| /* |
| * Copyright (C) 2014 The Android Open Source Project |
| * |
| * Licensed under the Apache License, Version 2.0 (the "License"); |
| * you may not use this file except in compliance with the License. |
| * You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| */ |
| |
| package com.android.internal.telephony; |
| |
| import static android.content.pm.PackageManager.PERMISSION_GRANTED; |
| import static android.telephony.TelephonyManager.MULTISIM_ALLOWED; |
| import static android.telephony.TelephonyManager.SET_OPPORTUNISTIC_SUB_REMOTE_SERVICE_EXCEPTION; |
| import static android.telephony.UiccSlotInfo.CARD_STATE_INFO_PRESENT; |
| |
| import android.Manifest; |
| import android.annotation.NonNull; |
| import android.annotation.Nullable; |
| import android.app.AppOpsManager; |
| import android.app.PendingIntent; |
| import android.compat.annotation.UnsupportedAppUsage; |
| import android.content.ContentResolver; |
| import android.content.ContentValues; |
| import android.content.Context; |
| import android.content.Intent; |
| import android.database.Cursor; |
| import android.graphics.Bitmap; |
| import android.graphics.BitmapFactory; |
| import android.net.Uri; |
| import android.os.Binder; |
| import android.os.Build; |
| import android.os.Handler; |
| import android.os.ParcelUuid; |
| import android.os.RegistrantList; |
| import android.os.RemoteException; |
| import android.os.TelephonyServiceManager.ServiceRegisterer; |
| import android.os.UserHandle; |
| import android.provider.Settings; |
| import android.telecom.PhoneAccountHandle; |
| import android.telecom.TelecomManager; |
| import android.telephony.AnomalyReporter; |
| import android.telephony.CarrierConfigManager; |
| import android.telephony.RadioAccessFamily; |
| import android.telephony.SubscriptionInfo; |
| import android.telephony.SubscriptionManager; |
| import android.telephony.SubscriptionManager.SimDisplayNameSource; |
| import android.telephony.TelephonyFrameworkInitializer; |
| import android.telephony.TelephonyManager; |
| import android.telephony.TelephonyRegistryManager; |
| import android.telephony.UiccAccessRule; |
| import android.telephony.UiccSlotInfo; |
| import android.telephony.euicc.EuiccManager; |
| import android.text.TextUtils; |
| import android.util.LocalLog; |
| import android.util.Log; |
| |
| import com.android.internal.annotations.VisibleForTesting; |
| import com.android.internal.telephony.IccCardConstants.State; |
| import com.android.internal.telephony.dataconnection.DataEnabledOverride; |
| import com.android.internal.telephony.metrics.TelephonyMetrics; |
| import com.android.internal.telephony.uicc.IccUtils; |
| import com.android.internal.telephony.uicc.UiccCard; |
| import com.android.internal.telephony.uicc.UiccController; |
| import com.android.internal.telephony.uicc.UiccSlot; |
| import com.android.internal.telephony.util.ArrayUtils; |
| import com.android.internal.telephony.util.TelephonyUtils; |
| import com.android.telephony.Rlog; |
| |
| import java.io.FileDescriptor; |
| import java.io.PrintWriter; |
| import java.util.ArrayList; |
| import java.util.Arrays; |
| import java.util.Collections; |
| import java.util.Comparator; |
| import java.util.HashSet; |
| import java.util.List; |
| import java.util.Map; |
| import java.util.Map.Entry; |
| import java.util.Objects; |
| import java.util.Set; |
| import java.util.UUID; |
| import java.util.concurrent.ConcurrentHashMap; |
| import java.util.concurrent.atomic.AtomicBoolean; |
| import java.util.stream.Collectors; |
| |
| /** |
| * Implementation of the ISub interface. |
| * |
| * Any setters which take subId, slotIndex or phoneId as a parameter will throw an exception if the |
| * parameter equals the corresponding INVALID_XXX_ID or DEFAULT_XXX_ID. |
| * |
| * All getters will lookup the corresponding default if the parameter is DEFAULT_XXX_ID. Ie calling |
| * getPhoneId(DEFAULT_SUB_ID) will return the same as getPhoneId(getDefaultSubId()). |
| * |
| * Finally, any getters which perform the mapping between subscriptions, slots and phones will |
| * return the corresponding INVALID_XXX_ID if the parameter is INVALID_XXX_ID. All other getters |
| * will fail and return the appropriate error value. Ie calling |
| * getSlotIndex(INVALID_SUBSCRIPTION_ID) will return INVALID_SIM_SLOT_INDEX and calling |
| * getSubInfoForSubscriber(INVALID_SUBSCRIPTION_ID) will return null. |
| * |
| */ |
| public class SubscriptionController extends ISub.Stub { |
| private static final String LOG_TAG = "SubscriptionController"; |
| private static final boolean DBG = true; |
| private static final boolean VDBG = Rlog.isLoggable(LOG_TAG, Log.VERBOSE); |
| private static final boolean DBG_CACHE = false; |
| private static final int DEPRECATED_SETTING = -1; |
| private static final ParcelUuid INVALID_GROUP_UUID = |
| ParcelUuid.fromString(CarrierConfigManager.REMOVE_GROUP_UUID_STRING); |
| private final LocalLog mLocalLog = new LocalLog(200); |
| private static final int SUB_ID_FOUND = 1; |
| private static final int NO_ENTRY_FOR_SLOT_INDEX = -1; |
| private static final int SUB_ID_NOT_IN_SLOT = -2; |
| |
| // Lock that both mCacheActiveSubInfoList and mCacheOpportunisticSubInfoList use. |
| private Object mSubInfoListLock = new Object(); |
| |
| /* The Cache of Active SubInfoRecord(s) list of currently in use SubInfoRecord(s) */ |
| private final List<SubscriptionInfo> mCacheActiveSubInfoList = new ArrayList<>(); |
| |
| /* Similar to mCacheActiveSubInfoList but only caching opportunistic subscriptions. */ |
| private List<SubscriptionInfo> mCacheOpportunisticSubInfoList = new ArrayList<>(); |
| private AtomicBoolean mOpptSubInfoListChangedDirtyBit = new AtomicBoolean(); |
| |
| private static final Comparator<SubscriptionInfo> SUBSCRIPTION_INFO_COMPARATOR = |
| (arg0, arg1) -> { |
| // Primary sort key on SimSlotIndex |
| int flag = arg0.getSimSlotIndex() - arg1.getSimSlotIndex(); |
| if (flag == 0) { |
| // Secondary sort on SubscriptionId |
| return arg0.getSubscriptionId() - arg1.getSubscriptionId(); |
| } |
| return flag; |
| }; |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| protected final Object mLock = new Object(); |
| |
| /** The singleton instance. */ |
| protected static SubscriptionController sInstance = null; |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| protected Context mContext; |
| protected TelephonyManager mTelephonyManager; |
| protected UiccController mUiccController; |
| |
| private AppOpsManager mAppOps; |
| |
| // Allows test mocks to avoid SELinux failures on invalidate calls. |
| private static boolean sCachingEnabled = true; |
| |
| // Each slot can have multiple subs. |
| private static class WatchedSlotIndexToSubIds { |
| private Map<Integer, ArrayList<Integer>> mSlotIndexToSubIds = new ConcurrentHashMap<>(); |
| |
| WatchedSlotIndexToSubIds() { |
| } |
| |
| public void clear() { |
| mSlotIndexToSubIds.clear(); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| |
| public Set<Entry<Integer, ArrayList<Integer>>> entrySet() { |
| return mSlotIndexToSubIds.entrySet(); |
| } |
| |
| // Force all updates to data structure through wrapper. |
| public ArrayList<Integer> getCopy(int slotIndex) { |
| ArrayList<Integer> subIdList = mSlotIndexToSubIds.get(slotIndex); |
| if (subIdList == null) { |
| return null; |
| } |
| |
| return new ArrayList<Integer>(subIdList); |
| } |
| |
| public void put(int slotIndex, ArrayList<Integer> value) { |
| mSlotIndexToSubIds.put(slotIndex, value); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| |
| public void remove(int slotIndex) { |
| mSlotIndexToSubIds.remove(slotIndex); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| |
| public int size() { |
| return mSlotIndexToSubIds.size(); |
| } |
| |
| @VisibleForTesting |
| public Map<Integer, ArrayList<Integer>> getMap() { |
| return mSlotIndexToSubIds; |
| } |
| |
| public int removeFromSubIdList(int slotIndex, int subId) { |
| ArrayList<Integer> subIdList = mSlotIndexToSubIds.get(slotIndex); |
| if (subIdList == null) { |
| return NO_ENTRY_FOR_SLOT_INDEX; |
| } else { |
| if (subIdList.contains(subId)) { |
| subIdList.remove(new Integer(subId)); |
| if (subIdList.isEmpty()) { |
| mSlotIndexToSubIds.remove(slotIndex); |
| } |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| return SUB_ID_FOUND; |
| } else { |
| return SUB_ID_NOT_IN_SLOT; |
| } |
| } |
| } |
| |
| public void addToSubIdList(int slotIndex, Integer value) { |
| ArrayList<Integer> subIdList = mSlotIndexToSubIds.get(slotIndex); |
| if (subIdList == null) { |
| subIdList = new ArrayList<Integer>(); |
| subIdList.add(value); |
| mSlotIndexToSubIds.put(slotIndex, subIdList); |
| } else { |
| subIdList.add(value); |
| } |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| |
| public void clearSubIdList(int slotIndex) { |
| ArrayList<Integer> subIdList = mSlotIndexToSubIds.get(slotIndex); |
| if (subIdList != null) { |
| subIdList.clear(); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| } |
| } |
| |
| public static class WatchedInt { |
| private int mValue; |
| |
| public WatchedInt(int initialValue) { |
| mValue = initialValue; |
| } |
| |
| public int get() { |
| return mValue; |
| } |
| |
| public void set(int newValue) { |
| mValue = newValue; |
| } |
| } |
| |
| private static WatchedSlotIndexToSubIds sSlotIndexToSubIds = new WatchedSlotIndexToSubIds(); |
| |
| protected static WatchedInt sDefaultFallbackSubId = |
| new WatchedInt(SubscriptionManager.INVALID_SUBSCRIPTION_ID) { |
| @Override |
| public void set(int newValue) { |
| super.set(newValue); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } |
| }; |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private static int mDefaultPhoneId = SubscriptionManager.DEFAULT_PHONE_INDEX; |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private int[] colorArr; |
| private long mLastISubServiceRegTime; |
| private RegistrantList mUiccAppsEnableChangeRegList = new RegistrantList(); |
| |
| // The properties that should be shared and synced across grouped subscriptions. |
| private static final Set<String> GROUP_SHARING_PROPERTIES = new HashSet<>(Arrays.asList( |
| SubscriptionManager.ENHANCED_4G_MODE_ENABLED, |
| SubscriptionManager.VT_IMS_ENABLED, |
| SubscriptionManager.WFC_IMS_ENABLED, |
| SubscriptionManager.WFC_IMS_MODE, |
| SubscriptionManager.WFC_IMS_ROAMING_MODE, |
| SubscriptionManager.WFC_IMS_ROAMING_ENABLED, |
| SubscriptionManager.DATA_ROAMING, |
| SubscriptionManager.DISPLAY_NAME, |
| SubscriptionManager.DATA_ENABLED_OVERRIDE_RULES, |
| SubscriptionManager.UICC_APPLICATIONS_ENABLED, |
| SubscriptionManager.IMS_RCS_UCE_ENABLED)); |
| |
| public static SubscriptionController init(Context c) { |
| synchronized (SubscriptionController.class) { |
| if (sInstance == null) { |
| sInstance = new SubscriptionController(c); |
| } else { |
| Log.wtf(LOG_TAG, "init() called multiple times! sInstance = " + sInstance); |
| } |
| return sInstance; |
| } |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public static SubscriptionController getInstance() { |
| if (sInstance == null) { |
| Log.wtf(LOG_TAG, "getInstance null"); |
| } |
| |
| return sInstance; |
| } |
| |
| protected SubscriptionController(Context c) { |
| internalInit(c); |
| migrateImsSettings(); |
| } |
| |
| protected void internalInit(Context c) { |
| mContext = c; |
| mTelephonyManager = TelephonyManager.from(mContext); |
| |
| try { |
| mUiccController = UiccController.getInstance(); |
| } catch(RuntimeException ex) { |
| throw new RuntimeException( |
| "UiccController has to be initialised before SubscriptionController init"); |
| } |
| |
| mAppOps = (AppOpsManager)mContext.getSystemService(Context.APP_OPS_SERVICE); |
| |
| ServiceRegisterer subscriptionServiceRegisterer = TelephonyFrameworkInitializer |
| .getTelephonyServiceManager() |
| .getSubscriptionServiceRegisterer(); |
| if (subscriptionServiceRegisterer.get() == null) { |
| subscriptionServiceRegisterer.register(this); |
| mLastISubServiceRegTime = System.currentTimeMillis(); |
| } |
| |
| // clear SLOT_INDEX for all subs |
| clearSlotIndexForSubInfoRecords(); |
| |
| // Cache Setting values |
| cacheSettingValues(); |
| |
| // Initial invalidate activates caching. |
| invalidateDefaultSubIdCaches(); |
| invalidateDefaultDataSubIdCaches(); |
| invalidateDefaultSmsSubIdCaches(); |
| invalidateActiveDataSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| |
| if (DBG) logdl("[SubscriptionController] init by Context"); |
| } |
| |
| /** |
| * Should only be triggered once. |
| */ |
| public void notifySubInfoReady() { |
| // broadcast default subId. |
| sendDefaultChangedBroadcast(SubscriptionManager.getDefaultSubscriptionId()); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private boolean isSubInfoReady() { |
| return SubscriptionInfoUpdater.isSubInfoInitialized(); |
| } |
| |
| /** |
| * This function marks SIM_SLOT_INDEX as INVALID for all subscriptions in the database. This |
| * should be done as part of initialization. |
| * |
| * TODO: SIM_SLOT_INDEX is based on current state and should not even be persisted in the |
| * database. |
| */ |
| private void clearSlotIndexForSubInfoRecords() { |
| if (mContext == null) { |
| logel("[clearSlotIndexForSubInfoRecords] TelephonyManager or mContext is null"); |
| return; |
| } |
| |
| // Update all subscriptions in simInfo db with invalid slot index |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.SIM_SLOT_INDEX, SubscriptionManager.INVALID_SIM_SLOT_INDEX); |
| mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, value, null, null); |
| } |
| |
| /** |
| * Cache the Settings values by reading these values from Setting from disk to prevent disk I/O |
| * access during the API calling. This is based on an assumption that the Settings system will |
| * itself cache this value after the first read and thus only the first read after boot will |
| * access the disk. |
| */ |
| private void cacheSettingValues() { |
| Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_SMS_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| |
| Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_VOICE_CALL_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| |
| Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_DATA_CALL_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| protected void enforceModifyPhoneState(String message) { |
| mContext.enforceCallingOrSelfPermission( |
| android.Manifest.permission.MODIFY_PHONE_STATE, message); |
| } |
| |
| private void enforceReadPrivilegedPhoneState(String message) { |
| mContext.enforceCallingOrSelfPermission( |
| Manifest.permission.READ_PRIVILEGED_PHONE_STATE, message); |
| } |
| |
| /** |
| * Returns whether the {@code callingPackage} has access to subscriber identifiers on the |
| * specified {@code subId} using the provided {@code message} in any resulting |
| * SecurityException. |
| */ |
| private boolean hasSubscriberIdentifierAccess(int subId, String callingPackage, |
| String callingFeatureId, String message) { |
| try { |
| return TelephonyPermissions.checkCallingOrSelfReadSubscriberIdentifiers(mContext, subId, |
| callingPackage, callingFeatureId, message); |
| } catch (SecurityException e) { |
| // A SecurityException indicates that the calling package is targeting at least the |
| // minimum level that enforces identifier access restrictions and the new access |
| // requirements are not met. |
| return false; |
| } |
| } |
| |
| /** |
| * Returns whether the {@code callingPackage} has access to the phone number on the specified |
| * {@code subId} using the provided {@code message} in any resulting SecurityException. |
| */ |
| private boolean hasPhoneNumberAccess(int subId, String callingPackage, String callingFeatureId, |
| String message) { |
| try { |
| return TelephonyPermissions.checkCallingOrSelfReadPhoneNumber(mContext, subId, |
| callingPackage, callingFeatureId, message); |
| } catch (SecurityException e) { |
| return false; |
| } |
| } |
| |
| /** |
| * Broadcast when SubscriptionInfo has changed |
| * FIXME: Hopefully removed if the API council accepts SubscriptionInfoListener |
| */ |
| private void broadcastSimInfoContentChanged() { |
| Intent intent = new Intent(TelephonyIntents.ACTION_SUBINFO_CONTENT_CHANGE); |
| mContext.sendBroadcast(intent); |
| intent = new Intent(TelephonyIntents.ACTION_SUBINFO_RECORD_UPDATED); |
| mContext.sendBroadcast(intent); |
| } |
| |
| /** |
| * Notify the changed of subscription info. |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public void notifySubscriptionInfoChanged() { |
| TelephonyRegistryManager trm = |
| (TelephonyRegistryManager) |
| mContext.getSystemService(Context.TELEPHONY_REGISTRY_SERVICE); |
| if (DBG) logd("notifySubscriptionInfoChanged:"); |
| trm.notifySubscriptionInfoChanged(); |
| |
| // FIXME: Remove if listener technique accepted. |
| broadcastSimInfoContentChanged(); |
| |
| MultiSimSettingController.getInstance().notifySubscriptionInfoChanged(); |
| TelephonyMetrics metrics = TelephonyMetrics.getInstance(); |
| List<SubscriptionInfo> subInfos; |
| synchronized (mSubInfoListLock) { |
| subInfos = new ArrayList<>(mCacheActiveSubInfoList); |
| } |
| |
| if (mOpptSubInfoListChangedDirtyBit.getAndSet(false)) { |
| notifyOpportunisticSubscriptionInfoChanged(); |
| } |
| metrics.updateActiveSubscriptionInfoList(subInfos); |
| } |
| |
| /** |
| * New SubInfoRecord instance and fill in detail info |
| * @param cursor |
| * @return the query result of desired SubInfoRecord |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private SubscriptionInfo getSubInfoRecord(Cursor cursor) { |
| int id = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID)); |
| String iccId = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.ICC_ID)); |
| int simSlotIndex = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.SIM_SLOT_INDEX)); |
| String displayName = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.DISPLAY_NAME)); |
| String carrierName = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.CARRIER_NAME)); |
| int nameSource = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.NAME_SOURCE)); |
| int iconTint = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.HUE)); |
| String number = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.NUMBER)); |
| int dataRoaming = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.DATA_ROAMING)); |
