| /* |
| * Copyright 2020 The Android Open Source Project |
| * |
| * Licensed under the Apache License, Version 2.0 (the "License"); |
| * you may not use this file except in compliance with the License. |
| * You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| */ |
| |
| package android.hardware.identity; |
| |
| import android.hardware.identity.Certificate; |
| import android.hardware.identity.RequestNamespace; |
| import android.hardware.identity.SecureAccessControlProfile; |
| import android.hardware.identity.IWritableIdentityCredential; |
| import android.hardware.keymaster.HardwareAuthToken; |
| import android.hardware.keymaster.VerificationToken; |
| |
| @VintfStability |
| interface IIdentityCredential { |
| /** |
| * Delete a credential. |
| * |
| * This method returns a COSE_Sign1 data structure signed by CredentialKey |
| * with payload set to the ProofOfDeletion CBOR below: |
| * |
| * ProofOfDeletion = [ |
| * "ProofOfDeletion", ; tstr |
| * tstr, ; DocType |
| * bool ; true if this is a test credential, should |
| * ; always be false. |
| * ] |
| * |
| * After this method has been called, the persistent storage used for credentialData should |
| * be deleted. |
| * |
| * This method was deprecated in API version 3 because there's no challenge so freshness |
| * can't be checked. Use deleteCredentalWithChallenge() instead. |
| * |
| * @return a COSE_Sign1 signature described above |
| * @deprecated use deleteCredentalWithChallenge() instead. |
| */ |
| byte[] deleteCredential(); |
| |
| /** |
| * Creates an ephemeral EC key pair, for use in establishing a seceure session with a reader. |
| * This method returns the private key so the caller can perform an ECDH key agreement operation |
| * with the reader. The reason for generating the key pair in the secure environment is so that |
| * the secure environment knows what public key to expect to find in the session transcript. |
| * |
| * The generated key must be an EC key using the P-256 curve. |
| * |
| * This method may only be called once per instance. If called more than once, STATUS_FAILED |
| * will be returned. |
| * |
| * @return the private key, in DER format as specified in RFC 5915. |
| */ |
| byte[] createEphemeralKeyPair(); |
| |
| /** |
| * Sets the public part of the reader's ephemeral key pair. |
| * |
| * This method may only be called once per instance. If called more than once, STATUS_FAILED |
| * will be returned. |
| * |
| * @param publicKey contains the reader's ephemeral public key, in uncompressed |
| * form (e.g. 0x04 || X || Y). |
| */ |
| void setReaderEphemeralPublicKey(in byte[] publicKey); |
| |
| /** |
| * Creates a challenge value to be used for proving successful user authentication. This |
| * is included in the authToken passed to the startRetrieval() method and the |
| * verificationToken passed to the setVerificationToken() method. |
| * |
| * This method may only be called once per instance. If called more than once, STATUS_FAILED |
| * will be returned. If user authentication is not needed, this method may not be called. |
| * |
| * @return challenge, a non-zero number. |
| */ |
| long createAuthChallenge(); |
| |
| /** |
| * Start an entry retrieval process. |
| * |
| * The setRequestedNamespaces() and setVerificationToken() methods will be called before |
| * this method is called. |
| * |
| * This method is called after createEphemeralKeyPair(), setReaderEphemeralPublicKey(), |
| * createAuthChallenge() (note that those calls are optional) and before startRetrieveEntry(). |
| * This method call is followed by multiple calls of startRetrieveEntryValue(), |
| * retrieveEntryValue(), and finally finishRetrieval(). |
| * |
| * It is permissible to perform data retrievals multiple times using the same instance (e.g. |
| * startRetrieval(), then multiple calls of startRetrieveEntryValue(), retrieveEntryValue(), |
| * then finally finishRetrieval()) but if this is done, the sessionTranscript parameter |
