg off); |
| |
| op_cost(100); |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Long Offset Operand |
| operand indOffset32_win95_safe(eRegP_no_EBP reg, immI off) |
| %{ |
| match(AddP reg off); |
| |
| op_cost(100); |
| format %{ "[$reg + $off]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index(0x4); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Plus Index Register Plus Offset Operand |
| operand indIndexOffset_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI off) |
| %{ |
| match(AddP (AddP reg ireg) off); |
| |
| op_cost(100); |
| format %{"[$reg + $off + $ireg]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale(0x0); |
| disp($off); |
| %} |
| %} |
| |
| // Indirect Memory Times Scale Plus Index Register |
| operand indIndexScale_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI2 scale) |
| %{ |
| match(AddP reg (LShiftI ireg scale)); |
| |
| op_cost(100); |
| format %{"[$reg + $ireg << $scale]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale($scale); |
| disp(0x0); |
| %} |
| %} |
| |
| // Indirect Memory Times Scale Plus Index Register Plus Offset Operand |
| operand indIndexScaleOffset_win95_safe(eRegP_no_EBP reg, immI off, eRegI ireg, immI2 scale) |
| %{ |
| match(AddP (AddP reg (LShiftI ireg scale)) off); |
| |
| op_cost(100); |
| format %{"[$reg + $off + $ireg << $scale]" %} |
| interface(MEMORY_INTER) %{ |
| base($reg); |
| index($ireg); |
| scale($scale); |
| disp($off); |
| %} |
| %} |
| |
| //----------Conditional Branch Operands---------------------------------------- |
| // Comparison Op - This is the operation of the comparison, and is limited to |
| // the following set of codes: |
| // L (<), LE (<=), G (>), GE (>=), E (==), NE (!=) |
| // |
| // Other attributes of the comparison, such as unsignedness, are specified |
| // by the comparison instruction that sets a condition code flags register. |
| // That result is represented by a flags operand whose subtype is appropriate |
| // to the unsignedness (etc.) of the comparison. |
| // |
| // Later, the instruction which matches both the Comparison Op (a Bool) and |
| // the flags (produced by the Cmp) specifies the coding of the comparison op |
| // by matching a specific subtype of Bool operand below, such as cmpOpU. |
| |
| // Comparision Code |
| operand cmpOp() %{ |
| match(Bool); |
| |
| format %{ "" %} |
| interface(COND_INTER) %{ |
| equal(0x4); |
| not_equal(0x5); |
| less(0xC); |
| greater_equal(0xD); |
| less_equal(0xE); |
| greater(0xF); |
| %} |
| %} |
| |
| // Comparison Code, unsigned compare. Used by FP also, with |
| // C2 (unordered) turned into GT or LT already. The other bits |
| // C0 and C3 are turned into Carry & Zero flags. |
| operand cmpOpU() %{ |
| match(Bool); |
| |
| format %{ "" %} |
| interface(COND_INTER) %{ |
| equal(0x4); |
| not_equal(0x5); |
| less(0x2); |
| greater_equal(0x3); |
| less_equal(0x6); |
| greater(0x7); |
| %} |
| %} |
| |
| // Comparison Code for FP conditional move |
| operand cmpOp_fcmov() %{ |
| match(Bool); |
| |
| format %{ "" %} |
| interface(COND_INTER) %{ |
| equal (0x0C8); |
| not_equal (0x1C8); |
| less (0x0C0); |
| greater_equal(0x1C0); |
| less_equal (0x0D0); |
| greater (0x1D0); |
| %} |
| %} |
| |
| // Comparision Code used in long compares |
| operand cmpOp_commute() %{ |
| match(Bool); |
| |
| format %{ "" %} |
| interface(COND_INTER) %{ |
| equal(0x4); |
| not_equal(0x5); |
| less(0xF); |
| greater_equal(0xE); |
| less_equal(0xD); |
| greater(0xC); |
| %} |
| %} |
| |
| //----------OPERAND CLASSES---------------------------------------------------- |
| // Operand Classes are groups of operands that are used as to simplify |
| // instruction definitions by not requiring the AD writer to specify seperate |
| // instructions for every form of operand when the instruction accepts |
| // multiple operand types with the same basic encoding and format. The classic |
| // case of this is memory operands. |
| |
| opclass memory(direct, indirect, indOffset8, indOffset32, indOffset32X, indIndexOffset, |
| indIndex, indIndexScale, indIndexScaleOffset); |
| |
| // Long memory operations are encoded in 2 instructions and a +4 offset. |
| // This means some kind of offset is always required and you cannot use |
| // an oop as the offset (done when working on static globals). |
| opclass long_memory(direct, indirect, indOffset8, indOffset32, indIndexOffset, |
| indIndex, indIndexScale, indIndexScaleOffset); |
| |
| |
| //----------PIPELINE----------------------------------------------------------- |
| // Rules which define the behavior of the target architectures pipeline. |
| pipeline %{ |
| |
| //----------ATTRIBUTES--------------------------------------------------------- |
| attributes %{ |
| variable_size_instructions; // Fixed size instructions |
| max_instructions_per_bundle = 3; // Up to 3 instructions per bundle |
| instruction_unit_size = 1; // An instruction is 1 bytes long |
| instruction_fetch_unit_size = 16; // The processor fetches one line |
| instruction_fetch_units = 1; // of 16 bytes |
| |
| // List of nop instructions |
| nops( MachNop ); |
| %} |
| |
| //----------RESOURCES---------------------------------------------------------- |
| // Resources are the functional units available to the machine |
| |
| // Generic P2/P3 pipeline |
| // 3 decoders, only D0 handles big operands; a "bundle" is the limit of |
| // 3 instructions decoded per cycle. |
| // 2 load/store ops per cycle, 1 branch, 1 FPU, |
| // 2 ALU op, only ALU0 handles mul/div instructions. |
| resources( D0, D1, D2, DECODE = D0 | D1 | D2, |
| MS0, MS1, MEM = MS0 | MS1, |
| BR, FPU, |
| ALU0, ALU1, ALU = ALU0 | ALU1 ); |
| |
| //----------PIPELINE DESCRIPTION----------------------------------------------- |
| // Pipeline Description specifies the stages in the machine's pipeline |
| |
| // Generic P2/P3 pipeline |
| pipe_desc(S0, S1, S2, S3, S4, S5); |
| |
| //----------PIPELINE CLASSES--------------------------------------------------- |
| // Pipeline Classes describe the stages in which input and output are |
| // referenced by the hardware pipeline. |
| |
| // Naming convention: ialu or fpu |
| // Then: _reg |
| // Then: _reg if there is a 2nd register |
| // Then: _long if it's a pair of instructions implementing a long |
| // Then: _fat if it requires the big decoder |
| // Or: _mem if it requires the big decoder and a memory unit. |
| |
| // Integer ALU reg operation |
| pipe_class ialu_reg(eRegI dst) %{ |
| single_instruction; |
| dst : S4(write); |
| dst : S3(read); |
| DECODE : S0; // any decoder |
| ALU : S3; // any alu |
| %} |
| |
| // Long ALU reg operation |
| pipe_class ialu_reg_long(eRegL dst) %{ |
| instruction_count(2); |
| dst : S4(write); |
| dst : S3(read); |
| DECODE : S0(2); // any 2 decoders |
| ALU : S3(2); // both alus |
| %} |
| |
| // Integer ALU reg operation using big decoder |
| pipe_class ialu_reg_fat(eRegI dst) %{ |
| single_instruction; |
| dst : S4(write); |
| dst : S3(read); |
| D0 : S0; // big decoder only |
| ALU : S3; // any alu |
| %} |
| |
| // Long ALU reg operation using big decoder |
| pipe_class ialu_reg_long_fat(eRegL dst) %{ |
| instruction_count(2); |
| dst : S4(write); |
| dst : S3(read); |
| D0 : S0(2); // big decoder only; twice |
| ALU : S3(2); // any 2 alus |
| %} |
| |
| // Integer ALU reg-reg operation |
| pipe_class ialu_reg_reg(eRegI dst, eRegI src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| DECODE : S0; // any decoder |
| ALU : S3; // any alu |
| %} |
| |
| // Long ALU reg-reg operation |
| pipe_class ialu_reg_reg_long(eRegL dst, eRegL src) %{ |
| instruction_count(2); |
| dst : S4(write); |
| src : S3(read); |
| DECODE : S0(2); // any 2 decoders |
| ALU : S3(2); // both alus |
| %} |
| |
| // Integer ALU reg-reg operation |
| pipe_class ialu_reg_reg_fat(eRegI dst, memory src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| D0 : S0; // big decoder only |
| ALU : S3; // any alu |
| %} |
| |
| // Long ALU reg-reg operation |
| pipe_class ialu_reg_reg_long_fat(eRegL dst, eRegL src) %{ |
| instruction_count(2); |
| dst : S4(write); |
| src : S3(read); |
| D0 : S0(2); // big decoder only; twice |
| ALU : S3(2); // both alus |
| %} |
| |
| // Integer ALU reg-mem operation |
| pipe_class ialu_reg_mem(eRegI dst, memory mem) %{ |
| single_instruction; |
| dst : S5(write); |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| ALU : S4; // any alu |
| MEM : S3; // any mem |
| %} |
| |
| // Long ALU reg-mem operation |
| pipe_class ialu_reg_long_mem(eRegL dst, load_long_memory mem) %{ |
| instruction_count(2); |
| dst : S5(write); |
| mem : S3(read); |
| D0 : S0(2); // big decoder only; twice |
| ALU : S4(2); // any 2 alus |
| MEM : S3(2); // both mems |
| %} |
| |
| // Integer mem operation (prefetch) |
| pipe_class ialu_mem(memory mem) |
| %{ |
| single_instruction; |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| MEM : S3; // any mem |
| %} |
| |
| // Integer Store to Memory |
| pipe_class ialu_mem_reg(memory mem, eRegI src) %{ |
| single_instruction; |
| mem : S3(read); |
| src : S5(read); |
| D0 : S0; // big decoder only |
| ALU : S4; // any alu |
| MEM : S3; |
| %} |
| |
| // Long Store to Memory |
| pipe_class ialu_mem_long_reg(memory mem, eRegL src) %{ |
| instruction_count(2); |
| mem : S3(read); |
| src : S5(read); |
| D0 : S0(2); // big decoder only; twice |
| ALU : S4(2); // any 2 alus |
| MEM : S3(2); // Both mems |
| %} |
| |
| // Integer Store to Memory |
| pipe_class ialu_mem_imm(memory mem) %{ |
| single_instruction; |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| ALU : S4; // any alu |
| MEM : S3; |
| %} |
| |
| // Integer ALU0 reg-reg operation |
| pipe_class ialu_reg_reg_alu0(eRegI dst, eRegI src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| D0 : S0; // Big decoder only |
| ALU0 : S3; // only alu0 |
| %} |
| |
| // Integer ALU0 reg-mem operation |
| pipe_class ialu_reg_mem_alu0(eRegI dst, memory mem) %{ |
| single_instruction; |
| dst : S5(write); |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| ALU0 : S4; // ALU0 only |
| MEM : S3; // any mem |
| %} |
| |
| // Integer ALU reg-reg operation |
| pipe_class ialu_cr_reg_reg(eFlagsReg cr, eRegI src1, eRegI src2) %{ |
| single_instruction; |
| cr : S4(write); |
| src1 : S3(read); |
| src2 : S3(read); |
| DECODE : S0; // any decoder |
| ALU : S3; // any alu |
| %} |
| |
| // Integer ALU reg-imm operation |
| pipe_class ialu_cr_reg_imm(eFlagsReg cr, eRegI src1) %{ |
| single_instruction; |
| cr : S4(write); |
| src1 : S3(read); |
| DECODE : S0; // any decoder |
| ALU : S3; // any alu |
| %} |
| |
| // Integer ALU reg-mem operation |
| pipe_class ialu_cr_reg_mem(eFlagsReg cr, eRegI src1, memory src2) %{ |
| single_instruction; |
| cr : S4(write); |
| src1 : S3(read); |
| src2 : S3(read); |
| D0 : S0; // big decoder only |
| ALU : S4; // any alu |
| MEM : S3; |
| %} |
| |
| // Conditional move reg-reg |
| pipe_class pipe_cmplt( eRegI p, eRegI q, eRegI y ) %{ |
| instruction_count(4); |
| y : S4(read); |
| q : S3(read); |
| p : S3(read); |
| DECODE : S0(4); // any decoder |
| %} |
| |
| // Conditional move reg-reg |
| pipe_class pipe_cmov_reg( eRegI dst, eRegI src, eFlagsReg cr ) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| cr : S3(read); |
| DECODE : S0; // any decoder |
| %} |
| |
| // Conditional move reg-mem |
| pipe_class pipe_cmov_mem( eFlagsReg cr, eRegI dst, memory src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| cr : S3(read); |
| DECODE : S0; // any decoder |
| MEM : S3; |
| %} |
| |
| // Conditional move reg-reg long |
| pipe_class pipe_cmov_reg_long( eFlagsReg cr, eRegL dst, eRegL src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| cr : S3(read); |
| DECODE : S0(2); // any 2 decoders |
| %} |
| |
| // Conditional move double reg-reg |
| pipe_class pipe_cmovD_reg( eFlagsReg cr, regDPR1 dst, regD src) %{ |
| single_instruction; |
| dst : S4(write); |
| src : S3(read); |
| cr : S3(read); |
| DECODE : S0; // any decoder |
| %} |
| |
| // Float reg-reg operation |
| pipe_class fpu_reg(regD dst) %{ |
| instruction_count(2); |
| dst : S3(read); |
| DECODE : S0(2); // any 2 decoders |
| FPU : S3; |
| %} |
| |
| // Float reg-reg operation |
| pipe_class fpu_reg_reg(regD dst, regD src) %{ |
| instruction_count(2); |
| dst : S4(write); |
| src : S3(read); |
| DECODE : S0(2); // any 2 decoders |
| FPU : S3; |
| %} |
| |
| // Float reg-reg operation |
| pipe_class fpu_reg_reg_reg(regD dst, regD src1, regD src2) %{ |
| instruction_count(3); |
| dst : S4(write); |
| src1 : S3(read); |
| src2 : S3(read); |
| DECODE : S0(3); // any 3 decoders |
| FPU : S3(2); |
| %} |
| |
| // Float reg-reg operation |
| pipe_class fpu_reg_reg_reg_reg(regD dst, regD src1, regD src2, regD src3) %{ |
| instruction_count(4); |
| dst : S4(write); |
| src1 : S3(read); |
| src2 : S3(read); |
| src3 : S3(read); |
| DECODE : S0(4); // any 3 decoders |
| FPU : S3(2); |
| %} |
| |
| // Float reg-reg operation |
| pipe_class fpu_reg_mem_reg_reg(regD dst, memory src1, regD src2, regD src3) %{ |
| instruction_count(4); |
| dst : S4(write); |
| src1 : S3(read); |
| src2 : S3(read); |
| src3 : S3(read); |
| DECODE : S1(3); // any 3 decoders |
| D0 : S0; // Big decoder only |
| FPU : S3(2); |
| MEM : S3; |
| %} |
| |
| // Float reg-mem operation |
| pipe_class fpu_reg_mem(regD dst, memory mem) %{ |
| instruction_count(2); |
| dst : S5(write); |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| DECODE : S1; // any decoder for FPU POP |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| // Float reg-mem operation |
| pipe_class fpu_reg_reg_mem(regD dst, regD src1, memory mem) %{ |
| instruction_count(3); |
| dst : S5(write); |
| src1 : S3(read); |
| mem : S3(read); |
| D0 : S0; // big decoder only |
| DECODE : S1(2); // any decoder for FPU POP |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| // Float mem-reg operation |
| pipe_class fpu_mem_reg(memory mem, regD src) %{ |
| instruction_count(2); |
| src : S5(read); |
| mem : S3(read); |
| DECODE : S0; // any decoder for FPU PUSH |
| D0 : S1; // big decoder only |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| pipe_class fpu_mem_reg_reg(memory mem, regD src1, regD src2) %{ |
| instruction_count(3); |
| src1 : S3(read); |
| src2 : S3(read); |
| mem : S3(read); |
| DECODE : S0(2); // any decoder for FPU PUSH |
| D0 : S1; // big decoder only |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| pipe_class fpu_mem_reg_mem(memory mem, regD src1, memory src2) %{ |
| instruction_count(3); |
| src1 : S3(read); |
| src2 : S3(read); |
| mem : S4(read); |
| DECODE : S0; // any decoder for FPU PUSH |
| D0 : S0(2); // big decoder only |
| FPU : S4; |
| MEM : S3(2); // any mem |
| %} |
| |
| pipe_class fpu_mem_mem(memory dst, memory src1) %{ |
| instruction_count(2); |
| src1 : S3(read); |
| dst : S4(read); |
| D0 : S0(2); // big decoder only |
| MEM : S3(2); // any mem |
| %} |
| |
| pipe_class fpu_mem_mem_mem(memory dst, memory src1, memory src2) %{ |
| instruction_count(3); |
| src1 : S3(read); |
| src2 : S3(read); |
| dst : S4(read); |
| D0 : S0(3); // big decoder only |
| FPU : S4; |
| MEM : S3(3); // any mem |
| %} |
| |
| pipe_class fpu_mem_reg_con(memory mem, regD src1) %{ |
| instruction_count(3); |
| src1 : S4(read); |
| mem : S4(read); |
| DECODE : S0; // any decoder for FPU PUSH |
| D0 : S0(2); // big decoder only |
| FPU : S4; |
| MEM : S3(2); // any mem |
| %} |
| |
| // Float load constant |
| pipe_class fpu_reg_con(regD dst) %{ |
| instruction_count(2); |
| dst : S5(write); |
| D0 : S0; // big decoder only for the load |
| DECODE : S1; // any decoder for FPU POP |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| // Float load constant |
| pipe_class fpu_reg_reg_con(regD dst, regD src) %{ |
| instruction_count(3); |
| dst : S5(write); |
| src : S3(read); |
| D0 : S0; // big decoder only for the load |
| DECODE : S1(2); // any decoder for FPU POP |
| FPU : S4; |
| MEM : S3; // any mem |
| %} |
| |
| // UnConditional branch |
| pipe_class pipe_jmp( label labl ) %{ |
| single_instruction; |
| BR : S3; |
| %} |
| |
| // Conditional branch |
| pipe_class pipe_jcc( cmpOp cmp, eFlagsReg cr, label labl ) %{ |
| single_instruction; |
| cr : S1(read); |
| BR : S3; |
| %} |
| |
| // Allocation idiom |
| pipe_class pipe_cmpxchg( eRegP dst, eRegP heap_ptr ) %{ |
| instruction_count(1); force_serialization; |
| fixed_latency(6); |
| heap_ptr : S3(read); |
| DECODE : S0(3); |
| D0 : S2; |
| MEM : S3; |
| ALU : S3(2); |
| dst : S5(write); |
| BR : S5; |
| %} |
| |
| // Generic big/slow expanded idiom |
| pipe_class pipe_slow( ) %{ |
| instruction_count(10); multiple_bundles; force_serialization; |
| fixed_latency(100); |
| D0 : S0(2); |
| MEM : S3(2); |
| %} |
| |
| // The real do-nothing guy |
| pipe_class empty( ) %{ |
| instruction_count(0); |
| %} |
| |
| // Define the class for the Nop node |
| define %{ |
| MachNop = empty; |
| %} |
| |
| %} |
| |
| //----------INSTRUCTIONS------------------------------------------------------- |
| // |
| // match -- States which machine-independent subtree may be replaced |
| // by this instruction. |
| // ins_cost -- The estimated cost of this instruction is used by instruction |
| // selection to identify a minimum cost tree of machine |
| // instructions that matches a tree of machine-independent |
| // instructions. |
| // format -- A string providing the disassembly for this instruction. |
| // The value of an instruction's operand may be inserted |
| // by referring to it with a '$' prefix. |
| // opcode -- Three instruction opcodes may be provided. These are referred |
| // to within an encode class as $primary, $secondary, and $tertiary |
| // respectively. The primary opcode is commonly used to |
| // indicate the type of machine instruction, while secondary |
| // and tertiary are often used for prefix options or addressing |
| // modes. |
| // ins_encode -- A list of encode classes with parameters. The encode class |
| // name must have been defined in an 'enc_class' specification |
| // in the encode section of the architecture description. |
| |
| //----------BSWAP-Instruction-------------------------------------------------- |
| instruct bytes_reverse_int(eRegI dst) %{ |
| match(Set dst (ReverseBytesI dst)); |
| |
| format %{ "BSWAP $dst" %} |
| opcode(0x0F, 0xC8); |
| ins_encode( OpcP, OpcSReg(dst) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct bytes_reverse_long(eRegL dst) %{ |
| match(Set dst (ReverseBytesL dst)); |
| |
| format %{ "BSWAP $dst.lo\n\t" |
| "BSWAP $dst.hi\n\t" |
| "XCHG $dst.lo $dst.hi" %} |
| |
| ins_cost(125); |
| ins_encode( bswap_long_bytes(dst) ); |
| ins_pipe( ialu_reg_reg); |
| %} |
| |
| |
| //----------Load/Store/Move Instructions--------------------------------------- |
| //----------Load Instructions-------------------------------------------------- |
| // Load Byte (8bit signed) |
| instruct loadB(xRegI dst, memory mem) %{ |
| match(Set dst (LoadB mem)); |
| |
| ins_cost(125); |
| format %{ "MOVSX8 $dst,$mem" %} |
| opcode(0xBE, 0x0F); |
| ins_encode( OpcS, OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Byte (8bit UNsigned) |
| instruct loadUB(xRegI dst, memory mem, immI_255 bytemask) %{ |
| match(Set dst (AndI (LoadB mem) bytemask)); |
| |
| ins_cost(125); |
| format %{ "MOVZX8 $dst,$mem" %} |
| opcode(0xB6, 0x0F); |
| ins_encode( OpcS, OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Char (16bit unsigned) |
| instruct loadC(eRegI dst, memory mem) %{ |
| match(Set dst (LoadC mem)); |
| |
| ins_cost(125); |
| format %{ "MOVZX $dst,$mem" %} |
| opcode(0xB7, 0x0F); |
| ins_encode( OpcS, OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Integer |
| instruct loadI(eRegI dst, memory mem) %{ |
| match(Set dst (LoadI mem)); |
| |
| ins_cost(125); |
| format %{ "MOV $dst,$mem" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Long. Cannot clobber address while loading, so restrict address |
| // register to ESI |
| instruct loadL(eRegL dst, load_long_memory mem) %{ |
| predicate(!((LoadLNode*)n)->require_atomic_access()); |
| match(Set dst (LoadL mem)); |
| |
| ins_cost(250); |
| format %{ "MOV $dst.lo,$mem\n\t" |
| "MOV $dst.hi,$mem+4" %} |
| opcode(0x8B, 0x8B); |
| ins_encode( OpcP, RegMem(dst,mem), OpcS, RegMem_Hi(dst,mem)); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| // Volatile Load Long. Must be atomic, so do 64-bit FILD |
| // then store it down to the stack and reload on the int |
| // side. |
| instruct loadL_volatile(stackSlotL dst, memory mem) %{ |
| predicate(UseSSE<=1 && ((LoadLNode*)n)->require_atomic_access()); |
| match(Set dst (LoadL mem)); |
| |
| ins_cost(200); |
| format %{ "FILD $mem\t# Atomic volatile long load\n\t" |
| "FISTp $dst" %} |
| ins_encode(enc_loadL_volatile(mem,dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct loadLX_volatile(stackSlotL dst, memory mem, regXD tmp) %{ |
| predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); |
| match(Set dst (LoadL mem)); |
| effect(TEMP tmp); |
| ins_cost(180); |
| format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" |
| "MOVSD $dst,$tmp" %} |
| ins_encode(enc_loadLX_volatile(mem, dst, tmp)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct loadLX_reg_volatile(eRegL dst, memory mem, regXD tmp) %{ |
| predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); |
| match(Set dst (LoadL mem)); |
| effect(TEMP tmp); |
| ins_cost(160); |
| format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" |
| "MOVD $dst.lo,$tmp\n\t" |
| "PSRLQ $tmp,32\n\t" |
| "MOVD $dst.hi,$tmp" %} |
| ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Range |
| instruct loadRange(eRegI dst, memory mem) %{ |
| match(Set dst (LoadRange mem)); |
| |
| ins_cost(125); |
| format %{ "MOV $dst,$mem" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| |
| // Load Pointer |
| instruct loadP(eRegP dst, memory mem) %{ |
| match(Set dst (LoadP mem)); |
| |
| ins_cost(125); |
| format %{ "MOV $dst,$mem" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Klass Pointer |
| instruct loadKlass(eRegP dst, memory mem) %{ |
| match(Set dst (LoadKlass mem)); |
| |
| ins_cost(125); |
| format %{ "MOV $dst,$mem" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Short (16bit signed) |
| instruct loadS(eRegI dst, memory mem) %{ |
| match(Set dst (LoadS mem)); |
| |
| ins_cost(125); |
| format %{ "MOVSX $dst,$mem" %} |
| opcode(0xBF, 0x0F); |
| ins_encode( OpcS, OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Double |
| instruct loadD(regD dst, memory mem) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (LoadD mem)); |
| |
| ins_cost(150); |
| format %{ "FLD_D ST,$mem\n\t" |
| "FSTP $dst" %} |
| opcode(0xDD); /* DD /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), |
| Pop_Reg_D(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Load Double to XMM |
| instruct loadXD(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); |
| match(Set dst (LoadD mem)); |
| ins_cost(145); |
| format %{ "MOVSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct loadXD_partial(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); |
| match(Set dst (LoadD mem)); |
| ins_cost(145); |
| format %{ "MOVLPD $dst,$mem" %} |
| ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load to XMM register (single-precision floating point) |
| // MOVSS instruction |
| instruct loadX(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (LoadF mem)); |
| ins_cost(145); |
| format %{ "MOVSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Float |
| instruct loadF(regF dst, memory mem) %{ |
| predicate(UseSSE==0); |
| match(Set dst (LoadF mem)); |
| |
| ins_cost(150); |
| format %{ "FLD_S ST,$mem\n\t" |
| "FSTP $dst" %} |
| opcode(0xD9); /* D9 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Load Aligned Packed Byte to XMM register |
| instruct loadA8B(regXD dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (Load8B mem)); |
| ins_cost(125); |
| format %{ "MOVQ $dst,$mem\t! packed8B" %} |
| ins_encode( movq_ld(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Aligned Packed Short to XMM register |
| instruct loadA4S(regXD dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (Load4S mem)); |
| ins_cost(125); |
| format %{ "MOVQ $dst,$mem\t! packed4S" %} |
| ins_encode( movq_ld(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Aligned Packed Char to XMM register |
| instruct loadA4C(regXD dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (Load4C mem)); |
| ins_cost(125); |
| format %{ "MOVQ $dst,$mem\t! packed4C" %} |
| ins_encode( movq_ld(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Aligned Packed Integer to XMM register |
| instruct load2IU(regXD dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (Load2I mem)); |
| ins_cost(125); |
| format %{ "MOVQ $dst,$mem\t! packed2I" %} |
| ins_encode( movq_ld(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Aligned Packed Single to XMM |
| instruct loadA2F(regXD dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (Load2F mem)); |
| ins_cost(145); |
| format %{ "MOVQ $dst,$mem\t! packed2F" %} |
| ins_encode( movq_ld(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Effective Address |
| instruct leaP8(eRegP dst, indOffset8 mem) %{ |
| match(Set dst mem); |
| |
| ins_cost(110); |
| format %{ "LEA $dst,$mem" %} |
| opcode(0x8D); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_reg_fat ); |
| %} |
| |
| instruct leaP32(eRegP dst, indOffset32 mem) %{ |
| match(Set dst mem); |
| |
| ins_cost(110); |
| format %{ "LEA $dst,$mem" %} |
| opcode(0x8D); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_reg_fat ); |
| %} |
| |
| instruct leaPIdxOff(eRegP dst, indIndexOffset mem) %{ |
| match(Set dst mem); |
| |
| ins_cost(110); |
| format %{ "LEA $dst,$mem" %} |
| opcode(0x8D); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_reg_fat ); |
| %} |
| |
| instruct leaPIdxScale(eRegP dst, indIndexScale mem) %{ |
| match(Set dst mem); |
| |
| ins_cost(110); |
| format %{ "LEA $dst,$mem" %} |
| opcode(0x8D); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_reg_fat ); |
| %} |
| |
| instruct leaPIdxScaleOff(eRegP dst, indIndexScaleOffset mem) %{ |
| match(Set dst mem); |
| |
| ins_cost(110); |
| format %{ "LEA $dst,$mem" %} |