| // Get the blank bitmap for this SubInfoRecord |
| Bitmap iconBitmap = BitmapFactory.decodeResource(mContext.getResources(), |
| com.android.internal.R.drawable.ic_sim_card_multi_24px_clr); |
| String mcc = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.MCC_STRING)); |
| String mnc = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.MNC_STRING)); |
| String ehplmnsRaw = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.EHPLMNS)); |
| String hplmnsRaw = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.HPLMNS)); |
| String[] ehplmns = ehplmnsRaw == null ? null : ehplmnsRaw.split(","); |
| String[] hplmns = hplmnsRaw == null ? null : hplmnsRaw.split(","); |
| |
| // cardId is the private ICCID/EID string, also known as the card string |
| String cardId = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.CARD_ID)); |
| String countryIso = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.ISO_COUNTRY_CODE)); |
| // publicCardId is the publicly exposed int card ID |
| int publicCardId = mUiccController.convertToPublicCardId(cardId); |
| boolean isEmbedded = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.IS_EMBEDDED)) == 1; |
| int carrierId = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.CARRIER_ID)); |
| UiccAccessRule[] accessRules; |
| if (isEmbedded) { |
| accessRules = UiccAccessRule.decodeRules(cursor.getBlob( |
| cursor.getColumnIndexOrThrow(SubscriptionManager.ACCESS_RULES))); |
| } else { |
| accessRules = null; |
| } |
| UiccAccessRule[] carrierConfigAccessRules = UiccAccessRule.decodeRules(cursor.getBlob( |
| cursor.getColumnIndexOrThrow(SubscriptionManager.ACCESS_RULES_FROM_CARRIER_CONFIGS))); |
| boolean isOpportunistic = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.IS_OPPORTUNISTIC)) == 1; |
| String groupUUID = cursor.getString(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.GROUP_UUID)); |
| int profileClass = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.PROFILE_CLASS)); |
| int subType = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.SUBSCRIPTION_TYPE)); |
| String groupOwner = getOptionalStringFromCursor(cursor, SubscriptionManager.GROUP_OWNER, |
| /*defaultVal*/ null); |
| boolean areUiccApplicationsEnabled = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.UICC_APPLICATIONS_ENABLED)) == 1; |
| |
| if (VDBG) { |
| String iccIdToPrint = SubscriptionInfo.givePrintableIccid(iccId); |
| String cardIdToPrint = SubscriptionInfo.givePrintableIccid(cardId); |
| logd("[getSubInfoRecord] id:" + id + " iccid:" + iccIdToPrint + " simSlotIndex:" |
| + simSlotIndex + " carrierid:" + carrierId + " displayName:" + displayName |
| + " nameSource:" + nameSource + " iconTint:" + iconTint |
| + " dataRoaming:" + dataRoaming + " mcc:" + mcc + " mnc:" + mnc |
| + " countIso:" + countryIso + " isEmbedded:" |
| + isEmbedded + " accessRules:" + Arrays.toString(accessRules) |
| + " carrierConfigAccessRules: " + Arrays.toString(carrierConfigAccessRules) |
| + " cardId:" + cardIdToPrint + " publicCardId:" + publicCardId |
| + " isOpportunistic:" + isOpportunistic + " groupUUID:" + groupUUID |
| + " profileClass:" + profileClass + " subscriptionType: " + subType |
| + " carrierConfigAccessRules:" + carrierConfigAccessRules |
| + " areUiccApplicationsEnabled: " + areUiccApplicationsEnabled); |
| } |
| |
| // If line1number has been set to a different number, use it instead. |
| String line1Number = mTelephonyManager.getLine1Number(id); |
| if (!TextUtils.isEmpty(line1Number) && !line1Number.equals(number)) { |
| number = line1Number; |
| } |
| SubscriptionInfo info = new SubscriptionInfo(id, iccId, simSlotIndex, displayName, |
| carrierName, nameSource, iconTint, number, dataRoaming, iconBitmap, mcc, mnc, |
| countryIso, isEmbedded, accessRules, cardId, publicCardId, isOpportunistic, |
| groupUUID, false /* isGroupDisabled */, carrierId, profileClass, subType, |
| groupOwner, carrierConfigAccessRules, areUiccApplicationsEnabled); |
| info.setAssociatedPlmns(ehplmns, hplmns); |
| return info; |
| } |
| |
| private String getOptionalStringFromCursor(Cursor cursor, String column, String defaultVal) { |
| // Return defaultVal if the column doesn't exist. |
| int columnIndex = cursor.getColumnIndex(column); |
| return (columnIndex == -1) ? defaultVal : cursor.getString(columnIndex); |
| } |
| |
| /** |
| * Get a subscription that matches IccId. |
| * @return null if there isn't a match, or subscription info if there is one. |
| */ |
| public SubscriptionInfo getSubInfoForIccId(String iccId) { |
| List<SubscriptionInfo> info = getSubInfo( |
| SubscriptionManager.ICC_ID + "=\'" + iccId + "\'", null); |
| if (info == null || info.size() == 0) return null; |
| // Should be at most one subscription with the iccid. |
| return info.get(0); |
| } |
| |
| /** |
| * Query SubInfoRecord(s) from subinfo database |
| * @param selection A filter declaring which rows to return |
| * @param queryKey query key content |
| * @return Array list of queried result from database |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public List<SubscriptionInfo> getSubInfo(String selection, Object queryKey) { |
| if (VDBG) logd("selection:" + selection + ", querykey: " + queryKey); |
| String[] selectionArgs = null; |
| if (queryKey != null) { |
| selectionArgs = new String[] {queryKey.toString()}; |
| } |
| ArrayList<SubscriptionInfo> subList = null; |
| Cursor cursor = mContext.getContentResolver().query(SubscriptionManager.CONTENT_URI, |
| null, selection, selectionArgs, null); |
| try { |
| if (cursor != null) { |
| while (cursor.moveToNext()) { |
| SubscriptionInfo subInfo = getSubInfoRecord(cursor); |
| if (subInfo != null) { |
| if (subList == null) { |
| subList = new ArrayList<SubscriptionInfo>(); |
| } |
| subList.add(subInfo); |
| } |
| } |
| } else { |
| if (DBG) logd("Query fail"); |
| } |
| } finally { |
| if (cursor != null) { |
| cursor.close(); |
| } |
| } |
| |
| return subList; |
| } |
| |
| /** |
| * Find unused color to be set for new SubInfoRecord |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return RGB integer value of color |
| */ |
| private int getUnusedColor(String callingPackage, String callingFeatureId) { |
| List<SubscriptionInfo> availableSubInfos = getActiveSubscriptionInfoList(callingPackage, |
| callingFeatureId); |
| colorArr = mContext.getResources().getIntArray(com.android.internal.R.array.sim_colors); |
| int colorIdx = 0; |
| |
| if (availableSubInfos != null) { |
| for (int i = 0; i < colorArr.length; i++) { |
| int j; |
| for (j = 0; j < availableSubInfos.size(); j++) { |
| if (colorArr[i] == availableSubInfos.get(j).getIconTint()) { |
| break; |
| } |
| } |
| if (j == availableSubInfos.size()) { |
| return colorArr[i]; |
| } |
| } |
| colorIdx = availableSubInfos.size() % colorArr.length; |
| } |
| return colorArr[colorIdx]; |
| } |
| |
| @Deprecated |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public SubscriptionInfo getActiveSubscriptionInfo(int subId, String callingPackage) { |
| return getActiveSubscriptionInfo(subId, callingPackage, null); |
| } |
| |
| /** |
| * Get the active SubscriptionInfo with the subId key |
| * @param subId The unique SubscriptionInfo key in database |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return SubscriptionInfo, maybe null if its not active |
| */ |
| @Override |
| public SubscriptionInfo getActiveSubscriptionInfo(int subId, String callingPackage, |
| String callingFeatureId) { |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState(mContext, subId, callingPackage, |
| callingFeatureId, "getActiveSubscriptionInfo")) { |
| return null; |
| } |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| List<SubscriptionInfo> subList; |
| try { |
| subList = getActiveSubscriptionInfoList( |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| if (subList != null) { |
| for (SubscriptionInfo si : subList) { |
| if (si.getSubscriptionId() == subId) { |
| if (VDBG) { |
| logd("[getActiveSubscriptionInfo]+ subId=" + subId + " subInfo=" + si); |
| } |
| return conditionallyRemoveIdentifiers(si, callingPackage, callingFeatureId, |
| "getActiveSubscriptionInfo"); |
| } |
| } |
| } |
| if (DBG) { |
| logd("[getActiveSubscriptionInfo]- subId=" + subId |
| + " subList=" + subList + " subInfo=null"); |
| } |
| |
| return null; |
| } |
| |
| /** |
| * Get a single subscription info record for a given subscription. |
| * |
| * @param subId the subId to query. |
| * |
| * @hide |
| */ |
| public SubscriptionInfo getSubscriptionInfo(int subId) { |
| synchronized (mSubInfoListLock) { |
| // check cache for active subscriptions first, before querying db |
| for (SubscriptionInfo subInfo : mCacheActiveSubInfoList) { |
| if (subInfo.getSubscriptionId() == subId) { |
| return subInfo; |
| } |
| } |
| // check cache for opportunistic subscriptions too, before querying db |
| for (SubscriptionInfo subInfo : mCacheOpportunisticSubInfoList) { |
| if (subInfo.getSubscriptionId() == subId) { |
| return subInfo; |
| } |
| } |
| } |
| |
| List<SubscriptionInfo> subInfoList = getSubInfo( |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=" + subId, null); |
| if (subInfoList == null || subInfoList.isEmpty()) return null; |
| return subInfoList.get(0); |
| } |
| |
| /** |
| * Get the active SubscriptionInfo associated with the iccId |
| * @param iccId the IccId of SIM card |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return SubscriptionInfo, maybe null if its not active |
| */ |
| @Override |
| public SubscriptionInfo getActiveSubscriptionInfoForIccId(String iccId, String callingPackage, |
| String callingFeatureId) { |
| enforceReadPrivilegedPhoneState("getActiveSubscriptionInfoForIccId"); |
| return getActiveSubscriptionInfoForIccIdInternal(iccId); |
| } |
| |
| /** |
| * Get the active SubscriptionInfo associated with the given iccId. The caller *must* perform |
| * permission checks when using this method. |
| */ |
| private SubscriptionInfo getActiveSubscriptionInfoForIccIdInternal(String iccId) { |
| if (iccId == null) { |
| return null; |
| } |
| |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| List<SubscriptionInfo> subList = getActiveSubscriptionInfoList( |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| if (subList != null) { |
| for (SubscriptionInfo si : subList) { |
| if (iccId.equals(si.getIccId())) { |
| if (DBG) |
| logd("[getActiveSubInfoUsingIccId]+ iccId=" + iccId + " subInfo=" + si); |
| return si; |
| } |
| } |
| } |
| if (DBG) { |
| logd("[getActiveSubInfoUsingIccId]+ iccId=" + iccId |
| + " subList=" + subList + " subInfo=null"); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| |
| return null; |
| } |
| |
| /** |
| * Get the active SubscriptionInfo associated with the slotIndex. |
| * This API does not return details on Remote-SIM subscriptions. |
| * @param slotIndex the slot which the subscription is inserted |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return SubscriptionInfo, null for Remote-SIMs or non-active slotIndex. |
| */ |
| @Override |
| public SubscriptionInfo getActiveSubscriptionInfoForSimSlotIndex(int slotIndex, |
| String callingPackage, String callingFeatureId) { |
| Phone phone = PhoneFactory.getPhone(slotIndex); |
| if (phone == null) { |
| if (DBG) { |
| loge("[getActiveSubscriptionInfoForSimSlotIndex] no phone, slotIndex=" + slotIndex); |
| } |
| return null; |
| } |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState( |
| mContext, phone.getSubId(), callingPackage, callingFeatureId, |
| "getActiveSubscriptionInfoForSimSlotIndex")) { |
| return null; |
| } |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| List<SubscriptionInfo> subList; |
| try { |
| subList = getActiveSubscriptionInfoList( |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| if (subList != null) { |
| for (SubscriptionInfo si : subList) { |
| if (si.getSimSlotIndex() == slotIndex) { |
| if (DBG) { |
| logd("[getActiveSubscriptionInfoForSimSlotIndex]+ slotIndex=" |
| + slotIndex + " subId=" + si); |
| } |
| return conditionallyRemoveIdentifiers(si, callingPackage, callingFeatureId, |
| "getActiveSubscriptionInfoForSimSlotIndex"); |
| } |
| } |
| if (DBG) { |
| logd("[getActiveSubscriptionInfoForSimSlotIndex]+ slotIndex=" + slotIndex |
| + " subId=null"); |
| } |
| } else { |
| if (DBG) { |
| logd("[getActiveSubscriptionInfoForSimSlotIndex]+ subList=null"); |
| } |
| } |
| |
| |
| return null; |
| } |
| |
| /** |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return List of all SubscriptionInfo records in database, |
| * include those that were inserted before, maybe empty but not null. |
| * @hide |
| */ |
| @Override |
| public List<SubscriptionInfo> getAllSubInfoList(String callingPackage, |
| String callingFeatureId) { |
| if (VDBG) logd("[getAllSubInfoList]+"); |
| |
| // This API isn't public, so no need to provide a valid subscription ID - we're not worried |
| // about carrier-privileged callers not having access. |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState( |
| mContext, SubscriptionManager.INVALID_SUBSCRIPTION_ID, callingPackage, |
| callingFeatureId, "getAllSubInfoList")) { |
| return null; |
| } |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| List<SubscriptionInfo> subList = null; |
| subList = getSubInfo(null, null); |
| if (subList != null) { |
| if (VDBG) logd("[getAllSubInfoList]- " + subList.size() + " infos return"); |
| } else { |
| if (VDBG) logd("[getAllSubInfoList]- no info return"); |
| } |
| return subList; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| private List<SubscriptionInfo> makeCacheListCopyWithLock(List<SubscriptionInfo> cacheSubList) { |
| synchronized (mSubInfoListLock) { |
| return new ArrayList<>(cacheSubList); |
| } |
| } |
| |
| @Deprecated |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public List<SubscriptionInfo> getActiveSubscriptionInfoList(String callingPackage) { |
| return getSubscriptionInfoListFromCacheHelper(callingPackage, null, |
| makeCacheListCopyWithLock(mCacheActiveSubInfoList)); |
| } |
| |
| /** |
| * Get the SubInfoRecord(s) of the currently active SIM(s) - which include both local |
| * and remote SIMs. |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return Array list of currently inserted SubInfoRecord(s) |
| */ |
| @Override |
| public List<SubscriptionInfo> getActiveSubscriptionInfoList(String callingPackage, |
| String callingFeatureId) { |
| return getSubscriptionInfoListFromCacheHelper(callingPackage, callingFeatureId, |
| makeCacheListCopyWithLock(mCacheActiveSubInfoList)); |
| } |
| |
| /** |
| * Refresh the cache of SubInfoRecord(s) of the currently available SIM(s) - including |
| * local & remote SIMs. |
| */ |
| @VisibleForTesting // For mockito to mock this method |
| public void refreshCachedActiveSubscriptionInfoList() { |
| boolean opptSubListChanged; |
| |
| List<SubscriptionInfo> activeSubscriptionInfoList = getSubInfo( |
| SubscriptionManager.SIM_SLOT_INDEX + ">=0 OR " |
| + SubscriptionManager.SUBSCRIPTION_TYPE + "=" |
| + SubscriptionManager.SUBSCRIPTION_TYPE_REMOTE_SIM, |
| null); |
| |
| synchronized (mSubInfoListLock) { |
| if (activeSubscriptionInfoList != null) { |
| // Log when active sub info changes. |
| if (mCacheActiveSubInfoList.size() != activeSubscriptionInfoList.size() |
| || !mCacheActiveSubInfoList.containsAll(activeSubscriptionInfoList)) { |
| logdl("Active subscription info list changed. " + activeSubscriptionInfoList); |
| } |
| |
| mCacheActiveSubInfoList.clear(); |
| activeSubscriptionInfoList.sort(SUBSCRIPTION_INFO_COMPARATOR); |
| mCacheActiveSubInfoList.addAll(activeSubscriptionInfoList); |
| } else { |
| logd("activeSubscriptionInfoList is null."); |
| mCacheActiveSubInfoList.clear(); |
| } |
| if (DBG_CACHE) { |
| if (!mCacheActiveSubInfoList.isEmpty()) { |
| for (SubscriptionInfo si : mCacheActiveSubInfoList) { |
| logd("[refreshCachedActiveSubscriptionInfoList] Setting Cached info=" |
| + si); |
| } |
| } else { |
| logdl("[refreshCachedActiveSubscriptionInfoList]- no info return"); |
| } |
| } |
| } |
| |
| // Refresh cached opportunistic sub list and detect whether it's changed. |
| refreshCachedOpportunisticSubscriptionInfoList(); |
| } |
| |
| @Deprecated |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public int getActiveSubInfoCount(String callingPackage) { |
| return getActiveSubInfoCount(callingPackage, null); |
| } |
| |
| /** |
| * Get the SUB count of active SUB(s) |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package. |
| * @return active SIM count |
| */ |
| @Override |
| public int getActiveSubInfoCount(String callingPackage, String callingFeatureId) { |
| // Let getActiveSubscriptionInfoList perform permission checks / filtering. |
| List<SubscriptionInfo> records = getActiveSubscriptionInfoList(callingPackage, |
| callingFeatureId); |
| if (records == null) { |
| if (VDBG) logd("[getActiveSubInfoCount] records null"); |
| return 0; |
| } |
| if (VDBG) logd("[getActiveSubInfoCount]- count: " + records.size()); |
| return records.size(); |
| } |
| |
| /** |
| * Get the SUB count of all SUB(s) in SubscriptoinInfo database |
| * @param callingPackage The package making the IPC. |
| * @param callingFeatureId The feature in the package |
| * @return all SIM count in database, include what was inserted before |
| */ |
| @Override |
| public int getAllSubInfoCount(String callingPackage, String callingFeatureId) { |
| if (DBG) logd("[getAllSubInfoCount]+"); |
| |
| // This API isn't public, so no need to provide a valid subscription ID - we're not worried |
| // about carrier-privileged callers not having access. |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState( |
| mContext, SubscriptionManager.INVALID_SUBSCRIPTION_ID, callingPackage, |
| callingFeatureId, "getAllSubInfoCount")) { |
| return 0; |
| } |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| Cursor cursor = mContext.getContentResolver().query(SubscriptionManager.CONTENT_URI, |
| null, null, null, null); |
| try { |
| if (cursor != null) { |
| int count = cursor.getCount(); |
| if (DBG) logd("[getAllSubInfoCount]- " + count + " SUB(s) in DB"); |
| return count; |
| } |
| } finally { |
| if (cursor != null) { |
| cursor.close(); |
| } |
| } |
| if (DBG) logd("[getAllSubInfoCount]- no SUB in DB"); |
| |