| * must be identical for each startRetrieval() invocation. If this is not the case, this call |
| * fails with the STATUS_SESSION_TRANSCRIPT_MISMATCH error. |
| * |
| * If either authToken or verificationToken (as passed with setVerificationToken()) |
| * is not valid this method fails with STATUS_INVALID_AUTH_TOKEN. Note that valid tokens |
| * are only passed if they are actually needed and available (this can be detected by |
| * the timestamp being set to zero). For example, if no data items with access control |
| * profiles using user authentication are requested, the tokens are not filled in. |
| * It's also possible that no usable auth token is actually available (it could be the user |
| * never unlocked the device within the timeouts in the access control profiles) and |
| * in this case the tokens aren't filled in either. |
| * |
| * For test credentials (identified by the testCredential boolean in the CredentialData |
| * CBOR created at provisioning time), the |mac| field in both the authToken and |
| * verificationToken should not be checked against the shared HMAC key (see IKeyMasterDevice |
| * for details). This is to enable VTS tests to check for correct behavior. |
| * |
| * Each of the provided accessControlProfiles is checked in this call. If they are not |
| * all valid, the call fails with STATUS_INVALID_DATA. |
| * |
| * For the itemsRequest parameter, the content can be defined in the way appropriate for |
| * the credential, but there are three requirements that must be met to work with this HAL: |
| * |
| * 1. The content must be a CBOR-encoded structure. |
| * 2. The CBOR structure must be a map. |
| * 3. The map must contain a tstr key "nameSpaces" whose value contains a map, as described in |
| * the example below. |
| * |
| * If these requirements are not met the startRetrieval() call fails with |
| * STATUS_INVALID_ITEMS_REQUEST_MESSAGE. |
| * |
| * Here's an example of ItemsRequest CBOR which conforms to this requirement: |
| * |
| * ItemsRequest = { |
| * ? "docType" : DocType, |
| * "nameSpaces" : NameSpaces, |
| * ? "requestInfo" : {* tstr => any} ; Additional info the reader wants to provide |
| * } |
| * |
| * DocType = tstr |
| * |
| * NameSpaces = { |
| * + NameSpace => DataElements ; Requested data elements for each NameSpace |
| * } |
| * |
| * NameSpace = tstr |
| * |
| * DataElements = { |
| * + DataElement => IntentToRetain |
| * } |
| * |
| * DataElement = tstr |
| * IntentToRetain = bool |
| * |
| * For the readerSignature parameter, this can either be empty or if non-empty it |
| * must be a COSE_Sign1 where the payload is the bytes of the |
| * ReaderAuthenticationBytes CBOR defined below: |
| * |
| * ReaderAuthentication = [ |
| * "ReaderAuthentication", |
| * SessionTranscript, |
| * ItemsRequestBytes |
| * ] |
| * |
| * SessionTranscript = any |
| * |
| * ItemsRequestBytes = #6.24(bstr .cbor ItemsRequest) |
| * |
| * ReaderAuthenticationBytes = #6.24(bstr .cbor ReaderAuthentication) |
| * |
| * The public key corresponding to the key used to made signature, can be found in the |
| * 'x5chain' unprotected header element of the COSE_Sign1 structure (as as described |
| * in 'draft-ietf-cose-x509-04'). There will be at least one certificate in said element |
| * and there may be more (and if so, each certificate must be signed by its successor). |
| * This is checked and if the check fails the call fails with |
| * STATUS_READER_SIGNATURE_CHECK_FAILED. |
| * |
| * The SessionTranscript CBOR is conveyed in the sessionTranscript parameter. It |
| * is permissible for this to be empty in which case the readerSignature parameter |
| * must also be empty. If this is not the case, the call fails with STATUS_FAILED. |
| * |
| * If the SessionTranscript CBOR is not empty, the X and Y coordinates of the public |
| * part of the key-pair previously generated by createEphemeralKeyPair() must appear |
| * somewhere in the bytes of the CBOR. Each of these coordinates must appear encoded |