| opcode(0x8D); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_reg_fat ); |
| %} |
| |
| // Load Constant |
| instruct loadConI(eRegI dst, immI src) %{ |
| match(Set dst src); |
| |
| format %{ "MOV $dst,$src" %} |
| ins_encode( LdImmI(dst, src) ); |
| ins_pipe( ialu_reg_fat ); |
| %} |
| |
| // Load Constant zero |
| instruct loadConI0(eRegI dst, immI0 src, eFlagsReg cr) %{ |
| match(Set dst src); |
| effect(KILL cr); |
| |
| ins_cost(50); |
| format %{ "XOR $dst,$dst" %} |
| opcode(0x33); /* + rd */ |
| ins_encode( OpcP, RegReg( dst, dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct loadConP(eRegP dst, immP src) %{ |
| match(Set dst src); |
| |
| format %{ "MOV $dst,$src" %} |
| opcode(0xB8); /* + rd */ |
| ins_encode( LdImmP(dst, src) ); |
| ins_pipe( ialu_reg_fat ); |
| %} |
| |
| instruct loadConL(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst src); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "MOV $dst.lo,$src.lo\n\t" |
| "MOV $dst.hi,$src.hi" %} |
| opcode(0xB8); |
| ins_encode( LdImmL_Lo(dst, src), LdImmL_Hi(dst, src) ); |
| ins_pipe( ialu_reg_long_fat ); |
| %} |
| |
| instruct loadConL0(eRegL dst, immL0 src, eFlagsReg cr) %{ |
| match(Set dst src); |
| effect(KILL cr); |
| ins_cost(150); |
| format %{ "XOR $dst.lo,$dst.lo\n\t" |
| "XOR $dst.hi,$dst.hi" %} |
| opcode(0x33,0x33); |
| ins_encode( RegReg_Lo(dst,dst), RegReg_Hi(dst, dst) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immF(). |
| instruct loadConF(regF dst, immF src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "FLD_S ST,$src\n\t" |
| "FSTP $dst" %} |
| opcode(0xD9, 0x00); /* D9 /0 */ |
| ins_encode(LdImmF(src), Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_con ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immXF(). |
| instruct loadConX(regX dst, immXF con) %{ |
| match(Set dst con); |
| ins_cost(125); |
| format %{ "MOVSS $dst,[$con]" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), LdImmX(dst, con)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immXF0(). |
| instruct loadConX0(regX dst, immXF0 src) %{ |
| match(Set dst src); |
| ins_cost(100); |
| format %{ "XORPS $dst,$dst\t# float 0.0" %} |
| ins_encode( Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immD(). |
| instruct loadConD(regD dst, immD src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "FLD_D ST,$src\n\t" |
| "FSTP $dst" %} |
| ins_encode(LdImmD(src), Pop_Reg_D(dst) ); |
| ins_pipe( fpu_reg_con ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immXD(). |
| instruct loadConXD(regXD dst, immXD con) %{ |
| match(Set dst con); |
| ins_cost(125); |
| format %{ "MOVSD $dst,[$con]" %} |
| ins_encode(load_conXD(dst, con)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // The instruction usage is guarded by predicate in operand immXD0(). |
| instruct loadConXD0(regXD dst, immXD0 src) %{ |
| match(Set dst src); |
| ins_cost(100); |
| format %{ "XORPD $dst,$dst\t# double 0.0" %} |
| ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Load Stack Slot |
| instruct loadSSI(eRegI dst, stackSlotI src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "MOV $dst,$src" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,src)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| instruct loadSSL(eRegL dst, stackSlotL src) %{ |
| match(Set dst src); |
| |
| ins_cost(200); |
| format %{ "MOV $dst,$src.lo\n\t" |
| "MOV $dst+4,$src.hi" %} |
| opcode(0x8B, 0x8B); |
| ins_encode( OpcP, RegMem( dst, src ), OpcS, RegMem_Hi( dst, src ) ); |
| ins_pipe( ialu_mem_long_reg ); |
| %} |
| |
| // Load Stack Slot |
| instruct loadSSP(eRegP dst, stackSlotP src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "MOV $dst,$src" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,src)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Load Stack Slot |
| instruct loadSSF(regF dst, stackSlotF src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "FLD_S $src\n\t" |
| "FSTP $dst" %} |
| opcode(0xD9); /* D9 /0, FLD m32real */ |
| ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Load Stack Slot |
| instruct loadSSD(regD dst, stackSlotD src) %{ |
| match(Set dst src); |
| ins_cost(125); |
| |
| format %{ "FLD_D $src\n\t" |
| "FSTP $dst" %} |
| opcode(0xDD); /* DD /0, FLD m64real */ |
| ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), |
| Pop_Reg_D(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Prefetch instructions. |
| // Must be safe to execute with invalid address (cannot fault). |
| |
| instruct prefetchr0( memory mem ) %{ |
| predicate(UseSSE==0 && !VM_Version::supports_3dnow()); |
| match(PrefetchRead mem); |
| ins_cost(0); |
| size(0); |
| format %{ "PREFETCHR (non-SSE is empty encoding)" %} |
| ins_encode(); |
| ins_pipe(empty); |
| %} |
| |
| instruct prefetchr( memory mem ) %{ |
| predicate(UseSSE==0 && VM_Version::supports_3dnow() || ReadPrefetchInstr==3); |
| match(PrefetchRead mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHR $mem\t! Prefetch into level 1 cache for read" %} |
| opcode(0x0F, 0x0d); /* Opcode 0F 0d /0 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchrNTA( memory mem ) %{ |
| predicate(UseSSE>=1 && ReadPrefetchInstr==0); |
| match(PrefetchRead mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for read" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchrT0( memory mem ) %{ |
| predicate(UseSSE>=1 && ReadPrefetchInstr==1); |
| match(PrefetchRead mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for read" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchrT2( memory mem ) %{ |
| predicate(UseSSE>=1 && ReadPrefetchInstr==2); |
| match(PrefetchRead mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for read" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchw0( memory mem ) %{ |
| predicate(UseSSE==0 && !VM_Version::supports_3dnow()); |
| match(PrefetchWrite mem); |
| ins_cost(0); |
| size(0); |
| format %{ "Prefetch (non-SSE is empty encoding)" %} |
| ins_encode(); |
| ins_pipe(empty); |
| %} |
| |
| instruct prefetchw( memory mem ) %{ |
| predicate(UseSSE==0 && VM_Version::supports_3dnow() || AllocatePrefetchInstr==3); |
| match( PrefetchWrite mem ); |
| ins_cost(100); |
| |
| format %{ "PREFETCHW $mem\t! Prefetch into L1 cache and mark modified" %} |
| opcode(0x0F, 0x0D); /* Opcode 0F 0D /1 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchwNTA( memory mem ) %{ |
| predicate(UseSSE>=1 && AllocatePrefetchInstr==0); |
| match(PrefetchWrite mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for write" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchwT0( memory mem ) %{ |
| predicate(UseSSE>=1 && AllocatePrefetchInstr==1); |
| match(PrefetchWrite mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for write" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| instruct prefetchwT2( memory mem ) %{ |
| predicate(UseSSE>=1 && AllocatePrefetchInstr==2); |
| match(PrefetchWrite mem); |
| ins_cost(100); |
| |
| format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for write" %} |
| opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ |
| ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); |
| ins_pipe(ialu_mem); |
| %} |
| |
| //----------Store Instructions------------------------------------------------- |
| |
| // Store Byte |
| instruct storeB(memory mem, xRegI src) %{ |
| match(Set mem (StoreB mem src)); |
| |
| ins_cost(125); |
| format %{ "MOV8 $mem,$src" %} |
| opcode(0x88); |
| ins_encode( OpcP, RegMem( src, mem ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Char/Short |
| instruct storeC(memory mem, eRegI src) %{ |
| match(Set mem (StoreC mem src)); |
| |
| ins_cost(125); |
| format %{ "MOV16 $mem,$src" %} |
| opcode(0x89, 0x66); |
| ins_encode( OpcS, OpcP, RegMem( src, mem ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Integer |
| instruct storeI(memory mem, eRegI src) %{ |
| match(Set mem (StoreI mem src)); |
| |
| ins_cost(125); |
| format %{ "MOV $mem,$src" %} |
| opcode(0x89); |
| ins_encode( OpcP, RegMem( src, mem ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Long |
| instruct storeL(long_memory mem, eRegL src) %{ |
| predicate(!((StoreLNode*)n)->require_atomic_access()); |
| match(Set mem (StoreL mem src)); |
| |
| ins_cost(200); |
| format %{ "MOV $mem,$src.lo\n\t" |
| "MOV $mem+4,$src.hi" %} |
| opcode(0x89, 0x89); |
| ins_encode( OpcP, RegMem( src, mem ), OpcS, RegMem_Hi( src, mem ) ); |
| ins_pipe( ialu_mem_long_reg ); |
| %} |
| |
| // Volatile Store Long. Must be atomic, so move it into |
| // the FP TOS and then do a 64-bit FIST. Has to probe the |
| // target address before the store (for null-ptr checks) |
| // so the memory operand is used twice in the encoding. |
| instruct storeL_volatile(memory mem, stackSlotL src, eFlagsReg cr ) %{ |
| predicate(UseSSE<=1 && ((StoreLNode*)n)->require_atomic_access()); |
| match(Set mem (StoreL mem src)); |
| effect( KILL cr ); |
| ins_cost(400); |
| format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" |
| "FILD $src\n\t" |
| "FISTp $mem\t # 64-bit atomic volatile long store" %} |
| opcode(0x3B); |
| ins_encode( OpcP, RegMem( EAX, mem ), enc_storeL_volatile(mem,src)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct storeLX_volatile(memory mem, stackSlotL src, regXD tmp, eFlagsReg cr) %{ |
| predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); |
| match(Set mem (StoreL mem src)); |
| effect( TEMP tmp, KILL cr ); |
| ins_cost(380); |
| format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" |
| "MOVSD $tmp,$src\n\t" |
| "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} |
| opcode(0x3B); |
| ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_volatile(mem, src, tmp)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct storeLX_reg_volatile(memory mem, eRegL src, regXD tmp2, regXD tmp, eFlagsReg cr) %{ |
| predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); |
| match(Set mem (StoreL mem src)); |
| effect( TEMP tmp2 , TEMP tmp, KILL cr ); |
| ins_cost(360); |
| format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" |
| "MOVD $tmp,$src.lo\n\t" |
| "MOVD $tmp2,$src.hi\n\t" |
| "PUNPCKLDQ $tmp,$tmp2\n\t" |
| "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} |
| opcode(0x3B); |
| ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_reg_volatile(mem, src, tmp, tmp2)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store Pointer; for storing unknown oops and raw pointers |
| instruct storeP(memory mem, anyRegP src) %{ |
| match(Set mem (StoreP mem src)); |
| |
| ins_cost(125); |
| format %{ "MOV $mem,$src" %} |
| opcode(0x89); |
| ins_encode( OpcP, RegMem( src, mem ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Integer Immediate |
| instruct storeImmI(memory mem, immI src) %{ |
| match(Set mem (StoreI mem src)); |
| |
| ins_cost(150); |
| format %{ "MOV $mem,$src" %} |
| opcode(0xC7); /* C7 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Short/Char Immediate |
| instruct storeImmI16(memory mem, immI16 src) %{ |
| predicate(UseStoreImmI16); |
| match(Set mem (StoreC mem src)); |
| |
| ins_cost(150); |
| format %{ "MOV16 $mem,$src" %} |
| opcode(0xC7); /* C7 /0 Same as 32 store immediate with prefix */ |
| ins_encode( SizePrefix, OpcP, RMopc_Mem(0x00,mem), Con16( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Pointer Immediate; null pointers or constant oops that do not |
| // need card-mark barriers. |
| instruct storeImmP(memory mem, immP src) %{ |
| match(Set mem (StoreP mem src)); |
| |
| ins_cost(150); |
| format %{ "MOV $mem,$src" %} |
| opcode(0xC7); /* C7 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Byte Immediate |
| instruct storeImmB(memory mem, immI8 src) %{ |
| match(Set mem (StoreB mem src)); |
| |
| ins_cost(150); |
| format %{ "MOV8 $mem,$src" %} |
| opcode(0xC6); /* C6 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Aligned Packed Byte XMM register to memory |
| instruct storeA8B(memory mem, regXD src) %{ |
| predicate(UseSSE>=1); |
| match(Set mem (Store8B mem src)); |
| ins_cost(145); |
| format %{ "MOVQ $mem,$src\t! packed8B" %} |
| ins_encode( movq_st(mem, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store Aligned Packed Char/Short XMM register to memory |
| instruct storeA4C(memory mem, regXD src) %{ |
| predicate(UseSSE>=1); |
| match(Set mem (Store4C mem src)); |
| ins_cost(145); |
| format %{ "MOVQ $mem,$src\t! packed4C" %} |
| ins_encode( movq_st(mem, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store Aligned Packed Integer XMM register to memory |
| instruct storeA2I(memory mem, regXD src) %{ |
| predicate(UseSSE>=1); |
| match(Set mem (Store2I mem src)); |
| ins_cost(145); |
| format %{ "MOVQ $mem,$src\t! packed2I" %} |
| ins_encode( movq_st(mem, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store CMS card-mark Immediate |
| instruct storeImmCM(memory mem, immI8 src) %{ |
| match(Set mem (StoreCM mem src)); |
| |
| ins_cost(150); |
| format %{ "MOV8 $mem,$src\t! CMS card-mark imm0" %} |
| opcode(0xC6); /* C6 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Double |
| instruct storeD( memory mem, regDPR1 src) %{ |
| predicate(UseSSE<=1); |
| match(Set mem (StoreD mem src)); |
| |
| ins_cost(100); |
| format %{ "FST_D $mem,$src" %} |
| opcode(0xDD); /* DD /2 */ |
| ins_encode( enc_FP_store(mem,src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Store double does rounding on x86 |
| instruct storeD_rounded( memory mem, regDPR1 src) %{ |
| predicate(UseSSE<=1); |
| match(Set mem (StoreD mem (RoundDouble src))); |
| |
| ins_cost(100); |
| format %{ "FST_D $mem,$src\t# round" %} |
| opcode(0xDD); /* DD /2 */ |
| ins_encode( enc_FP_store(mem,src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Store XMM register to memory (double-precision floating points) |
| // MOVSD instruction |
| instruct storeXD(memory mem, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set mem (StoreD mem src)); |
| ins_cost(95); |
| format %{ "MOVSD $mem,$src" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store XMM register to memory (single-precision floating point) |
| // MOVSS instruction |
| instruct storeX(memory mem, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set mem (StoreF mem src)); |
| ins_cost(95); |
| format %{ "MOVSS $mem,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store Aligned Packed Single Float XMM register to memory |
| instruct storeA2F(memory mem, regXD src) %{ |
| predicate(UseSSE>=1); |
| match(Set mem (Store2F mem src)); |
| ins_cost(145); |
| format %{ "MOVQ $mem,$src\t! packed2F" %} |
| ins_encode( movq_st(mem, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Store Float |
| instruct storeF( memory mem, regFPR1 src) %{ |
| predicate(UseSSE==0); |
| match(Set mem (StoreF mem src)); |
| |
| ins_cost(100); |
| format %{ "FST_S $mem,$src" %} |
| opcode(0xD9); /* D9 /2 */ |
| ins_encode( enc_FP_store(mem,src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Store Float does rounding on x86 |
| instruct storeF_rounded( memory mem, regFPR1 src) %{ |
| predicate(UseSSE==0); |
| match(Set mem (StoreF mem (RoundFloat src))); |
| |
| ins_cost(100); |
| format %{ "FST_S $mem,$src\t# round" %} |
| opcode(0xD9); /* D9 /2 */ |
| ins_encode( enc_FP_store(mem,src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Store Float does rounding on x86 |
| instruct storeF_Drounded( memory mem, regDPR1 src) %{ |
| predicate(UseSSE<=1); |
| match(Set mem (StoreF mem (ConvD2F src))); |
| |
| ins_cost(100); |
| format %{ "FST_S $mem,$src\t# D-round" %} |
| opcode(0xD9); /* D9 /2 */ |
| ins_encode( enc_FP_store(mem,src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Store immediate Float value (it is faster than store from FPU register) |
| // The instruction usage is guarded by predicate in operand immF(). |
| instruct storeF_imm( memory mem, immF src) %{ |
| match(Set mem (StoreF mem src)); |
| |
| ins_cost(50); |
| format %{ "MOV $mem,$src\t# store float" %} |
| opcode(0xC7); /* C7 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32F_as_bits( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store immediate Float value (it is faster than store from XMM register) |
| // The instruction usage is guarded by predicate in operand immXF(). |
| instruct storeX_imm( memory mem, immXF src) %{ |
| match(Set mem (StoreF mem src)); |
| |
| ins_cost(50); |
| format %{ "MOV $mem,$src\t# store float" %} |
| opcode(0xC7); /* C7 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32XF_as_bits( src )); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Store Integer to stack slot |
| instruct storeSSI(stackSlotI dst, eRegI src) %{ |
| match(Set dst src); |
| |
| ins_cost(100); |
| format %{ "MOV $dst,$src" %} |
| opcode(0x89); |
| ins_encode( OpcPRegSS( dst, src ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Integer to stack slot |
| instruct storeSSP(stackSlotP dst, eRegP src) %{ |
| match(Set dst src); |
| |
| ins_cost(100); |
| format %{ "MOV $dst,$src" %} |
| opcode(0x89); |
| ins_encode( OpcPRegSS( dst, src ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Store Long to stack slot |
| instruct storeSSL(stackSlotL dst, eRegL src) %{ |
| match(Set dst src); |
| |
| ins_cost(200); |
| format %{ "MOV $dst,$src.lo\n\t" |
| "MOV $dst+4,$src.hi" %} |
| opcode(0x89, 0x89); |
| ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); |
| ins_pipe( ialu_mem_long_reg ); |
| %} |
| |
| //----------MemBar Instructions----------------------------------------------- |
| // Memory barrier flavors |
| |
| instruct membar_acquire() %{ |
| match(MemBarAcquire); |
| ins_cost(400); |
| |
| size(0); |
| format %{ "MEMBAR-acquire" %} |
| ins_encode( enc_membar_acquire ); |
| ins_pipe(pipe_slow); |
| %} |
| |
| instruct membar_acquire_lock() %{ |
| match(MemBarAcquire); |
| predicate(Matcher::prior_fast_lock(n)); |
| ins_cost(0); |
| |
| size(0); |
| format %{ "MEMBAR-acquire (prior CMPXCHG in FastLock so empty encoding)" %} |
| ins_encode( ); |
| ins_pipe(empty); |
| %} |
| |
| instruct membar_release() %{ |
| match(MemBarRelease); |
| ins_cost(400); |
| |
| size(0); |
| format %{ "MEMBAR-release" %} |
| ins_encode( enc_membar_release ); |
| ins_pipe(pipe_slow); |
| %} |
| |
| instruct membar_release_lock() %{ |
| match(MemBarRelease); |
| predicate(Matcher::post_fast_unlock(n)); |
| ins_cost(0); |
| |
| size(0); |
| format %{ "MEMBAR-release (a FastUnlock follows so empty encoding)" %} |
| ins_encode( ); |
| ins_pipe(empty); |
| %} |
| |
| instruct membar_volatile() %{ |
| match(MemBarVolatile); |
| ins_cost(400); |
| |
| format %{ "MEMBAR-volatile" %} |
| ins_encode( enc_membar_volatile ); |
| ins_pipe(pipe_slow); |
| %} |
| |
| instruct unnecessary_membar_volatile() %{ |
| match(MemBarVolatile); |
| predicate(Matcher::post_store_load_barrier(n)); |
| ins_cost(0); |
| |
| size(0); |
| format %{ "MEMBAR-volatile (unnecessary so empty encoding)" %} |
| ins_encode( ); |
| ins_pipe(empty); |
| %} |
| |
| //----------Move Instructions-------------------------------------------------- |
| instruct castX2P(eAXRegP dst, eAXRegI src) %{ |
| match(Set dst (CastX2P src)); |
| format %{ "# X2P $dst, $src" %} |
| ins_encode( /*empty encoding*/ ); |
| ins_cost(0); |
| ins_pipe(empty); |
| %} |
| |
| instruct castP2X(eRegI dst, eRegP src ) %{ |
| match(Set dst (CastP2X src)); |
| ins_cost(50); |
| format %{ "MOV $dst, $src\t# CastP2X" %} |
| ins_encode( enc_Copy( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| //----------Conditional Move--------------------------------------------------- |
| // Conditional move |
| instruct cmovI_reg(eRegI dst, eRegI src, eFlagsReg cr, cmpOp cop ) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| instruct cmovI_regU( eRegI dst, eRegI src, eFlagsRegU cr, cmpOpU cop ) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Conditional move |
| instruct cmovI_mem(cmpOp cop, eFlagsReg cr, eRegI dst, memory src) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); |
| ins_cost(250); |
| format %{ "CMOV$cop $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegMem( dst, src ) ); |
| ins_pipe( pipe_cmov_mem ); |
| %} |
| |
| // Conditional move |
| instruct cmovI_memu(cmpOpU cop, eFlagsRegU cr, eRegI dst, memory src) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); |
| ins_cost(250); |
| format %{ "CMOV$cop $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegMem( dst, src ) ); |
| ins_pipe( pipe_cmov_mem ); |
| %} |
| |
| // Conditional move |
| instruct cmovP_reg(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst,$src\t# ptr" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Conditional move (non-P6 version) |
| // Note: a CMoveP is generated for stubs and native wrappers |
| // regardless of whether we are on a P6, so we |
| // emulate a cmov here |
| instruct cmovP_reg_nonP6(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ |
| match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); |
| ins_cost(300); |
| format %{ "Jn$cop skip\n\t" |
| "MOV $dst,$src\t# pointer\n" |
| "skip:" %} |
| opcode(0x8b); |
| ins_encode( enc_cmov_branch(cop, 0x2), OpcP, RegReg(dst, src)); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Conditional move |
| instruct cmovP_regU(eRegP dst, eRegP src, eFlagsRegU cr, cmpOpU cop ) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst,$src\t# ptr" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // DISABLED: Requires the ADLC to emit a bottom_type call that |
| // correctly meets the two pointer arguments; one is an incoming |
| // register but the other is a memory operand. ALSO appears to |
| // be buggy with implicit null checks. |
| // |
| //// Conditional move |
| //instruct cmovP_mem(cmpOp cop, eFlagsReg cr, eRegP dst, memory src) %{ |
| // predicate(VM_Version::supports_cmov() ); |
| // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); |
| // ins_cost(250); |
| // format %{ "CMOV$cop $dst,$src\t# ptr" %} |
| // opcode(0x0F,0x40); |
| // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); |
| // ins_pipe( pipe_cmov_mem ); |
| //%} |
| // |
| //// Conditional move |
| //instruct cmovP_memU(cmpOpU cop, eFlagsRegU cr, eRegP dst, memory src) %{ |
| // predicate(VM_Version::supports_cmov() ); |
| // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); |
| // ins_cost(250); |
| // format %{ "CMOV$cop $dst,$src\t# ptr" %} |
| // opcode(0x0F,0x40); |
| // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); |
| // ins_pipe( pipe_cmov_mem ); |
| //%} |
| |
| // Conditional move |
| instruct fcmovD_regU(cmpOp_fcmov cop, eFlagsRegU cr, regDPR1 dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "FCMOV$cop $dst,$src\t# double" %} |
| opcode(0xDA); |
| ins_encode( enc_cmov_d(cop,src) ); |
| ins_pipe( pipe_cmovD_reg ); |
| %} |
| |
| // Conditional move |
| instruct fcmovF_regU(cmpOp_fcmov cop, eFlagsRegU cr, regFPR1 dst, regF src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "FCMOV$cop $dst,$src\t# float" %} |
| opcode(0xDA); |
| ins_encode( enc_cmov_d(cop,src) ); |
| ins_pipe( pipe_cmovD_reg ); |
| %} |
| |
| // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. |
| instruct fcmovD_regS(cmpOp cop, eFlagsReg cr, regD dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOV $dst,$src\t# double\n" |
| "skip:" %} |
| opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ |
| ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_D(src), OpcP, RegOpc(dst) ); |
| ins_pipe( pipe_cmovD_reg ); |
| %} |
| |
| // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. |
| instruct fcmovF_regS(cmpOp cop, eFlagsReg cr, regF dst, regF src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOV $dst,$src\t# float\n" |
| "skip:" %} |
| opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ |
| ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_F(src), OpcP, RegOpc(dst) ); |
| ins_pipe( pipe_cmovD_reg ); |
| %} |
| |
| // No CMOVE with SSE/SSE2 |
| instruct fcmovX_regS(cmpOp cop, eFlagsReg cr, regX dst, regX src) %{ |
| predicate (UseSSE>=1); |
| match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOVSS $dst,$src\t# float\n" |
| "skip:" %} |
| ins_encode %{ |
| Label skip; |
| // Invert sense of branch from sense of CMOV |
| __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); |
| __ movflt($dst$$XMMRegister, $src$$XMMRegister); |
| __ bind(skip); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // No CMOVE with SSE/SSE2 |
| instruct fcmovXD_regS(cmpOp cop, eFlagsReg cr, regXD dst, regXD src) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOVSD $dst,$src\t# float\n" |
| "skip:" %} |
| ins_encode %{ |
| Label skip; |
| // Invert sense of branch from sense of CMOV |
| __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); |
| __ movdbl($dst$$XMMRegister, $src$$XMMRegister); |
| __ bind(skip); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // unsigned version |
| instruct fcmovX_regU(cmpOpU cop, eFlagsRegU cr, regX dst, regX src) %{ |
| predicate (UseSSE>=1); |
| match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOVSS $dst,$src\t# float\n" |
| "skip:" %} |
| ins_encode %{ |
| Label skip; |
| // Invert sense of branch from sense of CMOV |
| __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); |
| __ movflt($dst$$XMMRegister, $src$$XMMRegister); |
| __ bind(skip); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // unsigned version |
| instruct fcmovXD_regU(cmpOpU cop, eFlagsRegU cr, regXD dst, regXD src) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "Jn$cop skip\n\t" |
| "MOVSD $dst,$src\t# float\n" |
| "skip:" %} |
| ins_encode %{ |
| Label skip; |
| // Invert sense of branch from sense of CMOV |
| __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); |
| __ movdbl($dst$$XMMRegister, $src$$XMMRegister); |
| __ bind(skip); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct cmovL_reg(cmpOp cop, eFlagsReg cr, eRegL dst, eRegL src) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst.lo,$src.lo\n\t" |
| "CMOV$cop $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| instruct cmovL_regU(cmpOpU cop, eFlagsRegU cr, eRegL dst, eRegL src) %{ |
| predicate(VM_Version::supports_cmov() ); |
| match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cop $dst.lo,$src.lo\n\t" |
| "CMOV$cop $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| //----------Arithmetic Instructions-------------------------------------------- |