| return 0; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * @return the maximum number of local subscriptions this device will support at any one time. |
| */ |
| @Override |
| public int getActiveSubInfoCountMax() { |
| // FIXME: This valid now but change to use TelephonyDevController in the future |
| return mTelephonyManager.getSimCount(); |
| } |
| |
| @Override |
| public List<SubscriptionInfo> getAvailableSubscriptionInfoList(String callingPackage, |
| String callingFeatureId) { |
| // This API isn't public, so no need to provide a valid subscription ID - we're not worried |
| // about carrier-privileged callers not having access. |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState( |
| mContext, SubscriptionManager.INVALID_SUBSCRIPTION_ID, callingPackage, |
| callingFeatureId, "getAvailableSubscriptionInfoList")) { |
| throw new SecurityException("Need READ_PHONE_STATE to call " |
| + " getAvailableSubscriptionInfoList"); |
| } |
| |
| // Now that all security checks pass, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| String selection = SubscriptionManager.SIM_SLOT_INDEX + ">=0 OR " |
| + SubscriptionManager.SUBSCRIPTION_TYPE + "=" |
| + SubscriptionManager.SUBSCRIPTION_TYPE_REMOTE_SIM; |
| |
| EuiccManager euiccManager = |
| (EuiccManager) mContext.getSystemService(Context.EUICC_SERVICE); |
| if (euiccManager.isEnabled()) { |
| selection += " OR " + SubscriptionManager.IS_EMBEDDED + "=1"; |
| } |
| |
| // Available eSIM profiles are reported by EuiccManager. However for physical SIMs if |
| // they are in inactive slot or programmatically disabled, they are still considered |
| // available. In this case we get their iccid from slot info and include their |
| // subscriptionInfos. |
| List<String> iccIds = getIccIdsOfInsertedPhysicalSims(); |
| |
| if (!iccIds.isEmpty()) { |
| selection += " OR (" + getSelectionForIccIdList(iccIds.toArray(new String[0])) |
| + ")"; |
| } |
| |
| List<SubscriptionInfo> subList = getSubInfo(selection, null /* queryKey */); |
| |
| if (subList != null) { |
| subList.sort(SUBSCRIPTION_INFO_COMPARATOR); |
| |
| if (VDBG) logdl("[getAvailableSubInfoList]- " + subList.size() + " infos return"); |
| } else { |
| if (DBG) logdl("[getAvailableSubInfoList]- no info return"); |
| } |
| |
| return subList; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| private List<String> getIccIdsOfInsertedPhysicalSims() { |
| List<String> ret = new ArrayList<>(); |
| UiccSlot[] uiccSlots = UiccController.getInstance().getUiccSlots(); |
| if (uiccSlots == null) return ret; |
| |
| for (UiccSlot uiccSlot : uiccSlots) { |
| if (uiccSlot != null && uiccSlot.getCardState() != null |
| && uiccSlot.getCardState().isCardPresent() |
| && !uiccSlot.isEuicc() |
| && !TextUtils.isEmpty(uiccSlot.getIccId())) { |
| ret.add(IccUtils.stripTrailingFs(uiccSlot.getIccId())); |
| } |
| } |
| |
| return ret; |
| } |
| |
| @Override |
| public List<SubscriptionInfo> getAccessibleSubscriptionInfoList(String callingPackage) { |
| EuiccManager euiccManager = (EuiccManager) mContext.getSystemService(Context.EUICC_SERVICE); |
| if (!euiccManager.isEnabled()) { |
| if (DBG) { |
| logdl("[getAccessibleSubInfoList] Embedded subscriptions are disabled"); |
| } |
| return null; |
| } |
| |
| // Verify that the given package belongs to the calling UID. |
| mAppOps.checkPackage(Binder.getCallingUid(), callingPackage); |
| |
| // Perform the operation as ourselves. If the caller cannot read phone state, they may still |
| // have carrier privileges per the subscription metadata, so we always need to make the |
| // query and then filter the results. |
| final long identity = Binder.clearCallingIdentity(); |
| List<SubscriptionInfo> subList; |
| try { |
| subList = getSubInfo(SubscriptionManager.IS_EMBEDDED + "=1", null); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| |
| if (subList == null) { |
| if (DBG) logdl("[getAccessibleSubInfoList] No info returned"); |
| return null; |
| } |
| |
| // Filter the list to only include subscriptions which the (restored) caller can manage. |
| List<SubscriptionInfo> filteredList = subList.stream() |
| .filter(subscriptionInfo -> |
| subscriptionInfo.canManageSubscription(mContext, callingPackage)) |
| .sorted(SUBSCRIPTION_INFO_COMPARATOR) |
| .collect(Collectors.toList()); |
| if (VDBG) { |
| logdl("[getAccessibleSubInfoList] " + filteredList.size() + " infos returned"); |
| } |
| return filteredList; |
| } |
| |
| /** |
| * Return the list of subscriptions in the database which are either: |
| * <ul> |
| * <li>Embedded (but see note about {@code includeNonRemovableSubscriptions}, or |
| * <li>In the given list of current embedded ICCIDs (which may not yet be in the database, or |
| * which may not currently be marked as embedded). |
| * </ul> |
| * |
| * <p>NOTE: This is not accessible to external processes, so it does not need a permission |
| * check. It is only intended for use by {@link SubscriptionInfoUpdater}. |
| * |
| * @param embeddedIccids all ICCIDs of available embedded subscriptions. This is used to surface |
| * entries for profiles which had been previously deleted. |
| * @param isEuiccRemovable whether the current ICCID is removable. Non-removable subscriptions |
| * will only be returned if the current ICCID is not removable; otherwise, they are left |
| * alone (not returned here unless in the embeddedIccids list) under the assumption that |
| * they will still be accessible when the eUICC containing them is activated. |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PACKAGE) |
| public List<SubscriptionInfo> getSubscriptionInfoListForEmbeddedSubscriptionUpdate( |
| String[] embeddedIccids, boolean isEuiccRemovable) { |
| StringBuilder whereClause = new StringBuilder(); |
| whereClause.append("(").append(SubscriptionManager.IS_EMBEDDED).append("=1"); |
| if (isEuiccRemovable) { |
| // Current eUICC is removable, so don't return non-removable subscriptions (which would |
| // be deleted), as these are expected to still be present on a different, non-removable |
| // eUICC. |
| whereClause.append(" AND ").append(SubscriptionManager.IS_REMOVABLE).append("=1"); |
| } |
| // Else, return both removable and non-removable subscriptions. This is expected to delete |
| // all removable subscriptions, which is desired as they may not be accessible. |
| |
| whereClause.append(") OR ").append(SubscriptionManager.ICC_ID).append(" IN ("); |
| // ICCIDs are validated to contain only numbers when passed in, and come from a trusted |
| // app, so no need to escape. |
| for (int i = 0; i < embeddedIccids.length; i++) { |
| if (i > 0) { |
| whereClause.append(","); |
| } |
| whereClause.append("\"").append(embeddedIccids[i]).append("\""); |
| } |
| whereClause.append(")"); |
| |
| List<SubscriptionInfo> list = getSubInfo(whereClause.toString(), null); |
| if (list == null) { |
| return Collections.emptyList(); |
| } |
| return list; |
| } |
| |
| @Override |
| public void requestEmbeddedSubscriptionInfoListRefresh(int cardId) { |
| mContext.enforceCallingOrSelfPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS, |
| "requestEmbeddedSubscriptionInfoListRefresh"); |
| long token = Binder.clearCallingIdentity(); |
| try { |
| PhoneFactory.requestEmbeddedSubscriptionInfoListRefresh(cardId, null /* callback */); |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| /** |
| * Asynchronously refresh the embedded subscription info list for the embedded card has the |
| * given card id {@code cardId}. |
| * |
| * @param callback Optional callback to execute after the refresh completes. Must terminate |
| * quickly as it will be called from SubscriptionInfoUpdater's handler thread. |
| */ |
| // No permission check needed as this is not exposed via AIDL. |
| public void requestEmbeddedSubscriptionInfoListRefresh( |
| int cardId, @Nullable Runnable callback) { |
| PhoneFactory.requestEmbeddedSubscriptionInfoListRefresh(cardId, callback); |
| } |
| |
| /** |
| * Asynchronously refresh the embedded subscription info list for the embedded card has the |
| * default card id return by {@link TelephonyManager#getCardIdForDefaultEuicc()}. |
| * |
| * @param callback Optional callback to execute after the refresh completes. Must terminate |
| * quickly as it will be called from SubscriptionInfoUpdater's handler thread. |
| */ |
| // No permission check needed as this is not exposed via AIDL. |
| public void requestEmbeddedSubscriptionInfoListRefresh(@Nullable Runnable callback) { |
| PhoneFactory.requestEmbeddedSubscriptionInfoListRefresh( |
| mTelephonyManager.getCardIdForDefaultEuicc(), callback); |
| } |
| |
| /** |
| * Add a new SubInfoRecord to subinfo database if needed |
| * @param iccId the IccId of the SIM card |
| * @param slotIndex the slot which the SIM is inserted |
| * @return 0 if success, < 0 on error. |
| */ |
| @Override |
| public int addSubInfoRecord(String iccId, int slotIndex) { |
| return addSubInfo(iccId, null, slotIndex, SubscriptionManager.SUBSCRIPTION_TYPE_LOCAL_SIM); |
| } |
| |
| /** |
| * Add a new subscription info record, if needed. |
| * @param uniqueId This is the unique identifier for the subscription within the specific |
| * subscription type. |
| * @param displayName human-readable name of the device the subscription corresponds to. |
| * @param slotIndex value for {@link SubscriptionManager#SIM_SLOT_INDEX} |
| * @param subscriptionType the type of subscription to be added. |
| * @return 0 if success, < 0 on error. |
| */ |
| @Override |
| public int addSubInfo(String uniqueId, String displayName, int slotIndex, |
| int subscriptionType) { |
| if (DBG) { |
| String iccIdStr = uniqueId; |
| if (!isSubscriptionForRemoteSim(subscriptionType)) { |
| iccIdStr = SubscriptionInfo.givePrintableIccid(uniqueId); |
| } |
| logdl("[addSubInfoRecord]+ iccid: " + iccIdStr |
| + ", slotIndex: " + slotIndex |
| + ", subscriptionType: " + subscriptionType); |
| } |
| |
| enforceModifyPhoneState("addSubInfo"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| if (uniqueId == null) { |
| if (DBG) logdl("[addSubInfo]- null iccId"); |
| return -1; |
| } |
| |
| ContentResolver resolver = mContext.getContentResolver(); |
| String selection = SubscriptionManager.ICC_ID + "=?"; |
| String[] args; |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| selection += " AND " + SubscriptionManager.SUBSCRIPTION_TYPE + "=?"; |
| args = new String[]{uniqueId, Integer.toString(subscriptionType)}; |
| } else { |
| selection += " OR " + SubscriptionManager.ICC_ID + "=?"; |
| args = new String[]{uniqueId, IccUtils.getDecimalSubstring(uniqueId)}; |
| } |
| Cursor cursor = resolver.query(SubscriptionManager.CONTENT_URI, |
| new String[]{SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID, |
| SubscriptionManager.SIM_SLOT_INDEX, SubscriptionManager.NAME_SOURCE, |
| SubscriptionManager.ICC_ID, SubscriptionManager.CARD_ID}, |
| selection, args, null); |
| |
| boolean setDisplayName = false; |
| try { |
| boolean recordsDoNotExist = (cursor == null || !cursor.moveToFirst()); |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| if (recordsDoNotExist) { |
| // create a Subscription record |
| slotIndex = SubscriptionManager.SLOT_INDEX_FOR_REMOTE_SIM_SUB; |
| Uri uri = insertEmptySubInfoRecord(uniqueId, displayName, |
| slotIndex, subscriptionType); |
| if (DBG) logd("[addSubInfoRecord] New record created: " + uri); |
| } else { |
| if (DBG) logdl("[addSubInfoRecord] Record already exists"); |
| } |
| } else { // Handle Local SIM devices |
| if (recordsDoNotExist) { |
| setDisplayName = true; |
| Uri uri = insertEmptySubInfoRecord(uniqueId, slotIndex); |
| if (DBG) logdl("[addSubInfoRecord] New record created: " + uri); |
| } else { // there are matching records in the database for the given ICC_ID |
| int subId = cursor.getInt(0); |
| int oldSimInfoId = cursor.getInt(1); |
| int nameSource = cursor.getInt(2); |
| String oldIccId = cursor.getString(3); |
| String oldCardId = cursor.getString(4); |
| ContentValues value = new ContentValues(); |
| |
| if (slotIndex != oldSimInfoId) { |
| value.put(SubscriptionManager.SIM_SLOT_INDEX, slotIndex); |
| } |
| |
| if (oldIccId != null && oldIccId.length() < uniqueId.length() |
| && (oldIccId.equals(IccUtils.getDecimalSubstring(uniqueId)))) { |
| value.put(SubscriptionManager.ICC_ID, uniqueId); |
| } |
| |
| UiccCard card = mUiccController.getUiccCardForPhone(slotIndex); |
| if (card != null) { |
| String cardId = card.getCardId(); |
| if (cardId != null && cardId != oldCardId) { |
| value.put(SubscriptionManager.CARD_ID, cardId); |
| } |
| } |
| |
| if (value.size() > 0) { |
| resolver.update(SubscriptionManager.getUriForSubscriptionId(subId), |
| value, null, null); |
| } |
| |
| if (DBG) logdl("[addSubInfoRecord] Record already exists"); |
| } |
| } |
| } finally { |
| if (cursor != null) { |
| cursor.close(); |
| } |
| } |
| |
| selection = SubscriptionManager.SIM_SLOT_INDEX + "=?"; |
| args = new String[] {String.valueOf(slotIndex)}; |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| selection = SubscriptionManager.ICC_ID + "=? AND " |
| + SubscriptionManager.SUBSCRIPTION_TYPE + "=?"; |
| args = new String[]{uniqueId, Integer.toString(subscriptionType)}; |
| } |
| cursor = resolver.query(SubscriptionManager.CONTENT_URI, null, |
| selection, args, null); |
| try { |
| if (cursor != null && cursor.moveToFirst()) { |
| do { |
| int subId = cursor.getInt(cursor.getColumnIndexOrThrow( |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID)); |
| // If sSlotIndexToSubIds already has the same subId for a slotIndex/phoneId, |
| // do not add it. |
| if (addToSubIdList(slotIndex, subId, subscriptionType)) { |
| // TODO While two subs active, if user deactivats first |
| // one, need to update the default subId with second one. |
| |
| // FIXME: Currently we assume phoneId == slotIndex which in the future |
| // may not be true, for instance with multiple subs per slot. |
| // But is true at the moment. |
| int subIdCountMax = getActiveSubInfoCountMax(); |
| int defaultSubId = getDefaultSubId(); |
| if (DBG) { |
| logdl("[addSubInfoRecord]" |
| + " sSlotIndexToSubIds.size=" + sSlotIndexToSubIds.size() |
| + " slotIndex=" + slotIndex + " subId=" + subId |
| + " defaultSubId=" + defaultSubId |
| + " simCount=" + subIdCountMax); |
| } |
| |
| // Set the default sub if not set or if single sim device |
| if (!isSubscriptionForRemoteSim(subscriptionType)) { |
| if (!SubscriptionManager.isValidSubscriptionId(defaultSubId) |
| || subIdCountMax == 1) { |
| logdl("setting default fallback subid to " + subId); |
| setDefaultFallbackSubId(subId, subscriptionType); |
| } |
| // If single sim device, set this subscription as the default for |
| // everything |
| if (subIdCountMax == 1) { |
| if (DBG) { |
| logdl("[addSubInfoRecord] one sim set defaults to subId=" |
| + subId); |
| } |
| setDefaultDataSubId(subId); |
| setDefaultSmsSubId(subId); |
| setDefaultVoiceSubId(subId); |
| } |
| } else { |
| updateDefaultSubIdsIfNeeded(subId, subscriptionType); |
| } |
| } else { |
| if (DBG) { |
| logdl("[addSubInfoRecord] current SubId is already known, " |
| + "IGNORE"); |
| } |
| } |
| if (DBG) { |
| logdl("[addSubInfoRecord] hashmap(" + slotIndex + "," + subId + ")"); |
| } |
| } while (cursor.moveToNext()); |
| } |
| } finally { |
| if (cursor != null) { |
| cursor.close(); |
| } |
| } |
| |
| // Refresh the Cache of Active Subscription Info List. This should be done after |
| // updating sSlotIndexToSubIds which is done through addToSubIdList() above. |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| notifySubscriptionInfoChanged(); |
| } else { // Handle Local SIM devices |
| // Set Display name after sub id is set above so as to get valid simCarrierName |
| int subId = getSubIdUsingPhoneId(slotIndex); |
| if (!SubscriptionManager.isValidSubscriptionId(subId)) { |
| if (DBG) { |
| logdl("[addSubInfoRecord]- getSubId failed invalid subId = " + subId); |
| } |
| return -1; |
| } |
| if (setDisplayName) { |
| String simCarrierName = mTelephonyManager.getSimOperatorName(subId); |
| String nameToSet; |
| |
| if (!TextUtils.isEmpty(simCarrierName)) { |
| nameToSet = simCarrierName; |
| } else { |
| nameToSet = "CARD " + Integer.toString(slotIndex + 1); |
| } |
| |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.DISPLAY_NAME, nameToSet); |
| resolver.update(SubscriptionManager.getUriForSubscriptionId(subId), value, |
| null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| if (DBG) logdl("[addSubInfoRecord] sim name = " + nameToSet); |
| } |
| |
| if (DBG) logdl("[addSubInfoRecord]- info size=" + sSlotIndexToSubIds.size()); |
| } |
| |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| return 0; |
| } |
| |
| private void updateDefaultSubIdsIfNeeded(int newDefault, int subscriptionType) { |
| if (DBG) { |
| logdl("[updateDefaultSubIdsIfNeeded] newDefault=" + newDefault |
| + ", subscriptionType=" + subscriptionType); |
| } |
| // Set the default ot new value only if the current default is invalid. |
| if (!isActiveSubscriptionId(getDefaultSubId())) { |
| // current default is not valid anylonger. set a new default |
| if (DBG) { |
| logdl("[updateDefaultSubIdsIfNeeded] set sDefaultFallbackSubId=" + newDefault); |
| } |
| setDefaultFallbackSubId(newDefault, subscriptionType); |
| } |
| |
| int value = getDefaultSmsSubId(); |
| if (!isActiveSubscriptionId(value)) { |
| // current default is not valid. set it to the given newDefault value |
| setDefaultSmsSubId(newDefault); |
| } |
| value = getDefaultDataSubId(); |
| if (!isActiveSubscriptionId(value)) { |
| setDefaultDataSubId(newDefault); |
| } |
| value = getDefaultVoiceSubId(); |
| if (!isActiveSubscriptionId(value)) { |
| setDefaultVoiceSubId(newDefault); |
| } |
| } |
| |
| /** |
| * This method returns true if the given subId is among the list of currently active |
| * subscriptions. |
| */ |
| private boolean isActiveSubscriptionId(int subId) { |
| if (!SubscriptionManager.isValidSubscriptionId(subId)) return false; |
| ArrayList<Integer> subIdList = getActiveSubIdArrayList(); |
| if (subIdList.isEmpty()) return false; |
| return subIdList.contains(new Integer(subId)); |
| } |
| |
| /* |
| * Delete subscription info record for the given device. |
| * @param uniqueId This is the unique identifier for the subscription within the specific |
| * subscription type. |
| * @param subscriptionType the type of subscription to be removed |