| * with the most significant bits first and use the exact amount of bits indicated by |
| * the key size of the ephemeral keys. For example, if the ephemeral key is using the |
| * P-256 curve then the 32 bytes for the X coordinate encoded with the most significant |
| * bits first must appear somewhere in the CBOR and ditto for the 32 bytes for the Y |
| * coordinate. If this is not satisfied, the call fails with |
| * STATUS_EPHEMERAL_PUBLIC_KEY_NOT_FOUND. |
| * |
| * @param accessControlProfiles |
| * Access control profiles that are required to retrieve the entries that are going to be |
| * requested with IIdentityCredential.retrieveEntryValue(). See above. |
| * |
| * @param authToken |
| * The authentication token that proves the user was authenticated, as required |
| * by one or more of the provided accessControlProfiles. This token is only valid |
| * if the timestamp field is non-zero. See above. |
| * |
| * @param itemsRequest |
| * If non-empty, contains request data that is signed by the reader. See above. |
| * |
| * @param signingKeyBlob is either empty or a signingKeyBlob (see generateSigningKeyPair(), |
| * below) containing the signing key to use to sign the data retrieved. If this |
| * is not in the right format the call fails with STATUS_INVALID_DATA. |
| * |
| * @param sessionTranscript |
| * Either empty or the CBOR of the SessionTranscript. See above. |
| * |
| * @param readerSignature |
| * readerSignature is either empty or contains a CBOR_Sign1 structure. See above. |
| * |
| * @param requestCounts |
| * requestCounts specifies the number of data items that are going to be requested, per |
| * namespace. The number of elements in the vector must be the number of namespaces for which |
| * data items will be requested in retrieveEntryValue() calls, and the values of the elments |
| * must be the number of items from each namespace, in order, that will be requested in |
| * retrieveEntryValue() calls. |
| * Note that it's the caller's responsibility to ensure that the counts correspond to the |
| * retrieveEntryValue() calls that will be made, and that every retrieveEntryValue() call |
| * will succeed (i.e. that the access control profile checks will succeed). This means that |
| * it's the responsibility of the caller to determine which access control checks will fail |
| * and remove the corresponding requests from the counts. |
| */ |
| void startRetrieval(in SecureAccessControlProfile[] accessControlProfiles, |
| in HardwareAuthToken authToken, in byte[] itemsRequest, in byte[] signingKeyBlob, |
| in byte[] sessionTranscript, in byte[] readerSignature, in int[] requestCounts); |
| |
| /** |
| * Starts retrieving an entry, subject to access control requirements. Entries must be |
| * retrieved in namespace groups as specified in the requestCounts parameter. |
| * |
| * If the requestData parameter as passed to startRetrieval() was non-empty |
| * this method must only be called with entries specified in that field. If this |
| * requirement is not met, the call fails with STATUS_NOT_IN_REQUEST_MESSAGE. |
| * |
| * If nameSpace or name is empty this call fails with STATUS_INVALID_DATA. |
| * |
| * Each access control profile for the entry is checked. If user authentication |
| * is required and the supplied auth token doesn't provide it the call fails |
| * with STATUS_USER_AUTHENTICATION_FAILED. If reader authentication is required and |
| * a suitable reader certificate chain isn't presented, the call fails with |
| * STATUS_READER_AUTHENTICATION_FAILED. |
| * |
| * It is permissible to keep retrieving values if an access control check fails. |
| * |
| * @param nameSpace is the namespace of the element, e.g. "org.iso.18013.5.1" |
| * |
| * @param name is the name of the element, e.g. "driving_privileges". |
| * |
| * @param entrySize is the size of the entry value encoded in CBOR. |
| * |
| * @param accessControlProfileIds specifies the set of access control profiles that can |