| //----------Addition Instructions---------------------------------------------- |
| // Integer Addition Instructions |
| instruct addI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (AddI dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "ADD $dst,$src" %} |
| opcode(0x03); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct addI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (AddI dst src)); |
| effect(KILL cr); |
| |
| format %{ "ADD $dst,$src" %} |
| opcode(0x81, 0x00); /* /0 id */ |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ |
| predicate(UseIncDec); |
| match(Set dst (AddI dst src)); |
| effect(KILL cr); |
| |
| size(1); |
| format %{ "INC $dst" %} |
| opcode(0x40); /* */ |
| ins_encode( Opc_plus( primary, dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct leaI_eReg_immI(eRegI dst, eRegI src0, immI src1) %{ |
| match(Set dst (AddI src0 src1)); |
| ins_cost(110); |
| |
| format %{ "LEA $dst,[$src0 + $src1]" %} |
| opcode(0x8D); /* 0x8D /r */ |
| ins_encode( OpcP, RegLea( dst, src0, src1 ) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct leaP_eReg_immI(eRegP dst, eRegP src0, immI src1) %{ |
| match(Set dst (AddP src0 src1)); |
| ins_cost(110); |
| |
| format %{ "LEA $dst,[$src0 + $src1]\t# ptr" %} |
| opcode(0x8D); /* 0x8D /r */ |
| ins_encode( OpcP, RegLea( dst, src0, src1 ) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct decI_eReg(eRegI dst, immI_M1 src, eFlagsReg cr) %{ |
| predicate(UseIncDec); |
| match(Set dst (AddI dst src)); |
| effect(KILL cr); |
| |
| size(1); |
| format %{ "DEC $dst" %} |
| opcode(0x48); /* */ |
| ins_encode( Opc_plus( primary, dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct addP_eReg(eRegP dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (AddP dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "ADD $dst,$src" %} |
| opcode(0x03); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct addP_eReg_imm(eRegP dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (AddP dst src)); |
| effect(KILL cr); |
| |
| format %{ "ADD $dst,$src" %} |
| opcode(0x81,0x00); /* Opcode 81 /0 id */ |
| // ins_encode( RegImm( dst, src) ); |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct addI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (AddI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "ADD $dst,$src" %} |
| opcode(0x03); |
| ins_encode( OpcP, RegMem( dst, src) ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| instruct addI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AddI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(150); |
| format %{ "ADD $dst,$src" %} |
| opcode(0x01); /* Opcode 01 /r */ |
| ins_encode( OpcP, RegMem( src, dst ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Add Memory with Immediate |
| instruct addI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AddI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "ADD $dst,$src" %} |
| opcode(0x81); /* Opcode 81 /0 id */ |
| ins_encode( OpcSE( src ), RMopc_Mem(0x00,dst), Con8or32( src ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| instruct incI_mem(memory dst, immI1 src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AddI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "INC $dst" %} |
| opcode(0xFF); /* Opcode FF /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,dst)); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| instruct decI_mem(memory dst, immI_M1 src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AddI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "DEC $dst" %} |
| opcode(0xFF); /* Opcode FF /1 */ |
| ins_encode( OpcP, RMopc_Mem(0x01,dst)); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| |
| instruct checkCastPP( eRegP dst ) %{ |
| match(Set dst (CheckCastPP dst)); |
| |
| size(0); |
| format %{ "#checkcastPP of $dst" %} |
| ins_encode( /*empty encoding*/ ); |
| ins_pipe( empty ); |
| %} |
| |
| instruct castPP( eRegP dst ) %{ |
| match(Set dst (CastPP dst)); |
| format %{ "#castPP of $dst" %} |
| ins_encode( /*empty encoding*/ ); |
| ins_pipe( empty ); |
| %} |
| |
| instruct castII( eRegI dst ) %{ |
| match(Set dst (CastII dst)); |
| format %{ "#castII of $dst" %} |
| ins_encode( /*empty encoding*/ ); |
| ins_cost(0); |
| ins_pipe( empty ); |
| %} |
| |
| |
| // Load-locked - same as a regular pointer load when used with compare-swap |
| instruct loadPLocked(eRegP dst, memory mem) %{ |
| match(Set dst (LoadPLocked mem)); |
| |
| ins_cost(125); |
| format %{ "MOV $dst,$mem\t# Load ptr. locked" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,mem)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // LoadLong-locked - same as a volatile long load when used with compare-swap |
| instruct loadLLocked(stackSlotL dst, load_long_memory mem) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (LoadLLocked mem)); |
| |
| ins_cost(200); |
| format %{ "FILD $mem\t# Atomic volatile long load\n\t" |
| "FISTp $dst" %} |
| ins_encode(enc_loadL_volatile(mem,dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct loadLX_Locked(stackSlotL dst, load_long_memory mem, regXD tmp) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (LoadLLocked mem)); |
| effect(TEMP tmp); |
| ins_cost(180); |
| format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" |
| "MOVSD $dst,$tmp" %} |
| ins_encode(enc_loadLX_volatile(mem, dst, tmp)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct loadLX_reg_Locked(eRegL dst, load_long_memory mem, regXD tmp) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (LoadLLocked mem)); |
| effect(TEMP tmp); |
| ins_cost(160); |
| format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" |
| "MOVD $dst.lo,$tmp\n\t" |
| "PSRLQ $tmp,32\n\t" |
| "MOVD $dst.hi,$tmp" %} |
| ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Conditional-store of the updated heap-top. |
| // Used during allocation of the shared heap. |
| // Sets flags (EQ) on success. Implemented with a CMPXCHG on Intel. |
| instruct storePConditional( memory heap_top_ptr, eAXRegP oldval, eRegP newval, eFlagsReg cr ) %{ |
| match(Set cr (StorePConditional heap_top_ptr (Binary oldval newval))); |
| // EAX is killed if there is contention, but then it's also unused. |
| // In the common case of no contention, EAX holds the new oop address. |
| format %{ "CMPXCHG $heap_top_ptr,$newval\t# If EAX==$heap_top_ptr Then store $newval into $heap_top_ptr" %} |
| ins_encode( lock_prefix, Opcode(0x0F), Opcode(0xB1), RegMem(newval,heap_top_ptr) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| // Conditional-store of a long value |
| // Returns a boolean value (0/1) on success. Implemented with a CMPXCHG8 on Intel. |
| // mem_ptr can actually be in either ESI or EDI |
| instruct storeLConditional( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ |
| match(Set res (StoreLConditional mem_ptr (Binary oldval newval))); |
| effect(KILL cr); |
| // EDX:EAX is killed if there is contention, but then it's also unused. |
| // In the common case of no contention, EDX:EAX holds the new oop address. |
| format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" |
| "MOV $res,0\n\t" |
| "JNE,s fail\n\t" |
| "MOV $res,1\n" |
| "fail:" %} |
| ins_encode( enc_cmpxchg8(mem_ptr), |
| enc_flags_ne_to_boolean(res) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| // Conditional-store of a long value |
| // ZF flag is set on success, reset otherwise. Implemented with a CMPXCHG8 on Intel. |
| // mem_ptr can actually be in either ESI or EDI |
| instruct storeLConditional_flags( eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr, immI0 zero ) %{ |
| match(Set cr (CmpI (StoreLConditional mem_ptr (Binary oldval newval)) zero)); |
| // EDX:EAX is killed if there is contention, but then it's also unused. |
| // In the common case of no contention, EDX:EAX holds the new oop address. |
| format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" %} |
| ins_encode( enc_cmpxchg8(mem_ptr) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| // No flag versions for CompareAndSwap{P,I,L} because matcher can't match them |
| |
| instruct compareAndSwapL( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ |
| match(Set res (CompareAndSwapL mem_ptr (Binary oldval newval))); |
| effect(KILL cr, KILL oldval); |
| format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" |
| "MOV $res,0\n\t" |
| "JNE,s fail\n\t" |
| "MOV $res,1\n" |
| "fail:" %} |
| ins_encode( enc_cmpxchg8(mem_ptr), |
| enc_flags_ne_to_boolean(res) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| instruct compareAndSwapP( eRegI res, pRegP mem_ptr, eAXRegP oldval, eCXRegP newval, eFlagsReg cr) %{ |
| match(Set res (CompareAndSwapP mem_ptr (Binary oldval newval))); |
| effect(KILL cr, KILL oldval); |
| format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" |
| "MOV $res,0\n\t" |
| "JNE,s fail\n\t" |
| "MOV $res,1\n" |
| "fail:" %} |
| ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| instruct compareAndSwapI( eRegI res, pRegP mem_ptr, eAXRegI oldval, eCXRegI newval, eFlagsReg cr) %{ |
| match(Set res (CompareAndSwapI mem_ptr (Binary oldval newval))); |
| effect(KILL cr, KILL oldval); |
| format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" |
| "MOV $res,0\n\t" |
| "JNE,s fail\n\t" |
| "MOV $res,1\n" |
| "fail:" %} |
| ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); |
| ins_pipe( pipe_cmpxchg ); |
| %} |
| |
| //----------Subtraction Instructions------------------------------------------- |
| // Integer Subtraction Instructions |
| instruct subI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (SubI dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SUB $dst,$src" %} |
| opcode(0x2B); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct subI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (SubI dst src)); |
| effect(KILL cr); |
| |
| format %{ "SUB $dst,$src" %} |
| opcode(0x81,0x05); /* Opcode 81 /5 */ |
| // ins_encode( RegImm( dst, src) ); |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct subI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (SubI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "SUB $dst,$src" %} |
| opcode(0x2B); |
| ins_encode( OpcP, RegMem( dst, src) ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| instruct subI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (SubI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(150); |
| format %{ "SUB $dst,$src" %} |
| opcode(0x29); /* Opcode 29 /r */ |
| ins_encode( OpcP, RegMem( src, dst ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Subtract from a pointer |
| instruct subP_eReg(eRegP dst, eRegI src, immI0 zero, eFlagsReg cr) %{ |
| match(Set dst (AddP dst (SubI zero src))); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SUB $dst,$src" %} |
| opcode(0x2B); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct negI_eReg(eRegI dst, immI0 zero, eFlagsReg cr) %{ |
| match(Set dst (SubI zero dst)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "NEG $dst" %} |
| opcode(0xF7,0x03); // Opcode F7 /3 |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| |
| //----------Multiplication/Division Instructions------------------------------- |
| // Integer Multiplication Instructions |
| // Multiply Register |
| instruct mulI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (MulI dst src)); |
| effect(KILL cr); |
| |
| size(3); |
| ins_cost(300); |
| format %{ "IMUL $dst,$src" %} |
| opcode(0xAF, 0x0F); |
| ins_encode( OpcS, OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| // Multiply 32-bit Immediate |
| instruct mulI_eReg_imm(eRegI dst, eRegI src, immI imm, eFlagsReg cr) %{ |
| match(Set dst (MulI src imm)); |
| effect(KILL cr); |
| |
| ins_cost(300); |
| format %{ "IMUL $dst,$src,$imm" %} |
| opcode(0x69); /* 69 /r id */ |
| ins_encode( OpcSE(imm), RegReg( dst, src ), Con8or32( imm ) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| instruct loadConL_low_only(eADXRegL_low_only dst, immL32 src, eFlagsReg cr) %{ |
| match(Set dst src); |
| effect(KILL cr); |
| |
| // Note that this is artificially increased to make it more expensive than loadConL |
| ins_cost(250); |
| format %{ "MOV EAX,$src\t// low word only" %} |
| opcode(0xB8); |
| ins_encode( LdImmL_Lo(dst, src) ); |
| ins_pipe( ialu_reg_fat ); |
| %} |
| |
| // Multiply by 32-bit Immediate, taking the shifted high order results |
| // (special case for shift by 32) |
| instruct mulI_imm_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32 cnt, eFlagsReg cr) %{ |
| match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); |
| predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && |
| _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && |
| _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); |
| effect(USE src1, KILL cr); |
| |
| // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only |
| ins_cost(0*100 + 1*400 - 150); |
| format %{ "IMUL EDX:EAX,$src1" %} |
| ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Multiply by 32-bit Immediate, taking the shifted high order results |
| instruct mulI_imm_RShift_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr) %{ |
| match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); |
| predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && |
| _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && |
| _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); |
| effect(USE src1, KILL cr); |
| |
| // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only |
| ins_cost(1*100 + 1*400 - 150); |
| format %{ "IMUL EDX:EAX,$src1\n\t" |
| "SAR EDX,$cnt-32" %} |
| ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Multiply Memory 32-bit Immediate |
| instruct mulI_mem_imm(eRegI dst, memory src, immI imm, eFlagsReg cr) %{ |
| match(Set dst (MulI (LoadI src) imm)); |
| effect(KILL cr); |
| |
| ins_cost(300); |
| format %{ "IMUL $dst,$src,$imm" %} |
| opcode(0x69); /* 69 /r id */ |
| ins_encode( OpcSE(imm), RegMem( dst, src ), Con8or32( imm ) ); |
| ins_pipe( ialu_reg_mem_alu0 ); |
| %} |
| |
| // Multiply Memory |
| instruct mulI(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (MulI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(350); |
| format %{ "IMUL $dst,$src" %} |
| opcode(0xAF, 0x0F); |
| ins_encode( OpcS, OpcP, RegMem( dst, src) ); |
| ins_pipe( ialu_reg_mem_alu0 ); |
| %} |
| |
| // Multiply Register Int to Long |
| instruct mulI2L(eADXRegL dst, eAXRegI src, nadxRegI src1, eFlagsReg flags) %{ |
| // Basic Idea: long = (long)int * (long)int |
| match(Set dst (MulL (ConvI2L src) (ConvI2L src1))); |
| effect(DEF dst, USE src, USE src1, KILL flags); |
| |
| ins_cost(300); |
| format %{ "IMUL $dst,$src1" %} |
| |
| ins_encode( long_int_multiply( dst, src1 ) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| instruct mulIS_eReg(eADXRegL dst, immL_32bits mask, eFlagsReg flags, eAXRegI src, nadxRegI src1) %{ |
| // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) |
| match(Set dst (MulL (AndL (ConvI2L src) mask) (AndL (ConvI2L src1) mask))); |
| effect(KILL flags); |
| |
| ins_cost(300); |
| format %{ "MUL $dst,$src1" %} |
| |
| ins_encode( long_uint_multiply(dst, src1) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| // Multiply Register Long |
| instruct mulL_eReg(eADXRegL dst, eRegL src, eRegI tmp, eFlagsReg cr) %{ |
| match(Set dst (MulL dst src)); |
| effect(KILL cr, TEMP tmp); |
| ins_cost(4*100+3*400); |
| // Basic idea: lo(result) = lo(x_lo * y_lo) |
| // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) |
| format %{ "MOV $tmp,$src.lo\n\t" |
| "IMUL $tmp,EDX\n\t" |
| "MOV EDX,$src.hi\n\t" |
| "IMUL EDX,EAX\n\t" |
| "ADD $tmp,EDX\n\t" |
| "MUL EDX:EAX,$src.lo\n\t" |
| "ADD EDX,$tmp" %} |
| ins_encode( long_multiply( dst, src, tmp ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Multiply Register Long by small constant |
| instruct mulL_eReg_con(eADXRegL dst, immL_127 src, eRegI tmp, eFlagsReg cr) %{ |
| match(Set dst (MulL dst src)); |
| effect(KILL cr, TEMP tmp); |
| ins_cost(2*100+2*400); |
| size(12); |
| // Basic idea: lo(result) = lo(src * EAX) |
| // hi(result) = hi(src * EAX) + lo(src * EDX) |
| format %{ "IMUL $tmp,EDX,$src\n\t" |
| "MOV EDX,$src\n\t" |
| "MUL EDX\t# EDX*EAX -> EDX:EAX\n\t" |
| "ADD EDX,$tmp" %} |
| ins_encode( long_multiply_con( dst, src, tmp ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Integer DIV with Register |
| instruct divI_eReg(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ |
| match(Set rax (DivI rax div)); |
| effect(KILL rdx, KILL cr); |
| size(26); |
| ins_cost(30*100+10*100); |
| format %{ "CMP EAX,0x80000000\n\t" |
| "JNE,s normal\n\t" |
| "XOR EDX,EDX\n\t" |
| "CMP ECX,-1\n\t" |
| "JE,s done\n" |
| "normal: CDQ\n\t" |
| "IDIV $div\n\t" |
| "done:" %} |
| opcode(0xF7, 0x7); /* Opcode F7 /7 */ |
| ins_encode( cdq_enc, OpcP, RegOpc(div) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| // Divide Register Long |
| instruct divL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ |
| match(Set dst (DivL src1 src2)); |
| effect( KILL cr, KILL cx, KILL bx ); |
| ins_cost(10000); |
| format %{ "PUSH $src1.hi\n\t" |
| "PUSH $src1.lo\n\t" |
| "PUSH $src2.hi\n\t" |
| "PUSH $src2.lo\n\t" |
| "CALL SharedRuntime::ldiv\n\t" |
| "ADD ESP,16" %} |
| ins_encode( long_div(src1,src2) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Integer DIVMOD with Register, both quotient and mod results |
| instruct divModI_eReg_divmod(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ |
| match(DivModI rax div); |
| effect(KILL cr); |
| size(26); |
| ins_cost(30*100+10*100); |
| format %{ "CMP EAX,0x80000000\n\t" |
| "JNE,s normal\n\t" |
| "XOR EDX,EDX\n\t" |
| "CMP ECX,-1\n\t" |
| "JE,s done\n" |
| "normal: CDQ\n\t" |
| "IDIV $div\n\t" |
| "done:" %} |
| opcode(0xF7, 0x7); /* Opcode F7 /7 */ |
| ins_encode( cdq_enc, OpcP, RegOpc(div) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Integer MOD with Register |
| instruct modI_eReg(eDXRegI rdx, eAXRegI rax, eCXRegI div, eFlagsReg cr) %{ |
| match(Set rdx (ModI rax div)); |
| effect(KILL rax, KILL cr); |
| |
| size(26); |
| ins_cost(300); |
| format %{ "CDQ\n\t" |
| "IDIV $div" %} |
| opcode(0xF7, 0x7); /* Opcode F7 /7 */ |
| ins_encode( cdq_enc, OpcP, RegOpc(div) ); |
| ins_pipe( ialu_reg_reg_alu0 ); |
| %} |
| |
| // Remainder Register Long |
| instruct modL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ |
| match(Set dst (ModL src1 src2)); |
| effect( KILL cr, KILL cx, KILL bx ); |
| ins_cost(10000); |
| format %{ "PUSH $src1.hi\n\t" |
| "PUSH $src1.lo\n\t" |
| "PUSH $src2.hi\n\t" |
| "PUSH $src2.lo\n\t" |
| "CALL SharedRuntime::lrem\n\t" |
| "ADD ESP,16" %} |
| ins_encode( long_mod(src1,src2) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Integer Shift Instructions |
| // Shift Left by one |
| instruct shlI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ |
| match(Set dst (LShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SHL $dst,$shift" %} |
| opcode(0xD1, 0x4); /* D1 /4 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Shift Left by 8-bit immediate |
| instruct salI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ |
| match(Set dst (LShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(3); |
| format %{ "SHL $dst,$shift" %} |
| opcode(0xC1, 0x4); /* C1 /4 ib */ |
| ins_encode( RegOpcImm( dst, shift) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Shift Left by variable |
| instruct salI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (LShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SHL $dst,$shift" %} |
| opcode(0xD3, 0x4); /* D3 /4 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // Arithmetic shift right by one |
| instruct sarI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ |
| match(Set dst (RShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SAR $dst,$shift" %} |
| opcode(0xD1, 0x7); /* D1 /7 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Arithmetic shift right by one |
| instruct sarI_mem_1(memory dst, immI1 shift, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); |
| effect(KILL cr); |
| format %{ "SAR $dst,$shift" %} |
| opcode(0xD1, 0x7); /* D1 /7 */ |
| ins_encode( OpcP, RMopc_Mem(secondary,dst) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Arithmetic Shift Right by 8-bit immediate |
| instruct sarI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ |
| match(Set dst (RShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(3); |
| format %{ "SAR $dst,$shift" %} |
| opcode(0xC1, 0x7); /* C1 /7 ib */ |
| ins_encode( RegOpcImm( dst, shift ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Arithmetic Shift Right by 8-bit immediate |
| instruct sarI_mem_imm(memory dst, immI8 shift, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); |
| effect(KILL cr); |
| |
| format %{ "SAR $dst,$shift" %} |
| opcode(0xC1, 0x7); /* C1 /7 ib */ |
| ins_encode( OpcP, RMopc_Mem(secondary, dst ), Con8or32( shift ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Arithmetic Shift Right by variable |
| instruct sarI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (RShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SAR $dst,$shift" %} |
| opcode(0xD3, 0x7); /* D3 /7 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // Logical shift right by one |
| instruct shrI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ |
| match(Set dst (URShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SHR $dst,$shift" %} |
| opcode(0xD1, 0x5); /* D1 /5 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Logical Shift Right by 8-bit immediate |
| instruct shrI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ |
| match(Set dst (URShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(3); |
| format %{ "SHR $dst,$shift" %} |
| opcode(0xC1, 0x5); /* C1 /5 ib */ |
| ins_encode( RegOpcImm( dst, shift) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Logical Shift Right by 24, followed by Arithmetic Shift Left by 24. |
| // This idiom is used by the compiler for the i2b bytecode. |
| instruct i2b(eRegI dst, xRegI src, immI_24 twentyfour, eFlagsReg cr) %{ |
| match(Set dst (RShiftI (LShiftI src twentyfour) twentyfour)); |
| effect(KILL cr); |
| |
| size(3); |
| format %{ "MOVSX $dst,$src :8" %} |
| opcode(0xBE, 0x0F); |
| ins_encode( OpcS, OpcP, RegReg( dst, src)); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // Logical Shift Right by 16, followed by Arithmetic Shift Left by 16. |
| // This idiom is used by the compiler the i2s bytecode. |
| instruct i2s(eRegI dst, xRegI src, immI_16 sixteen, eFlagsReg cr) %{ |
| match(Set dst (RShiftI (LShiftI src sixteen) sixteen)); |
| effect(KILL cr); |
| |
| size(3); |
| format %{ "MOVSX $dst,$src :16" %} |
| opcode(0xBF, 0x0F); |
| ins_encode( OpcS, OpcP, RegReg( dst, src)); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| |
| // Logical Shift Right by variable |
| instruct shrI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (URShiftI dst shift)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "SHR $dst,$shift" %} |
| opcode(0xD3, 0x5); /* D3 /5 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| |
| //----------Logical Instructions----------------------------------------------- |
| //----------Integer Logical Instructions--------------------------------------- |
| // And Instructions |
| // And Register with Register |
| instruct andI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (AndI dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "AND $dst,$src" %} |
| opcode(0x23); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // And Register with Immediate |
| instruct andI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (AndI dst src)); |
| effect(KILL cr); |
| |
| format %{ "AND $dst,$src" %} |
| opcode(0x81,0x04); /* Opcode 81 /4 */ |
| // ins_encode( RegImm( dst, src) ); |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // And Register with Memory |
| instruct andI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (AndI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "AND $dst,$src" %} |
| opcode(0x23); |
| ins_encode( OpcP, RegMem( dst, src) ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // And Memory with Register |
| instruct andI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AndI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(150); |
| format %{ "AND $dst,$src" %} |
| opcode(0x21); /* Opcode 21 /r */ |
| ins_encode( OpcP, RegMem( src, dst ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // And Memory with Immediate |
| instruct andI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (AndI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "AND $dst,$src" %} |
| opcode(0x81, 0x4); /* Opcode 81 /4 id */ |
| // ins_encode( MemImm( dst, src) ); |
| ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // Or Instructions |
| // Or Register with Register |
| instruct orI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (OrI dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "OR $dst,$src" %} |
| opcode(0x0B); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // Or Register with Immediate |
| instruct orI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (OrI dst src)); |
| effect(KILL cr); |
| |
| format %{ "OR $dst,$src" %} |
| opcode(0x81,0x01); /* Opcode 81 /1 id */ |
| // ins_encode( RegImm( dst, src) ); |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Or Register with Memory |
| instruct orI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (OrI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "OR $dst,$src" %} |
| opcode(0x0B); |
| ins_encode( OpcP, RegMem( dst, src) ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Or Memory with Register |
| instruct orI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (OrI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(150); |
| format %{ "OR $dst,$src" %} |
| opcode(0x09); /* Opcode 09 /r */ |
| ins_encode( OpcP, RegMem( src, dst ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Or Memory with Immediate |
| instruct orI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (OrI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "OR $dst,$src" %} |
| opcode(0x81,0x1); /* Opcode 81 /1 id */ |