| * @return 0 if success, < 0 on error. |
| */ |
| @Override |
| public int removeSubInfo(String uniqueId, int subscriptionType) { |
| enforceModifyPhoneState("removeSubInfo"); |
| if (DBG) { |
| logd("[removeSubInfo] uniqueId: " + uniqueId |
| + ", subscriptionType: " + subscriptionType); |
| } |
| |
| // validate the given info - does it exist in the active subscription list |
| int subId = SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| int slotIndex = SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| synchronized (mSubInfoListLock) { |
| for (SubscriptionInfo info : mCacheActiveSubInfoList) { |
| if ((info.getSubscriptionType() == subscriptionType) |
| && info.getIccId().equalsIgnoreCase(uniqueId)) { |
| subId = info.getSubscriptionId(); |
| slotIndex = info.getSimSlotIndex(); |
| break; |
| } |
| } |
| } |
| if (subId == SubscriptionManager.INVALID_SUBSCRIPTION_ID) { |
| if (DBG) { |
| logd("Invalid subscription details: subscriptionType = " + subscriptionType |
| + ", uniqueId = " + uniqueId); |
| } |
| return -1; |
| } |
| |
| if (DBG) logd("removing the subid : " + subId); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| int result = 0; |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| ContentResolver resolver = mContext.getContentResolver(); |
| result = resolver.delete(SubscriptionManager.CONTENT_URI, |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=? AND " |
| + SubscriptionManager.SUBSCRIPTION_TYPE + "=?", |
| new String[]{Integer.toString(subId), Integer.toString(subscriptionType)}); |
| if (result != 1) { |
| if (DBG) { |
| logd("found NO subscription to remove with subscriptionType = " |
| + subscriptionType + ", uniqueId = " + uniqueId); |
| } |
| return -1; |
| } |
| refreshCachedActiveSubscriptionInfoList(); |
| result = sSlotIndexToSubIds.removeFromSubIdList(slotIndex, subId); |
| if (result == NO_ENTRY_FOR_SLOT_INDEX) { |
| loge("sSlotIndexToSubIds has no entry for slotIndex = " + slotIndex); |
| } else if (result == SUB_ID_NOT_IN_SLOT) { |
| loge("sSlotIndexToSubIds has no subid: " + subId + ", in index: " + slotIndex); |
| } |
| |
| // Since a subscription is removed, if this one is set as default for any setting, |
| // set some other subid as the default. |
| int newDefault = SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| SubscriptionInfo info = null; |
| final List<SubscriptionInfo> records = getActiveSubscriptionInfoList( |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| if (!records.isEmpty()) { |
| // yes, we have more subscriptions. pick the first one. |
| // FIXME do we need a policy to figure out which one is to be next default |
| info = records.get(0); |
| } |
| updateDefaultSubIdsIfNeeded(info.getSubscriptionId(), info.getSubscriptionType()); |
| |
| notifySubscriptionInfoChanged(); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| return result; |
| } |
| |
| /** |
| * Clear an subscriptionInfo to subinfo database if needed by updating slot index to invalid. |
| * @param slotIndex the slot which the SIM is removed |
| */ |
| public void clearSubInfoRecord(int slotIndex) { |
| if (DBG) logdl("[clearSubInfoRecord]+ iccId:" + " slotIndex:" + slotIndex); |
| |
| // update simInfo db with invalid slot index |
| ContentResolver resolver = mContext.getContentResolver(); |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.SIM_SLOT_INDEX, SubscriptionManager.INVALID_SIM_SLOT_INDEX); |
| String where = "(" + SubscriptionManager.SIM_SLOT_INDEX + "=" + slotIndex + ")"; |
| resolver.update(SubscriptionManager.CONTENT_URI, value, where, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| sSlotIndexToSubIds.remove(slotIndex); |
| } |
| |
| /** |
| * Insert an empty SubInfo record into the database. |
| * |
| * <p>NOTE: This is not accessible to external processes, so it does not need a permission |
| * check. It is only intended for use by {@link SubscriptionInfoUpdater}. |
| * |
| * <p>Precondition: No record exists with this iccId. |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PACKAGE) |
| public Uri insertEmptySubInfoRecord(String iccId, int slotIndex) { |
| return insertEmptySubInfoRecord(iccId, null, slotIndex, |
| SubscriptionManager.SUBSCRIPTION_TYPE_LOCAL_SIM); |
| } |
| |
| Uri insertEmptySubInfoRecord(String uniqueId, String displayName, int slotIndex, |
| int subscriptionType) { |
| ContentResolver resolver = mContext.getContentResolver(); |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.ICC_ID, uniqueId); |
| int color = getUnusedColor(mContext.getOpPackageName(), mContext.getAttributionTag()); |
| // default SIM color differs between slots |
| value.put(SubscriptionManager.HUE, color); |
| value.put(SubscriptionManager.SIM_SLOT_INDEX, slotIndex); |
| value.put(SubscriptionManager.CARRIER_NAME, ""); |
| value.put(SubscriptionManager.CARD_ID, uniqueId); |
| value.put(SubscriptionManager.SUBSCRIPTION_TYPE, subscriptionType); |
| if (!TextUtils.isEmpty(displayName)) { |
| value.put(SubscriptionManager.DISPLAY_NAME, displayName); |
| } |
| if (!isSubscriptionForRemoteSim(subscriptionType)) { |
| UiccCard card = mUiccController.getUiccCardForPhone(slotIndex); |
| if (card != null) { |
| String cardId = card.getCardId(); |
| if (cardId != null) { |
| value.put(SubscriptionManager.CARD_ID, cardId); |
| } |
| } |
| } |
| |
| Uri uri = resolver.insert(SubscriptionManager.CONTENT_URI, value); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| return uri; |
| } |
| |
| /** |
| * Generate and set carrier text based on input parameters |
| * @param showPlmn flag to indicate if plmn should be included in carrier text |
| * @param plmn plmn to be included in carrier text |
| * @param showSpn flag to indicate if spn should be included in carrier text |
| * @param spn spn to be included in carrier text |
| * @return true if carrier text is set, false otherwise |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public boolean setPlmnSpn(int slotIndex, boolean showPlmn, String plmn, boolean showSpn, |
| String spn) { |
| synchronized (mLock) { |
| int subId = getSubIdUsingPhoneId(slotIndex); |
| if (mContext.getPackageManager().resolveContentProvider( |
| SubscriptionManager.CONTENT_URI.getAuthority(), 0) == null || |
| !SubscriptionManager.isValidSubscriptionId(subId)) { |
| // No place to store this info. Notify registrants of the change anyway as they |
| // might retrieve the SPN/PLMN text from the SST sticky broadcast. |
| // TODO: This can be removed once SubscriptionController is not running on devices |
| // that don't need it, such as TVs. |
| if (DBG) logd("[setPlmnSpn] No valid subscription to store info"); |
| notifySubscriptionInfoChanged(); |
| return false; |
| } |
| String carrierText = ""; |
| if (showPlmn) { |
| carrierText = plmn; |
| if (showSpn) { |
| // Need to show both plmn and spn if both are not same. |
| if(!Objects.equals(spn, plmn)) { |
| String separator = mContext.getString( |
| com.android.internal.R.string.kg_text_message_separator).toString(); |
| carrierText = new StringBuilder().append(carrierText).append(separator) |
| .append(spn).toString(); |
| } |
| } |
| } else if (showSpn) { |
| carrierText = spn; |
| } |
| setCarrierText(carrierText, subId); |
| return true; |
| } |
| } |
| |
| /** |
| * Set carrier text by simInfo index |
| * @param text new carrier text |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| private int setCarrierText(String text, int subId) { |
| if (DBG) logd("[setCarrierText]+ text:" + text + " subId:" + subId); |
| |
| enforceModifyPhoneState("setCarrierText"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.CARRIER_NAME, text); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Set SIM color tint by simInfo index |
| * @param tint the tint color of the SIM |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| @Override |
| public int setIconTint(int tint, int subId) { |
| if (DBG) logd("[setIconTint]+ tint:" + tint + " subId:" + subId); |
| |
| enforceModifyPhoneState("setIconTint"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| validateSubId(subId); |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.HUE, tint); |
| if (DBG) logd("[setIconTint]- tint:" + tint + " set"); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * This is only for internal use and the returned priority is arbitrary. The idea is to give a |
| * higher value to name source that has higher priority to override other name sources. |
| * @param nameSource Source of display name |
| * @return int representing the priority. Higher value means higher priority. |
| */ |
| public static int getNameSourcePriority(@SimDisplayNameSource int nameSource) { |
| int index = Arrays.asList( |
| SubscriptionManager.NAME_SOURCE_CARRIER_ID, |
| SubscriptionManager.NAME_SOURCE_SIM_PNN, |
| SubscriptionManager.NAME_SOURCE_SIM_SPN, |
| SubscriptionManager.NAME_SOURCE_CARRIER, |
| SubscriptionManager.NAME_SOURCE_USER_INPUT // user has highest priority. |
| ).indexOf(nameSource); |
| return (index < 0) ? 0 : index; |
| } |
| |
| /** |
| * Set display name by simInfo index with name source |
| * @param displayName the display name of SIM card |
| * @param subId the unique SubInfoRecord index in database |
| * @param nameSource SIM display name source |
| * @return the number of records updated |
| */ |
| @Override |
| public int setDisplayNameUsingSrc(String displayName, int subId, |
| @SimDisplayNameSource int nameSource) { |
| if (DBG) { |
| logd("[setDisplayName]+ displayName:" + displayName + " subId:" + subId |
| + " nameSource:" + nameSource); |
| } |
| |
| enforceModifyPhoneState("setDisplayNameUsingSrc"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| validateSubId(subId); |
| List<SubscriptionInfo> allSubInfo = getSubInfo(null, null); |
| // if there is no sub in the db, return 0 since subId does not exist in db |
| if (allSubInfo == null || allSubInfo.isEmpty()) return 0; |
| for (SubscriptionInfo subInfo : allSubInfo) { |
| if (subInfo.getSubscriptionId() == subId |
| && (getNameSourcePriority(subInfo.getNameSource()) |
| > getNameSourcePriority(nameSource) |
| || (displayName != null && displayName.equals(subInfo.getDisplayName())))) { |
| logd("Name source " + subInfo.getNameSource() + "'s priority " |
| + getNameSourcePriority(subInfo.getNameSource()) + " is greater than " |
| + "name source " + nameSource + "'s priority " |
| + getNameSourcePriority(nameSource) + ", return now."); |
| return 0; |
| } |
| } |
| String nameToSet; |
| if (TextUtils.isEmpty(displayName) || displayName.trim().length() == 0) { |
| nameToSet = mTelephonyManager.getSimOperatorName(subId); |
| if (TextUtils.isEmpty(nameToSet)) { |
| if (nameSource == SubscriptionManager.NAME_SOURCE_USER_INPUT |
| && SubscriptionManager.isValidSlotIndex(getSlotIndex(subId))) { |
| nameToSet = "CARD " + (getSlotIndex(subId) + 1); |
| } else { |
| nameToSet = mContext.getString(SubscriptionManager.DEFAULT_NAME_RES); |
| } |
| } |
| } else { |
| nameToSet = displayName; |
| } |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.DISPLAY_NAME, nameToSet); |
| if (nameSource >= SubscriptionManager.NAME_SOURCE_CARRIER_ID) { |
| if (DBG) logd("Set nameSource=" + nameSource); |
| value.put(SubscriptionManager.NAME_SOURCE, nameSource); |
| } |
| if (DBG) logd("[setDisplayName]- mDisplayName:" + nameToSet + " set"); |
| |
| // Update the nickname on the eUICC chip if it's an embedded subscription. |
| SubscriptionInfo sub = getSubscriptionInfo(subId); |
| if (sub != null && sub.isEmbedded()) { |
| // Ignore the result. |
| int cardId = sub.getCardId(); |
| if (DBG) logd("Updating embedded sub nickname on cardId: " + cardId); |
| EuiccManager euiccManager = ((EuiccManager) |
| mContext.getSystemService(Context.EUICC_SERVICE)).createForCardId(cardId); |
| euiccManager.updateSubscriptionNickname(subId, displayName, |
| // This PendingIntent simply fulfills the requirement to pass in a callback; |
| // we don't care about the result (hence 0 requestCode and no action |
| // specified on the intent). |
| PendingIntent.getService( |
| mContext, 0 /* requestCode */, new Intent(), 0 /* flags */)); |
| } |
| |
| int result = updateDatabase(value, subId, true); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Set phone number by subId |
| * @param number the phone number of the SIM |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| @Override |
| public int setDisplayNumber(String number, int subId) { |
| if (DBG) logd("[setDisplayNumber]+ subId:" + subId); |
| |
| enforceModifyPhoneState("setDisplayNumber"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| validateSubId(subId); |
| int result; |
| int phoneId = getPhoneId(subId); |
| |
| if (number == null || phoneId < 0 || |
| phoneId >= mTelephonyManager.getPhoneCount()) { |
| if (DBG) logd("[setDispalyNumber]- fail"); |
| return -1; |
| } |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.NUMBER, number); |
| |
| // This function had a call to update number on the SIM (Phone.setLine1Number()) but |
| // that was removed as there doesn't seem to be a reason for that. If it is added |
| // back, watch out for deadlocks. |
| |
| result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| if (DBG) logd("[setDisplayNumber]- update result :" + result); |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Set the EHPLMNs and HPLMNs associated with the subscription. |
| */ |
| public void setAssociatedPlmns(String[] ehplmns, String[] hplmns, int subId) { |
| if (DBG) logd("[setAssociatedPlmns]+ subId:" + subId); |
| |
| validateSubId(subId); |
| int phoneId = getPhoneId(subId); |
| |
| if (phoneId < 0 || phoneId >= mTelephonyManager.getPhoneCount()) { |
| if (DBG) logd("[setAssociatedPlmns]- fail"); |
| return; |
| } |
| |
| String formattedEhplmns = ehplmns == null ? "" : String.join(",", ehplmns); |
| String formattedHplmns = hplmns == null ? "" : String.join(",", hplmns); |
| |
| ContentValues value = new ContentValues(2); |
| value.put(SubscriptionManager.EHPLMNS, formattedEhplmns); |
| value.put(SubscriptionManager.HPLMNS, formattedHplmns); |
| |
| int count = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| if (DBG) logd("[setAssociatedPlmns]- update result :" + count); |
| notifySubscriptionInfoChanged(); |
| } |
| |
| /** |
| * Set data roaming by simInfo index |
| * @param roaming 0:Don't allow data when roaming, 1:Allow data when roaming |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| @Override |
| public int setDataRoaming(int roaming, int subId) { |
| if (DBG) logd("[setDataRoaming]+ roaming:" + roaming + " subId:" + subId); |
| |
| enforceModifyPhoneState("setDataRoaming"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| validateSubId(subId); |
| if (roaming < 0) { |
| if (DBG) logd("[setDataRoaming]- fail"); |
| return -1; |
| } |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.DATA_ROAMING, roaming); |
| if (DBG) logd("[setDataRoaming]- roaming:" + roaming + " set"); |
| |
| int result = updateDatabase(value, subId, true); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| public void syncGroupedSetting(int refSubId) { |
| logd("syncGroupedSetting"); |
| try (Cursor cursor = mContext.getContentResolver().query( |
| SubscriptionManager.CONTENT_URI, null, |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=?", |
| new String[] {String.valueOf(refSubId)}, null)) { |
| if (cursor == null || !cursor.moveToFirst()) { |
| logd("[syncGroupedSetting] failed. Can't find refSubId " + refSubId); |
| return; |
| } |
| |
| ContentValues values = new ContentValues(GROUP_SHARING_PROPERTIES.size()); |
| for (String propKey : GROUP_SHARING_PROPERTIES) { |
| copyDataFromCursorToContentValue(propKey, cursor, values); |
| } |
| updateDatabase(values, refSubId, true); |
| } |
| } |
| |
| private void copyDataFromCursorToContentValue(String propKey, Cursor cursor, |
| ContentValues values) { |
| int columnIndex = cursor.getColumnIndex(propKey); |
| if (columnIndex == -1) { |
| logd("[copyDataFromCursorToContentValue] can't find column " + propKey); |
| return; |
| } |
| |
| switch (propKey) { |
| case SubscriptionManager.ENHANCED_4G_MODE_ENABLED: |
| case SubscriptionManager.VT_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_ENABLED: |
| case SubscriptionManager.DATA_ROAMING: |
| case SubscriptionManager.IMS_RCS_UCE_ENABLED: |
| values.put(propKey, cursor.getInt(columnIndex)); |
| break; |
| case SubscriptionManager.DISPLAY_NAME: |
| case SubscriptionManager.DATA_ENABLED_OVERRIDE_RULES: |
| values.put(propKey, cursor.getString(columnIndex)); |
| break; |
| default: |
| loge("[copyDataFromCursorToContentValue] invalid propKey " + propKey); |
| } |
| } |
| |
| // TODO: replace all updates with this helper method. |
| private int updateDatabase(ContentValues value, int subId, boolean updateEntireGroup) { |
| List<SubscriptionInfo> infoList = getSubscriptionsInGroup(getGroupUuid(subId), |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| if (!updateEntireGroup || infoList == null || infoList.size() == 0) { |
| // Only update specified subscriptions. |
| return mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| } else { |
| // Update all subscriptions in the same group. |
| int[] subIdList = new int[infoList.size()]; |
| for (int i = 0; i < infoList.size(); i++) { |
| subIdList[i] = infoList.get(i).getSubscriptionId(); |
| } |
| return mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, |
| value, getSelectionForSubIdList(subIdList), null); |
| } |
| } |
| |
| /** |
| * Set carrier id by subId |
| * @param carrierId the subscription carrier id. |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| * |
| * @see TelephonyManager#getSimCarrierId() |
| */ |
| public int setCarrierId(int carrierId, int subId) { |
| if (DBG) logd("[setCarrierId]+ carrierId:" + carrierId + " subId:" + subId); |
| |
| enforceModifyPhoneState("setCarrierId"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| validateSubId(subId); |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.CARRIER_ID, carrierId); |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Set MCC/MNC by subscription ID |
| * @param mccMnc MCC/MNC associated with the subscription |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| public int setMccMnc(String mccMnc, int subId) { |
| String mccString = mccMnc.substring(0, 3); |
| String mncString = mccMnc.substring(3); |
| int mcc = 0; |
| int mnc = 0; |
| try { |