| * authorize access to the provisioned element. If an identifier of a profile |
| * is given and this profile wasn't passed to startRetrieval() this call fails |
| * with STATUS_INVALID_DATA. |
| */ |
| void startRetrieveEntryValue(in @utf8InCpp String nameSpace, in @utf8InCpp String name, |
| in int entrySize, in int[] accessControlProfileIds); |
| |
| /** |
| * Retrieves an entry value, or part of one, if the entry value is larger than gcmChunkSize. |
| * May only be called after startRetrieveEntry(). |
| * |
| * If the passed in data is not authentic, can't be decrypted, is of the wrong size, or can't |
| * be decoded, this call fails with STATUS_INVALID_DATA. |
| * |
| * @param encryptedContent contains the encrypted and MACed content. |
| * |
| * @return the entry value as CBOR, or part of the entry value in the case the |
| * content exceeds gcmChunkSize in length. |
| */ |
| byte[] retrieveEntryValue(in byte[] encryptedContent); |
| |
| /** |
| * End retrieval of data, optionally returning a message authentication code over the |
| * returned data. |
| * |
| * If signingKeyBlob or the sessionTranscript parameter passed to startRetrieval() is |
| * empty then the returned MAC will be empty. |
| * |
| * @param out mac is empty if signingKeyBlob or the sessionTranscript passed to |
| * startRetrieval() is empty. Otherwise it is a COSE_Mac0 with empty payload |
| * and the detached content is set to DeviceAuthenticationBytes as defined below. |
| * This code is produced by using the key agreement and key derivation function |
| * from the ciphersuite with the authentication private key and the reader |
| * ephemeral public key to compute a shared message authentication code (MAC) |
| * key, then using the MAC function from the ciphersuite to compute a MAC of |
| * the authenticated data. See section 9.2.3.5 of ISO/IEC 18013-5 for details |
| * of this operation. |
| * |
| * DeviceAuthentication = [ |
| * "DeviceAuthentication", |
| * SessionTranscript, |
| * DocType, |
| * DeviceNameSpacesBytes, |
| * ] |
| * |
| * DocType = tstr |
| * |
| * SessionTranscript = any |
| * |
| * DeviceNameSpacesBytes = #6.24(bstr .cbor DeviceNameSpaces) |
| * |
| * DeviceAuthenticationBytes = #6.24(bstr .cbor DeviceAuthentication) |
| * |
| * where |
| * |
| * DeviceNameSpaces = { |
| * * NameSpace => DeviceSignedItems |
| * } |
| * DeviceSignedItems = { |
| * + DataItemName => DataItemValue |
| * } |
| * |
| * Namespace = tstr |
| * DataItemName = tstr |
| * DataItemValue = any |
| * |
| * |
| * @param out deviceNameSpaces the bytes of DeviceNameSpaces. |
| */ |
| @SuppressWarnings(value={"out-array"}) |
| void finishRetrieval(out byte[] mac, out byte[] deviceNameSpaces); |
| |
| /** |
| * Generate a key pair to be used for signing session data and retrieved data items. |
| * |
| * The generated key must be an EC key using the P-256 curve. |
| * |
| * This method shall return just a single X.509 certificate which is signed by CredentialKey. |
| * When combined with the certificate chain returned at provisioning time by |
| * getAttestationCertificate() on IWritableIdentityCredential (for the credential key), this |
| * forms a chain all the way from the root of trust to the generated key. |
| * |
| * The public part of a signing key is usually included in issuer-signed data and is |
| * used for anti-cloning purposes or as a mechanism for the issuer to attest to data |
| * generated on the device. |
| * |
| * The following non-optional fields for the X.509 certificate shall be set as follows: |
| * |
| * - version: INTEGER 2 (means v3 certificate). |
| * |
| * - serialNumber: INTEGER 1 (fixed value: same on all certs). |
| * |
| * - signature: must be set to ECDSA. |
| * |
| * - subject: CN shall be set to "Android Identity Credential Authentication Key". (fixed |
| * value: same on all certs) |
| * |
| * - issuer: CN shall be set to "Android Identity Credential Key". (fixed value: |
| * same on all certs) |
| * |
| * - validity: should be from current time and one year in the future (365 days). |