| // ins_encode( MemImm( dst, src) ); |
| ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| // ROL/ROR |
| // ROL expand |
| instruct rolI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ |
| effect(USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROL $dst, $shift" %} |
| opcode(0xD1, 0x0); /* Opcode D1 /0 */ |
| ins_encode( OpcP, RegOpc( dst )); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct rolI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ |
| effect(USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROL $dst, $shift" %} |
| opcode(0xC1, 0x0); /*Opcode /C1 /0 */ |
| ins_encode( RegOpcImm(dst, shift) ); |
| ins_pipe(ialu_reg); |
| %} |
| |
| instruct rolI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr) %{ |
| effect(USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROL $dst, $shift" %} |
| opcode(0xD3, 0x0); /* Opcode D3 /0 */ |
| ins_encode(OpcP, RegOpc(dst)); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| // end of ROL expand |
| |
| // ROL 32bit by one once |
| instruct rolI_eReg_i1(eRegI dst, immI1 lshift, immI_M1 rshift, eFlagsReg cr) %{ |
| match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); |
| |
| expand %{ |
| rolI_eReg_imm1(dst, lshift, cr); |
| %} |
| %} |
| |
| // ROL 32bit var by imm8 once |
| instruct rolI_eReg_i8(eRegI dst, immI8 lshift, immI8 rshift, eFlagsReg cr) %{ |
| predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); |
| match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); |
| |
| expand %{ |
| rolI_eReg_imm8(dst, lshift, cr); |
| %} |
| %} |
| |
| // ROL 32bit var by var once |
| instruct rolI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ |
| match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI zero shift)))); |
| |
| expand %{ |
| rolI_eReg_CL(dst, shift, cr); |
| %} |
| %} |
| |
| // ROL 32bit var by var once |
| instruct rolI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ |
| match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI c32 shift)))); |
| |
| expand %{ |
| rolI_eReg_CL(dst, shift, cr); |
| %} |
| %} |
| |
| // ROR expand |
| instruct rorI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ |
| effect(USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROR $dst, $shift" %} |
| opcode(0xD1,0x1); /* Opcode D1 /1 */ |
| ins_encode( OpcP, RegOpc( dst ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct rorI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ |
| effect (USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROR $dst, $shift" %} |
| opcode(0xC1, 0x1); /* Opcode /C1 /1 ib */ |
| ins_encode( RegOpcImm(dst, shift) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| instruct rorI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr)%{ |
| effect(USE_DEF dst, USE shift, KILL cr); |
| |
| format %{ "ROR $dst, $shift" %} |
| opcode(0xD3, 0x1); /* Opcode D3 /1 */ |
| ins_encode(OpcP, RegOpc(dst)); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| // end of ROR expand |
| |
| // ROR right once |
| instruct rorI_eReg_i1(eRegI dst, immI1 rshift, immI_M1 lshift, eFlagsReg cr) %{ |
| match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); |
| |
| expand %{ |
| rorI_eReg_imm1(dst, rshift, cr); |
| %} |
| %} |
| |
| // ROR 32bit by immI8 once |
| instruct rorI_eReg_i8(eRegI dst, immI8 rshift, immI8 lshift, eFlagsReg cr) %{ |
| predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); |
| match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); |
| |
| expand %{ |
| rorI_eReg_imm8(dst, rshift, cr); |
| %} |
| %} |
| |
| // ROR 32bit var by var once |
| instruct rorI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ |
| match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI zero shift)))); |
| |
| expand %{ |
| rorI_eReg_CL(dst, shift, cr); |
| %} |
| %} |
| |
| // ROR 32bit var by var once |
| instruct rorI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ |
| match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI c32 shift)))); |
| |
| expand %{ |
| rorI_eReg_CL(dst, shift, cr); |
| %} |
| %} |
| |
| // Xor Instructions |
| // Xor Register with Register |
| instruct xorI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (XorI dst src)); |
| effect(KILL cr); |
| |
| size(2); |
| format %{ "XOR $dst,$src" %} |
| opcode(0x33); |
| ins_encode( OpcP, RegReg( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| // Xor Register with Immediate |
| instruct xorI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (XorI dst src)); |
| effect(KILL cr); |
| |
| format %{ "XOR $dst,$src" %} |
| opcode(0x81,0x06); /* Opcode 81 /6 id */ |
| // ins_encode( RegImm( dst, src) ); |
| ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| // Xor Register with Memory |
| instruct xorI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ |
| match(Set dst (XorI dst (LoadI src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "XOR $dst,$src" %} |
| opcode(0x33); |
| ins_encode( OpcP, RegMem(dst, src) ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| // Xor Memory with Register |
| instruct xorI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (XorI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(150); |
| format %{ "XOR $dst,$src" %} |
| opcode(0x31); /* Opcode 31 /r */ |
| ins_encode( OpcP, RegMem( src, dst ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| // Xor Memory with Immediate |
| instruct xorI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ |
| match(Set dst (StoreI dst (XorI (LoadI dst) src))); |
| effect(KILL cr); |
| |
| ins_cost(125); |
| format %{ "XOR $dst,$src" %} |
| opcode(0x81,0x6); /* Opcode 81 /6 id */ |
| ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); |
| ins_pipe( ialu_mem_imm ); |
| %} |
| |
| //----------Convert Int to Boolean--------------------------------------------- |
| |
| instruct movI_nocopy(eRegI dst, eRegI src) %{ |
| effect( DEF dst, USE src ); |
| format %{ "MOV $dst,$src" %} |
| ins_encode( enc_Copy( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct ci2b( eRegI dst, eRegI src, eFlagsReg cr ) %{ |
| effect( USE_DEF dst, USE src, KILL cr ); |
| |
| size(4); |
| format %{ "NEG $dst\n\t" |
| "ADC $dst,$src" %} |
| ins_encode( neg_reg(dst), |
| OpcRegReg(0x13,dst,src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| instruct convI2B( eRegI dst, eRegI src, eFlagsReg cr ) %{ |
| match(Set dst (Conv2B src)); |
| |
| expand %{ |
| movI_nocopy(dst,src); |
| ci2b(dst,src,cr); |
| %} |
| %} |
| |
| instruct movP_nocopy(eRegI dst, eRegP src) %{ |
| effect( DEF dst, USE src ); |
| format %{ "MOV $dst,$src" %} |
| ins_encode( enc_Copy( dst, src) ); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| instruct cp2b( eRegI dst, eRegP src, eFlagsReg cr ) %{ |
| effect( USE_DEF dst, USE src, KILL cr ); |
| format %{ "NEG $dst\n\t" |
| "ADC $dst,$src" %} |
| ins_encode( neg_reg(dst), |
| OpcRegReg(0x13,dst,src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| instruct convP2B( eRegI dst, eRegP src, eFlagsReg cr ) %{ |
| match(Set dst (Conv2B src)); |
| |
| expand %{ |
| movP_nocopy(dst,src); |
| cp2b(dst,src,cr); |
| %} |
| %} |
| |
| instruct cmpLTMask( eCXRegI dst, ncxRegI p, ncxRegI q, eFlagsReg cr ) %{ |
| match(Set dst (CmpLTMask p q)); |
| effect( KILL cr ); |
| ins_cost(400); |
| |
| // SETlt can only use low byte of EAX,EBX, ECX, or EDX as destination |
| format %{ "XOR $dst,$dst\n\t" |
| "CMP $p,$q\n\t" |
| "SETlt $dst\n\t" |
| "NEG $dst" %} |
| ins_encode( OpcRegReg(0x33,dst,dst), |
| OpcRegReg(0x3B,p,q), |
| setLT_reg(dst), neg_reg(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct cmpLTMask0( eRegI dst, immI0 zero, eFlagsReg cr ) %{ |
| match(Set dst (CmpLTMask dst zero)); |
| effect( DEF dst, KILL cr ); |
| ins_cost(100); |
| |
| format %{ "SAR $dst,31" %} |
| opcode(0xC1, 0x7); /* C1 /7 ib */ |
| ins_encode( RegOpcImm( dst, 0x1F ) ); |
| ins_pipe( ialu_reg ); |
| %} |
| |
| |
| instruct cadd_cmpLTMask( ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp, eFlagsReg cr ) %{ |
| match(Set p (AddI (AndI (CmpLTMask p q) y) (SubI p q))); |
| effect( KILL tmp, KILL cr ); |
| ins_cost(400); |
| // annoyingly, $tmp has no edges so you cant ask for it in |
| // any format or encoding |
| format %{ "SUB $p,$q\n\t" |
| "SBB ECX,ECX\n\t" |
| "AND ECX,$y\n\t" |
| "ADD $p,ECX" %} |
| ins_encode( enc_cmpLTP(p,q,y,tmp) ); |
| ins_pipe( pipe_cmplt ); |
| %} |
| |
| /* If I enable this, I encourage spilling in the inner loop of compress. |
| instruct cadd_cmpLTMask_mem( ncxRegI p, ncxRegI q, memory y, eCXRegI tmp, eFlagsReg cr ) %{ |
| match(Set p (AddI (AndI (CmpLTMask p q) (LoadI y)) (SubI p q))); |
| effect( USE_KILL tmp, KILL cr ); |
| ins_cost(400); |
| |
| format %{ "SUB $p,$q\n\t" |
| "SBB ECX,ECX\n\t" |
| "AND ECX,$y\n\t" |
| "ADD $p,ECX" %} |
| ins_encode( enc_cmpLTP_mem(p,q,y,tmp) ); |
| %} |
| */ |
| |
| //----------Long Instructions------------------------------------------------ |
| // Add Long Register with Register |
| instruct addL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (AddL dst src)); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "ADD $dst.lo,$src.lo\n\t" |
| "ADC $dst.hi,$src.hi" %} |
| opcode(0x03, 0x13); |
| ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Add Long Register with Immediate |
| instruct addL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst (AddL dst src)); |
| effect(KILL cr); |
| format %{ "ADD $dst.lo,$src.lo\n\t" |
| "ADC $dst.hi,$src.hi" %} |
| opcode(0x81,0x00,0x02); /* Opcode 81 /0, 81 /2 */ |
| ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Add Long Register with Memory |
| instruct addL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ |
| match(Set dst (AddL dst (LoadL mem))); |
| effect(KILL cr); |
| ins_cost(125); |
| format %{ "ADD $dst.lo,$mem\n\t" |
| "ADC $dst.hi,$mem+4" %} |
| opcode(0x03, 0x13); |
| ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| // Subtract Long Register with Register. |
| instruct subL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (SubL dst src)); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "SUB $dst.lo,$src.lo\n\t" |
| "SBB $dst.hi,$src.hi" %} |
| opcode(0x2B, 0x1B); |
| ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Subtract Long Register with Immediate |
| instruct subL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst (SubL dst src)); |
| effect(KILL cr); |
| format %{ "SUB $dst.lo,$src.lo\n\t" |
| "SBB $dst.hi,$src.hi" %} |
| opcode(0x81,0x05,0x03); /* Opcode 81 /5, 81 /3 */ |
| ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Subtract Long Register with Memory |
| instruct subL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ |
| match(Set dst (SubL dst (LoadL mem))); |
| effect(KILL cr); |
| ins_cost(125); |
| format %{ "SUB $dst.lo,$mem\n\t" |
| "SBB $dst.hi,$mem+4" %} |
| opcode(0x2B, 0x1B); |
| ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| instruct negL_eReg(eRegL dst, immL0 zero, eFlagsReg cr) %{ |
| match(Set dst (SubL zero dst)); |
| effect(KILL cr); |
| ins_cost(300); |
| format %{ "NEG $dst.hi\n\tNEG $dst.lo\n\tSBB $dst.hi,0" %} |
| ins_encode( neg_long(dst) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // And Long Register with Register |
| instruct andL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (AndL dst src)); |
| effect(KILL cr); |
| format %{ "AND $dst.lo,$src.lo\n\t" |
| "AND $dst.hi,$src.hi" %} |
| opcode(0x23,0x23); |
| ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // And Long Register with Immediate |
| instruct andL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst (AndL dst src)); |
| effect(KILL cr); |
| format %{ "AND $dst.lo,$src.lo\n\t" |
| "AND $dst.hi,$src.hi" %} |
| opcode(0x81,0x04,0x04); /* Opcode 81 /4, 81 /4 */ |
| ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // And Long Register with Memory |
| instruct andL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ |
| match(Set dst (AndL dst (LoadL mem))); |
| effect(KILL cr); |
| ins_cost(125); |
| format %{ "AND $dst.lo,$mem\n\t" |
| "AND $dst.hi,$mem+4" %} |
| opcode(0x23, 0x23); |
| ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| // Or Long Register with Register |
| instruct orl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (OrL dst src)); |
| effect(KILL cr); |
| format %{ "OR $dst.lo,$src.lo\n\t" |
| "OR $dst.hi,$src.hi" %} |
| opcode(0x0B,0x0B); |
| ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Or Long Register with Immediate |
| instruct orl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst (OrL dst src)); |
| effect(KILL cr); |
| format %{ "OR $dst.lo,$src.lo\n\t" |
| "OR $dst.hi,$src.hi" %} |
| opcode(0x81,0x01,0x01); /* Opcode 81 /1, 81 /1 */ |
| ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Or Long Register with Memory |
| instruct orl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ |
| match(Set dst (OrL dst (LoadL mem))); |
| effect(KILL cr); |
| ins_cost(125); |
| format %{ "OR $dst.lo,$mem\n\t" |
| "OR $dst.hi,$mem+4" %} |
| opcode(0x0B,0x0B); |
| ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| // Xor Long Register with Register |
| instruct xorl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (XorL dst src)); |
| effect(KILL cr); |
| format %{ "XOR $dst.lo,$src.lo\n\t" |
| "XOR $dst.hi,$src.hi" %} |
| opcode(0x33,0x33); |
| ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Xor Long Register with Immediate |
| instruct xorl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ |
| match(Set dst (XorL dst src)); |
| effect(KILL cr); |
| format %{ "XOR $dst.lo,$src.lo\n\t" |
| "XOR $dst.hi,$src.hi" %} |
| opcode(0x81,0x06,0x06); /* Opcode 81 /6, 81 /6 */ |
| ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Xor Long Register with Memory |
| instruct xorl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ |
| match(Set dst (XorL dst (LoadL mem))); |
| effect(KILL cr); |
| ins_cost(125); |
| format %{ "XOR $dst.lo,$mem\n\t" |
| "XOR $dst.hi,$mem+4" %} |
| opcode(0x33,0x33); |
| ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); |
| ins_pipe( ialu_reg_long_mem ); |
| %} |
| |
| // Shift Left Long by 1-31 |
| instruct shlL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ |
| match(Set dst (LShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "SHLD $dst.hi,$dst.lo,$cnt\n\t" |
| "SHL $dst.lo,$cnt" %} |
| opcode(0xC1, 0x4, 0xA4); /* 0F/A4, then C1 /4 ib */ |
| ins_encode( move_long_small_shift(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Left Long by 32-63 |
| instruct shlL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ |
| match(Set dst (LShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(300); |
| format %{ "MOV $dst.hi,$dst.lo\n" |
| "\tSHL $dst.hi,$cnt-32\n" |
| "\tXOR $dst.lo,$dst.lo" %} |
| opcode(0xC1, 0x4); /* C1 /4 ib */ |
| ins_encode( move_long_big_shift_clr(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Left Long by variable |
| instruct salL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (LShiftL dst shift)); |
| effect(KILL cr); |
| ins_cost(500+200); |
| size(17); |
| format %{ "TEST $shift,32\n\t" |
| "JEQ,s small\n\t" |
| "MOV $dst.hi,$dst.lo\n\t" |
| "XOR $dst.lo,$dst.lo\n" |
| "small:\tSHLD $dst.hi,$dst.lo,$shift\n\t" |
| "SHL $dst.lo,$shift" %} |
| ins_encode( shift_left_long( dst, shift ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Shift Right Long by 1-31 |
| instruct shrL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ |
| match(Set dst (URShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" |
| "SHR $dst.hi,$cnt" %} |
| opcode(0xC1, 0x5, 0xAC); /* 0F/AC, then C1 /5 ib */ |
| ins_encode( move_long_small_shift(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Right Long by 32-63 |
| instruct shrL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ |
| match(Set dst (URShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(300); |
| format %{ "MOV $dst.lo,$dst.hi\n" |
| "\tSHR $dst.lo,$cnt-32\n" |
| "\tXOR $dst.hi,$dst.hi" %} |
| opcode(0xC1, 0x5); /* C1 /5 ib */ |
| ins_encode( move_long_big_shift_clr(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Right Long by variable |
| instruct shrL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (URShiftL dst shift)); |
| effect(KILL cr); |
| ins_cost(600); |
| size(17); |
| format %{ "TEST $shift,32\n\t" |
| "JEQ,s small\n\t" |
| "MOV $dst.lo,$dst.hi\n\t" |
| "XOR $dst.hi,$dst.hi\n" |
| "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" |
| "SHR $dst.hi,$shift" %} |
| ins_encode( shift_right_long( dst, shift ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Shift Right Long by 1-31 |
| instruct sarL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ |
| match(Set dst (RShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(200); |
| format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" |
| "SAR $dst.hi,$cnt" %} |
| opcode(0xC1, 0x7, 0xAC); /* 0F/AC, then C1 /7 ib */ |
| ins_encode( move_long_small_shift(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Right Long by 32-63 |
| instruct sarL_eReg_32_63( eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ |
| match(Set dst (RShiftL dst cnt)); |
| effect(KILL cr); |
| ins_cost(300); |
| format %{ "MOV $dst.lo,$dst.hi\n" |
| "\tSAR $dst.lo,$cnt-32\n" |
| "\tSAR $dst.hi,31" %} |
| opcode(0xC1, 0x7); /* C1 /7 ib */ |
| ins_encode( move_long_big_shift_sign(dst,cnt) ); |
| ins_pipe( ialu_reg_long ); |
| %} |
| |
| // Shift Right arithmetic Long by variable |
| instruct sarL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ |
| match(Set dst (RShiftL dst shift)); |
| effect(KILL cr); |
| ins_cost(600); |
| size(18); |
| format %{ "TEST $shift,32\n\t" |
| "JEQ,s small\n\t" |
| "MOV $dst.lo,$dst.hi\n\t" |
| "SAR $dst.hi,31\n" |
| "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" |
| "SAR $dst.hi,$shift" %} |
| ins_encode( shift_right_arith_long( dst, shift ) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| //----------Double Instructions------------------------------------------------ |
| // Double Math |
| |
| // Compare & branch |
| |
| // P6 version of float compare, sets condition codes in EFLAGS |
| instruct cmpD_cc_P6(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ |
| predicate(VM_Version::supports_cmov() && UseSSE <=1); |
| match(Set cr (CmpD src1 src2)); |
| effect(KILL rax); |
| ins_cost(150); |
| format %{ "FLD $src1\n\t" |
| "FUCOMIP ST,$src2 // P6 instruction\n\t" |
| "JNP exit\n\t" |
| "MOV ah,1 // saw a NaN, set CF\n\t" |
| "SAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| cmpF_P6_fixup ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare & branch |
| instruct cmpD_cc(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ |
| predicate(UseSSE<=1); |
| match(Set cr (CmpD src1 src2)); |
| effect(KILL rax); |
| ins_cost(200); |
| format %{ "FLD $src1\n\t" |
| "FCOMp $src2\n\t" |
| "FNSTSW AX\n\t" |
| "TEST AX,0x400\n\t" |
| "JZ,s flags\n\t" |
| "MOV AH,1\t# unordered treat as LT\n" |
| "flags:\tSAHF" %} |
| opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| fpu_flags); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare vs zero into -1,0,1 |
| instruct cmpD_0(eRegI dst, regD src1, immD0 zero, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (CmpD3 src1 zero)); |
| effect(KILL cr, KILL rax); |
| ins_cost(280); |
| format %{ "FTSTD $dst,$src1" %} |
| opcode(0xE4, 0xD9); |
| ins_encode( Push_Reg_D(src1), |
| OpcS, OpcP, PopFPU, |
| CmpF_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 |
| instruct cmpD_reg(eRegI dst, regD src1, regD src2, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (CmpD3 src1 src2)); |
| effect(KILL cr, KILL rax); |
| ins_cost(300); |
| format %{ "FCMPD $dst,$src1,$src2" %} |
| opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| CmpF_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // float compare and set condition codes in EFLAGS by XMM regs |
| instruct cmpXD_cc(eFlagsRegU cr, regXD dst, regXD src, eAXRegI rax) %{ |
| predicate(UseSSE>=2); |
| match(Set cr (CmpD dst src)); |
| effect(KILL rax); |
| ins_cost(125); |
| format %{ "COMISD $dst,$src\n" |
| "\tJNP exit\n" |
| "\tMOV ah,1 // saw a NaN, set CF\n" |
| "\tSAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0x66, 0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, Opcode(tertiary), RegReg(dst, src), cmpF_P6_fixup); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // float compare and set condition codes in EFLAGS by XMM regs |
| instruct cmpXD_ccmem(eFlagsRegU cr, regXD dst, memory src, eAXRegI rax) %{ |
| predicate(UseSSE>=2); |
| match(Set cr (CmpD dst (LoadD src))); |
| effect(KILL rax); |
| ins_cost(145); |
| format %{ "COMISD $dst,$src\n" |
| "\tJNP exit\n" |
| "\tMOV ah,1 // saw a NaN, set CF\n" |
| "\tSAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0x66, 0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(dst, src), cmpF_P6_fixup); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 in XMM |
| instruct cmpXD_reg(eRegI dst, regXD src1, regXD src2, eFlagsReg cr) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (CmpD3 src1 src2)); |
| effect(KILL cr); |
| ins_cost(255); |
| format %{ "XOR $dst,$dst\n" |
| "\tCOMISD $src1,$src2\n" |
| "\tJP,s nan\n" |
| "\tJEQ,s exit\n" |
| "\tJA,s inc\n" |
| "nan:\tDEC $dst\n" |
| "\tJMP,s exit\n" |
| "inc:\tINC $dst\n" |
| "exit:" |
| %} |
| opcode(0x66, 0x0F, 0x2F); |
| ins_encode(Xor_Reg(dst), OpcP, OpcS, Opcode(tertiary), RegReg(src1, src2), |
| CmpX_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 in XMM and memory |
| instruct cmpXD_regmem(eRegI dst, regXD src1, memory mem, eFlagsReg cr) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (CmpD3 src1 (LoadD mem))); |
| effect(KILL cr); |
| ins_cost(275); |
| format %{ "COMISD $src1,$mem\n" |
| "\tMOV $dst,0\t\t# do not blow flags\n" |
| "\tJP,s nan\n" |
| "\tJEQ,s exit\n" |
| "\tJA,s inc\n" |
| "nan:\tDEC $dst\n" |
| "\tJMP,s exit\n" |
| "inc:\tINC $dst\n" |
| "exit:" |
| %} |
| opcode(0x66, 0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(src1, mem), |
| LdImmI(dst,0x0), CmpX_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| instruct subD_reg(regD dst, regD src) %{ |
| predicate (UseSSE <=1); |
| match(Set dst (SubD dst src)); |
| |
| format %{ "FLD $src\n\t" |
| "DSUBp $dst,ST" %} |
| opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ |
| ins_cost(150); |
| ins_encode( Push_Reg_D(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct subD_reg_round(stackSlotD dst, regD src1, regD src2) %{ |
| predicate (UseSSE <=1); |
| match(Set dst (RoundDouble (SubD src1 src2))); |
| ins_cost(250); |
| |
| format %{ "FLD $src2\n\t" |
| "DSUB ST,$src1\n\t" |
| "FSTP_D $dst\t# D-round" %} |
| opcode(0xD8, 0x5); |
| ins_encode( Push_Reg_D(src2), |
| OpcP, RegOpc(src1), Pop_Mem_D(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| |
| |
| instruct subD_reg_mem(regD dst, memory src) %{ |
| predicate (UseSSE <=1); |
| match(Set dst (SubD dst (LoadD src))); |
| ins_cost(150); |
| |
| format %{ "FLD $src\n\t" |
| "DSUBp $dst,ST" %} |
| opcode(0xDE, 0x5, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct absD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (AbsD src)); |
| ins_cost(100); |
| format %{ "FABS" %} |
| opcode(0xE1, 0xD9); |
| ins_encode( OpcS, OpcP ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct absXD_reg( regXD dst ) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (AbsD dst)); |
| format %{ "ANDPD $dst,[0x7FFFFFFFFFFFFFFF]\t# ABS D by sign masking" %} |
| ins_encode( AbsXD_encoding(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct negD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (NegD src)); |
| ins_cost(100); |
| format %{ "FCHS" %} |
| opcode(0xE0, 0xD9); |
| ins_encode( OpcS, OpcP ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct negXD_reg( regXD dst ) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (NegD dst)); |
| format %{ "XORPD $dst,[0x8000000000000000]\t# CHS D by sign flipping" %} |
| ins_encode %{ |
| __ xorpd($dst$$XMMRegister, |
| ExternalAddress((address)double_signflip_pool)); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct addD_reg(regD dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (AddD dst src)); |
| format %{ "FLD $src\n\t" |
| "DADD $dst,ST" %} |
| size(4); |
| ins_cost(150); |
| opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ |
| ins_encode( Push_Reg_D(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| |
| instruct addD_reg_round(stackSlotD dst, regD src1, regD src2) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (RoundDouble (AddD src1 src2))); |
| ins_cost(250); |
| |
| format %{ "FLD $src2\n\t" |
| "DADD ST,$src1\n\t" |
| "FSTP_D $dst\t# D-round" %} |
| opcode(0xD8, 0x0); /* D8 C0+i or D8 /0*/ |
| ins_encode( Push_Reg_D(src2), |
| OpcP, RegOpc(src1), Pop_Mem_D(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| |
| |
| instruct addD_reg_mem(regD dst, memory src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (AddD dst (LoadD src))); |
| ins_cost(150); |
| |
| format %{ "FLD $src\n\t" |
| "DADDp $dst,ST" %} |
| opcode(0xDE, 0x0, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // add-to-memory |
| instruct addD_mem_reg(memory dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (StoreD dst (RoundDouble (AddD (LoadD dst) src)))); |
| ins_cost(150); |
| |
| format %{ "FLD_D $dst\n\t" |
| "DADD ST,$src\n\t" |
| "FST_D $dst" %} |
| opcode(0xDD, 0x0); |
| ins_encode( Opcode(0xDD), RMopc_Mem(0x00,dst), |
| Opcode(0xD8), RegOpc(src), |
| set_instruction_start, |
| Opcode(0xDD), RMopc_Mem(0x03,dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct addD_reg_imm1(regD dst, immD1 src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (AddD dst src)); |
| ins_cost(125); |
| format %{ "FLD1\n\t" |
| "DADDp $dst,ST" %} |
| opcode(0xDE, 0x00); |
| ins_encode( LdImmD(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg ); |
| %} |
| |
| instruct addD_reg_imm(regD dst, immD src) %{ |
| predicate(UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); |
| match(Set dst (AddD dst src)); |
| ins_cost(200); |
| format %{ "FLD_D [$src]\n\t" |
| "DADDp $dst,ST" %} |
| opcode(0xDE, 0x00); /* DE /0 */ |
| ins_encode( LdImmD(src), |
| OpcP, RegOpc(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct addD_reg_imm_round(stackSlotD dst, regD src, immD con) %{ |