| mcc = Integer.parseInt(mccString); |
| mnc = Integer.parseInt(mncString); |
| } catch (NumberFormatException e) { |
| loge("[setMccMnc] - couldn't parse mcc/mnc: " + mccMnc); |
| } |
| if (DBG) logd("[setMccMnc]+ mcc/mnc:" + mcc + "/" + mnc + " subId:" + subId); |
| ContentValues value = new ContentValues(4); |
| value.put(SubscriptionManager.MCC, mcc); |
| value.put(SubscriptionManager.MNC, mnc); |
| value.put(SubscriptionManager.MCC_STRING, mccString); |
| value.put(SubscriptionManager.MNC_STRING, mncString); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } |
| |
| /** |
| * Scrub given IMSI on production builds. |
| */ |
| private String scrubImsi(String imsi) { |
| if (Build.IS_ENG) { |
| return imsi; |
| } else if (imsi != null) { |
| return imsi.substring(0, Math.min(6, imsi.length())) + "..."; |
| } else { |
| return "null"; |
| } |
| } |
| |
| /** |
| * Set IMSI by subscription ID |
| * @param imsi IMSI (International Mobile Subscriber Identity) |
| * @return the number of records updated |
| */ |
| public int setImsi(String imsi, int subId) { |
| if (DBG) logd("[setImsi]+ imsi:" + scrubImsi(imsi) + " subId:" + subId); |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.IMSI, imsi); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } |
| |
| /** |
| * Set uicc applications being enabled or disabled. |
| * @param enabled whether uicc applications are enabled or disabled. |
| * @return the number of records updated |
| */ |
| public int setUiccApplicationsEnabled(boolean enabled, int subId) { |
| if (DBG) logd("[setUiccApplicationsEnabled]+ enabled:" + enabled + " subId:" + subId); |
| |
| enforceModifyPhoneState("setUiccApplicationsEnabled"); |
| |
| long identity = Binder.clearCallingIdentity(); |
| try { |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.UICC_APPLICATIONS_ENABLED, enabled); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifyUiccAppsEnableChanged(); |
| notifySubscriptionInfoChanged(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Register to change of uicc applications enablement changes. |
| * @param notifyNow whether to notify target upon registration. |
| */ |
| public void registerForUiccAppsEnabled(Handler handler, int what, Object object, |
| boolean notifyNow) { |
| mUiccAppsEnableChangeRegList.addUnique(handler, what, object); |
| if (notifyNow) { |
| handler.obtainMessage(what, object).sendToTarget(); |
| } |
| } |
| |
| /** |
| * Unregister to change of uicc applications enablement changes. |
| */ |
| public void unregisterForUiccAppsEnabled(Handler handler) { |
| mUiccAppsEnableChangeRegList.remove(handler); |
| } |
| |
| private void notifyUiccAppsEnableChanged() { |
| mUiccAppsEnableChangeRegList.notifyRegistrants(); |
| } |
| |
| /** |
| * Get IMSI by subscription ID |
| * For active subIds, this will always return the corresponding imsi |
| * For inactive subIds, once they are activated once, even if they are deactivated at the time |
| * of calling this function, the corresponding imsi will be returned |
| * When calling this method, the permission check should have already been done to allow |
| * only privileged read |
| * |
| * @return imsi |
| */ |
| public String getImsiPrivileged(int subId) { |
| try (Cursor cursor = mContext.getContentResolver().query( |
| SubscriptionManager.CONTENT_URI, null, |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=?", |
| new String[] {String.valueOf(subId)}, null)) { |
| String imsi = null; |
| if (cursor != null) { |
| if (cursor.moveToNext()) { |
| imsi = getOptionalStringFromCursor(cursor, SubscriptionManager.IMSI, |
| /*defaultVal*/ null); |
| } |
| } else { |
| logd("getImsiPrivileged: failed to retrieve imsi."); |
| } |
| |
| return imsi; |
| } |
| } |
| |
| /** |
| * Set ISO country code by subscription ID |
| * @param iso iso country code associated with the subscription |
| * @param subId the unique SubInfoRecord index in database |
| * @return the number of records updated |
| */ |
| public int setCountryIso(String iso, int subId) { |
| if (DBG) logd("[setCountryIso]+ iso:" + iso + " subId:" + subId); |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.ISO_COUNTRY_CODE, iso); |
| |
| int result = mContext.getContentResolver().update( |
| SubscriptionManager.getUriForSubscriptionId(subId), value, null, null); |
| |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| return result; |
| } |
| |
| @Override |
| public int getSlotIndex(int subId) { |
| if (VDBG) printStackTrace("[getSlotIndex] subId=" + subId); |
| |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| subId = getDefaultSubId(); |
| } |
| if (!SubscriptionManager.isValidSubscriptionId(subId)) { |
| if (DBG) logd("[getSlotIndex]- subId invalid"); |
| return SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| } |
| |
| int size = sSlotIndexToSubIds.size(); |
| |
| if (size == 0) { |
| if (DBG) logd("[getSlotIndex]- size == 0, return SIM_NOT_INSERTED instead"); |
| return SubscriptionManager.SIM_NOT_INSERTED; |
| } |
| |
| for (Entry<Integer, ArrayList<Integer>> entry : sSlotIndexToSubIds.entrySet()) { |
| int sim = entry.getKey(); |
| ArrayList<Integer> subs = entry.getValue(); |
| |
| if (subs != null && subs.contains(subId)) { |
| if (VDBG) logv("[getSlotIndex]- return = " + sim); |
| return sim; |
| } |
| } |
| |
| if (DBG) logd("[getSlotIndex]- return fail"); |
| return SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| } |
| |
| /** |
| * Return the subId for specified slot Id. |
| * @deprecated |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| @Deprecated |
| public int[] getSubId(int slotIndex) { |
| if (VDBG) printStackTrace("[getSubId]+ slotIndex=" + slotIndex); |
| |
| // Map default slotIndex to the current default subId. |
| // TODO: Not used anywhere sp consider deleting as it's somewhat nebulous |
| // as a slot maybe used for multiple different type of "connections" |
| // such as: voice, data and sms. But we're doing the best we can and using |
| // getDefaultSubId which makes a best guess. |
| if (slotIndex == SubscriptionManager.DEFAULT_SIM_SLOT_INDEX) { |
| slotIndex = getSlotIndex(getDefaultSubId()); |
| if (VDBG) logd("[getSubId] map default slotIndex=" + slotIndex); |
| } |
| |
| // Check that we have a valid slotIndex or the slotIndex is for a remote SIM (remote SIM |
| // uses special slot index that may be invalid otherwise) |
| if (!SubscriptionManager.isValidSlotIndex(slotIndex) |
| && slotIndex != SubscriptionManager.SLOT_INDEX_FOR_REMOTE_SIM_SUB) { |
| if (DBG) logd("[getSubId]- invalid slotIndex=" + slotIndex); |
| return null; |
| } |
| |
| // Check if we've got any SubscriptionInfo records using slotIndexToSubId as a surrogate. |
| int size = sSlotIndexToSubIds.size(); |
| if (size == 0) { |
| if (VDBG) { |
| logd("[getSubId]- sSlotIndexToSubIds.size == 0, return null slotIndex=" |
| + slotIndex); |
| } |
| return null; |
| } |
| |
| // Convert ArrayList to array |
| ArrayList<Integer> subIds = sSlotIndexToSubIds.getCopy(slotIndex); |
| if (subIds != null && subIds.size() > 0) { |
| int[] subIdArr = new int[subIds.size()]; |
| for (int i = 0; i < subIds.size(); i++) { |
| subIdArr[i] = subIds.get(i); |
| } |
| if (VDBG) logd("[getSubId]- subIdArr=" + subIdArr); |
| return subIdArr; |
| } else { |
| if (DBG) logd("[getSubId]- numSubIds == 0, return null slotIndex=" + slotIndex); |
| return null; |
| } |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public int getPhoneId(int subId) { |
| if (VDBG) printStackTrace("[getPhoneId] subId=" + subId); |
| int phoneId; |
| |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| subId = getDefaultSubId(); |
| if (DBG) logd("[getPhoneId] asked for default subId=" + subId); |
| } |
| |
| if (!SubscriptionManager.isValidSubscriptionId(subId)) { |
| if (VDBG) { |
| logdl("[getPhoneId]- invalid subId return=" |
| + SubscriptionManager.INVALID_PHONE_INDEX); |
| } |
| return SubscriptionManager.INVALID_PHONE_INDEX; |
| } |
| |
| int size = sSlotIndexToSubIds.size(); |
| if (size == 0) { |
| phoneId = mDefaultPhoneId; |
| if (VDBG) logdl("[getPhoneId]- no sims, returning default phoneId=" + phoneId); |
| return phoneId; |
| } |
| |
| // FIXME: Assumes phoneId == slotIndex |
| for (Entry<Integer, ArrayList<Integer>> entry: sSlotIndexToSubIds.entrySet()) { |
| int sim = entry.getKey(); |
| ArrayList<Integer> subs = entry.getValue(); |
| |
| if (subs != null && subs.contains(subId)) { |
| if (VDBG) logdl("[getPhoneId]- found subId=" + subId + " phoneId=" + sim); |
| return sim; |
| } |
| } |
| |
| phoneId = mDefaultPhoneId; |
| if (VDBG) { |
| logd("[getPhoneId]- subId=" + subId + " not found return default phoneId=" + phoneId); |
| } |
| return phoneId; |
| |
| } |
| |
| /** |
| * @return the number of records cleared |
| */ |
| @Override |
| public int clearSubInfo() { |
| enforceModifyPhoneState("clearSubInfo"); |
| |
| // Now that all security checks passes, perform the operation as ourselves. |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| int size = sSlotIndexToSubIds.size(); |
| |
| if (size == 0) { |
| if (DBG) logdl("[clearSubInfo]- no simInfo size=" + size); |
| return 0; |
| } |
| |
| sSlotIndexToSubIds.clear(); |
| if (DBG) logdl("[clearSubInfo]- clear size=" + size); |
| return size; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| private void logvl(String msg) { |
| logv(msg); |
| mLocalLog.log(msg); |
| } |
| |
| private void logv(String msg) { |
| Rlog.v(LOG_TAG, msg); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| protected void logdl(String msg) { |
| logd(msg); |
| mLocalLog.log(msg); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private void logd(String msg) { |
| Rlog.d(LOG_TAG, msg); |
| } |
| |
| private void logel(String msg) { |
| loge(msg); |
| mLocalLog.log(msg); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private void loge(String msg) { |
| Rlog.e(LOG_TAG, msg); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public int getDefaultSubId() { |
| int subId; |
| boolean isVoiceCapable = mTelephonyManager.isVoiceCapable(); |
| if (isVoiceCapable) { |
| subId = getDefaultVoiceSubId(); |
| if (VDBG) logdl("[getDefaultSubId] isVoiceCapable subId=" + subId); |
| } else { |
| subId = getDefaultDataSubId(); |
| if (VDBG) logdl("[getDefaultSubId] NOT VoiceCapable subId=" + subId); |
| } |
| if (!isActiveSubId(subId)) { |
| subId = sDefaultFallbackSubId.get(); |
| if (VDBG) logdl("[getDefaultSubId] NOT active use fall back subId=" + subId); |
| } |
| if (VDBG) logv("[getDefaultSubId]- value = " + subId); |
| return subId; |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public void setDefaultSmsSubId(int subId) { |
| enforceModifyPhoneState("setDefaultSmsSubId"); |
| |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| throw new RuntimeException("setDefaultSmsSubId called with DEFAULT_SUB_ID"); |
| } |
| if (DBG) logdl("[setDefaultSmsSubId] subId=" + subId); |
| setGlobalSetting(Settings.Global.MULTI_SIM_SMS_SUBSCRIPTION, subId); |
| broadcastDefaultSmsSubIdChanged(subId); |
| } |
| |
| private void broadcastDefaultSmsSubIdChanged(int subId) { |
| // Broadcast an Intent for default sms sub change |
| if (DBG) logdl("[broadcastDefaultSmsSubIdChanged] subId=" + subId); |
| Intent intent = new Intent(SubscriptionManager.ACTION_DEFAULT_SMS_SUBSCRIPTION_CHANGED); |
| intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING); |
| SubscriptionManager.putSubscriptionIdExtra(intent, subId); |
| mContext.sendStickyBroadcastAsUser(intent, UserHandle.ALL); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public int getDefaultSmsSubId() { |
| int subId = Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_SMS_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| if (VDBG) logd("[getDefaultSmsSubId] subId=" + subId); |
| return subId; |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public void setDefaultVoiceSubId(int subId) { |
| enforceModifyPhoneState("setDefaultVoiceSubId"); |
| |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| throw new RuntimeException("setDefaultVoiceSubId called with DEFAULT_SUB_ID"); |
| } |
| if (DBG) logdl("[setDefaultVoiceSubId] subId=" + subId); |
| |
| int previousDefaultSub = getDefaultSubId(); |
| |
| setGlobalSetting(Settings.Global.MULTI_SIM_VOICE_CALL_SUBSCRIPTION, subId); |
| broadcastDefaultVoiceSubIdChanged(subId); |
| |
| PhoneAccountHandle newHandle = |
| subId == SubscriptionManager.INVALID_SUBSCRIPTION_ID |
| ? null : mTelephonyManager.getPhoneAccountHandleForSubscriptionId( |
| subId); |
| |
| TelecomManager telecomManager = mContext.getSystemService(TelecomManager.class); |
| PhoneAccountHandle currentHandle = telecomManager.getUserSelectedOutgoingPhoneAccount(); |
| |
| if (!Objects.equals(currentHandle, newHandle)) { |
| telecomManager.setUserSelectedOutgoingPhoneAccount(newHandle); |
| logd("[setDefaultVoiceSubId] change to phoneAccountHandle=" + newHandle); |
| } else { |
| logd("[setDefaultVoiceSubId] default phone account not changed"); |
| } |
| |
| if (previousDefaultSub != getDefaultSubId()) { |
| sendDefaultChangedBroadcast(getDefaultSubId()); |
| } |
| } |
| |
| /** |
| * Broadcast intent of ACTION_DEFAULT_VOICE_SUBSCRIPTION_CHANGED. |
| * @hide |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PRIVATE) |
| public void broadcastDefaultVoiceSubIdChanged(int subId) { |
| // Broadcast an Intent for default voice sub change |
| if (DBG) logdl("[broadcastDefaultVoiceSubIdChanged] subId=" + subId); |
| Intent intent = new Intent(TelephonyIntents.ACTION_DEFAULT_VOICE_SUBSCRIPTION_CHANGED); |
| intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING); |
| SubscriptionManager.putSubscriptionIdExtra(intent, subId); |
| mContext.sendStickyBroadcastAsUser(intent, UserHandle.ALL); |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public int getDefaultVoiceSubId() { |
| int subId = Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_VOICE_CALL_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| if (VDBG) logd("[getDefaultVoiceSubId] subId=" + subId); |
| return subId; |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public int getDefaultDataSubId() { |
| int subId = Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MULTI_SIM_DATA_CALL_SUBSCRIPTION, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| if (VDBG) logd("[getDefaultDataSubId] subId=" + subId); |
| return subId; |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Override |
| public void setDefaultDataSubId(int subId) { |
| enforceModifyPhoneState("setDefaultDataSubId"); |
| |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| throw new RuntimeException("setDefaultDataSubId called with DEFAULT_SUB_ID"); |
| } |
| |
| ProxyController proxyController = ProxyController.getInstance(); |
| int len = TelephonyManager.from(mContext).getActiveModemCount(); |
| logdl("[setDefaultDataSubId] num phones=" + len + ", subId=" + subId); |
| |
| if (SubscriptionManager.isValidSubscriptionId(subId)) { |
| // Only re-map modems if the new default data sub is valid |
| RadioAccessFamily[] rafs = new RadioAccessFamily[len]; |
| boolean atLeastOneMatch = false; |
| for (int phoneId = 0; phoneId < len; phoneId++) { |
| Phone phone = PhoneFactory.getPhone(phoneId); |
| int raf; |
| int id = phone.getSubId(); |
| if (id == subId) { |
| // TODO Handle the general case of N modems and M subscriptions. |
| raf = proxyController.getMaxRafSupported(); |
| atLeastOneMatch = true; |
| } else { |
| // TODO Handle the general case of N modems and M subscriptions. |
| raf = proxyController.getMinRafSupported(); |
| } |
| logdl("[setDefaultDataSubId] phoneId=" + phoneId + " subId=" + id + " RAF=" |
| + raf); |
| rafs[phoneId] = new RadioAccessFamily(phoneId, raf); |
| } |
| if (atLeastOneMatch) { |
| proxyController.setRadioCapability(rafs); |
| } else { |
| if (DBG) logdl("[setDefaultDataSubId] no valid subId's found - not updating."); |
| } |
| } |
| |
| int previousDefaultSub = getDefaultSubId(); |
| setGlobalSetting(Settings.Global.MULTI_SIM_DATA_CALL_SUBSCRIPTION, subId); |
| MultiSimSettingController.getInstance().notifyDefaultDataSubChanged(); |
| broadcastDefaultDataSubIdChanged(subId); |
| if (previousDefaultSub != getDefaultSubId()) { |
| sendDefaultChangedBroadcast(getDefaultSubId()); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private void broadcastDefaultDataSubIdChanged(int subId) { |
| // Broadcast an Intent for default data sub change |
| if (DBG) logdl("[broadcastDefaultDataSubIdChanged] subId=" + subId); |
| Intent intent = new Intent(TelephonyIntents.ACTION_DEFAULT_DATA_SUBSCRIPTION_CHANGED); |
| intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING); |
| SubscriptionManager.putSubscriptionIdExtra(intent, subId); |
| mContext.sendStickyBroadcastAsUser(intent, UserHandle.ALL); |
| } |
| |
| /* Sets the default subscription. If only one sub is active that |
| * sub is set as default subId. If two or more sub's are active |
| * the first sub is set as default subscription |
| */ |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| protected void setDefaultFallbackSubId(int subId, int subscriptionType) { |
| if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| throw new RuntimeException("setDefaultSubId called with DEFAULT_SUB_ID"); |
| } |
| if (DBG) { |
| logdl("[setDefaultFallbackSubId] subId=" + subId + ", subscriptionType=" |
| + subscriptionType); |
| } |
| int previousDefaultSub = getDefaultSubId(); |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| sDefaultFallbackSubId.set(subId); |
| return; |
| } |
| if (SubscriptionManager.isValidSubscriptionId(subId)) { |
| int phoneId = getPhoneId(subId); |
| if (phoneId >= 0 && (phoneId < mTelephonyManager.getPhoneCount() |
| || mTelephonyManager.getSimCount() == 1)) { |
| if (DBG) logdl("[setDefaultFallbackSubId] set sDefaultFallbackSubId=" + subId); |
| sDefaultFallbackSubId.set(subId); |
| // Update MCC MNC device configuration information |
| String defaultMccMnc = mTelephonyManager.getSimOperatorNumericForPhone(phoneId); |
| MccTable.updateMccMncConfiguration(mContext, defaultMccMnc); |
| } else { |
| if (DBG) { |
| logdl("[setDefaultFallbackSubId] not set invalid phoneId=" + phoneId |
| + " subId=" + subId); |
| } |
| } |
| } |
| if (previousDefaultSub != getDefaultSubId()) { |
| sendDefaultChangedBroadcast(getDefaultSubId()); |
| } |
| } |
| |
| public void sendDefaultChangedBroadcast(int subId) { |