| * |
| * - subjectPublicKeyInfo: must contain attested public key. |
| * |
| * As of API version 3, the certificate shall also have an X.509 extension at |
| * OID 1.3.6.1.4.1.11129.2.1.26 which shall contain an OCTET STRING with the |
| * bytes of the CBOR with the following CDDL: |
| * |
| * ProofOfBinding = [ |
| * "ProofOfBinding", |
| * bstr, // Contains SHA-256(ProofOfProvisioning) |
| * ] |
| * |
| * This CBOR enables an issuer to determine the exact state of the credential it |
| * returns issuer-signed data for. |
| * |
| * @param out signingKeyBlob contains an AES-GCM-ENC(storageKey, R, signingKey, docType) |
| * where signingKey is an EC private key in uncompressed form. That is, the returned |
| * blob is an encrypted copy of the newly-generated private signing key. |
| * |
| * @return an X.509 certificate for the new signing key, signed by the credential key. |
| */ |
| @SuppressWarnings(value={"out-array"}) |
| Certificate generateSigningKeyPair(out byte[] signingKeyBlob); |
| |
| /** |
| * Sets the namespaces and data items (including their size and access control profiles) |
| * which will be requested. This method must be called before startRetrieval() is called. |
| * |
| * This information is provided to make it possible for a HAL implementation to |
| * incrementally build up cryptographically authenticated data which includes the |
| * DeviceNameSpaces CBOR. |
| * |
| * @param requestNamespaces Namespaces and data items which will be requested. |
| */ |
| void setRequestedNamespaces(in RequestNamespace[] requestNamespaces); |
| |
| /** |
| * Sets the VerificationToken. This method must be called before startRetrieval() is |
| * called. This token uses the same challenge as returned by createAuthChallenge(). |
| * |
| * @param verificationToken |
| * The verification token. This token is only valid if the timestamp field is non-zero. |
| */ |
| void setVerificationToken(in VerificationToken verificationToken); |
| |
| /** |
| * Delete a credential. |
| * |
| * This method returns a COSE_Sign1 data structure signed by CredentialKey |
| * with payload set to the ProofOfDeletion CBOR below: |
| * |
| * ProofOfDeletion = [ |
| * "ProofOfDeletion", ; tstr |
| * tstr, ; DocType |
| * bstr, ; Challenge |
| * bool ; true if this is a test credential, should |
| * ; always be false. |
| * ] |
| * |
| * After this method has been called, the persistent storage used for credentialData should |
| * be deleted. |
| * |
| * This method was introduced in API version 3. |
| * |
| * @param challenge a challenge set by the issuer to ensure freshness. Maximum size is 32 bytes |
| * and it may be empty. Fails with STATUS_INVALID_DATA if bigger than 32 bytes. |
| * @return a COSE_Sign1 signature described above. |
| */ |
| byte[] deleteCredentialWithChallenge(in byte[] challenge); |
| |
| /** |
| * Prove ownership of credential. |
| * |
| * This method returns a COSE_Sign1 data structure signed by CredentialKey with payload |
| * set to the ProofOfOwnership CBOR below. |
| * |
| * ProofOfOwnership = [ |
| * "ProofOfOwnership", ; tstr |
| * tstr, ; DocType |
| * bstr, ; Challenge |
| * bool ; true if this is a test credential, should |
| * ; always be false. |
| * ] |
| * |
| * This method was introduced in API version 3. |
| * |
| * @param challenge a challenge set by the issuer to ensure freshness. Maximum size is 32 bytes |
| * and it may be empty. Fails with STATUS_INVALID_DATA if bigger than 32 bytes. |
| * @return a COSE_Sign1 signature described above. |
| */ |
| byte[] proveOwnership(in byte[] challenge); |
| |
| /** |
| * Called to start updating the credential with new data items. |
| * |
| * If the getAttestationCertificate() method is called on the returned object |
| * it fails with the error STATUS_FAILED. |
| * |
| * This method was introduced in API version 3. |
| * |
| * @return an IWritableIdentityCredential |
| */ |
| IWritableIdentityCredential updateCredential(); |
| } |