| predicate(UseSSE<=1 && _kids[0]->_kids[1]->_leaf->getd() != 0.0 && _kids[0]->_kids[1]->_leaf->getd() != 1.0 ); |
| match(Set dst (RoundDouble (AddD src con))); |
| ins_cost(200); |
| format %{ "FLD_D [$con]\n\t" |
| "DADD ST,$src\n\t" |
| "FSTP_D $dst\t# D-round" %} |
| opcode(0xD8, 0x00); /* D8 /0 */ |
| ins_encode( LdImmD(con), |
| OpcP, RegOpc(src), Pop_Mem_D(dst)); |
| ins_pipe( fpu_mem_reg_con ); |
| %} |
| |
| // Add two double precision floating point values in xmm |
| instruct addXD_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (AddD dst src)); |
| format %{ "ADDSD $dst,$src" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct addXD_imm(regXD dst, immXD con) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (AddD dst con)); |
| format %{ "ADDSD $dst,[$con]" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), LdImmXD(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct addXD_mem(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (AddD dst (LoadD mem))); |
| format %{ "ADDSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Sub two double precision floating point values in xmm |
| instruct subXD_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (SubD dst src)); |
| format %{ "SUBSD $dst,$src" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct subXD_imm(regXD dst, immXD con) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (SubD dst con)); |
| format %{ "SUBSD $dst,[$con]" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), LdImmXD(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct subXD_mem(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (SubD dst (LoadD mem))); |
| format %{ "SUBSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Mul two double precision floating point values in xmm |
| instruct mulXD_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MulD dst src)); |
| format %{ "MULSD $dst,$src" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct mulXD_imm(regXD dst, immXD con) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MulD dst con)); |
| format %{ "MULSD $dst,[$con]" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), LdImmXD(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct mulXD_mem(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MulD dst (LoadD mem))); |
| format %{ "MULSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Div two double precision floating point values in xmm |
| instruct divXD_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (DivD dst src)); |
| format %{ "DIVSD $dst,$src" %} |
| opcode(0xF2, 0x0F, 0x5E); |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct divXD_imm(regXD dst, immXD con) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (DivD dst con)); |
| format %{ "DIVSD $dst,[$con]" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), LdImmXD(dst, con)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct divXD_mem(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (DivD dst (LoadD mem))); |
| format %{ "DIVSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| instruct mulD_reg(regD dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (MulD dst src)); |
| format %{ "FLD $src\n\t" |
| "DMULp $dst,ST" %} |
| opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ |
| ins_cost(150); |
| ins_encode( Push_Reg_D(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Strict FP instruction biases argument before multiply then |
| // biases result to avoid double rounding of subnormals. |
| // |
| // scale arg1 by multiplying arg1 by 2^(-15360) |
| // load arg2 |
| // multiply scaled arg1 by arg2 |
| // rescale product by 2^(15360) |
| // |
| instruct strictfp_mulD_reg(regDPR1 dst, regnotDPR1 src) %{ |
| predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); |
| match(Set dst (MulD dst src)); |
| ins_cost(1); // Select this instruction for all strict FP double multiplies |
| |
| format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" |
| "DMULp $dst,ST\n\t" |
| "FLD $src\n\t" |
| "DMULp $dst,ST\n\t" |
| "FLD StubRoutines::_fpu_subnormal_bias2\n\t" |
| "DMULp $dst,ST\n\t" %} |
| opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ |
| ins_encode( strictfp_bias1(dst), |
| Push_Reg_D(src), |
| OpcP, RegOpc(dst), |
| strictfp_bias2(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct mulD_reg_imm(regD dst, immD src) %{ |
| predicate( UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); |
| match(Set dst (MulD dst src)); |
| ins_cost(200); |
| format %{ "FLD_D [$src]\n\t" |
| "DMULp $dst,ST" %} |
| opcode(0xDE, 0x1); /* DE /1 */ |
| ins_encode( LdImmD(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| |
| instruct mulD_reg_mem(regD dst, memory src) %{ |
| predicate( UseSSE<=1 ); |
| match(Set dst (MulD dst (LoadD src))); |
| ins_cost(200); |
| format %{ "FLD_D $src\n\t" |
| "DMULp $dst,ST" %} |
| opcode(0xDE, 0x1, 0xDD); /* DE C8+i or DE /1*/ /* LoadD DD /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // |
| // Cisc-alternate to reg-reg multiply |
| instruct mulD_reg_mem_cisc(regD dst, regD src, memory mem) %{ |
| predicate( UseSSE<=1 ); |
| match(Set dst (MulD src (LoadD mem))); |
| ins_cost(250); |
| format %{ "FLD_D $mem\n\t" |
| "DMUL ST,$src\n\t" |
| "FSTP_D $dst" %} |
| opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadD D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem), |
| OpcReg_F(src), |
| Pop_Reg_D(dst) ); |
| ins_pipe( fpu_reg_reg_mem ); |
| %} |
| |
| |
| // MACRO3 -- addD a mulD |
| // This instruction is a '2-address' instruction in that the result goes |
| // back to src2. This eliminates a move from the macro; possibly the |
| // register allocator will have to add it back (and maybe not). |
| instruct addD_mulD_reg(regD src2, regD src1, regD src0) %{ |
| predicate( UseSSE<=1 ); |
| match(Set src2 (AddD (MulD src0 src1) src2)); |
| format %{ "FLD $src0\t# ===MACRO3d===\n\t" |
| "DMUL ST,$src1\n\t" |
| "DADDp $src2,ST" %} |
| ins_cost(250); |
| opcode(0xDD); /* LoadD DD /0 */ |
| ins_encode( Push_Reg_F(src0), |
| FMul_ST_reg(src1), |
| FAddP_reg_ST(src2) ); |
| ins_pipe( fpu_reg_reg_reg ); |
| %} |
| |
| |
| // MACRO3 -- subD a mulD |
| instruct subD_mulD_reg(regD src2, regD src1, regD src0) %{ |
| predicate( UseSSE<=1 ); |
| match(Set src2 (SubD (MulD src0 src1) src2)); |
| format %{ "FLD $src0\t# ===MACRO3d===\n\t" |
| "DMUL ST,$src1\n\t" |
| "DSUBRp $src2,ST" %} |
| ins_cost(250); |
| ins_encode( Push_Reg_F(src0), |
| FMul_ST_reg(src1), |
| Opcode(0xDE), Opc_plus(0xE0,src2)); |
| ins_pipe( fpu_reg_reg_reg ); |
| %} |
| |
| |
| instruct divD_reg(regD dst, regD src) %{ |
| predicate( UseSSE<=1 ); |
| match(Set dst (DivD dst src)); |
| |
| format %{ "FLD $src\n\t" |
| "FDIVp $dst,ST" %} |
| opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ |
| ins_cost(150); |
| ins_encode( Push_Reg_D(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Strict FP instruction biases argument before division then |
| // biases result, to avoid double rounding of subnormals. |
| // |
| // scale dividend by multiplying dividend by 2^(-15360) |
| // load divisor |
| // divide scaled dividend by divisor |
| // rescale quotient by 2^(15360) |
| // |
| instruct strictfp_divD_reg(regDPR1 dst, regnotDPR1 src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (DivD dst src)); |
| predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); |
| ins_cost(01); |
| |
| format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" |
| "DMULp $dst,ST\n\t" |
| "FLD $src\n\t" |
| "FDIVp $dst,ST\n\t" |
| "FLD StubRoutines::_fpu_subnormal_bias2\n\t" |
| "DMULp $dst,ST\n\t" %} |
| opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ |
| ins_encode( strictfp_bias1(dst), |
| Push_Reg_D(src), |
| OpcP, RegOpc(dst), |
| strictfp_bias2(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct divD_reg_round(stackSlotD dst, regD src1, regD src2) %{ |
| predicate( UseSSE<=1 && !(Compile::current()->has_method() && Compile::current()->method()->is_strict()) ); |
| match(Set dst (RoundDouble (DivD src1 src2))); |
| |
| format %{ "FLD $src1\n\t" |
| "FDIV ST,$src2\n\t" |
| "FSTP_D $dst\t# D-round" %} |
| opcode(0xD8, 0x6); /* D8 F0+i or D8 /6 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), Pop_Mem_D(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| |
| |
| instruct modD_reg(regD dst, regD src, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (ModD dst src)); |
| effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS |
| |
| format %{ "DMOD $dst,$src" %} |
| ins_cost(250); |
| ins_encode(Push_Reg_Mod_D(dst, src), |
| emitModD(), |
| Push_Result_Mod_D(src), |
| Pop_Reg_D(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct modXD_reg(regXD dst, regXD src0, regXD src1, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (ModD src0 src1)); |
| effect(KILL rax, KILL cr); |
| |
| format %{ "SUB ESP,8\t # DMOD\n" |
| "\tMOVSD [ESP+0],$src1\n" |
| "\tFLD_D [ESP+0]\n" |
| "\tMOVSD [ESP+0],$src0\n" |
| "\tFLD_D [ESP+0]\n" |
| "loop:\tFPREM\n" |
| "\tFWAIT\n" |
| "\tFNSTSW AX\n" |
| "\tSAHF\n" |
| "\tJP loop\n" |
| "\tFSTP_D [ESP+0]\n" |
| "\tMOVSD $dst,[ESP+0]\n" |
| "\tADD ESP,8\n" |
| "\tFSTP ST0\t # Restore FPU Stack" |
| %} |
| ins_cost(250); |
| ins_encode( Push_ModD_encoding(src0, src1), emitModD(), Push_ResultXD(dst), PopFPU); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct sinD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (SinD src)); |
| ins_cost(1800); |
| format %{ "DSIN $dst" %} |
| opcode(0xD9, 0xFE); |
| ins_encode( OpcP, OpcS ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct sinXD_reg(regXD dst, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (SinD dst)); |
| effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" |
| ins_cost(1800); |
| format %{ "DSIN $dst" %} |
| opcode(0xD9, 0xFE); |
| ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct cosD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (CosD src)); |
| ins_cost(1800); |
| format %{ "DCOS $dst" %} |
| opcode(0xD9, 0xFF); |
| ins_encode( OpcP, OpcS ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct cosXD_reg(regXD dst, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (CosD dst)); |
| effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" |
| ins_cost(1800); |
| format %{ "DCOS $dst" %} |
| opcode(0xD9, 0xFF); |
| ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct tanD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst(TanD src)); |
| format %{ "DTAN $dst" %} |
| ins_encode( Opcode(0xD9), Opcode(0xF2), // fptan |
| Opcode(0xDD), Opcode(0xD8)); // fstp st |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct tanXD_reg(regXD dst, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| match(Set dst(TanD dst)); |
| effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" |
| format %{ "DTAN $dst" %} |
| ins_encode( Push_SrcXD(dst), |
| Opcode(0xD9), Opcode(0xF2), // fptan |
| Opcode(0xDD), Opcode(0xD8), // fstp st |
| Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct atanD_reg(regD dst, regD src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst(AtanD dst src)); |
| format %{ "DATA $dst,$src" %} |
| opcode(0xD9, 0xF3); |
| ins_encode( Push_Reg_D(src), |
| OpcP, OpcS, RegOpc(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct atanXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| match(Set dst(AtanD dst src)); |
| effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" |
| format %{ "DATA $dst,$src" %} |
| opcode(0xD9, 0xF3); |
| ins_encode( Push_SrcXD(src), |
| OpcP, OpcS, Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct sqrtD_reg(regD dst, regD src) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (SqrtD src)); |
| format %{ "DSQRT $dst,$src" %} |
| opcode(0xFA, 0xD9); |
| ins_encode( Push_Reg_D(src), |
| OpcS, OpcP, Pop_Reg_D(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct powD_reg(regD X, regDPR1 Y, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ |
| predicate (UseSSE<=1); |
| match(Set Y (PowD X Y)); // Raise X to the Yth power |
| effect(KILL rax, KILL rbx, KILL rcx); |
| format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" |
| "FLD_D $X\n\t" |
| "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" |
| |
| "FDUP \t\t\t# Q Q\n\t" |
| "FRNDINT\t\t\t# int(Q) Q\n\t" |
| "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" |
| "FISTP dword [ESP]\n\t" |
| "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" |
| "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" |
| "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead |
| "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" |
| "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" |
| "ADD EAX,1023\t\t# Double exponent bias\n\t" |
| "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" |
| "SHL EAX,20\t\t# Shift exponent into place\n\t" |
| "TEST EBX,ECX\t\t# Check for overflow\n\t" |
| "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" |
| "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" |
| "MOV [ESP+0],0\n\t" |
| "FMUL ST(0),[ESP+0]\t# Scale\n\t" |
| |
| "ADD ESP,8" |
| %} |
| ins_encode( push_stack_temp_qword, |
| Push_Reg_D(X), |
| Opcode(0xD9), Opcode(0xF1), // fyl2x |
| pow_exp_core_encoding, |
| pop_stack_temp_qword); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct powXD_reg(regXD dst, regXD src0, regXD src1, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx ) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (PowD src0 src1)); // Raise src0 to the src1'th power |
| effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx ); |
| format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" |
| "MOVSD [ESP],$src1\n\t" |
| "FLD FPR1,$src1\n\t" |
| "MOVSD [ESP],$src0\n\t" |
| "FLD FPR1,$src0\n\t" |
| "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" |
| |
| "FDUP \t\t\t# Q Q\n\t" |
| "FRNDINT\t\t\t# int(Q) Q\n\t" |
| "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" |
| "FISTP dword [ESP]\n\t" |
| "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" |
| "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" |
| "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead |
| "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" |
| "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" |
| "ADD EAX,1023\t\t# Double exponent bias\n\t" |
| "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" |
| "SHL EAX,20\t\t# Shift exponent into place\n\t" |
| "TEST EBX,ECX\t\t# Check for overflow\n\t" |
| "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" |
| "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" |
| "MOV [ESP+0],0\n\t" |
| "FMUL ST(0),[ESP+0]\t# Scale\n\t" |
| |
| "FST_D [ESP]\n\t" |
| "MOVSD $dst,[ESP]\n\t" |
| "ADD ESP,8" |
| %} |
| ins_encode( push_stack_temp_qword, |
| push_xmm_to_fpr1(src1), |
| push_xmm_to_fpr1(src0), |
| Opcode(0xD9), Opcode(0xF1), // fyl2x |
| pow_exp_core_encoding, |
| Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| instruct expD_reg(regDPR1 dpr1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ |
| predicate (UseSSE<=1); |
| match(Set dpr1 (ExpD dpr1)); |
| effect(KILL rax, KILL rbx, KILL rcx); |
| format %{ "SUB ESP,8\t\t# Fast-path EXP encoding" |
| "FLDL2E \t\t\t# Ld log2(e) X\n\t" |
| "FMULP \t\t\t# Q=X*log2(e)\n\t" |
| |
| "FDUP \t\t\t# Q Q\n\t" |
| "FRNDINT\t\t\t# int(Q) Q\n\t" |
| "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" |
| "FISTP dword [ESP]\n\t" |
| "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" |
| "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" |
| "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead |
| "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" |
| "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" |
| "ADD EAX,1023\t\t# Double exponent bias\n\t" |
| "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" |
| "SHL EAX,20\t\t# Shift exponent into place\n\t" |
| "TEST EBX,ECX\t\t# Check for overflow\n\t" |
| "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" |
| "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" |
| "MOV [ESP+0],0\n\t" |
| "FMUL ST(0),[ESP+0]\t# Scale\n\t" |
| |
| "ADD ESP,8" |
| %} |
| ins_encode( push_stack_temp_qword, |
| Opcode(0xD9), Opcode(0xEA), // fldl2e |
| Opcode(0xDE), Opcode(0xC9), // fmulp |
| pow_exp_core_encoding, |
| pop_stack_temp_qword); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct expXD_reg(regXD dst, regXD src, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (ExpD src)); |
| effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx); |
| format %{ "SUB ESP,8\t\t# Fast-path EXP encoding\n\t" |
| "MOVSD [ESP],$src\n\t" |
| "FLDL2E \t\t\t# Ld log2(e) X\n\t" |
| "FMULP \t\t\t# Q=X*log2(e) X\n\t" |
| |
| "FDUP \t\t\t# Q Q\n\t" |
| "FRNDINT\t\t\t# int(Q) Q\n\t" |
| "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" |
| "FISTP dword [ESP]\n\t" |
| "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" |
| "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" |
| "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead |
| "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" |
| "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" |
| "ADD EAX,1023\t\t# Double exponent bias\n\t" |
| "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" |
| "SHL EAX,20\t\t# Shift exponent into place\n\t" |
| "TEST EBX,ECX\t\t# Check for overflow\n\t" |
| "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" |
| "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" |
| "MOV [ESP+0],0\n\t" |
| "FMUL ST(0),[ESP+0]\t# Scale\n\t" |
| |
| "FST_D [ESP]\n\t" |
| "MOVSD $dst,[ESP]\n\t" |
| "ADD ESP,8" |
| %} |
| ins_encode( Push_SrcXD(src), |
| Opcode(0xD9), Opcode(0xEA), // fldl2e |
| Opcode(0xDE), Opcode(0xC9), // fmulp |
| pow_exp_core_encoding, |
| Push_ResultXD(dst) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| |
| instruct log10D_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| // The source Double operand on FPU stack |
| match(Set dst (Log10D src)); |
| // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number |
| // fxch ; swap ST(0) with ST(1) |
| // fyl2x ; compute log_10(2) * log_2(x) |
| format %{ "FLDLG2 \t\t\t#Log10\n\t" |
| "FXCH \n\t" |
| "FYL2X \t\t\t# Q=Log10*Log_2(x)" |
| %} |
| ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 |
| Opcode(0xD9), Opcode(0xC9), // fxch |
| Opcode(0xD9), Opcode(0xF1)); // fyl2x |
| |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct log10XD_reg(regXD dst, regXD src, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| effect(KILL cr); |
| match(Set dst (Log10D src)); |
| // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number |
| // fyl2x ; compute log_10(2) * log_2(x) |
| format %{ "FLDLG2 \t\t\t#Log10\n\t" |
| "FYL2X \t\t\t# Q=Log10*Log_2(x)" |
| %} |
| ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 |
| Push_SrcXD(src), |
| Opcode(0xD9), Opcode(0xF1), // fyl2x |
| Push_ResultXD(dst)); |
| |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct logD_reg(regDPR1 dst, regDPR1 src) %{ |
| predicate (UseSSE<=1); |
| // The source Double operand on FPU stack |
| match(Set dst (LogD src)); |
| // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number |
| // fxch ; swap ST(0) with ST(1) |
| // fyl2x ; compute log_e(2) * log_2(x) |
| format %{ "FLDLN2 \t\t\t#Log_e\n\t" |
| "FXCH \n\t" |
| "FYL2X \t\t\t# Q=Log_e*Log_2(x)" |
| %} |
| ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 |
| Opcode(0xD9), Opcode(0xC9), // fxch |
| Opcode(0xD9), Opcode(0xF1)); // fyl2x |
| |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct logXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| effect(KILL cr); |
| // The source and result Double operands in XMM registers |
| match(Set dst (LogD src)); |
| // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number |
| // fyl2x ; compute log_e(2) * log_2(x) |
| format %{ "FLDLN2 \t\t\t#Log_e\n\t" |
| "FYL2X \t\t\t# Q=Log_e*Log_2(x)" |
| %} |
| ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 |
| Push_SrcXD(src), |
| Opcode(0xD9), Opcode(0xF1), // fyl2x |
| Push_ResultXD(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| //-------------Float Instructions------------------------------- |
| // Float Math |
| |
| // Code for float compare: |
| // fcompp(); |
| // fwait(); fnstsw_ax(); |
| // sahf(); |
| // movl(dst, unordered_result); |
| // jcc(Assembler::parity, exit); |
| // movl(dst, less_result); |
| // jcc(Assembler::below, exit); |
| // movl(dst, equal_result); |
| // jcc(Assembler::equal, exit); |
| // movl(dst, greater_result); |
| // exit: |
| |
| // P6 version of float compare, sets condition codes in EFLAGS |
| instruct cmpF_cc_P6(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ |
| predicate(VM_Version::supports_cmov() && UseSSE == 0); |
| match(Set cr (CmpF src1 src2)); |
| effect(KILL rax); |
| ins_cost(150); |
| format %{ "FLD $src1\n\t" |
| "FUCOMIP ST,$src2 // P6 instruction\n\t" |
| "JNP exit\n\t" |
| "MOV ah,1 // saw a NaN, set CF (treat as LT)\n\t" |
| "SAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| cmpF_P6_fixup ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| // Compare & branch |
| instruct cmpF_cc(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ |
| predicate(UseSSE == 0); |
| match(Set cr (CmpF src1 src2)); |
| effect(KILL rax); |
| ins_cost(200); |
| format %{ "FLD $src1\n\t" |
| "FCOMp $src2\n\t" |
| "FNSTSW AX\n\t" |
| "TEST AX,0x400\n\t" |
| "JZ,s flags\n\t" |
| "MOV AH,1\t# unordered treat as LT\n" |
| "flags:\tSAHF" %} |
| opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| fpu_flags); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare vs zero into -1,0,1 |
| instruct cmpF_0(eRegI dst, regF src1, immF0 zero, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE == 0); |
| match(Set dst (CmpF3 src1 zero)); |
| effect(KILL cr, KILL rax); |
| ins_cost(280); |
| format %{ "FTSTF $dst,$src1" %} |
| opcode(0xE4, 0xD9); |
| ins_encode( Push_Reg_D(src1), |
| OpcS, OpcP, PopFPU, |
| CmpF_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 |
| instruct cmpF_reg(eRegI dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE == 0); |
| match(Set dst (CmpF3 src1 src2)); |
| effect(KILL cr, KILL rax); |
| ins_cost(300); |
| format %{ "FCMPF $dst,$src1,$src2" %} |
| opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ |
| ins_encode( Push_Reg_D(src1), |
| OpcP, RegOpc(src2), |
| CmpF_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // float compare and set condition codes in EFLAGS by XMM regs |
| instruct cmpX_cc(eFlagsRegU cr, regX dst, regX src, eAXRegI rax) %{ |
| predicate(UseSSE>=1); |
| match(Set cr (CmpF dst src)); |
| effect(KILL rax); |
| ins_cost(145); |
| format %{ "COMISS $dst,$src\n" |
| "\tJNP exit\n" |
| "\tMOV ah,1 // saw a NaN, set CF\n" |
| "\tSAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, RegReg(dst, src), cmpF_P6_fixup); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // float compare and set condition codes in EFLAGS by XMM regs |
| instruct cmpX_ccmem(eFlagsRegU cr, regX dst, memory src, eAXRegI rax) %{ |
| predicate(UseSSE>=1); |
| match(Set cr (CmpF dst (LoadF src))); |
| effect(KILL rax); |
| ins_cost(165); |
| format %{ "COMISS $dst,$src\n" |
| "\tJNP exit\n" |
| "\tMOV ah,1 // saw a NaN, set CF\n" |
| "\tSAHF\n" |
| "exit:\tNOP // avoid branch to branch" %} |
| opcode(0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, RegMem(dst, src), cmpF_P6_fixup); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 in XMM |
| instruct cmpX_reg(eRegI dst, regX src1, regX src2, eFlagsReg cr) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (CmpF3 src1 src2)); |
| effect(KILL cr); |
| ins_cost(255); |
| format %{ "XOR $dst,$dst\n" |
| "\tCOMISS $src1,$src2\n" |
| "\tJP,s nan\n" |
| "\tJEQ,s exit\n" |
| "\tJA,s inc\n" |
| "nan:\tDEC $dst\n" |
| "\tJMP,s exit\n" |
| "inc:\tINC $dst\n" |
| "exit:" |
| %} |
| opcode(0x0F, 0x2F); |
| ins_encode(Xor_Reg(dst), OpcP, OpcS, RegReg(src1, src2), CmpX_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Compare into -1,0,1 in XMM and memory |
| instruct cmpX_regmem(eRegI dst, regX src1, memory mem, eFlagsReg cr) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (CmpF3 src1 (LoadF mem))); |
| effect(KILL cr); |
| ins_cost(275); |
| format %{ "COMISS $src1,$mem\n" |
| "\tMOV $dst,0\t\t# do not blow flags\n" |
| "\tJP,s nan\n" |
| "\tJEQ,s exit\n" |
| "\tJA,s inc\n" |
| "nan:\tDEC $dst\n" |
| "\tJMP,s exit\n" |
| "inc:\tINC $dst\n" |
| "exit:" |
| %} |
| opcode(0x0F, 0x2F); |
| ins_encode(OpcP, OpcS, RegMem(src1, mem), LdImmI(dst,0x0), CmpX_Result(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct subF24_reg(stackSlotF dst, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (SubF src1 src2)); |
| |
| format %{ "FSUB $dst,$src1 - $src2" %} |
| opcode(0xD8, 0x4); /* D8 E0+i or D8 /4 mod==0x3 ;; result in TOS */ |
| ins_encode( Push_Reg_F(src1), |
| OpcReg_F(src2), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct subF_reg(regF dst, regF src) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (SubF dst src)); |
| |
| format %{ "FSUB $dst,$src" %} |
| opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ |
| ins_encode( Push_Reg_F(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct addF24_reg(stackSlotF dst, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 src2)); |
| |
| format %{ "FADD $dst,$src1,$src2" %} |
| opcode(0xD8, 0x0); /* D8 C0+i */ |
| ins_encode( Push_Reg_F(src2), |
| OpcReg_F(src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct addF_reg(regF dst, regF src) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF dst src)); |
| |
| format %{ "FLD $src\n\t" |
| "FADDp $dst,ST" %} |
| opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ |
| ins_encode( Push_Reg_F(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Add two single precision floating point values in xmm |
| instruct addX_reg(regX dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (AddF dst src)); |
| format %{ "ADDSS $dst,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct addX_imm(regX dst, immXF con) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (AddF dst con)); |