| // Broadcast an Intent for default sub change |
| int phoneId = SubscriptionManager.getPhoneId(subId); |
| Intent intent = new Intent(SubscriptionManager.ACTION_DEFAULT_SUBSCRIPTION_CHANGED); |
| intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING); |
| SubscriptionManager.putPhoneIdAndSubIdExtra(intent, phoneId, subId); |
| if (DBG) { |
| logdl("[sendDefaultChangedBroadcast] broadcast default subId changed phoneId=" |
| + phoneId + " subId=" + subId); |
| } |
| mContext.sendStickyBroadcastAsUser(intent, UserHandle.ALL); |
| } |
| |
| /** |
| * Whether a subscription is opportunistic or not. |
| */ |
| public boolean isOpportunistic(int subId) { |
| SubscriptionInfo info = getActiveSubscriptionInfo(subId, mContext.getOpPackageName(), |
| mContext.getAttributionTag()); |
| return (info != null) && info.isOpportunistic(); |
| } |
| |
| // FIXME: We need we should not be assuming phoneId == slotIndex as it will not be true |
| // when there are multiple subscriptions per sim and probably for other reasons. |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| public int getSubIdUsingPhoneId(int phoneId) { |
| int[] subIds = getSubId(phoneId); |
| if (subIds == null || subIds.length == 0) { |
| return SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| } |
| return subIds[0]; |
| } |
| |
| /** Must be public for access from instrumentation tests. */ |
| @VisibleForTesting |
| public List<SubscriptionInfo> getSubInfoUsingSlotIndexPrivileged(int slotIndex) { |
| if (DBG) logd("[getSubInfoUsingSlotIndexPrivileged]+ slotIndex:" + slotIndex); |
| if (slotIndex == SubscriptionManager.DEFAULT_SIM_SLOT_INDEX) { |
| slotIndex = getSlotIndex(getDefaultSubId()); |
| } |
| if (!SubscriptionManager.isValidSlotIndex(slotIndex)) { |
| if (DBG) logd("[getSubInfoUsingSlotIndexPrivileged]- invalid slotIndex"); |
| return null; |
| } |
| |
| Cursor cursor = mContext.getContentResolver().query(SubscriptionManager.CONTENT_URI, |
| null, SubscriptionManager.SIM_SLOT_INDEX + "=?", |
| new String[]{String.valueOf(slotIndex)}, null); |
| ArrayList<SubscriptionInfo> subList = null; |
| try { |
| if (cursor != null) { |
| while (cursor.moveToNext()) { |
| SubscriptionInfo subInfo = getSubInfoRecord(cursor); |
| if (subInfo != null) { |
| if (subList == null) { |
| subList = new ArrayList<SubscriptionInfo>(); |
| } |
| subList.add(subInfo); |
| } |
| } |
| } |
| } finally { |
| if (cursor != null) { |
| cursor.close(); |
| } |
| } |
| if (DBG) logd("[getSubInfoUsingSlotIndex]- null info return"); |
| |
| return subList; |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| private void validateSubId(int subId) { |
| if (DBG) logd("validateSubId subId: " + subId); |
| if (!SubscriptionManager.isValidSubscriptionId(subId)) { |
| throw new RuntimeException("Invalid sub id passed as parameter"); |
| } else if (subId == SubscriptionManager.DEFAULT_SUBSCRIPTION_ID) { |
| throw new RuntimeException("Default sub id passed as parameter"); |
| } |
| } |
| |
| private synchronized ArrayList<Integer> getActiveSubIdArrayList() { |
| // Clone the sub id list so it can't change out from under us while iterating |
| List<Entry<Integer, ArrayList<Integer>>> simInfoList = |
| new ArrayList<>(sSlotIndexToSubIds.entrySet()); |
| |
| // Put the set of sub ids in slot index order |
| Collections.sort(simInfoList, (x, y) -> x.getKey().compareTo(y.getKey())); |
| |
| // Collect the sub ids for each slot in turn |
| ArrayList<Integer> allSubs = new ArrayList<>(); |
| for (Entry<Integer, ArrayList<Integer>> slot : simInfoList) { |
| allSubs.addAll(slot.getValue()); |
| } |
| return allSubs; |
| } |
| |
| private boolean isSubscriptionVisible(int subId) { |
| synchronized (mSubInfoListLock) { |
| for (SubscriptionInfo info : mCacheOpportunisticSubInfoList) { |
| if (info.getSubscriptionId() == subId) { |
| // If group UUID is null, it's stand alone opportunistic profile. So it's |
| // visible. Otherwise, it's bundled opportunistic profile, and is not visible. |
| return info.getGroupUuid() == null; |
| } |
| } |
| } |
| |
| return true; |
| } |
| |
| /** |
| * @return the list of subId's that are active, is never null but the length maybe 0. |
| */ |
| @Override |
| public int[] getActiveSubIdList(boolean visibleOnly) { |
| List<Integer> allSubs = getActiveSubIdArrayList(); |
| |
| if (visibleOnly) { |
| // Grouped opportunistic subscriptions should be hidden. |
| allSubs = allSubs.stream().filter(subId -> isSubscriptionVisible(subId)) |
| .collect(Collectors.toList()); |
| } |
| |
| int[] subIdArr = new int[allSubs.size()]; |
| int i = 0; |
| for (int sub : allSubs) { |
| subIdArr[i] = sub; |
| i++; |
| } |
| |
| if (VDBG) { |
| logdl("[getActiveSubIdList] allSubs=" + allSubs + " subIdArr.length=" |
| + subIdArr.length); |
| } |
| return subIdArr; |
| } |
| |
| @Override |
| public boolean isActiveSubId(int subId, String callingPackage, String callingFeatureId) { |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState(mContext, subId, callingPackage, |
| callingFeatureId, "isActiveSubId")) { |
| throw new SecurityException("Requires READ_PHONE_STATE permission."); |
| } |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| return isActiveSubId(subId); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553) |
| @Deprecated // This should be moved into isActiveSubId(int, String) |
| public boolean isActiveSubId(int subId) { |
| boolean retVal = SubscriptionManager.isValidSubscriptionId(subId) |
| && getActiveSubIdArrayList().contains(subId); |
| |
| if (VDBG) logdl("[isActiveSubId]- " + retVal); |
| return retVal; |
| } |
| |
| /** |
| * Get the SIM state for the slot index. |
| * For Remote-SIMs, this method returns {@link #IccCardConstants.State.UNKNOWN} |
| * @return SIM state as the ordinal of {@See IccCardConstants.State} |
| */ |
| @Override |
| public int getSimStateForSlotIndex(int slotIndex) { |
| State simState; |
| String err; |
| if (slotIndex < 0) { |
| simState = IccCardConstants.State.UNKNOWN; |
| err = "invalid slotIndex"; |
| } else { |
| Phone phone = null; |
| try { |
| phone = PhoneFactory.getPhone(slotIndex); |
| } catch (IllegalStateException e) { |
| // ignore |
| } |
| if (phone == null) { |
| simState = IccCardConstants.State.UNKNOWN; |
| err = "phone == null"; |
| } else { |
| IccCard icc = phone.getIccCard(); |
| if (icc == null) { |
| simState = IccCardConstants.State.UNKNOWN; |
| err = "icc == null"; |
| } else { |
| simState = icc.getState(); |
| err = ""; |
| } |
| } |
| } |
| if (VDBG) { |
| logd("getSimStateForSlotIndex: " + err + " simState=" + simState |
| + " ordinal=" + simState.ordinal() + " slotIndex=" + slotIndex); |
| } |
| return simState.ordinal(); |
| } |
| |
| /** |
| * Store properties associated with SubscriptionInfo in database |
| * @param subId Subscription Id of Subscription |
| * @param propKey Column name in database associated with SubscriptionInfo |
| * @param propValue Value to store in DB for particular subId & column name |
| * |
| * @return number of rows updated. |
| * @hide |
| */ |
| @Override |
| public int setSubscriptionProperty(int subId, String propKey, String propValue) { |
| enforceModifyPhoneState("setSubscriptionProperty"); |
| final long token = Binder.clearCallingIdentity(); |
| |
| try { |
| validateSubId(subId); |
| ContentResolver resolver = mContext.getContentResolver(); |
| int result = setSubscriptionPropertyIntoContentResolver( |
| subId, propKey, propValue, resolver); |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| return result; |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| private int setSubscriptionPropertyIntoContentResolver( |
| int subId, String propKey, String propValue, ContentResolver resolver) { |
| ContentValues value = new ContentValues(); |
| boolean updateEntireGroup = GROUP_SHARING_PROPERTIES.contains(propKey); |
| switch (propKey) { |
| case SubscriptionManager.CB_EXTREME_THREAT_ALERT: |
| case SubscriptionManager.CB_SEVERE_THREAT_ALERT: |
| case SubscriptionManager.CB_AMBER_ALERT: |
| case SubscriptionManager.CB_EMERGENCY_ALERT: |
| case SubscriptionManager.CB_ALERT_SOUND_DURATION: |
| case SubscriptionManager.CB_ALERT_REMINDER_INTERVAL: |
| case SubscriptionManager.CB_ALERT_VIBRATE: |
| case SubscriptionManager.CB_ALERT_SPEECH: |
| case SubscriptionManager.CB_ETWS_TEST_ALERT: |
| case SubscriptionManager.CB_CHANNEL_50_ALERT: |
| case SubscriptionManager.CB_CMAS_TEST_ALERT: |
| case SubscriptionManager.CB_OPT_OUT_DIALOG: |
| case SubscriptionManager.ENHANCED_4G_MODE_ENABLED: |
| case SubscriptionManager.IS_OPPORTUNISTIC: |
| case SubscriptionManager.VT_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_ENABLED: |
| case SubscriptionManager.IMS_RCS_UCE_ENABLED: |
| value.put(propKey, Integer.parseInt(propValue)); |
| break; |
| case SubscriptionManager.ALLOWED_NETWORK_TYPES: |
| value.put(propKey, Long.parseLong(propValue)); |
| break; |
| default: |
| if (DBG) logd("Invalid column name"); |
| break; |
| } |
| |
| return updateDatabase(value, subId, updateEntireGroup); |
| } |
| |
| /** |
| * Get properties associated with SubscriptionInfo from database |
| * |
| * @param subId Subscription Id of Subscription |
| * @param propKey Column name in SubscriptionInfo database |
| * @return Value associated with subId and propKey column in database |
| */ |
| @Override |
| public String getSubscriptionProperty(int subId, String propKey, String callingPackage, |
| String callingFeatureId) { |
| if (!TelephonyPermissions.checkCallingOrSelfReadPhoneState(mContext, subId, callingPackage, |
| callingFeatureId, "getSubscriptionProperty")) { |
| return null; |
| } |
| |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| return getSubscriptionProperty(subId, propKey); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Get properties associated with SubscriptionInfo from database. Note this is the version |
| * without permission check for telephony internal use only. |
| * |
| * @param subId Subscription Id of Subscription |
| * @param propKey Column name in SubscriptionInfo database |
| * @return Value associated with subId and propKey column in database |
| */ |
| public String getSubscriptionProperty(int subId, String propKey) { |
| String resultValue = null; |
| try (Cursor cursor = mContext.getContentResolver().query(SubscriptionManager.CONTENT_URI, |
| new String[]{propKey}, |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=?", |
| new String[]{subId + ""}, null)) { |
| if (cursor != null) { |
| if (cursor.moveToFirst()) { |
| switch (propKey) { |
| case SubscriptionManager.CB_EXTREME_THREAT_ALERT: |
| case SubscriptionManager.CB_SEVERE_THREAT_ALERT: |
| case SubscriptionManager.CB_AMBER_ALERT: |
| case SubscriptionManager.CB_EMERGENCY_ALERT: |
| case SubscriptionManager.CB_ALERT_SOUND_DURATION: |
| case SubscriptionManager.CB_ALERT_REMINDER_INTERVAL: |
| case SubscriptionManager.CB_ALERT_VIBRATE: |
| case SubscriptionManager.CB_ALERT_SPEECH: |
| case SubscriptionManager.CB_ETWS_TEST_ALERT: |
| case SubscriptionManager.CB_CHANNEL_50_ALERT: |
| case SubscriptionManager.CB_CMAS_TEST_ALERT: |
| case SubscriptionManager.CB_OPT_OUT_DIALOG: |
| case SubscriptionManager.ENHANCED_4G_MODE_ENABLED: |
| case SubscriptionManager.VT_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_ENABLED: |
| case SubscriptionManager.WFC_IMS_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_MODE: |
| case SubscriptionManager.WFC_IMS_ROAMING_ENABLED: |
| case SubscriptionManager.IMS_RCS_UCE_ENABLED: |
| case SubscriptionManager.IS_OPPORTUNISTIC: |
| case SubscriptionManager.GROUP_UUID: |
| case SubscriptionManager.DATA_ENABLED_OVERRIDE_RULES: |
| case SubscriptionManager.ALLOWED_NETWORK_TYPES: |
| resultValue = cursor.getString(0); |
| break; |
| default: |
| if(DBG) logd("Invalid column name"); |
| break; |
| } |
| } else { |
| if(DBG) logd("Valid row not present in db"); |
| } |
| } else { |
| if(DBG) logd("Query failed"); |
| } |
| } |
| |
| if (DBG) logd("getSubscriptionProperty Query value = " + resultValue); |
| return resultValue; |
| } |
| |
| private void printStackTrace(String msg) { |
| RuntimeException re = new RuntimeException(); |
| logd("StackTrace - " + msg); |
| StackTraceElement[] st = re.getStackTrace(); |
| boolean first = true; |
| for (StackTraceElement ste : st) { |
| if (first) { |
| first = false; |
| } else { |
| logd(ste.toString()); |
| } |
| } |
| } |
| |
| @Override |
| public void dump(FileDescriptor fd, PrintWriter pw, String[] args) { |
| mContext.enforceCallingOrSelfPermission(android.Manifest.permission.DUMP, |
| "Requires DUMP"); |
| final long token = Binder.clearCallingIdentity(); |
| try { |
| pw.println("SubscriptionController:"); |
| pw.println(" mLastISubServiceRegTime=" + mLastISubServiceRegTime); |
| pw.println(" defaultSubId=" + getDefaultSubId()); |
| pw.println(" defaultDataSubId=" + getDefaultDataSubId()); |
| pw.println(" defaultVoiceSubId=" + getDefaultVoiceSubId()); |
| pw.println(" defaultSmsSubId=" + getDefaultSmsSubId()); |
| |
| pw.println(" defaultDataPhoneId=" + SubscriptionManager |
| .from(mContext).getDefaultDataPhoneId()); |
| pw.println(" defaultVoicePhoneId=" + SubscriptionManager.getDefaultVoicePhoneId()); |
| pw.println(" defaultSmsPhoneId=" + SubscriptionManager |
| .from(mContext).getDefaultSmsPhoneId()); |
| pw.flush(); |
| |
| for (Entry<Integer, ArrayList<Integer>> entry : sSlotIndexToSubIds.entrySet()) { |
| pw.println(" sSlotIndexToSubId[" + entry.getKey() + "]: subIds=" + entry); |
| } |
| pw.flush(); |
| pw.println("++++++++++++++++++++++++++++++++"); |
| |
| List<SubscriptionInfo> sirl = getActiveSubscriptionInfoList( |
| mContext.getOpPackageName(), mContext.getAttributionTag()); |
| if (sirl != null) { |
| pw.println(" ActiveSubInfoList:"); |
| for (SubscriptionInfo entry : sirl) { |
| pw.println(" " + entry.toString()); |
| } |
| } else { |
| pw.println(" ActiveSubInfoList: is null"); |
| } |
| pw.flush(); |
| pw.println("++++++++++++++++++++++++++++++++"); |
| |
| sirl = getAllSubInfoList(mContext.getOpPackageName(), mContext.getAttributionTag()); |
| if (sirl != null) { |
| pw.println(" AllSubInfoList:"); |
| for (SubscriptionInfo entry : sirl) { |
| pw.println(" " + entry.toString()); |
| } |
| } else { |
| pw.println(" AllSubInfoList: is null"); |
| } |
| pw.flush(); |
| pw.println("++++++++++++++++++++++++++++++++"); |
| |
| mLocalLog.dump(fd, pw, args); |
| pw.flush(); |
| pw.println("++++++++++++++++++++++++++++++++"); |
| pw.flush(); |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| /** |
| * Migrating Ims settings from global setting to subscription DB, if not already done. |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PRIVATE) |
| public void migrateImsSettings() { |
| migrateImsSettingHelper( |
| Settings.Global.ENHANCED_4G_MODE_ENABLED, |
| SubscriptionManager.ENHANCED_4G_MODE_ENABLED); |
| migrateImsSettingHelper( |
| Settings.Global.VT_IMS_ENABLED, |
| SubscriptionManager.VT_IMS_ENABLED); |
| migrateImsSettingHelper( |
| Settings.Global.WFC_IMS_ENABLED, |
| SubscriptionManager.WFC_IMS_ENABLED); |
| migrateImsSettingHelper( |
| Settings.Global.WFC_IMS_MODE, |
| SubscriptionManager.WFC_IMS_MODE); |
| migrateImsSettingHelper( |
| Settings.Global.WFC_IMS_ROAMING_MODE, |
| SubscriptionManager.WFC_IMS_ROAMING_MODE); |
| migrateImsSettingHelper( |
| Settings.Global.WFC_IMS_ROAMING_ENABLED, |
| SubscriptionManager.WFC_IMS_ROAMING_ENABLED); |
| } |
| |
| private void migrateImsSettingHelper(String settingGlobal, String subscriptionProperty) { |
| ContentResolver resolver = mContext.getContentResolver(); |
| int defaultSubId = getDefaultVoiceSubId(); |
| if (defaultSubId == SubscriptionManager.INVALID_SUBSCRIPTION_ID) { |
| return; |
| } |
| try { |
| int prevSetting = Settings.Global.getInt(resolver, settingGlobal); |
| |
| if (prevSetting != DEPRECATED_SETTING) { |
| // Write previous setting into Subscription DB. |
| setSubscriptionPropertyIntoContentResolver(defaultSubId, subscriptionProperty, |
| Integer.toString(prevSetting), resolver); |
| // Write global setting value with DEPRECATED_SETTING making sure |
| // migration only happen once. |
| Settings.Global.putInt(resolver, settingGlobal, DEPRECATED_SETTING); |
| } |
| } catch (Settings.SettingNotFoundException e) { |
| } |
| } |
| |
| /** |
| * Set whether a subscription is opportunistic. |
| * |
| * Throws SecurityException if doesn't have required permission. |
| * |
| * @param opportunistic whether it’s opportunistic subscription. |
| * @param subId the unique SubscriptionInfo index in database |
| * @param callingPackage The package making the IPC. |
| * @return the number of records updated |
| */ |
| @Override |
| public int setOpportunistic(boolean opportunistic, int subId, String callingPackage) { |
| try { |
| TelephonyPermissions.enforceCallingOrSelfModifyPermissionOrCarrierPrivilege( |
| mContext, subId, callingPackage); |
| } catch (SecurityException e) { |
| // The subscription may be inactive eSIM profile. If so, check the access rule in |
| // database. |
| enforceCarrierPrivilegeOnInactiveSub(subId, callingPackage, |
| "Caller requires permission on sub " + subId); |
| } |
| |
| long token = Binder.clearCallingIdentity(); |
| try { |
| int ret = setSubscriptionProperty(subId, SubscriptionManager.IS_OPPORTUNISTIC, |
| String.valueOf(opportunistic ? 1 : 0)); |
| |
| if (ret != 0) notifySubscriptionInfoChanged(); |
| |
| return ret; |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| /** |
| * Get subscription info from database, and check whether caller has carrier privilege |
| * permission with it. If checking fails, throws SecurityException. |
| */ |
| private void enforceCarrierPrivilegeOnInactiveSub(int subId, String callingPackage, |
| String message) { |
| mAppOps.checkPackage(Binder.getCallingUid(), callingPackage); |
| |
| SubscriptionManager subManager = (SubscriptionManager) |
| mContext.getSystemService(Context.TELEPHONY_SUBSCRIPTION_SERVICE); |
| List<SubscriptionInfo> subInfo = getSubInfo( |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=" + subId, null); |
| |
| try { |
| if (!isActiveSubId(subId) && subInfo != null && subInfo.size() == 1 |
| && subManager.canManageSubscription(subInfo.get(0), callingPackage)) { |
| return; |
| } |
| throw new SecurityException(message); |
| } catch (IllegalArgumentException e) { |
| // canManageSubscription will throw IllegalArgumentException if sub is not embedded |