| format %{ "ADDSS $dst,[$con]" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), LdImmX(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct addX_mem(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (AddF dst (LoadF mem))); |
| format %{ "ADDSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegMem(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Subtract two single precision floating point values in xmm |
| instruct subX_reg(regX dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (SubF dst src)); |
| format %{ "SUBSS $dst,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct subX_imm(regX dst, immXF con) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (SubF dst con)); |
| format %{ "SUBSS $dst,[$con]" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), LdImmX(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct subX_mem(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (SubF dst (LoadF mem))); |
| format %{ "SUBSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Multiply two single precision floating point values in xmm |
| instruct mulX_reg(regX dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (MulF dst src)); |
| format %{ "MULSS $dst,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct mulX_imm(regX dst, immXF con) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (MulF dst con)); |
| format %{ "MULSS $dst,[$con]" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), LdImmX(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct mulX_mem(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (MulF dst (LoadF mem))); |
| format %{ "MULSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Divide two single precision floating point values in xmm |
| instruct divX_reg(regX dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (DivF dst src)); |
| format %{ "DIVSS $dst,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct divX_imm(regX dst, immXF con) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (DivF dst con)); |
| format %{ "DIVSS $dst,[$con]" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), LdImmX(dst, con) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct divX_mem(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (DivF dst (LoadF mem))); |
| format %{ "DIVSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Get the square root of a single precision floating point values in xmm |
| instruct sqrtX_reg(regX dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (ConvD2F (SqrtD (ConvF2D src)))); |
| format %{ "SQRTSS $dst,$src" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct sqrtX_mem(regX dst, memory mem) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (ConvD2F (SqrtD (ConvF2D (LoadF mem))))); |
| format %{ "SQRTSS $dst,$mem" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Get the square root of a double precision floating point values in xmm |
| instruct sqrtXD_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (SqrtD src)); |
| format %{ "SQRTSD $dst,$src" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct sqrtXD_mem(regXD dst, memory mem) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (SqrtD (LoadD mem))); |
| format %{ "SQRTSD $dst,$mem" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct absF_reg(regFPR1 dst, regFPR1 src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (AbsF src)); |
| ins_cost(100); |
| format %{ "FABS" %} |
| opcode(0xE1, 0xD9); |
| ins_encode( OpcS, OpcP ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct absX_reg(regX dst ) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (AbsF dst)); |
| format %{ "ANDPS $dst,[0x7FFFFFFF]\t# ABS F by sign masking" %} |
| ins_encode( AbsXF_encoding(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct negF_reg(regFPR1 dst, regFPR1 src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (NegF src)); |
| ins_cost(100); |
| format %{ "FCHS" %} |
| opcode(0xE0, 0xD9); |
| ins_encode( OpcS, OpcP ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct negX_reg( regX dst ) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (NegF dst)); |
| format %{ "XORPS $dst,[0x80000000]\t# CHS F by sign flipping" %} |
| ins_encode( NegXF_encoding(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Cisc-alternate to addF_reg |
| // Spill to obtain 24-bit precision |
| instruct addF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 (LoadF src2))); |
| |
| format %{ "FLD $src2\n\t" |
| "FADD ST,$src1\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| OpcReg_F(src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_mem ); |
| %} |
| // |
| // Cisc-alternate to addF_reg |
| // This instruction does not round to 24-bits |
| instruct addF_reg_mem(regF dst, memory src) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF dst (LoadF src))); |
| |
| format %{ "FADD $dst,$src" %} |
| opcode(0xDE, 0x0, 0xD9); /* DE C0+i or DE /0*/ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // // Following two instructions for _222_mpegaudio |
| // Spill to obtain 24-bit precision |
| instruct addF24_mem_reg(stackSlotF dst, regF src2, memory src1 ) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 src2)); |
| |
| format %{ "FADD $dst,$src1,$src2" %} |
| opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src1), |
| OpcReg_F(src2), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_mem ); |
| %} |
| |
| // Cisc-spill variant |
| // Spill to obtain 24-bit precision |
| instruct addF24_mem_cisc(stackSlotF dst, memory src1, memory src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 (LoadF src2))); |
| |
| format %{ "FADD $dst,$src1,$src2 cisc" %} |
| opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| set_instruction_start, |
| OpcP, RMopc_Mem(secondary,src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_mem_mem ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct addF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 src2)); |
| |
| format %{ "FADD $dst,$src1,$src2" %} |
| opcode(0xD8, 0x0, 0xD9); /* D8 /0 */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| set_instruction_start, |
| OpcP, RMopc_Mem(secondary,src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_mem_mem ); |
| %} |
| |
| |
| // Spill to obtain 24-bit precision |
| instruct addF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 src2)); |
| format %{ "FLD $src1\n\t" |
| "FADD $src2\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x00); /* D8 /0 */ |
| ins_encode( Push_Reg_F(src1), |
| Opc_MemImm_F(src2), |
| Pop_Mem_F(dst)); |
| ins_pipe( fpu_mem_reg_con ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct addF_reg_imm(regF dst, regF src1, immF src2) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF src1 src2)); |
| format %{ "FLD $src1\n\t" |
| "FADD $src2\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x00); /* D8 /0 */ |
| ins_encode( Push_Reg_F(src1), |
| Opc_MemImm_F(src2), |
| Pop_Reg_F(dst)); |
| ins_pipe( fpu_reg_reg_con ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct mulF24_reg(stackSlotF dst, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 src2)); |
| |
| format %{ "FLD $src1\n\t" |
| "FMUL $src2\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x1); /* D8 C8+i or D8 /1 ;; result in TOS */ |
| ins_encode( Push_Reg_F(src1), |
| OpcReg_F(src2), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct mulF_reg(regF dst, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 src2)); |
| |
| format %{ "FLD $src1\n\t" |
| "FMUL $src2\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x1); /* D8 C8+i */ |
| ins_encode( Push_Reg_F(src2), |
| OpcReg_F(src1), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_reg_reg ); |
| %} |
| |
| |
| // Spill to obtain 24-bit precision |
| // Cisc-alternate to reg-reg multiply |
| instruct mulF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 (LoadF src2))); |
| |
| format %{ "FLD_S $src2\n\t" |
| "FMUL $src1\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or DE /1*/ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| OpcReg_F(src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_mem ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| // Cisc-alternate to reg-reg multiply |
| instruct mulF_reg_mem(regF dst, regF src1, memory src2) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 (LoadF src2))); |
| |
| format %{ "FMUL $dst,$src1,$src2" %} |
| opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| OpcReg_F(src1), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_reg_mem ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct mulF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 src2)); |
| |
| format %{ "FMUL $dst,$src1,$src2" %} |
| opcode(0xD8, 0x1, 0xD9); /* D8 /1 */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), |
| set_instruction_start, |
| OpcP, RMopc_Mem(secondary,src1), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_mem_mem ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct mulF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 src2)); |
| |
| format %{ "FMULc $dst,$src1,$src2" %} |
| opcode(0xD8, 0x1); /* D8 /1*/ |
| ins_encode( Push_Reg_F(src1), |
| Opc_MemImm_F(src2), |
| Pop_Mem_F(dst)); |
| ins_pipe( fpu_mem_reg_con ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct mulF_reg_imm(regF dst, regF src1, immF src2) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF src1 src2)); |
| |
| format %{ "FMULc $dst. $src1, $src2" %} |
| opcode(0xD8, 0x1); /* D8 /1*/ |
| ins_encode( Push_Reg_F(src1), |
| Opc_MemImm_F(src2), |
| Pop_Reg_F(dst)); |
| ins_pipe( fpu_reg_reg_con ); |
| %} |
| |
| |
| // |
| // MACRO1 -- subsume unshared load into mulF |
| // This instruction does not round to 24-bits |
| instruct mulF_reg_load1(regF dst, regF src, memory mem1 ) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (MulF (LoadF mem1) src)); |
| |
| format %{ "FLD $mem1 ===MACRO1===\n\t" |
| "FMUL ST,$src\n\t" |
| "FSTP $dst" %} |
| opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or D8 /1 */ /* LoadF D9 /0 */ |
| ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem1), |
| OpcReg_F(src), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_reg_mem ); |
| %} |
| // |
| // MACRO2 -- addF a mulF which subsumed an unshared load |
| // This instruction does not round to 24-bits |
| instruct addF_mulF_reg_load1(regF dst, memory mem1, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (AddF (MulF (LoadF mem1) src1) src2)); |
| ins_cost(95); |
| |
| format %{ "FLD $mem1 ===MACRO2===\n\t" |
| "FMUL ST,$src1 subsume mulF left load\n\t" |
| "FADD ST,$src2\n\t" |
| "FSTP $dst" %} |
| opcode(0xD9); /* LoadF D9 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem1), |
| FMul_ST_reg(src1), |
| FAdd_ST_reg(src2), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_mem_reg_reg ); |
| %} |
| |
| // MACRO3 -- addF a mulF |
| // This instruction does not round to 24-bits. It is a '2-address' |
| // instruction in that the result goes back to src2. This eliminates |
| // a move from the macro; possibly the register allocator will have |
| // to add it back (and maybe not). |
| instruct addF_mulF_reg(regF src2, regF src1, regF src0) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set src2 (AddF (MulF src0 src1) src2)); |
| |
| format %{ "FLD $src0 ===MACRO3===\n\t" |
| "FMUL ST,$src1\n\t" |
| "FADDP $src2,ST" %} |
| opcode(0xD9); /* LoadF D9 /0 */ |
| ins_encode( Push_Reg_F(src0), |
| FMul_ST_reg(src1), |
| FAddP_reg_ST(src2) ); |
| ins_pipe( fpu_reg_reg_reg ); |
| %} |
| |
| // MACRO4 -- divF subF |
| // This instruction does not round to 24-bits |
| instruct subF_divF_reg(regF dst, regF src1, regF src2, regF src3) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (DivF (SubF src2 src1) src3)); |
| |
| format %{ "FLD $src2 ===MACRO4===\n\t" |
| "FSUB ST,$src1\n\t" |
| "FDIV ST,$src3\n\t" |
| "FSTP $dst" %} |
| opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ |
| ins_encode( Push_Reg_F(src2), |
| subF_divF_encode(src1,src3), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_reg_reg_reg ); |
| %} |
| |
| // Spill to obtain 24-bit precision |
| instruct divF24_reg(stackSlotF dst, regF src1, regF src2) %{ |
| predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (DivF src1 src2)); |
| |
| format %{ "FDIV $dst,$src1,$src2" %} |
| opcode(0xD8, 0x6); /* D8 F0+i or DE /6*/ |
| ins_encode( Push_Reg_F(src1), |
| OpcReg_F(src2), |
| Pop_Mem_F(dst) ); |
| ins_pipe( fpu_mem_reg_reg ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct divF_reg(regF dst, regF src) %{ |
| predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (DivF dst src)); |
| |
| format %{ "FDIV $dst,$src" %} |
| opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ |
| ins_encode( Push_Reg_F(src), |
| OpcP, RegOpc(dst) ); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| |
| // Spill to obtain 24-bit precision |
| instruct modF24_reg(stackSlotF dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ |
| predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (ModF src1 src2)); |
| effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS |
| |
| format %{ "FMOD $dst,$src1,$src2" %} |
| ins_encode( Push_Reg_Mod_D(src1, src2), |
| emitModD(), |
| Push_Result_Mod_D(src2), |
| Pop_Mem_F(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| // |
| // This instruction does not round to 24-bits |
| instruct modF_reg(regF dst, regF src, eAXRegI rax, eFlagsReg cr) %{ |
| predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (ModF dst src)); |
| effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS |
| |
| format %{ "FMOD $dst,$src" %} |
| ins_encode(Push_Reg_Mod_D(dst, src), |
| emitModD(), |
| Push_Result_Mod_D(src), |
| Pop_Reg_F(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct modX_reg(regX dst, regX src0, regX src1, eAXRegI rax, eFlagsReg cr) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (ModF src0 src1)); |
| effect(KILL rax, KILL cr); |
| format %{ "SUB ESP,4\t # FMOD\n" |
| "\tMOVSS [ESP+0],$src1\n" |
| "\tFLD_S [ESP+0]\n" |
| "\tMOVSS [ESP+0],$src0\n" |
| "\tFLD_S [ESP+0]\n" |
| "loop:\tFPREM\n" |
| "\tFWAIT\n" |
| "\tFNSTSW AX\n" |
| "\tSAHF\n" |
| "\tJP loop\n" |
| "\tFSTP_S [ESP+0]\n" |
| "\tMOVSS $dst,[ESP+0]\n" |
| "\tADD ESP,4\n" |
| "\tFSTP ST0\t # Restore FPU Stack" |
| %} |
| ins_cost(250); |
| ins_encode( Push_ModX_encoding(src0, src1), emitModD(), Push_ResultX(dst,0x4), PopFPU); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| |
| //----------Arithmetic Conversion Instructions--------------------------------- |
| // The conversions operations are all Alpha sorted. Please keep it that way! |
| |
| instruct roundFloat_mem_reg(stackSlotF dst, regF src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (RoundFloat src)); |
| ins_cost(125); |
| format %{ "FST_S $dst,$src\t# F-round" %} |
| ins_encode( Pop_Mem_Reg_F(dst, src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| instruct roundDouble_mem_reg(stackSlotD dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (RoundDouble src)); |
| ins_cost(125); |
| format %{ "FST_D $dst,$src\t# D-round" %} |
| ins_encode( Pop_Mem_Reg_D(dst, src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| // Force rounding to 24-bit precision and 6-bit exponent |
| instruct convD2F_reg(stackSlotF dst, regD src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (ConvD2F src)); |
| format %{ "FST_S $dst,$src\t# F-round" %} |
| expand %{ |
| roundFloat_mem_reg(dst,src); |
| %} |
| %} |
| |
| // Force rounding to 24-bit precision and 6-bit exponent |
| instruct convD2X_reg(regX dst, regD src, eFlagsReg cr) %{ |
| predicate(UseSSE==1); |
| match(Set dst (ConvD2F src)); |
| effect( KILL cr ); |
| format %{ "SUB ESP,4\n\t" |
| "FST_S [ESP],$src\t# F-round\n\t" |
| "MOVSS $dst,[ESP]\n\t" |
| "ADD ESP,4" %} |
| ins_encode( D2X_encoding(dst, src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Force rounding double precision to single precision |
| instruct convXD2X_reg(regX dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (ConvD2F src)); |
| format %{ "CVTSD2SS $dst,$src\t# F-round" %} |
| opcode(0xF2, 0x0F, 0x5A); |
| ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convF2D_reg_reg(regD dst, regF src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (ConvF2D src)); |
| format %{ "FST_S $dst,$src\t# D-round" %} |
| ins_encode( Pop_Reg_Reg_D(dst, src)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| instruct convF2D_reg(stackSlotD dst, regF src) %{ |
| predicate(UseSSE==1); |
| match(Set dst (ConvF2D src)); |
| format %{ "FST_D $dst,$src\t# D-round" %} |
| expand %{ |
| roundDouble_mem_reg(dst,src); |
| %} |
| %} |
| |
| instruct convX2D_reg(regD dst, regX src, eFlagsReg cr) %{ |
| predicate(UseSSE==1); |
| match(Set dst (ConvF2D src)); |
| effect( KILL cr ); |
| format %{ "SUB ESP,4\n\t" |
| "MOVSS [ESP] $src\n\t" |
| "FLD_S [ESP]\n\t" |
| "ADD ESP,4\n\t" |
| "FSTP $dst\t# D-round" %} |
| ins_encode( X2D_encoding(dst, src), Pop_Reg_D(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convX2XD_reg(regXD dst, regX src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (ConvF2D src)); |
| format %{ "CVTSS2SD $dst,$src\t# D-round" %} |
| opcode(0xF3, 0x0F, 0x5A); |
| ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Convert a double to an int. If the double is a NAN, stuff a zero in instead. |
| instruct convD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regD src, eFlagsReg cr ) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (ConvD2I src)); |
| effect( KILL tmp, KILL cr ); |
| format %{ "FLD $src\t# Convert double to int \n\t" |
| "FLDCW trunc mode\n\t" |
| "SUB ESP,4\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "CMP EAX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "FLD_D $src\n\t" |
| "CALL d2i_wrapper\n" |
| "fast:" %} |
| ins_encode( Push_Reg_D(src), D2I_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Convert a double to an int. If the double is a NAN, stuff a zero in instead. |
| instruct convXD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regXD src, eFlagsReg cr ) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (ConvD2I src)); |
| effect( KILL tmp, KILL cr ); |
| format %{ "CVTTSD2SI $dst, $src\n\t" |
| "CMP $dst,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "SUB ESP, 8\n\t" |
| "MOVSD [ESP], $src\n\t" |
| "FLD_D [ESP]\n\t" |
| "ADD ESP, 8\n\t" |
| "CALL d2i_wrapper\n" |
| "fast:" %} |
| opcode(0x1); // double-precision conversion |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convD2L_reg_reg( eADXRegL dst, regD src, eFlagsReg cr ) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (ConvD2L src)); |
| effect( KILL cr ); |
| format %{ "FLD $src\t# Convert double to long\n\t" |
| "FLDCW trunc mode\n\t" |
| "SUB ESP,8\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "POP EDX\n\t" |
| "CMP EDX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "TEST EAX,EAX\n\t" |
| "JNE,s fast\n\t" |
| "FLD $src\n\t" |
| "CALL d2l_wrapper\n" |
| "fast:" %} |
| ins_encode( Push_Reg_D(src), D2L_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // XMM lacks a float/double->long conversion, so use the old FPU stack. |
| instruct convXD2L_reg_reg( eADXRegL dst, regXD src, eFlagsReg cr ) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (ConvD2L src)); |
| effect( KILL cr ); |
| format %{ "SUB ESP,8\t# Convert double to long\n\t" |
| "MOVSD [ESP],$src\n\t" |
| "FLD_D [ESP]\n\t" |
| "FLDCW trunc mode\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "POP EDX\n\t" |
| "CMP EDX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "TEST EAX,EAX\n\t" |
| "JNE,s fast\n\t" |
| "SUB ESP,8\n\t" |
| "MOVSD [ESP],$src\n\t" |
| "FLD_D [ESP]\n\t" |
| "CALL d2l_wrapper\n" |
| "fast:" %} |
| ins_encode( XD2L_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Convert a double to an int. Java semantics require we do complex |
| // manglations in the corner cases. So we set the rounding mode to |
| // 'zero', store the darned double down as an int, and reset the |
| // rounding mode to 'nearest'. The hardware stores a flag value down |
| // if we would overflow or converted a NAN; we check for this and |
| // and go the slow path if needed. |
| instruct convF2I_reg_reg(eAXRegI dst, eDXRegI tmp, regF src, eFlagsReg cr ) %{ |
| predicate(UseSSE==0); |
| match(Set dst (ConvF2I src)); |
| effect( KILL tmp, KILL cr ); |
| format %{ "FLD $src\t# Convert float to int \n\t" |
| "FLDCW trunc mode\n\t" |
| "SUB ESP,4\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "CMP EAX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "FLD $src\n\t" |
| "CALL d2i_wrapper\n" |
| "fast:" %} |
| // D2I_encoding works for F2I |
| ins_encode( Push_Reg_F(src), D2I_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Convert a float in xmm to an int reg. |
| instruct convX2I_reg(eAXRegI dst, eDXRegI tmp, regX src, eFlagsReg cr ) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (ConvF2I src)); |
| effect( KILL tmp, KILL cr ); |
| format %{ "CVTTSS2SI $dst, $src\n\t" |
| "CMP $dst,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "SUB ESP, 4\n\t" |
| "MOVSS [ESP], $src\n\t" |
| "FLD [ESP]\n\t" |
| "ADD ESP, 4\n\t" |
| "CALL d2i_wrapper\n" |
| "fast:" %} |
| opcode(0x0); // single-precision conversion |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convF2L_reg_reg( eADXRegL dst, regF src, eFlagsReg cr ) %{ |
| predicate(UseSSE==0); |
| match(Set dst (ConvF2L src)); |
| effect( KILL cr ); |
| format %{ "FLD $src\t# Convert float to long\n\t" |
| "FLDCW trunc mode\n\t" |
| "SUB ESP,8\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "POP EDX\n\t" |
| "CMP EDX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "TEST EAX,EAX\n\t" |
| "JNE,s fast\n\t" |
| "FLD $src\n\t" |
| "CALL d2l_wrapper\n" |
| "fast:" %} |
| // D2L_encoding works for F2L |
| ins_encode( Push_Reg_F(src), D2L_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // XMM lacks a float/double->long conversion, so use the old FPU stack. |
| instruct convX2L_reg_reg( eADXRegL dst, regX src, eFlagsReg cr ) %{ |
| predicate (UseSSE>=1); |
| match(Set dst (ConvF2L src)); |
| effect( KILL cr ); |
| format %{ "SUB ESP,8\t# Convert float to long\n\t" |
| "MOVSS [ESP],$src\n\t" |
| "FLD_S [ESP]\n\t" |
| "FLDCW trunc mode\n\t" |
| "FISTp [ESP + #0]\n\t" |
| "FLDCW std/24-bit mode\n\t" |
| "POP EAX\n\t" |
| "POP EDX\n\t" |
| "CMP EDX,0x80000000\n\t" |
| "JNE,s fast\n\t" |
| "TEST EAX,EAX\n\t" |
| "JNE,s fast\n\t" |
| "SUB ESP,4\t# Convert float to long\n\t" |
| "MOVSS [ESP],$src\n\t" |
| "FLD_S [ESP]\n\t" |
| "ADD ESP,4\n\t" |
| "CALL d2l_wrapper\n" |
| "fast:" %} |
| ins_encode( X2L_encoding(src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convI2D_reg(regD dst, stackSlotI src) %{ |
| predicate( UseSSE<=1 ); |
| match(Set dst (ConvI2D src)); |
| format %{ "FILD $src\n\t" |
| "FSTP $dst" %} |
| opcode(0xDB, 0x0); /* DB /0 */ |
| ins_encode(Push_Mem_I(src), Pop_Reg_D(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct convI2XD_reg(regXD dst, eRegI src) %{ |
| predicate( UseSSE>=2 ); |
| match(Set dst (ConvI2D src)); |
| format %{ "CVTSI2SD $dst,$src" %} |
| opcode(0xF2, 0x0F, 0x2A); |
| ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convI2XD_mem(regXD dst, memory mem) %{ |
| predicate( UseSSE>=2 ); |
| match(Set dst (ConvI2D (LoadI mem))); |
| format %{ "CVTSI2SD $dst,$mem" %} |
| opcode(0xF2, 0x0F, 0x2A); |
| ins_encode( OpcP, OpcS, Opcode(tertiary), RegMem(dst, mem)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convI2D_mem(regD dst, memory mem) %{ |
| predicate( UseSSE<=1 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (ConvI2D (LoadI mem))); |
| format %{ "FILD $mem\n\t" |
| "FSTP $dst" %} |
| opcode(0xDB); /* DB /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), |
| Pop_Reg_D(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Convert a byte to a float; no rounding step needed. |
| instruct conv24I2F_reg(regF dst, stackSlotI src) %{ |
| predicate( UseSSE==0 && n->in(1)->Opcode() == Op_AndI && n->in(1)->in(2)->is_Con() && n->in(1)->in(2)->get_int() == 255 ); |
| match(Set dst (ConvI2F src)); |
| format %{ "FILD $src\n\t" |
| "FSTP $dst" %} |
| |
| opcode(0xDB, 0x0); /* DB /0 */ |
| ins_encode(Push_Mem_I(src), Pop_Reg_F(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // In 24-bit mode, force exponent rounding by storing back out |
| instruct convI2F_SSF(stackSlotF dst, stackSlotI src) %{ |
| predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (ConvI2F src)); |
| ins_cost(200); |
| format %{ "FILD $src\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xDB, 0x0); /* DB /0 */ |
| ins_encode( Push_Mem_I(src), |
| Pop_Mem_F(dst)); |
| ins_pipe( fpu_mem_mem ); |
| %} |
| |
| // In 24-bit mode, force exponent rounding by storing back out |
| instruct convI2F_SSF_mem(stackSlotF dst, memory mem) %{ |
| predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); |
| match(Set dst (ConvI2F (LoadI mem))); |
| ins_cost(200); |
| format %{ "FILD $mem\n\t" |
| "FSTP_S $dst" %} |
| opcode(0xDB); /* DB /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), |
| Pop_Mem_F(dst)); |
| ins_pipe( fpu_mem_mem ); |
| %} |
| |
| // This instruction does not round to 24-bits |
| instruct convI2F_reg(regF dst, stackSlotI src) %{ |
| predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (ConvI2F src)); |
| format %{ "FILD $src\n\t" |
| "FSTP $dst" %} |
| opcode(0xDB, 0x0); /* DB /0 */ |
| ins_encode( Push_Mem_I(src), |
| Pop_Reg_F(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // This instruction does not round to 24-bits |
| instruct convI2F_mem(regF dst, memory mem) %{ |
| predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); |
| match(Set dst (ConvI2F (LoadI mem))); |
| format %{ "FILD $mem\n\t" |
| "FSTP $dst" %} |
| opcode(0xDB); /* DB /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,mem), |
| Pop_Reg_F(dst)); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| // Convert an int to a float in xmm; no rounding step needed. |
| instruct convI2X_reg(regX dst, eRegI src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (ConvI2F src)); |
| format %{ "CVTSI2SS $dst, $src" %} |
| |
| opcode(0xF3, 0x0F, 0x2A); /* F3 0F 2A /r */ |
| ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convI2L_reg( eRegL dst, eRegI src, eFlagsReg cr) %{ |
| match(Set dst (ConvI2L src)); |
| effect(KILL cr); |
| format %{ "MOV $dst.lo,$src\n\t" |
| "MOV $dst.hi,$src\n\t" |
| "SAR $dst.hi,31" %} |
| ins_encode(convert_int_long(dst,src)); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Zero-extend convert int to long |
| instruct convI2L_reg_zex(eRegL dst, eRegI src, immL_32bits mask, eFlagsReg flags ) %{ |
| match(Set dst (AndL (ConvI2L src) mask) ); |
| effect( KILL flags ); |
| format %{ "MOV $dst.lo,$src\n\t" |
| "XOR $dst.hi,$dst.hi" %} |
| opcode(0x33); // XOR |
| ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Zero-extend long |
| instruct zerox_long(eRegL dst, eRegL src, immL_32bits mask, eFlagsReg flags ) %{ |
| match(Set dst (AndL src mask) ); |
| effect( KILL flags ); |
| format %{ "MOV $dst.lo,$src.lo\n\t" |
| "XOR $dst.hi,$dst.hi\n\t" %} |
| opcode(0x33); // XOR |
| ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| instruct convL2D_reg( stackSlotD dst, eRegL src, eFlagsReg cr) %{ |
| predicate (UseSSE<=1); |
| match(Set dst (ConvL2D src)); |
| effect( KILL cr ); |
| format %{ "PUSH $src.hi\t# Convert long to double\n\t" |
| "PUSH $src.lo\n\t" |
| "FILD ST,[ESP + #0]\n\t" |
| "ADD ESP,8\n\t" |
| "FSTP_D $dst\t# D-round" %} |
| opcode(0xDF, 0x5); /* DF /5 */ |
| ins_encode(convert_long_double(src), Pop_Mem_D(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convL2XD_reg( regXD dst, eRegL src, eFlagsReg cr) %{ |
| predicate (UseSSE>=2); |
| match(Set dst (ConvL2D src)); |
| effect( KILL cr ); |
| format %{ "PUSH $src.hi\t# Convert long to double\n\t" |
| "PUSH $src.lo\n\t" |
| "FILD_D [ESP]\n\t" |
| "FSTP_D [ESP]\n\t" |
| "MOVSD $dst,[ESP]\n\t" |
| "ADD ESP,8" %} |
| opcode(0xDF, 0x5); /* DF /5 */ |
| ins_encode(convert_long_double2(src), Push_ResultXD(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convL2X_reg( regX dst, eRegL src, eFlagsReg cr) %{ |
| predicate (UseSSE>=1); |
| match(Set dst (ConvL2F src)); |
| effect( KILL cr ); |
| format %{ "PUSH $src.hi\t# Convert long to single float\n\t" |
| "PUSH $src.lo\n\t" |
| "FILD_D [ESP]\n\t" |
| "FSTP_S [ESP]\n\t" |
| "MOVSS $dst,[ESP]\n\t" |
| "ADD ESP,8" %} |
| opcode(0xDF, 0x5); /* DF /5 */ |
| ins_encode(convert_long_double2(src), Push_ResultX(dst,0x8)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convL2F_reg( stackSlotF dst, eRegL src, eFlagsReg cr) %{ |
| match(Set dst (ConvL2F src)); |
| effect( KILL cr ); |
| format %{ "PUSH $src.hi\t# Convert long to single float\n\t" |
| "PUSH $src.lo\n\t" |
| "FILD ST,[ESP + #0]\n\t" |
| "ADD ESP,8\n\t" |
| "FSTP_S $dst\t# F-round" %} |
| opcode(0xDF, 0x5); /* DF /5 */ |
| ins_encode(convert_long_double(src), Pop_Mem_F(dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct convL2I_reg( eRegI dst, eRegL src ) %{ |
| match(Set dst (ConvL2I src)); |
| effect( DEF dst, USE src ); |
| format %{ "MOV $dst,$src.lo" %} |
| ins_encode(enc_CopyL_Lo(dst,src)); |
| ins_pipe( ialu_reg_reg ); |
| %} |
| |
| |
| instruct MoveF2I_stack_reg(eRegI dst, stackSlotF src) %{ |
| match(Set dst (MoveF2I src)); |
| effect( DEF dst, USE src ); |
| ins_cost(100); |
| format %{ "MOV $dst,$src\t# MoveF2I_stack_reg" %} |
| opcode(0x8B); |
| ins_encode( OpcP, RegMem(dst,src)); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| instruct MoveF2I_reg_stack(stackSlotI dst, regF src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (MoveF2I src)); |
| effect( DEF dst, USE src ); |
| |
| ins_cost(125); |
| format %{ "FST_S $dst,$src\t# MoveF2I_reg_stack" %} |
| ins_encode( Pop_Mem_Reg_F(dst, src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| instruct MoveF2I_reg_stack_sse(stackSlotI dst, regX src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (MoveF2I src)); |
| effect( DEF dst, USE src ); |
| |
| ins_cost(95); |
| format %{ "MOVSS $dst,$src\t# MoveF2I_reg_stack_sse" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveF2I_reg_reg_sse(eRegI dst, regX src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MoveF2I src)); |
| effect( DEF dst, USE src ); |
| ins_cost(85); |
| format %{ "MOVD $dst,$src\t# MoveF2I_reg_reg_sse" %} |
| ins_encode( MovX2I_reg(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveI2F_reg_stack(stackSlotF dst, eRegI src) %{ |
| match(Set dst (MoveI2F src)); |
| effect( DEF dst, USE src ); |
| |
| ins_cost(100); |
| format %{ "MOV $dst,$src\t# MoveI2F_reg_stack" %} |
| opcode(0x89); |
| ins_encode( OpcPRegSS( dst, src ) ); |
| ins_pipe( ialu_mem_reg ); |
| %} |
| |
| |
| instruct MoveI2F_stack_reg(regF dst, stackSlotI src) %{ |
| predicate(UseSSE==0); |
| match(Set dst (MoveI2F src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(125); |
| format %{ "FLD_S $src\n\t" |
| "FSTP $dst\t# MoveI2F_stack_reg" %} |
| opcode(0xD9); /* D9 /0, FLD m32real */ |
| ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), |
| Pop_Reg_F(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| instruct MoveI2F_stack_reg_sse(regX dst, stackSlotI src) %{ |
| predicate(UseSSE>=1); |
| match(Set dst (MoveI2F src)); |
| effect( DEF dst, USE src ); |
| |
| ins_cost(95); |
| format %{ "MOVSS $dst,$src\t# MoveI2F_stack_reg_sse" %} |
| ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveI2F_reg_reg_sse(regX dst, eRegI src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MoveI2F src)); |
| effect( DEF dst, USE src ); |
| |
| ins_cost(85); |
| format %{ "MOVD $dst,$src\t# MoveI2F_reg_reg_sse" %} |
| ins_encode( MovI2X_reg(dst, src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveD2L_stack_reg(eRegL dst, stackSlotD src) %{ |
| match(Set dst (MoveD2L src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(250); |
| format %{ "MOV $dst.lo,$src\n\t" |
| "MOV $dst.hi,$src+4\t# MoveD2L_stack_reg" %} |
| opcode(0x8B, 0x8B); |
| ins_encode( OpcP, RegMem(dst,src), OpcS, RegMem_Hi(dst,src)); |
| ins_pipe( ialu_mem_long_reg ); |
| %} |
| |
| instruct MoveD2L_reg_stack(stackSlotL dst, regD src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (MoveD2L src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(125); |
| format %{ "FST_D $dst,$src\t# MoveD2L_reg_stack" %} |
| ins_encode( Pop_Mem_Reg_D(dst, src) ); |
| ins_pipe( fpu_mem_reg ); |
| %} |
| |
| instruct MoveD2L_reg_stack_sse(stackSlotL dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MoveD2L src)); |
| effect(DEF dst, USE src); |
| ins_cost(95); |
| |
| format %{ "MOVSD $dst,$src\t# MoveD2L_reg_stack_sse" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src,dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveD2L_reg_reg_sse(eRegL dst, regXD src, regXD tmp) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MoveD2L src)); |
| effect(DEF dst, USE src, TEMP tmp); |
| ins_cost(85); |
| format %{ "MOVD $dst.lo,$src\n\t" |
| "PSHUFLW $tmp,$src,0x4E\n\t" |
| "MOVD $dst.hi,$tmp\t# MoveD2L_reg_reg_sse" %} |
| ins_encode( MovXD2L_reg(dst, src, tmp) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveL2D_reg_stack(stackSlotD dst, eRegL src) %{ |
| match(Set dst (MoveL2D src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(200); |
| format %{ "MOV $dst,$src.lo\n\t" |
| "MOV $dst+4,$src.hi\t# MoveL2D_reg_stack" %} |
| opcode(0x89, 0x89); |
| ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); |
| ins_pipe( ialu_mem_long_reg ); |
| %} |
| |
| |
| instruct MoveL2D_stack_reg(regD dst, stackSlotL src) %{ |
| predicate(UseSSE<=1); |
| match(Set dst (MoveL2D src)); |
| effect(DEF dst, USE src); |
| ins_cost(125); |
| |
| format %{ "FLD_D $src\n\t" |
| "FSTP $dst\t# MoveL2D_stack_reg" %} |
| opcode(0xDD); /* DD /0, FLD m64real */ |
| ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), |
| Pop_Reg_D(dst) ); |
| ins_pipe( fpu_reg_mem ); |
| %} |
| |
| |
| instruct MoveL2D_stack_reg_sse(regXD dst, stackSlotL src) %{ |
| predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); |
| match(Set dst (MoveL2D src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(95); |
| format %{ "MOVSD $dst,$src\t# MoveL2D_stack_reg_sse" %} |
| ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveL2D_stack_reg_sse_partial(regXD dst, stackSlotL src) %{ |
| predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); |
| match(Set dst (MoveL2D src)); |
| effect(DEF dst, USE src); |
| |
| ins_cost(95); |
| format %{ "MOVLPD $dst,$src\t# MoveL2D_stack_reg_sse" %} |
| ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct MoveL2D_reg_reg_sse(regXD dst, eRegL src, regXD tmp) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (MoveL2D src)); |
| effect(TEMP dst, USE src, TEMP tmp); |
| ins_cost(85); |
| format %{ "MOVD $dst,$src.lo\n\t" |
| "MOVD $tmp,$src.hi\n\t" |
| "PUNPCKLDQ $dst,$tmp\t# MoveL2D_reg_reg_sse" %} |
| ins_encode( MovL2XD_reg(dst, src, tmp) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Replicate scalar to packed byte (1 byte) values in xmm |
| instruct Repl8B_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate8B src)); |
| format %{ "MOVDQA $dst,$src\n\t" |
| "PUNPCKLBW $dst,$dst\n\t" |
| "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} |
| ins_encode( pshufd_8x8(dst, src)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Replicate scalar to packed byte (1 byte) values in xmm |
| instruct Repl8B_eRegI(regXD dst, eRegI src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate8B src)); |
| format %{ "MOVD $dst,$src\n\t" |
| "PUNPCKLBW $dst,$dst\n\t" |
| "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} |
| ins_encode( mov_i2x(dst, src), pshufd_8x8(dst, dst)); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Replicate scalar zero to packed byte (1 byte) values in xmm |
| instruct Repl8B_immI0(regXD dst, immI0 zero) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate8B zero)); |
| format %{ "PXOR $dst,$dst\t! replicate8B" %} |
| ins_encode( pxor(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed shore (2 byte) values in xmm |
| instruct Repl4S_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4S src)); |
| format %{ "PSHUFLW $dst,$src,0x00\t! replicate4S" %} |
| ins_encode( pshufd_4x16(dst, src)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed shore (2 byte) values in xmm |
| instruct Repl4S_eRegI(regXD dst, eRegI src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4S src)); |
| format %{ "MOVD $dst,$src\n\t" |
| "PSHUFLW $dst,$dst,0x00\t! replicate4S" %} |
| ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar zero to packed short (2 byte) values in xmm |
| instruct Repl4S_immI0(regXD dst, immI0 zero) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4S zero)); |
| format %{ "PXOR $dst,$dst\t! replicate4S" %} |
| ins_encode( pxor(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed char (2 byte) values in xmm |
| instruct Repl4C_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4C src)); |
| format %{ "PSHUFLW $dst,$src,0x00\t! replicate4C" %} |
| ins_encode( pshufd_4x16(dst, src)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed char (2 byte) values in xmm |
| instruct Repl4C_eRegI(regXD dst, eRegI src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4C src)); |
| format %{ "MOVD $dst,$src\n\t" |
| "PSHUFLW $dst,$dst,0x00\t! replicate4C" %} |
| ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar zero to packed char (2 byte) values in xmm |
| instruct Repl4C_immI0(regXD dst, immI0 zero) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate4C zero)); |
| format %{ "PXOR $dst,$dst\t! replicate4C" %} |
| ins_encode( pxor(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed integer (4 byte) values in xmm |
| instruct Repl2I_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2I src)); |
| format %{ "PSHUFD $dst,$src,0x00\t! replicate2I" %} |
| ins_encode( pshufd(dst, src, 0x00)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed integer (4 byte) values in xmm |
| instruct Repl2I_eRegI(regXD dst, eRegI src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2I src)); |
| format %{ "MOVD $dst,$src\n\t" |
| "PSHUFD $dst,$dst,0x00\t! replicate2I" %} |
| ins_encode( mov_i2x(dst, src), pshufd(dst, dst, 0x00)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar zero to packed integer (2 byte) values in xmm |
| instruct Repl2I_immI0(regXD dst, immI0 zero) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2I zero)); |
| format %{ "PXOR $dst,$dst\t! replicate2I" %} |
| ins_encode( pxor(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed single precision floating point values in xmm |
| instruct Repl2F_reg(regXD dst, regXD src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2F src)); |
| format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} |
| ins_encode( pshufd(dst, src, 0xe0)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed single precision floating point values in xmm |
| instruct Repl2F_regX(regXD dst, regX src) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2F src)); |
| format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} |
| ins_encode( pshufd(dst, src, 0xe0)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| // Replicate scalar to packed single precision floating point values in xmm |
| instruct Repl2F_immXF0(regXD dst, immXF0 zero) %{ |
| predicate(UseSSE>=2); |
| match(Set dst (Replicate2F zero)); |
| format %{ "PXOR $dst,$dst\t! replicate2F" %} |
| ins_encode( pxor(dst, dst)); |
| ins_pipe( fpu_reg_reg ); |
| %} |
| |
| |
| |
| // ======================================================================= |
| // fast clearing of an array |
| |
| instruct rep_stos(eCXRegI cnt, eDIRegP base, eAXRegI zero, Universe dummy, eFlagsReg cr) %{ |
| match(Set dummy (ClearArray cnt base)); |
| effect(USE_KILL cnt, USE_KILL base, KILL zero, KILL cr); |
| format %{ "SHL ECX,1\t# Convert doublewords to words\n\t" |
| "XOR EAX,EAX\n\t" |
| "REP STOS\t# store EAX into [EDI++] while ECX--" %} |
| opcode(0,0x4); |
| ins_encode( Opcode(0xD1), RegOpc(ECX), |
| OpcRegReg(0x33,EAX,EAX), |
| Opcode(0xF3), Opcode(0xAB) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct string_compare(eDIRegP str1, eSIRegP str2, eAXRegI tmp1, eBXRegI tmp2, eCXRegI result, eFlagsReg cr) %{ |
| match(Set result (StrComp str1 str2)); |
| effect(USE_KILL str1, USE_KILL str2, KILL tmp1, KILL tmp2, KILL cr); |
| //ins_cost(300); |
| |
| format %{ "String Compare $str1,$str2 -> $result // KILL EAX, EBX" %} |
| ins_encode( enc_String_Compare() ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| //----------Control Flow Instructions------------------------------------------ |
| // Signed compare Instructions |
| instruct compI_eReg(eFlagsReg cr, eRegI op1, eRegI op2) %{ |
| match(Set cr (CmpI op1 op2)); |
| effect( DEF cr, USE op1, USE op2 ); |
| format %{ "CMP $op1,$op2" %} |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegReg( op1, op2) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| instruct compI_eReg_imm(eFlagsReg cr, eRegI op1, immI op2) %{ |
| match(Set cr (CmpI op1 op2)); |
| effect( DEF cr, USE op1 ); |
| format %{ "CMP $op1,$op2" %} |
| opcode(0x81,0x07); /* Opcode 81 /7 */ |
| // ins_encode( RegImm( op1, op2) ); /* Was CmpImm */ |
| ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // Cisc-spilled version of cmpI_eReg |
| instruct compI_eReg_mem(eFlagsReg cr, eRegI op1, memory op2) %{ |
| match(Set cr (CmpI op1 (LoadI op2))); |
| |
| format %{ "CMP $op1,$op2" %} |
| ins_cost(500); |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegMem( op1, op2) ); |
| ins_pipe( ialu_cr_reg_mem ); |
| %} |
| |
| instruct testI_reg( eFlagsReg cr, eRegI src, immI0 zero ) %{ |
| match(Set cr (CmpI src zero)); |
| effect( DEF cr, USE src ); |
| |
| format %{ "TEST $src,$src" %} |
| opcode(0x85); |
| ins_encode( OpcP, RegReg( src, src ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| instruct testI_reg_imm( eFlagsReg cr, eRegI src, immI con, immI0 zero ) %{ |
| match(Set cr (CmpI (AndI src con) zero)); |
| |
| format %{ "TEST $src,$con" %} |
| opcode(0xF7,0x00); |
| ins_encode( OpcP, RegOpc(src), Con32(con) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| instruct testI_reg_mem( eFlagsReg cr, eRegI src, memory mem, immI0 zero ) %{ |
| match(Set cr (CmpI (AndI src mem) zero)); |
| |
| format %{ "TEST $src,$mem" %} |
| opcode(0x85); |
| ins_encode( OpcP, RegMem( src, mem ) ); |
| ins_pipe( ialu_cr_reg_mem ); |
| %} |
| |
| // Unsigned compare Instructions; really, same as signed except they |
| // produce an eFlagsRegU instead of eFlagsReg. |
| instruct compU_eReg(eFlagsRegU cr, eRegI op1, eRegI op2) %{ |
| match(Set cr (CmpU op1 op2)); |
| |
| format %{ "CMPu $op1,$op2" %} |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegReg( op1, op2) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| instruct compU_eReg_imm(eFlagsRegU cr, eRegI op1, immI op2) %{ |
| match(Set cr (CmpU op1 op2)); |
| |
| format %{ "CMPu $op1,$op2" %} |
| opcode(0x81,0x07); /* Opcode 81 /7 */ |
| ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // // Cisc-spilled version of cmpU_eReg |
| instruct compU_eReg_mem(eFlagsRegU cr, eRegI op1, memory op2) %{ |
| match(Set cr (CmpU op1 (LoadI op2))); |
| |
| format %{ "CMPu $op1,$op2" %} |
| ins_cost(500); |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegMem( op1, op2) ); |
| ins_pipe( ialu_cr_reg_mem ); |
| %} |
| |
| // // Cisc-spilled version of cmpU_eReg |
| //instruct compU_mem_eReg(eFlagsRegU cr, memory op1, eRegI op2) %{ |
| // match(Set cr (CmpU (LoadI op1) op2)); |
| // |
| // format %{ "CMPu $op1,$op2" %} |
| // ins_cost(500); |
| // opcode(0x39); /* Opcode 39 /r */ |
| // ins_encode( OpcP, RegMem( op1, op2) ); |
| //%} |
| |
| instruct testU_reg( eFlagsRegU cr, eRegI src, immI0 zero ) %{ |
| match(Set cr (CmpU src zero)); |
| |
| format %{ "TESTu $src,$src" %} |
| opcode(0x85); |
| ins_encode( OpcP, RegReg( src, src ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // Unsigned pointer compare Instructions |
| instruct compP_eReg(eFlagsRegU cr, eRegP op1, eRegP op2) %{ |
| match(Set cr (CmpP op1 op2)); |
| |
| format %{ "CMPu $op1,$op2" %} |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegReg( op1, op2) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| instruct compP_eReg_imm(eFlagsRegU cr, eRegP op1, immP op2) %{ |
| match(Set cr (CmpP op1 op2)); |
| |
| format %{ "CMPu $op1,$op2" %} |
| opcode(0x81,0x07); /* Opcode 81 /7 */ |
| ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // // Cisc-spilled version of cmpP_eReg |
| instruct compP_eReg_mem(eFlagsRegU cr, eRegP op1, memory op2) %{ |
| match(Set cr (CmpP op1 (LoadP op2))); |
| |
| format %{ "CMPu $op1,$op2" %} |
| ins_cost(500); |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegMem( op1, op2) ); |
| ins_pipe( ialu_cr_reg_mem ); |
| %} |
| |
| // // Cisc-spilled version of cmpP_eReg |
| //instruct compP_mem_eReg(eFlagsRegU cr, memory op1, eRegP op2) %{ |
| // match(Set cr (CmpP (LoadP op1) op2)); |
| // |
| // format %{ "CMPu $op1,$op2" %} |
| // ins_cost(500); |
| // opcode(0x39); /* Opcode 39 /r */ |
| // ins_encode( OpcP, RegMem( op1, op2) ); |
| //%} |
| |
| // Compare raw pointer (used in out-of-heap check). |
| // Only works because non-oop pointers must be raw pointers |
| // and raw pointers have no anti-dependencies. |
| instruct compP_mem_eReg( eFlagsRegU cr, eRegP op1, memory op2 ) %{ |
| predicate( !n->in(2)->in(2)->bottom_type()->isa_oop_ptr() ); |
| match(Set cr (CmpP op1 (LoadP op2))); |
| |
| format %{ "CMPu $op1,$op2" %} |
| opcode(0x3B); /* Opcode 3B /r */ |
| ins_encode( OpcP, RegMem( op1, op2) ); |
| ins_pipe( ialu_cr_reg_mem ); |
| %} |
| |
| // |
| // This will generate a signed flags result. This should be ok |
| // since any compare to a zero should be eq/neq. |
| instruct testP_reg( eFlagsReg cr, eRegP src, immP0 zero ) %{ |
| match(Set cr (CmpP src zero)); |
| |
| format %{ "TEST $src,$src" %} |
| opcode(0x85); |
| ins_encode( OpcP, RegReg( src, src ) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // Cisc-spilled version of testP_reg |
| // This will generate a signed flags result. This should be ok |
| // since any compare to a zero should be eq/neq. |
| instruct testP_Reg_mem( eFlagsReg cr, memory op, immI0 zero ) %{ |
| match(Set cr (CmpP (LoadP op) zero)); |
| |
| format %{ "TEST $op,0xFFFFFFFF" %} |
| ins_cost(500); |
| opcode(0xF7); /* Opcode F7 /0 */ |
| ins_encode( OpcP, RMopc_Mem(0x00,op), Con_d32(0xFFFFFFFF) ); |
| ins_pipe( ialu_cr_reg_imm ); |
| %} |
| |
| // Yanked all unsigned pointer compare operations. |
| // Pointer compares are done with CmpP which is already unsigned. |
| |
| //----------Max and Min-------------------------------------------------------- |
| // Min Instructions |
| //// |
| // *** Min and Max using the conditional move are slower than the |
| // *** branch version on a Pentium III. |
| // // Conditional move for min |
| //instruct cmovI_reg_lt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ |
| // effect( USE_DEF op2, USE op1, USE cr ); |
| // format %{ "CMOVlt $op2,$op1\t! min" %} |
| // opcode(0x4C,0x0F); |
| // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); |
| // ins_pipe( pipe_cmov_reg ); |
| //%} |
| // |
| //// Min Register with Register (P6 version) |
| //instruct minI_eReg_p6( eRegI op1, eRegI op2 ) %{ |
| // predicate(VM_Version::supports_cmov() ); |
| // match(Set op2 (MinI op1 op2)); |
| // ins_cost(200); |
| // expand %{ |
| // eFlagsReg cr; |
| // compI_eReg(cr,op1,op2); |
| // cmovI_reg_lt(op2,op1,cr); |
| // %} |
| //%} |
| |
| // Min Register with Register (generic version) |
| instruct minI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ |
| match(Set dst (MinI dst src)); |
| effect(KILL flags); |
| ins_cost(300); |
| |
| format %{ "MIN $dst,$src" %} |
| opcode(0xCC); |
| ins_encode( min_enc(dst,src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // Max Register with Register |
| // *** Min and Max using the conditional move are slower than the |
| // *** branch version on a Pentium III. |
| // // Conditional move for max |
| //instruct cmovI_reg_gt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ |
| // effect( USE_DEF op2, USE op1, USE cr ); |
| // format %{ "CMOVgt $op2,$op1\t! max" %} |
| // opcode(0x4F,0x0F); |
| // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); |
| // ins_pipe( pipe_cmov_reg ); |
| //%} |
| // |
| // // Max Register with Register (P6 version) |
| //instruct maxI_eReg_p6( eRegI op1, eRegI op2 ) %{ |
| // predicate(VM_Version::supports_cmov() ); |
| // match(Set op2 (MaxI op1 op2)); |
| // ins_cost(200); |
| // expand %{ |
| // eFlagsReg cr; |
| // compI_eReg(cr,op1,op2); |
| // cmovI_reg_gt(op2,op1,cr); |
| // %} |
| //%} |
| |
| // Max Register with Register (generic version) |
| instruct maxI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ |
| match(Set dst (MaxI dst src)); |
| effect(KILL flags); |
| ins_cost(300); |
| |
| format %{ "MAX $dst,$src" %} |
| opcode(0xCC); |
| ins_encode( max_enc(dst,src) ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // ============================================================================ |
| // Branch Instructions |
| // Jump Table |
| instruct jumpXtnd(eRegI switch_val) %{ |
| match(Jump switch_val); |
| ins_cost(350); |
| |
| format %{ "JMP [table_base](,$switch_val,1)\n\t" %} |
| |
| ins_encode %{ |
| address table_base = __ address_table_constant(_index2label); |
| |
| // Jump to Address(table_base + switch_reg) |
| InternalAddress table(table_base); |
| Address index(noreg, $switch_val$$Register, Address::times_1); |
| __ jump(ArrayAddress(table, index)); |
| %} |
| ins_pc_relative(1); |
| ins_pipe(pipe_jmp); |
| %} |
| |
| // Jump Direct - Label defines a relative address from JMP+1 |
| instruct jmpDir(label labl) %{ |
| match(Goto); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "JMP $labl" %} |
| size(5); |
| opcode(0xE9); |
| ins_encode( OpcP, Lbl( labl ) ); |
| ins_pipe( pipe_jmp ); |
| ins_pc_relative(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpCon(cmpOp cop, eFlagsReg cr, label labl) %{ |
| match(If cop cr); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop $labl" %} |
| size(6); |
| opcode(0x0F, 0x80); |
| ins_encode( Jcc( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpLoopEnd(cmpOp cop, eFlagsReg cr, label labl) %{ |
| match(CountedLoopEnd cop cr); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop $labl\t# Loop end" %} |
| size(6); |
| opcode(0x0F, 0x80); |
| ins_encode( Jcc( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpLoopEndU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ |
| match(CountedLoopEnd cop cmp); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,u $labl\t# Loop end" %} |
| size(6); |
| opcode(0x0F, 0x80); |
| ins_encode( Jcc( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| %} |
| |
| // Jump Direct Conditional - using unsigned comparison |
| instruct jmpConU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ |
| match(If cop cmp); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,u $labl" %} |
| size(6); |
| opcode(0x0F, 0x80); |
| ins_encode( Jcc( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| %} |
| |
| // ============================================================================ |
| // The 2nd slow-half of a subtype check. Scan the subklass's 2ndary superklass |
| // array for an instance of the superklass. Set a hidden internal cache on a |
| // hit (cache is checked with exposed code in gen_subtype_check()). Return |
| // NZ for a miss or zero for a hit. The encoding ALSO sets flags. |
| instruct partialSubtypeCheck( eDIRegP result, eSIRegP sub, eAXRegP super, eCXRegI rcx, eFlagsReg cr ) %{ |
| match(Set result (PartialSubtypeCheck sub super)); |
| effect( KILL rcx, KILL cr ); |
| |
| ins_cost(1100); // slightly larger than the next version |
| format %{ "CMPL EAX,ESI\n\t" |
| "JEQ,s hit\n\t" |
| "MOV EDI,[$sub+Klass::secondary_supers]\n\t" |
| "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" |
| "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" |
| "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" |
| "JNE,s miss\t\t# Missed: EDI not-zero\n\t" |
| "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache\n\t" |
| "hit:\n\t" |
| "XOR $result,$result\t\t Hit: EDI zero\n\t" |
| "miss:\t" %} |
| |
| opcode(0x1); // Force a XOR of EDI |
| ins_encode( enc_PartialSubtypeCheck() ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| instruct partialSubtypeCheck_vs_Zero( eFlagsReg cr, eSIRegP sub, eAXRegP super, eCXRegI rcx, eDIRegP result, immP0 zero ) %{ |