| // or package name is unknown. In this case, we also see it as permission check failure |
| // and throw a SecurityException. |
| throw new SecurityException(message); |
| } |
| } |
| |
| @Override |
| public void setPreferredDataSubscriptionId(int subId, boolean needValidation, |
| ISetOpportunisticDataCallback callback) { |
| enforceModifyPhoneState("setPreferredDataSubscriptionId"); |
| final long token = Binder.clearCallingIdentity(); |
| |
| try { |
| PhoneSwitcher phoneSwitcher = PhoneSwitcher.getInstance(); |
| if (phoneSwitcher == null) { |
| logd("Set preferred data sub: phoneSwitcher is null."); |
| AnomalyReporter.reportAnomaly( |
| UUID.fromString("a3ab0b9d-f2aa-4baf-911d-7096c0d4645a"), |
| "Set preferred data sub: phoneSwitcher is null."); |
| if (callback != null) { |
| try { |
| callback.onComplete(SET_OPPORTUNISTIC_SUB_REMOTE_SERVICE_EXCEPTION); |
| } catch (RemoteException exception) { |
| logd("RemoteException " + exception); |
| } |
| } |
| return; |
| } |
| |
| phoneSwitcher.trySetOpportunisticDataSubscription(subId, needValidation, callback); |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| @Override |
| public int getPreferredDataSubscriptionId() { |
| enforceReadPrivilegedPhoneState("getPreferredDataSubscriptionId"); |
| final long token = Binder.clearCallingIdentity(); |
| |
| try { |
| PhoneSwitcher phoneSwitcher = PhoneSwitcher.getInstance(); |
| if (phoneSwitcher == null) { |
| AnomalyReporter.reportAnomaly( |
| UUID.fromString("a3ab0b9d-f2aa-4baf-911d-7096c0d4645a"), |
| "Get preferred data sub: phoneSwitcher is null."); |
| return SubscriptionManager.DEFAULT_SUBSCRIPTION_ID; |
| } |
| |
| return phoneSwitcher.getOpportunisticDataSubscriptionId(); |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| @Override |
| public List<SubscriptionInfo> getOpportunisticSubscriptions(String callingPackage, |
| String callingFeatureId) { |
| return getSubscriptionInfoListFromCacheHelper(callingPackage, callingFeatureId, |
| makeCacheListCopyWithLock(mCacheOpportunisticSubInfoList)); |
| } |
| |
| /** |
| * Inform SubscriptionManager that subscriptions in the list are bundled |
| * as a group. Typically it's a primary subscription and an opportunistic |
| * subscription. It should only affect multi-SIM scenarios where primary |
| * and opportunistic subscriptions can be activated together. |
| * Being in the same group means they might be activated or deactivated |
| * together, some of them may be invisible to the users, etc. |
| * |
| * Caller will either have {@link android.Manifest.permission#MODIFY_PHONE_STATE} |
| * permission or had carrier privilege permission on the subscriptions: |
| * {@link TelephonyManager#hasCarrierPrivileges(int)} or |
| * {@link SubscriptionManager#canManageSubscription(SubscriptionInfo)} |
| * |
| * @throws SecurityException if the caller doesn't meet the requirements |
| * outlined above. |
| * @throws IllegalArgumentException if the some subscriptions in the list doesn't exist. |
| * |
| * @param subIdList list of subId that will be in the same group |
| * @return groupUUID a UUID assigned to the subscription group. It returns |
| * null if fails. |
| * |
| */ |
| @Override |
| public ParcelUuid createSubscriptionGroup(int[] subIdList, String callingPackage) { |
| if (subIdList == null || subIdList.length == 0) { |
| throw new IllegalArgumentException("Invalid subIdList " + subIdList); |
| } |
| |
| // Makes sure calling package matches caller UID. |
| mAppOps.checkPackage(Binder.getCallingUid(), callingPackage); |
| // If it doesn't have modify phone state permission, or carrier privilege permission, |
| // a SecurityException will be thrown. |
| if (mContext.checkCallingOrSelfPermission(android.Manifest.permission.MODIFY_PHONE_STATE) |
| != PERMISSION_GRANTED && !checkCarrierPrivilegeOnSubList( |
| subIdList, callingPackage)) { |
| throw new SecurityException("CreateSubscriptionGroup needs MODIFY_PHONE_STATE or" |
| + " carrier privilege permission on all specified subscriptions"); |
| } |
| |
| long identity = Binder.clearCallingIdentity(); |
| |
| try { |
| // Generate a UUID. |
| ParcelUuid groupUUID = new ParcelUuid(UUID.randomUUID()); |
| |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.GROUP_UUID, groupUUID.toString()); |
| value.put(SubscriptionManager.GROUP_OWNER, callingPackage); |
| int result = mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, |
| value, getSelectionForSubIdList(subIdList), null); |
| |
| if (DBG) logdl("createSubscriptionGroup update DB result: " + result); |
| |
| refreshCachedActiveSubscriptionInfoList(); |
| |
| notifySubscriptionInfoChanged(); |
| |
| MultiSimSettingController.getInstance().notifySubscriptionGroupChanged(groupUUID); |
| |
| return groupUUID; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| private String getOwnerPackageOfSubGroup(ParcelUuid groupUuid) { |
| if (groupUuid == null) return null; |
| |
| List<SubscriptionInfo> infoList = getSubInfo(SubscriptionManager.GROUP_UUID |
| + "=\'" + groupUuid.toString() + "\'", null); |
| |
| return ArrayUtils.isEmpty(infoList) ? null : infoList.get(0).getGroupOwner(); |
| } |
| |
| /** |
| * @param groupUuid a UUID assigned to the subscription group. |
| * @param callingPackage the package making the IPC. |
| * @return if callingPackage has carrier privilege on sublist. |
| * |
| */ |
| public boolean canPackageManageGroup(ParcelUuid groupUuid, String callingPackage) { |
| if (groupUuid == null) { |
| throw new IllegalArgumentException("Invalid groupUuid"); |
| } |
| |
| if (TextUtils.isEmpty(callingPackage)) { |
| throw new IllegalArgumentException("Empty callingPackage"); |
| } |
| |
| List<SubscriptionInfo> infoList; |
| |
| // Getting all subscriptions in the group. |
| long identity = Binder.clearCallingIdentity(); |
| try { |
| infoList = getSubInfo(SubscriptionManager.GROUP_UUID |
| + "=\'" + groupUuid.toString() + "\'", null); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| |
| // If the group does not exist, then by default the UUID is up for grabs so no need to |
| // restrict management of a group (that someone may be attempting to create). |
| if (ArrayUtils.isEmpty(infoList)) { |
| return true; |
| } |
| |
| // If the calling package is the group owner, skip carrier permission check and return |
| // true as it was done before. |
| if (callingPackage.equals(infoList.get(0).getGroupOwner())) return true; |
| |
| // Check carrier privilege for all subscriptions in the group. |
| int[] subIdArray = infoList.stream().mapToInt(info -> info.getSubscriptionId()) |
| .toArray(); |
| return (checkCarrierPrivilegeOnSubList(subIdArray, callingPackage)); |
| } |
| |
| private int updateGroupOwner(ParcelUuid groupUuid, String groupOwner) { |
| // If the existing group owner is different from current caller, make caller the new |
| // owner of all subscriptions in group. |
| // This is for use-case of: |
| // 1) Both package1 and package2 has permission (MODIFY_PHONE_STATE or carrier |
| // privilege permission) of all related subscriptions. |
| // 2) Package 1 created a group. |
| // 3) Package 2 wants to add a subscription into it. |
| // Step 3 should be granted as all operations are permission based. Which means as |
| // long as the package passes the permission check, it can modify the subscription |
| // and the group. And package 2 becomes the new group owner as it's the last to pass |
| // permission checks on all members. |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.GROUP_OWNER, groupOwner); |
| return mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, |
| value, SubscriptionManager.GROUP_UUID + "=\"" + groupUuid + "\"", null); |
| } |
| |
| @Override |
| public void addSubscriptionsIntoGroup(int[] subIdList, ParcelUuid groupUuid, |
| String callingPackage) { |
| if (subIdList == null || subIdList.length == 0) { |
| throw new IllegalArgumentException("Invalid subId list"); |
| } |
| |
| if (groupUuid == null || groupUuid.equals(INVALID_GROUP_UUID)) { |
| throw new IllegalArgumentException("Invalid groupUuid"); |
| } |
| |
| // Makes sure calling package matches caller UID. |
| mAppOps.checkPackage(Binder.getCallingUid(), callingPackage); |
| // If it doesn't have modify phone state permission, or carrier privilege permission, |
| // a SecurityException will be thrown. |
| if (mContext.checkCallingOrSelfPermission(android.Manifest.permission.MODIFY_PHONE_STATE) |
| != PERMISSION_GRANTED && !(checkCarrierPrivilegeOnSubList(subIdList, callingPackage) |
| && canPackageManageGroup(groupUuid, callingPackage))) { |
| throw new SecurityException("Requires MODIFY_PHONE_STATE or carrier privilege" |
| + " permissions on subscriptions and the group."); |
| } |
| |
| long identity = Binder.clearCallingIdentity(); |
| |
| try { |
| if (DBG) { |
| logdl("addSubscriptionsIntoGroup sub list " |
| + Arrays.toString(subIdList) + " into group " + groupUuid); |
| } |
| |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.GROUP_UUID, groupUuid.toString()); |
| int result = mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, |
| value, getSelectionForSubIdList(subIdList), null); |
| |
| if (DBG) logdl("addSubscriptionsIntoGroup update DB result: " + result); |
| |
| if (result > 0) { |
| updateGroupOwner(groupUuid, callingPackage); |
| refreshCachedActiveSubscriptionInfoList(); |
| notifySubscriptionInfoChanged(); |
| MultiSimSettingController.getInstance().notifySubscriptionGroupChanged(groupUuid); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Remove a list of subscriptions from their subscription group. |
| * See {@link SubscriptionManager#createSubscriptionGroup(List<Integer>)} for more details. |
| * |
| * Caller will either have {@link android.Manifest.permission#MODIFY_PHONE_STATE} |
| * permission or had carrier privilege permission on the subscriptions: |
| * {@link TelephonyManager#hasCarrierPrivileges()} or |
| * {@link SubscriptionManager#canManageSubscription(SubscriptionInfo)} |
| * |
| * @throws SecurityException if the caller doesn't meet the requirements |
| * outlined above. |
| * @throws IllegalArgumentException if the some subscriptions in the list doesn't belong |
| * the specified group. |
| * |
| * @param subIdList list of subId that need removing from their groups. |
| * |
| */ |
| public void removeSubscriptionsFromGroup(int[] subIdList, ParcelUuid groupUuid, |
| String callingPackage) { |
| if (subIdList == null || subIdList.length == 0) { |
| return; |
| } |
| |
| // Makes sure calling package matches caller UID. |
| mAppOps.checkPackage(Binder.getCallingUid(), callingPackage); |
| // If it doesn't have modify phone state permission, or carrier privilege permission, |
| // a SecurityException will be thrown. If it's due to invalid parameter or internal state, |
| // it will return null. |
| if (mContext.checkCallingOrSelfPermission(android.Manifest.permission.MODIFY_PHONE_STATE) |
| != PERMISSION_GRANTED && !(checkCarrierPrivilegeOnSubList(subIdList, callingPackage) |
| && canPackageManageGroup(groupUuid, callingPackage))) { |
| throw new SecurityException("removeSubscriptionsFromGroup needs MODIFY_PHONE_STATE or" |
| + " carrier privilege permission on all specified subscriptions"); |
| } |
| |
| long identity = Binder.clearCallingIdentity(); |
| |
| try { |
| List<SubscriptionInfo> subInfoList = getSubInfo(getSelectionForSubIdList(subIdList), |
| null); |
| for (SubscriptionInfo info : subInfoList) { |
| if (!groupUuid.equals(info.getGroupUuid())) { |
| throw new IllegalArgumentException("Subscription " + info.getSubscriptionId() |
| + " doesn't belong to group " + groupUuid); |
| } |
| } |
| ContentValues value = new ContentValues(); |
| value.put(SubscriptionManager.GROUP_UUID, (String) null); |
| value.put(SubscriptionManager.GROUP_OWNER, (String) null); |
| int result = mContext.getContentResolver().update(SubscriptionManager.CONTENT_URI, |
| value, getSelectionForSubIdList(subIdList), null); |
| |
| if (DBG) logdl("removeSubscriptionsFromGroup update DB result: " + result); |
| |
| if (result > 0) { |
| updateGroupOwner(groupUuid, callingPackage); |
| refreshCachedActiveSubscriptionInfoList(); |
| notifySubscriptionInfoChanged(); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Helper function to check if the caller has carrier privilege permissions on a list of subId. |
| * The check can either be processed against access rules on currently active SIM cards, or |
| * the access rules we keep in our database for currently inactive eSIMs. |
| * |
| * @throws IllegalArgumentException if the some subId is invalid or doesn't exist. |
| * |
| * @return true if checking passes on all subId, false otherwise. |
| */ |
| private boolean checkCarrierPrivilegeOnSubList(int[] subIdList, String callingPackage) { |
| // Check carrier privilege permission on active subscriptions first. |
| // If it fails, they could be inactive. So keep them in a HashSet and later check |
| // access rules in our database. |
| Set<Integer> checkSubList = new HashSet<>(); |
| for (int subId : subIdList) { |
| if (isActiveSubId(subId)) { |
| if (!mTelephonyManager.hasCarrierPrivileges(subId)) { |
| return false; |
| } |
| } else { |
| checkSubList.add(subId); |
| } |
| } |
| |
| if (checkSubList.isEmpty()) { |
| return true; |
| } |
| |
| long identity = Binder.clearCallingIdentity(); |
| |
| try { |
| // Check access rules for each sub info. |
| SubscriptionManager subscriptionManager = (SubscriptionManager) |
| mContext.getSystemService(Context.TELEPHONY_SUBSCRIPTION_SERVICE); |
| List<SubscriptionInfo> subInfoList = getSubInfo( |
| getSelectionForSubIdList(subIdList), null); |
| |
| // Didn't find all the subscriptions specified in subIdList. |
| if (subInfoList == null || subInfoList.size() != subIdList.length) { |
| throw new IllegalArgumentException("Invalid subInfoList."); |
| } |
| |
| for (SubscriptionInfo subInfo : subInfoList) { |
| if (checkSubList.contains(subInfo.getSubscriptionId())) { |
| if (subInfo.isEmbedded() && subscriptionManager.canManageSubscription( |
| subInfo, callingPackage)) { |
| checkSubList.remove(subInfo.getSubscriptionId()); |
| } else { |
| return false; |
| } |
| } |
| } |
| |
| return checkSubList.isEmpty(); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * Helper function to create selection argument of a list of subId. |
| * The result should be: "in (subId1, subId2, ...)". |
| */ |
| public static String getSelectionForSubIdList(int[] subId) { |
| StringBuilder selection = new StringBuilder(); |
| selection.append(SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID); |
| selection.append(" IN ("); |
| for (int i = 0; i < subId.length - 1; i++) { |
| selection.append(subId[i] + ", "); |
| } |
| selection.append(subId[subId.length - 1]); |
| selection.append(")"); |
| |
| return selection.toString(); |
| } |
| |
| /** |
| * Helper function to create selection argument of a list of subId. |
| * The result should be: "in (iccId1, iccId2, ...)". |
| */ |
| private String getSelectionForIccIdList(String[] iccIds) { |
| StringBuilder selection = new StringBuilder(); |
| selection.append(SubscriptionManager.ICC_ID); |
| selection.append(" IN ("); |
| for (int i = 0; i < iccIds.length - 1; i++) { |
| selection.append("\"" + iccIds[i] + "\", "); |
| } |
| selection.append("\"" + iccIds[iccIds.length - 1] + "\""); |
| selection.append(")"); |
| |
| return selection.toString(); |
| } |
| |
| /** |
| * Get subscriptionInfo list of subscriptions that are in the same group of given subId. |
| * See {@link #createSubscriptionGroup(int[], String)} for more details. |
| * |
| * Caller will either have {@link android.Manifest.permission#READ_PHONE_STATE} |
| * permission or had carrier privilege permission on the subscription. |
| * {@link TelephonyManager#hasCarrierPrivileges(int)} |
| * |
| * @throws SecurityException if the caller doesn't meet the requirements |
| * outlined above. |
| * |
| * @param groupUuid of which list of subInfo will be returned. |
| * @return list of subscriptionInfo that belong to the same group, including the given |
| * subscription itself. It will return an empty list if no subscription belongs to the group. |
| * |
| */ |
| @Override |
| public List<SubscriptionInfo> getSubscriptionsInGroup(ParcelUuid groupUuid, |
| String callingPackage, String callingFeatureId) { |
| long identity = Binder.clearCallingIdentity(); |
| List<SubscriptionInfo> subInfoList; |
| |
| try { |
| subInfoList = getAllSubInfoList(mContext.getOpPackageName(), |
| mContext.getAttributionTag()); |
| if (groupUuid == null || subInfoList == null || subInfoList.isEmpty()) { |
| return new ArrayList<>(); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| |
| return subInfoList.stream().filter(info -> { |
| if (!groupUuid.equals(info.getGroupUuid())) return false; |
| int subId = info.getSubscriptionId(); |
| return TelephonyPermissions.checkCallingOrSelfReadPhoneState(mContext, subId, |
| callingPackage, callingFeatureId, "getSubscriptionsInGroup") |
| || info.canManageSubscription(mContext, callingPackage); |
| }).map(subscriptionInfo -> conditionallyRemoveIdentifiers(subscriptionInfo, |
| callingPackage, callingFeatureId, "getSubscriptionsInGroup")) |
| .collect(Collectors.toList()); |
| |
| } |
| |
| public ParcelUuid getGroupUuid(int subId) { |
| ParcelUuid groupUuid; |
| List<SubscriptionInfo> subInfo = getSubInfo(SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID |
| + "=" + subId, null); |
| if (subInfo == null || subInfo.size() == 0) { |
| groupUuid = null; |
| } else { |
| groupUuid = subInfo.get(0).getGroupUuid(); |
| } |
| |
| return groupUuid; |
| } |
| |
| |
| /** |
| * Enable/Disable a subscription |
| * @param enable true if enabling, false if disabling |
| * @param subId the unique SubInfoRecord index in database |
| * |
| * @return true if success, false if fails or the further action is |
| * needed hence it's redirected to Euicc. |
| */ |
| @Override |
| public boolean setSubscriptionEnabled(boolean enable, int subId) { |
| enforceModifyPhoneState("setSubscriptionEnabled"); |
| |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| logd("setSubscriptionEnabled" + (enable ? " enable " : " disable ") |
| + " subId " + subId); |
| |
| // Error checking. |
| if (!SubscriptionManager.isUsableSubscriptionId(subId)) { |
| throw new IllegalArgumentException( |