| match(Set cr (CmpP (PartialSubtypeCheck sub super) zero)); |
| effect( KILL rcx, KILL result ); |
| |
| ins_cost(1000); |
| format %{ "CMPL EAX,ESI\n\t" |
| "JEQ,s miss\t# Actually a hit; we are done.\n\t" |
| "MOV EDI,[$sub+Klass::secondary_supers]\n\t" |
| "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" |
| "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" |
| "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" |
| "JNE,s miss\t\t# Missed: flags NZ\n\t" |
| "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache, flags Z\n\t" |
| "miss:\t" %} |
| |
| opcode(0x0); // No need to XOR EDI |
| ins_encode( enc_PartialSubtypeCheck() ); |
| ins_pipe( pipe_slow ); |
| %} |
| |
| // ============================================================================ |
| // Branch Instructions -- short offset versions |
| // |
| // These instructions are used to replace jumps of a long offset (the default |
| // match) with jumps of a shorter offset. These instructions are all tagged |
| // with the ins_short_branch attribute, which causes the ADLC to suppress the |
| // match rules in general matching. Instead, the ADLC generates a conversion |
| // method in the MachNode which can be used to do in-place replacement of the |
| // long variant with the shorter variant. The compiler will determine if a |
| // branch can be taken by the is_short_branch_offset() predicate in the machine |
| // specific code section of the file. |
| |
| // Jump Direct - Label defines a relative address from JMP+1 |
| instruct jmpDir_short(label labl) %{ |
| match(Goto); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "JMP,s $labl" %} |
| size(2); |
| opcode(0xEB); |
| ins_encode( OpcP, LblShort( labl ) ); |
| ins_pipe( pipe_jmp ); |
| ins_pc_relative(1); |
| ins_short_branch(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpCon_short(cmpOp cop, eFlagsReg cr, label labl) %{ |
| match(If cop cr); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,s $labl" %} |
| size(2); |
| opcode(0x70); |
| ins_encode( JccShort( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| ins_short_branch(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpLoopEnd_short(cmpOp cop, eFlagsReg cr, label labl) %{ |
| match(CountedLoopEnd cop cr); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,s $labl" %} |
| size(2); |
| opcode(0x70); |
| ins_encode( JccShort( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| ins_short_branch(1); |
| %} |
| |
| // Jump Direct Conditional - Label defines a relative address from Jcc+1 |
| instruct jmpLoopEndU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ |
| match(CountedLoopEnd cop cmp); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,us $labl" %} |
| size(2); |
| opcode(0x70); |
| ins_encode( JccShort( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| ins_short_branch(1); |
| %} |
| |
| // Jump Direct Conditional - using unsigned comparison |
| instruct jmpConU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ |
| match(If cop cmp); |
| effect(USE labl); |
| |
| ins_cost(300); |
| format %{ "J$cop,us $labl" %} |
| size(2); |
| opcode(0x70); |
| ins_encode( JccShort( cop, labl) ); |
| ins_pipe( pipe_jcc ); |
| ins_pc_relative(1); |
| ins_short_branch(1); |
| %} |
| |
| // ============================================================================ |
| // Long Compare |
| // |
| // Currently we hold longs in 2 registers. Comparing such values efficiently |
| // is tricky. The flavor of compare used depends on whether we are testing |
| // for LT, LE, or EQ. For a simple LT test we can check just the sign bit. |
| // The GE test is the negated LT test. The LE test can be had by commuting |
| // the operands (yielding a GE test) and then negating; negate again for the |
| // GT test. The EQ test is done by ORcc'ing the high and low halves, and the |
| // NE test is negated from that. |
| |
| // Due to a shortcoming in the ADLC, it mixes up expressions like: |
| // (foo (CmpI (CmpL X Y) 0)) and (bar (CmpI (CmpL X 0L) 0)). Note the |
| // difference between 'Y' and '0L'. The tree-matches for the CmpI sections |
| // are collapsed internally in the ADLC's dfa-gen code. The match for |
| // (CmpI (CmpL X Y) 0) is silently replaced with (CmpI (CmpL X 0L) 0) and the |
| // foo match ends up with the wrong leaf. One fix is to not match both |
| // reg-reg and reg-zero forms of long-compare. This is unfortunate because |
| // both forms beat the trinary form of long-compare and both are very useful |
| // on Intel which has so few registers. |
| |
| // Manifest a CmpL result in an integer register. Very painful. |
| // This is the test to avoid. |
| instruct cmpL3_reg_reg(eSIRegI dst, eRegL src1, eRegL src2, eFlagsReg flags ) %{ |
| match(Set dst (CmpL3 src1 src2)); |
| effect( KILL flags ); |
| ins_cost(1000); |
| format %{ "XOR $dst,$dst\n\t" |
| "CMP $src1.hi,$src2.hi\n\t" |
| "JLT,s m_one\n\t" |
| "JGT,s p_one\n\t" |
| "CMP $src1.lo,$src2.lo\n\t" |
| "JB,s m_one\n\t" |
| "JEQ,s done\n" |
| "p_one:\tINC $dst\n\t" |
| "JMP,s done\n" |
| "m_one:\tDEC $dst\n" |
| "done:" %} |
| ins_encode %{ |
| Label p_one, m_one, done; |
| __ xorl($dst$$Register, $dst$$Register); |
| __ cmpl(HIGH_FROM_LOW($src1$$Register), HIGH_FROM_LOW($src2$$Register)); |
| __ jccb(Assembler::less, m_one); |
| __ jccb(Assembler::greater, p_one); |
| __ cmpl($src1$$Register, $src2$$Register); |
| __ jccb(Assembler::below, m_one); |
| __ jccb(Assembler::equal, done); |
| __ bind(p_one); |
| __ increment($dst$$Register); |
| __ jmpb(done); |
| __ bind(m_one); |
| __ decrement($dst$$Register); |
| __ bind(done); |
| %} |
| ins_pipe( pipe_slow ); |
| %} |
| |
| //====== |
| // Manifest a CmpL result in the normal flags. Only good for LT or GE |
| // compares. Can be used for LE or GT compares by reversing arguments. |
| // NOT GOOD FOR EQ/NE tests. |
| instruct cmpL_zero_flags_LTGE( flagsReg_long_LTGE flags, eRegL src, immL0 zero ) %{ |
| match( Set flags (CmpL src zero )); |
| ins_cost(100); |
| format %{ "TEST $src.hi,$src.hi" %} |
| opcode(0x85); |
| ins_encode( OpcP, RegReg_Hi2( src, src ) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| // Manifest a CmpL result in the normal flags. Only good for LT or GE |
| // compares. Can be used for LE or GT compares by reversing arguments. |
| // NOT GOOD FOR EQ/NE tests. |
| instruct cmpL_reg_flags_LTGE( flagsReg_long_LTGE flags, eRegL src1, eRegL src2, eRegI tmp ) %{ |
| match( Set flags (CmpL src1 src2 )); |
| effect( TEMP tmp ); |
| ins_cost(300); |
| format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" |
| "MOV $tmp,$src1.hi\n\t" |
| "SBB $tmp,$src2.hi\t! Compute flags for long compare" %} |
| ins_encode( long_cmp_flags2( src1, src2, tmp ) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| // Long compares reg < zero/req OR reg >= zero/req. |
| // Just a wrapper for a normal branch, plus the predicate test. |
| instruct cmpL_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, label labl) %{ |
| match(If cmp flags); |
| effect(USE labl); |
| predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); |
| expand %{ |
| jmpCon(cmp,flags,labl); // JLT or JGE... |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE longs. |
| instruct cmovLL_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, eRegL src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); |
| ins_cost(400); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| instruct cmovLL_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, load_long_memory src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); |
| ins_cost(500); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| // Compare 2 longs and CMOVE ints. |
| instruct cmovII_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, eRegI src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| instruct cmovII_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, memory src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); |
| ins_cost(250); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); |
| ins_pipe( pipe_cmov_mem ); |
| %} |
| |
| // Compare 2 longs and CMOVE ints. |
| instruct cmovPP_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegP dst, eRegP src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); |
| match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regD dst, regD src) %{ |
| predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovXDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regXD dst, regXD src) %{ |
| predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovXD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| instruct cmovFF_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regF dst, regF src) %{ |
| predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovF_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| instruct cmovXX_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regX dst, regX src) %{ |
| predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovX_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| //====== |
| // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. |
| instruct cmpL_zero_flags_EQNE( flagsReg_long_EQNE flags, eRegL src, immL0 zero, eRegI tmp ) %{ |
| match( Set flags (CmpL src zero )); |
| effect(TEMP tmp); |
| ins_cost(200); |
| format %{ "MOV $tmp,$src.lo\n\t" |
| "OR $tmp,$src.hi\t! Long is EQ/NE 0?" %} |
| ins_encode( long_cmp_flags0( src, tmp ) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. |
| instruct cmpL_reg_flags_EQNE( flagsReg_long_EQNE flags, eRegL src1, eRegL src2 ) %{ |
| match( Set flags (CmpL src1 src2 )); |
| ins_cost(200+300); |
| format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" |
| "JNE,s skip\n\t" |
| "CMP $src1.hi,$src2.hi\n\t" |
| "skip:\t" %} |
| ins_encode( long_cmp_flags1( src1, src2 ) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| // Long compare reg == zero/reg OR reg != zero/reg |
| // Just a wrapper for a normal branch, plus the predicate test. |
| instruct cmpL_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, label labl) %{ |
| match(If cmp flags); |
| effect(USE labl); |
| predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); |
| expand %{ |
| jmpCon(cmp,flags,labl); // JEQ or JNE... |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE longs. |
| instruct cmovLL_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, eRegL src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); |
| ins_cost(400); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| instruct cmovLL_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, load_long_memory src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); |
| ins_cost(500); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| // Compare 2 longs and CMOVE ints. |
| instruct cmovII_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, eRegI src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| instruct cmovII_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, memory src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); |
| ins_cost(250); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); |
| ins_pipe( pipe_cmov_mem ); |
| %} |
| |
| // Compare 2 longs and CMOVE ints. |
| instruct cmovPP_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegP dst, eRegP src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); |
| match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regD dst, regD src) %{ |
| predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovXDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regXD dst, regXD src) %{ |
| predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovXD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| instruct cmovFF_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regF dst, regF src) %{ |
| predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovF_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| instruct cmovXX_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regX dst, regX src) %{ |
| predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovX_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| //====== |
| // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. |
| // Same as cmpL_reg_flags_LEGT except must negate src |
| instruct cmpL_zero_flags_LEGT( flagsReg_long_LEGT flags, eRegL src, immL0 zero, eRegI tmp ) %{ |
| match( Set flags (CmpL src zero )); |
| effect( TEMP tmp ); |
| ins_cost(300); |
| format %{ "XOR $tmp,$tmp\t# Long compare for -$src < 0, use commuted test\n\t" |
| "CMP $tmp,$src.lo\n\t" |
| "SBB $tmp,$src.hi\n\t" %} |
| ins_encode( long_cmp_flags3(src, tmp) ); |
| ins_pipe( ialu_reg_reg_long ); |
| %} |
| |
| // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. |
| // Same as cmpL_reg_flags_LTGE except operands swapped. Swapping operands |
| // requires a commuted test to get the same result. |
| instruct cmpL_reg_flags_LEGT( flagsReg_long_LEGT flags, eRegL src1, eRegL src2, eRegI tmp ) %{ |
| match( Set flags (CmpL src1 src2 )); |
| effect( TEMP tmp ); |
| ins_cost(300); |
| format %{ "CMP $src2.lo,$src1.lo\t! Long compare, swapped operands, use with commuted test\n\t" |
| "MOV $tmp,$src2.hi\n\t" |
| "SBB $tmp,$src1.hi\t! Compute flags for long compare" %} |
| ins_encode( long_cmp_flags2( src2, src1, tmp ) ); |
| ins_pipe( ialu_cr_reg_reg ); |
| %} |
| |
| // Long compares reg < zero/req OR reg >= zero/req. |
| // Just a wrapper for a normal branch, plus the predicate test |
| instruct cmpL_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, label labl) %{ |
| match(If cmp flags); |
| effect(USE labl); |
| predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le ); |
| ins_cost(300); |
| expand %{ |
| jmpCon(cmp,flags,labl); // JGT or JLE... |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE longs. |
| instruct cmovLL_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, eRegL src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); |
| ins_cost(400); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| instruct cmovLL_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, load_long_memory src) %{ |
| match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); |
| ins_cost(500); |
| format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" |
| "CMOV$cmp $dst.hi,$src.hi+4" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); |
| ins_pipe( pipe_cmov_reg_long ); |
| %} |
| |
| // Compare 2 longs and CMOVE ints. |
| instruct cmovII_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, eRegI src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| instruct cmovII_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, memory src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); |
| match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); |
| ins_cost(250); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); |
| ins_pipe( pipe_cmov_mem ); |
| %} |
| |
| // Compare 2 longs and CMOVE ptrs. |
| instruct cmovPP_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegP dst, eRegP src) %{ |
| predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); |
| match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| format %{ "CMOV$cmp $dst,$src" %} |
| opcode(0x0F,0x40); |
| ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); |
| ins_pipe( pipe_cmov_reg ); |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regD dst, regD src) %{ |
| predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| // Compare 2 longs and CMOVE doubles |
| instruct cmovXDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regXD dst, regXD src) %{ |
| predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); |
| match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovXD_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| instruct cmovFF_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regF dst, regF src) %{ |
| predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovF_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| |
| instruct cmovXX_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regX dst, regX src) %{ |
| predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); |
| match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); |
| ins_cost(200); |
| expand %{ |
| fcmovX_regS(cmp,flags,dst,src); |
| %} |
| %} |
| |
| |
| // ============================================================================ |
| // Procedure Call/Return Instructions |
| // Call Java Static Instruction |
| // Note: If this code changes, the corresponding ret_addr_offset() and |
| // compute_padding() functions will have to be adjusted. |
| instruct CallStaticJavaDirect(method meth) %{ |
| match(CallStaticJava); |
| effect(USE meth); |
| |
| ins_cost(300); |
| format %{ "CALL,static " %} |
| opcode(0xE8); /* E8 cd */ |
| ins_encode( pre_call_FPU, |
| Java_Static_Call( meth ), |
| call_epilog, |
| post_call_FPU ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| ins_alignment(4); |
| %} |
| |
| // Call Java Dynamic Instruction |
| // Note: If this code changes, the corresponding ret_addr_offset() and |
| // compute_padding() functions will have to be adjusted. |
| instruct CallDynamicJavaDirect(method meth) %{ |
| match(CallDynamicJava); |
| effect(USE meth); |
| |
| ins_cost(300); |
| format %{ "MOV EAX,(oop)-1\n\t" |
| "CALL,dynamic" %} |
| opcode(0xE8); /* E8 cd */ |
| ins_encode( pre_call_FPU, |
| Java_Dynamic_Call( meth ), |
| call_epilog, |
| post_call_FPU ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| ins_alignment(4); |
| %} |
| |
| // Call Runtime Instruction |
| instruct CallRuntimeDirect(method meth) %{ |
| match(CallRuntime ); |
| effect(USE meth); |
| |
| ins_cost(300); |
| format %{ "CALL,runtime " %} |
| opcode(0xE8); /* E8 cd */ |
| // Use FFREEs to clear entries in float stack |
| ins_encode( pre_call_FPU, |
| FFree_Float_Stack_All, |
| Java_To_Runtime( meth ), |
| post_call_FPU ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| %} |
| |
| // Call runtime without safepoint |
| instruct CallLeafDirect(method meth) %{ |
| match(CallLeaf); |
| effect(USE meth); |
| |
| ins_cost(300); |
| format %{ "CALL_LEAF,runtime " %} |
| opcode(0xE8); /* E8 cd */ |
| ins_encode( pre_call_FPU, |
| FFree_Float_Stack_All, |
| Java_To_Runtime( meth ), |
| Verify_FPU_For_Leaf, post_call_FPU ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| %} |
| |
| instruct CallLeafNoFPDirect(method meth) %{ |
| match(CallLeafNoFP); |
| effect(USE meth); |
| |
| ins_cost(300); |
| format %{ "CALL_LEAF_NOFP,runtime " %} |
| opcode(0xE8); /* E8 cd */ |
| ins_encode(Java_To_Runtime(meth)); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| %} |
| |
| |
| // Return Instruction |
| // Remove the return address & jump to it. |
| instruct Ret() %{ |
| match(Return); |
| format %{ "RET" %} |
| opcode(0xC3); |
| ins_encode(OpcP); |
| ins_pipe( pipe_jmp ); |
| %} |
| |
| // Tail Call; Jump from runtime stub to Java code. |
| // Also known as an 'interprocedural jump'. |
| // Target of jump will eventually return to caller. |
| // TailJump below removes the return address. |
| instruct TailCalljmpInd(eRegP_no_EBP jump_target, eBXRegP method_oop) %{ |
| match(TailCall jump_target method_oop ); |
| ins_cost(300); |
| format %{ "JMP $jump_target \t# EBX holds method oop" %} |
| opcode(0xFF, 0x4); /* Opcode FF /4 */ |
| ins_encode( OpcP, RegOpc(jump_target) ); |
| ins_pipe( pipe_jmp ); |
| %} |
| |
| |
| // Tail Jump; remove the return address; jump to target. |
| // TailCall above leaves the return address around. |
| instruct tailjmpInd(eRegP_no_EBP jump_target, eAXRegP ex_oop) %{ |
| match( TailJump jump_target ex_oop ); |
| ins_cost(300); |
| format %{ "POP EDX\t# pop return address into dummy\n\t" |
| "JMP $jump_target " %} |
| opcode(0xFF, 0x4); /* Opcode FF /4 */ |
| ins_encode( enc_pop_rdx, |
| OpcP, RegOpc(jump_target) ); |
| ins_pipe( pipe_jmp ); |
| %} |
| |
| // Create exception oop: created by stack-crawling runtime code. |
| // Created exception is now available to this handler, and is setup |
| // just prior to jumping to this handler. No code emitted. |
| instruct CreateException( eAXRegP ex_oop ) |
| %{ |
| match(Set ex_oop (CreateEx)); |
| |
| size(0); |
| // use the following format syntax |
| format %{ "# exception oop is in EAX; no code emitted" %} |
| ins_encode(); |
| ins_pipe( empty ); |
| %} |
| |
| |
| // Rethrow exception: |
| // The exception oop will come in the first argument position. |
| // Then JUMP (not call) to the rethrow stub code. |
| instruct RethrowException() |
| %{ |
| match(Rethrow); |
| |
| // use the following format syntax |
| format %{ "JMP rethrow_stub" %} |
| ins_encode(enc_rethrow); |
| ins_pipe( pipe_jmp ); |
| %} |
| |
| // inlined locking and unlocking |
| |
| |
| instruct cmpFastLock( eFlagsReg cr, eRegP object, eRegP box, eAXRegI tmp, eRegP scr) %{ |
| match( Set cr (FastLock object box) ); |
| effect( TEMP tmp, TEMP scr ); |
| ins_cost(300); |
| format %{ "FASTLOCK $object, $box KILLS $tmp,$scr" %} |
| ins_encode( Fast_Lock(object,box,tmp,scr) ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| %} |
| |
| instruct cmpFastUnlock( eFlagsReg cr, eRegP object, eAXRegP box, eRegP tmp ) %{ |
| match( Set cr (FastUnlock object box) ); |
| effect( TEMP tmp ); |
| ins_cost(300); |
| format %{ "FASTUNLOCK $object, $box, $tmp" %} |
| ins_encode( Fast_Unlock(object,box,tmp) ); |
| ins_pipe( pipe_slow ); |
| ins_pc_relative(1); |
| %} |
| |
| |
| |
| // ============================================================================ |
| // Safepoint Instruction |
| instruct safePoint_poll(eFlagsReg cr) %{ |
| match(SafePoint); |
| effect(KILL cr); |
| |
| // TODO-FIXME: we currently poll at offset 0 of the safepoint polling page. |
| // On SPARC that might be acceptable as we can generate the address with |
| // just a sethi, saving an or. By polling at offset 0 we can end up |
| // putting additional pressure on the index-0 in the D$. Because of |
| // alignment (just like the situation at hand) the lower indices tend |
| // to see more traffic. It'd be better to change the polling address |
| // to offset 0 of the last $line in the polling page. |
| |
| format %{ "TSTL #polladdr,EAX\t! Safepoint: poll for GC" %} |
| ins_cost(125); |
| size(6) ; |
| ins_encode( Safepoint_Poll() ); |
| ins_pipe( ialu_reg_mem ); |
| %} |
| |
| //----------PEEPHOLE RULES----------------------------------------------------- |
| // These must follow all instruction definitions as they use the names |
| // defined in the instructions definitions. |
| // |
| // peepmatch ( root_instr_name [preceeding_instruction]* ); |
| // |
| // peepconstraint %{ |
| // (instruction_number.operand_name relational_op instruction_number.operand_name |
| // [, ...] ); |
| // // instruction numbers are zero-based using left to right order in peepmatch |
| // |
| // peepreplace ( instr_name ( [instruction_number.operand_name]* ) ); |
| // // provide an instruction_number.operand_name for each operand that appears |
| // // in the replacement instruction's match rule |
| // |
| // ---------VM FLAGS--------------------------------------------------------- |
| // |
| // All peephole optimizations can be turned off using -XX:-OptoPeephole |
| // |
| // Each peephole rule is given an identifying number starting with zero and |
| // increasing by one in the order seen by the parser. An individual peephole |
| // can be enabled, and all others disabled, by using -XX:OptoPeepholeAt=# |
| // on the command-line. |
| // |
| // ---------CURRENT LIMITATIONS---------------------------------------------- |
| // |
| // Only match adjacent instructions in same basic block |
| // Only equality constraints |
| // Only constraints between operands, not (0.dest_reg == EAX_enc) |
| // Only one replacement instruction |
| // |
| // ---------EXAMPLE---------------------------------------------------------- |
| // |
| // // pertinent parts of existing instructions in architecture description |
| // instruct movI(eRegI dst, eRegI src) %{ |
| // match(Set dst (CopyI src)); |
| // %} |
| // |
| // instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ |
| // match(Set dst (AddI dst src)); |
| // effect(KILL cr); |
| // %} |
| // |
| // // Change (inc mov) to lea |
| // peephole %{ |
| // // increment preceeded by register-register move |
| // peepmatch ( incI_eReg movI ); |
| // // require that the destination register of the increment |
| // // match the destination register of the move |
| // peepconstraint ( 0.dst == 1.dst ); |
| // // construct a replacement instruction that sets |
| // // the destination to ( move's source register + one ) |
| // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); |
| // %} |
| // |
| // Implementation no longer uses movX instructions since |
| // machine-independent system no longer uses CopyX nodes. |
| // |
| // peephole %{ |
| // peepmatch ( incI_eReg movI ); |
| // peepconstraint ( 0.dst == 1.dst ); |
| // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); |
| // %} |
| // |
| // peephole %{ |
| // peepmatch ( decI_eReg movI ); |
| // peepconstraint ( 0.dst == 1.dst ); |
| // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); |
| // %} |
| // |
| // peephole %{ |
| // peepmatch ( addI_eReg_imm movI ); |
| // peepconstraint ( 0.dst == 1.dst ); |
| // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); |
| // %} |
| // |
| // peephole %{ |
| // peepmatch ( addP_eReg_imm movP ); |
| // peepconstraint ( 0.dst == 1.dst ); |
| // peepreplace ( leaP_eReg_immI( 0.dst 1.src 0.src ) ); |
| // %} |
| |
| // // Change load of spilled value to only a spill |
| // instruct storeI(memory mem, eRegI src) %{ |
| // match(Set mem (StoreI mem src)); |
| // %} |
| // |
| // instruct loadI(eRegI dst, memory mem) %{ |
| // match(Set dst (LoadI mem)); |
| // %} |
| // |
| peephole %{ |
| peepmatch ( loadI storeI ); |
| peepconstraint ( 1.src == 0.dst, 1.mem == 0.mem ); |
| peepreplace ( storeI( 1.mem 1.mem 1.src ) ); |
| %} |
| |
| //----------SMARTSPILL RULES--------------------------------------------------- |
| // These must follow all instruction definitions as they use the names |
| // defined in the instructions definitions. |