| "setSubscriptionEnabled not usable subId " + subId); |
| } |
| |
| // Nothing to do if it's already active or inactive. |
| if (enable == isActiveSubscriptionId(subId)) return true; |
| |
| SubscriptionInfo info = SubscriptionController.getInstance() |
| .getAllSubInfoList(mContext.getOpPackageName(), mContext.getAttributionTag()) |
| .stream() |
| .filter(subInfo -> subInfo.getSubscriptionId() == subId) |
| .findFirst() |
| .get(); |
| |
| if (info == null) { |
| logd("setSubscriptionEnabled subId " + subId + " doesn't exist."); |
| return false; |
| } |
| |
| // TODO: make sure after slot mapping, we enable the uicc applications for the |
| // subscription we are enabling. |
| if (info.isEmbedded()) { |
| return enableEmbeddedSubscription(info, enable); |
| } else { |
| return enablePhysicalSubscription(info, enable); |
| } |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| private boolean enableEmbeddedSubscription(SubscriptionInfo info, boolean enable) { |
| // We need to send intents to Euicc for operations: |
| |
| // 1) In single SIM mode, turning on a eSIM subscription while pSIM is the active slot. |
| // Euicc will ask user to switch to DSDS if supported or to confirm SIM slot |
| // switching. |
| // 2) In DSDS mode, turning on / off an eSIM profile. Euicc can ask user whether |
| // to turn on DSDS, or whether to switch from current active eSIM profile to it, or |
| // to simply show a progress dialog. |
| // 3) In future, similar operations on triple SIM devices. |
| enableSubscriptionOverEuiccManager(info.getSubscriptionId(), enable, |
| SubscriptionManager.INVALID_SIM_SLOT_INDEX); |
| // returning false to indicate state is not changed. If changed, a subscriptionInfo |
| // change will be filed separately. |
| return false; |
| |
| // TODO: uncomment or clean up if we decide whether to support standalone CBRS for Q. |
| // subId = enable ? subId : SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| // updateEnabledSubscriptionGlobalSetting(subId, physicalSlotIndex); |
| } |
| |
| private boolean enablePhysicalSubscription(SubscriptionInfo info, boolean enable) { |
| if (info == null || !SubscriptionManager.isValidSubscriptionId(info.getSubscriptionId())) { |
| return false; |
| } |
| |
| int subId = info.getSubscriptionId(); |
| |
| UiccSlotInfo slotInfo = null; |
| int physicalSlotIndex = SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| UiccSlotInfo[] slotsInfo = mTelephonyManager.getUiccSlotsInfo(); |
| if (slotsInfo == null) return false; |
| for (int i = 0; i < slotsInfo.length; i++) { |
| UiccSlotInfo curSlotInfo = slotsInfo[i]; |
| if (curSlotInfo.getCardStateInfo() == CARD_STATE_INFO_PRESENT) { |
| if (TextUtils.equals(IccUtils.stripTrailingFs(curSlotInfo.getCardId()), |
| IccUtils.stripTrailingFs(info.getCardString()))) { |
| slotInfo = curSlotInfo; |
| physicalSlotIndex = i; |
| break; |
| } |
| } |
| } |
| |
| // Can't find the existing SIM. |
| if (slotInfo == null) return false; |
| |
| if (enable && !slotInfo.getIsActive()) { |
| // We need to send intents to Euicc if we are turning on an inactive slot. |
| // Euicc will decide whether to ask user to switch to DSDS, or change SIM |
| // slot mapping. |
| EuiccManager euiccManager = |
| (EuiccManager) mContext.getSystemService(Context.EUICC_SERVICE); |
| if (euiccManager != null && euiccManager.isEnabled()) { |
| enableSubscriptionOverEuiccManager(subId, enable, physicalSlotIndex); |
| } else { |
| // Enable / disable uicc applications. |
| if (!info.areUiccApplicationsEnabled()) setUiccApplicationsEnabled(enable, subId); |
| // If euiccManager is not enabled, we try to switch to DSDS if possible, |
| // or switch slot if not. |
| if (mTelephonyManager.isMultiSimSupported() == MULTISIM_ALLOWED) { |
| PhoneConfigurationManager.getInstance().switchMultiSimConfig( |
| mTelephonyManager.getSupportedModemCount()); |
| } else { |
| UiccController.getInstance().switchSlots(new int[]{physicalSlotIndex}, null); |
| } |
| } |
| return true; |
| } else { |
| // Enable / disable uicc applications. |
| setUiccApplicationsEnabled(enable, subId); |
| return true; |
| } |
| } |
| |
| private void enableSubscriptionOverEuiccManager(int subId, boolean enable, |
| int physicalSlotIndex) { |
| logdl("enableSubscriptionOverEuiccManager" + (enable ? " enable " : " disable ") |
| + "subId " + subId + " on slotIndex " + physicalSlotIndex); |
| Intent intent = new Intent(EuiccManager.ACTION_TOGGLE_SUBSCRIPTION_PRIVILEGED); |
| intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK); |
| intent.putExtra(EuiccManager.EXTRA_SUBSCRIPTION_ID, subId); |
| intent.putExtra(EuiccManager.EXTRA_ENABLE_SUBSCRIPTION, enable); |
| if (physicalSlotIndex != SubscriptionManager.INVALID_SIM_SLOT_INDEX) { |
| intent.putExtra(EuiccManager.EXTRA_PHYSICAL_SLOT_ID, physicalSlotIndex); |
| } |
| mContext.startActivity(intent); |
| } |
| |
| private void updateEnabledSubscriptionGlobalSetting(int subId, int physicalSlotIndex) { |
| // Write the value which subscription is enabled into global setting. |
| Settings.Global.putInt(mContext.getContentResolver(), |
| Settings.Global.ENABLED_SUBSCRIPTION_FOR_SLOT + physicalSlotIndex, subId); |
| } |
| |
| private void updateModemStackEnabledGlobalSetting(boolean enabled, int physicalSlotIndex) { |
| // Write the whether a modem stack is disabled into global setting. |
| Settings.Global.putInt(mContext.getContentResolver(), |
| Settings.Global.MODEM_STACK_ENABLED_FOR_SLOT |
| + physicalSlotIndex, enabled ? 1 : 0); |
| } |
| |
| private int getPhysicalSlotIndex(boolean isEmbedded, int subId) { |
| UiccSlotInfo[] slotInfos = mTelephonyManager.getUiccSlotsInfo(); |
| int logicalSlotIndex = getSlotIndex(subId); |
| int physicalSlotIndex = SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| boolean isLogicalSlotIndexValid = SubscriptionManager.isValidSlotIndex(logicalSlotIndex); |
| |
| for (int i = 0; i < slotInfos.length; i++) { |
| // If we can know the logicalSlotIndex from subId, we should find the exact matching |
| // physicalSlotIndex. However for some cases like inactive eSIM, the logicalSlotIndex |
| // will be -1. In this case, we assume there's only one eSIM, and return the |
| // physicalSlotIndex of that eSIM. |
| if ((isLogicalSlotIndexValid && slotInfos[i].getLogicalSlotIdx() == logicalSlotIndex) |
| || (!isLogicalSlotIndexValid && slotInfos[i].getIsEuicc() && isEmbedded)) { |
| physicalSlotIndex = i; |
| break; |
| } |
| } |
| |
| return physicalSlotIndex; |
| } |
| |
| private int getPhysicalSlotIndexFromLogicalSlotIndex(int logicalSlotIndex) { |
| int physicalSlotIndex = SubscriptionManager.INVALID_SIM_SLOT_INDEX; |
| UiccSlotInfo[] slotInfos = mTelephonyManager.getUiccSlotsInfo(); |
| for (int i = 0; i < slotInfos.length; i++) { |
| if (slotInfos[i].getLogicalSlotIdx() == logicalSlotIndex) { |
| physicalSlotIndex = i; |
| break; |
| } |
| } |
| |
| return physicalSlotIndex; |
| } |
| |
| @Override |
| public boolean isSubscriptionEnabled(int subId) { |
| // TODO: b/123314365 support multi-eSIM and removable eSIM. |
| enforceReadPrivilegedPhoneState("isSubscriptionEnabled"); |
| |
| long identity = Binder.clearCallingIdentity(); |
| try { |
| // Error checking. |
| if (!SubscriptionManager.isUsableSubscriptionId(subId)) { |
| throw new IllegalArgumentException( |
| "isSubscriptionEnabled not usable subId " + subId); |
| } |
| |
| List<SubscriptionInfo> infoList = getSubInfo( |
| SubscriptionManager.UNIQUE_KEY_SUBSCRIPTION_ID + "=" + subId, null); |
| if (infoList == null || infoList.isEmpty()) { |
| // Subscription doesn't exist. |
| return false; |
| } |
| |
| boolean isEmbedded = infoList.get(0).isEmbedded(); |
| |
| if (isEmbedded) { |
| return isActiveSubId(subId); |
| } else { |
| // For pSIM, we also need to check if modem is disabled or not. |
| return isActiveSubId(subId) && PhoneConfigurationManager.getInstance() |
| .getPhoneStatus(PhoneFactory.getPhone(getPhoneId(subId))); |
| } |
| |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| @Override |
| public int getEnabledSubscriptionId(int logicalSlotIndex) { |
| // TODO: b/123314365 support multi-eSIM and removable eSIM. |
| enforceReadPrivilegedPhoneState("getEnabledSubscriptionId"); |
| |
| long identity = Binder.clearCallingIdentity(); |
| try { |
| if (!SubscriptionManager.isValidPhoneId(logicalSlotIndex)) { |
| throw new IllegalArgumentException( |
| "getEnabledSubscriptionId with invalid logicalSlotIndex " |
| + logicalSlotIndex); |
| } |
| |
| // Getting and validating the physicalSlotIndex. |
| int physicalSlotIndex = getPhysicalSlotIndexFromLogicalSlotIndex(logicalSlotIndex); |
| if (physicalSlotIndex == SubscriptionManager.INVALID_SIM_SLOT_INDEX) { |
| return SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| } |
| |
| // if modem stack is disabled, return INVALID_SUBSCRIPTION_ID without reading |
| // Settings.Global.ENABLED_SUBSCRIPTION_FOR_SLOT. |
| int modemStackEnabled = Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.MODEM_STACK_ENABLED_FOR_SLOT + physicalSlotIndex, 1); |
| if (modemStackEnabled != 1) { |
| return SubscriptionManager.INVALID_SUBSCRIPTION_ID; |
| } |
| |
| int subId; |
| try { |
| subId = Settings.Global.getInt(mContext.getContentResolver(), |
| Settings.Global.ENABLED_SUBSCRIPTION_FOR_SLOT + physicalSlotIndex); |
| } catch (Settings.SettingNotFoundException e) { |
| // Value never set. Return whether it's currently active. |
| subId = getSubIdUsingPhoneId(logicalSlotIndex); |
| } |
| |
| return subId; |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| // Helper function of getOpportunisticSubscriptions and getActiveSubscriptionInfoList. |
| // They are doing similar things except operating on different cache. |
| private List<SubscriptionInfo> getSubscriptionInfoListFromCacheHelper( |
| String callingPackage, String callingFeatureId, List<SubscriptionInfo> cacheSubList) { |
| boolean canReadPhoneState = false; |
| boolean canReadIdentifiers = false; |
| boolean canReadPhoneNumber = false; |
| try { |
| canReadPhoneState = TelephonyPermissions.checkReadPhoneState(mContext, |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID, Binder.getCallingPid(), |
| Binder.getCallingUid(), callingPackage, callingFeatureId, |
| "getSubscriptionInfoList"); |
| // If the calling package has the READ_PHONE_STATE permission then check if the caller |
| // also has access to subscriber identifiers and the phone number to ensure that the ICC |
| // ID and any other unique identifiers are removed if the caller should not have access. |
| if (canReadPhoneState) { |
| canReadIdentifiers = hasSubscriberIdentifierAccess( |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID, callingPackage, |
| callingFeatureId, "getSubscriptionInfoList"); |
| canReadPhoneNumber = hasPhoneNumberAccess( |
| SubscriptionManager.INVALID_SUBSCRIPTION_ID, callingPackage, |
| callingFeatureId, "getSubscriptionInfoList"); |
| } |
| } catch (SecurityException e) { |
| // If a SecurityException is thrown during the READ_PHONE_STATE check then the only way |
| // to access a subscription is to have carrier privileges for its subId; an app with |
| // carrier privileges for a subscription is also granted access to all identifiers so |
| // the identifier and phone number access checks are not required. |
| } |
| |
| if (canReadIdentifiers && canReadPhoneNumber) { |
| return cacheSubList; |
| } |
| // Filter the list to only include subscriptions which the caller can manage. |
| List<SubscriptionInfo> subscriptions = new ArrayList<>(cacheSubList.size()); |
| for (SubscriptionInfo subscriptionInfo : cacheSubList) { |
| int subId = subscriptionInfo.getSubscriptionId(); |
| boolean hasCarrierPrivileges = TelephonyPermissions.checkCarrierPrivilegeForSubId( |
| mContext, subId); |
| // If the caller does not have the READ_PHONE_STATE permission nor carrier |
| // privileges then they cannot access the current subscription. |
| if (!canReadPhoneState && !hasCarrierPrivileges) { |
| continue; |
| } |
| // If the caller has carrier privileges then they are granted access to all |
| // identifiers for their subscription. |
| if (hasCarrierPrivileges) { |
| subscriptions.add(subscriptionInfo); |
| } else { |
| // The caller does not have carrier privileges for this subId, filter the |
| // identifiers in the subscription based on the results of the initial |
| // permission checks. |
| subscriptions.add( |
| conditionallyRemoveIdentifiers(subscriptionInfo, canReadIdentifiers, |
| canReadPhoneNumber)); |
| } |
| } |
| return subscriptions; |
| } |
| |
| /** |
| * Conditionally removes identifiers from the provided {@code subInfo} if the {@code |
| * callingPackage} does not meet the access requirements for identifiers and returns the |
| * potentially modified object.. |
| * |
| * <p>If the caller does not meet the access requirements for identifiers a clone of the |
| * provided SubscriptionInfo is created and modified to avoid altering SubscriptionInfo objects |
| * in a cache. |
| */ |
| private SubscriptionInfo conditionallyRemoveIdentifiers(SubscriptionInfo subInfo, |
| String callingPackage, String callingFeatureId, String message) { |
| SubscriptionInfo result = subInfo; |
| int subId = subInfo.getSubscriptionId(); |
| boolean hasIdentifierAccess = hasSubscriberIdentifierAccess(subId, callingPackage, |
| callingFeatureId, message); |
| boolean hasPhoneNumberAccess = hasPhoneNumberAccess(subId, callingPackage, callingFeatureId, |
| message); |
| return conditionallyRemoveIdentifiers(subInfo, hasIdentifierAccess, hasPhoneNumberAccess); |
| } |
| |
| /** |
| * Conditionally removes identifiers from the provided {@code subInfo} based on if the calling |
| * package {@code hasIdentifierAccess} and {@code hasPhoneNumberAccess} and returns the |
| * potentially modified object. |
| * |
| * <p>If the caller specifies the package does not have identifier or phone number access |
| * a clone of the provided SubscriptionInfo is created and modified to avoid altering |
| * SubscriptionInfo objects in a cache. |
| */ |
| private SubscriptionInfo conditionallyRemoveIdentifiers(SubscriptionInfo subInfo, |
| boolean hasIdentifierAccess, boolean hasPhoneNumberAccess) { |
| if (hasIdentifierAccess && hasPhoneNumberAccess) { |
| return subInfo; |
| } |
| SubscriptionInfo result = new SubscriptionInfo(subInfo); |
| if (!hasIdentifierAccess) { |
| result.clearIccId(); |
| result.clearCardString(); |
| } |
| if (!hasPhoneNumberAccess) { |
| result.clearNumber(); |
| } |
| return result; |
| } |
| |
| private synchronized boolean addToSubIdList(int slotIndex, int subId, int subscriptionType) { |
| ArrayList<Integer> subIdsList = sSlotIndexToSubIds.getCopy(slotIndex); |
| if (subIdsList == null) { |
| subIdsList = new ArrayList<>(); |
| sSlotIndexToSubIds.put(slotIndex, subIdsList); |
| } |
| |
| // add the given subId unless it already exists |
| if (subIdsList.contains(subId)) { |
| logdl("slotIndex, subId combo already exists in the map. Not adding it again."); |
| return false; |
| } |
| if (isSubscriptionForRemoteSim(subscriptionType)) { |
| // For Remote SIM subscriptions, a slot can have multiple subscriptions. |
| sSlotIndexToSubIds.addToSubIdList(slotIndex, subId); |
| } else { |
| // for all other types of subscriptions, a slot can have only one subscription at a time |
| sSlotIndexToSubIds.clearSubIdList(slotIndex); |
| sSlotIndexToSubIds.addToSubIdList(slotIndex, subId); |
| } |
| |
| |
| // Remove the slot from sSlotIndexToSubIds if it has the same sub id with the added slot |
| for (Entry<Integer, ArrayList<Integer>> entry : sSlotIndexToSubIds.entrySet()) { |
| if (entry.getKey() != slotIndex && entry.getValue() != null |
| && entry.getValue().contains(subId)) { |
| logdl("addToSubIdList - remove " + entry.getKey()); |
| sSlotIndexToSubIds.remove(entry.getKey()); |
| } |
| } |
| |
| if (DBG) logdl("slotIndex, subId combo is added to the map."); |
| return true; |
| } |
| |
| private boolean isSubscriptionForRemoteSim(int subscriptionType) { |
| return subscriptionType == SubscriptionManager.SUBSCRIPTION_TYPE_REMOTE_SIM; |
| } |
| |
| /** |
| * This is only for testing |
| * @hide |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PRIVATE) |
| public Map<Integer, ArrayList<Integer>> getSlotIndexToSubIdsMap() { |
| return sSlotIndexToSubIds.getMap(); |
| } |
| |
| /** |
| * This is only for testing |
| * @hide |
| */ |
| @VisibleForTesting(visibility = VisibleForTesting.Visibility.PRIVATE) |
| public void resetStaticMembers() { |
| sDefaultFallbackSubId.set(SubscriptionManager.INVALID_SUBSCRIPTION_ID); |
| mDefaultPhoneId = SubscriptionManager.DEFAULT_PHONE_INDEX; |
| } |
| |
| private void notifyOpportunisticSubscriptionInfoChanged() { |
| TelephonyRegistryManager trm = |
| (TelephonyRegistryManager) |
| mContext.getSystemService(Context.TELEPHONY_REGISTRY_SERVICE); |
| if (DBG) logd("notifyOpptSubscriptionInfoChanged:"); |
| trm.notifyOpportunisticSubscriptionInfoChanged(); |
| } |
| |
| private void refreshCachedOpportunisticSubscriptionInfoList() { |
| List<SubscriptionInfo> subList = getSubInfo( |
| SubscriptionManager.IS_OPPORTUNISTIC + "=1 AND (" |
| + SubscriptionManager.SIM_SLOT_INDEX + ">=0 OR " |
| + SubscriptionManager.IS_EMBEDDED + "=1)", null); |
| synchronized (mSubInfoListLock) { |
| List<SubscriptionInfo> oldOpptCachedList = mCacheOpportunisticSubInfoList; |
| |
| if (subList != null) { |
| subList.sort(SUBSCRIPTION_INFO_COMPARATOR); |
| } else { |
| subList = new ArrayList<>(); |
| } |
| |
| mCacheOpportunisticSubInfoList = subList; |
| |
| for (SubscriptionInfo info : mCacheOpportunisticSubInfoList) { |
| if (shouldDisableSubGroup(info.getGroupUuid())) { |
| info.setGroupDisabled(true); |
| } |
| } |
| |
| if (DBG_CACHE) { |
| if (!mCacheOpportunisticSubInfoList.isEmpty()) { |
| for (SubscriptionInfo si : mCacheOpportunisticSubInfoList) { |
| logd("[refreshCachedOpptSubscriptionInfoList] Setting Cached info=" |
| + si); |
| } |
| } else { |
| logdl("[refreshCachedOpptSubscriptionInfoList]- no info return"); |
| } |
| } |
| |
| if (!oldOpptCachedList.equals(mCacheOpportunisticSubInfoList)) { |
| mOpptSubInfoListChangedDirtyBit.set(true); |
| } |
| } |
| } |
| |
| private boolean shouldDisableSubGroup(ParcelUuid groupUuid) { |
| if (groupUuid == null) return false; |
| |
| synchronized (mSubInfoListLock) { |
| for (SubscriptionInfo activeInfo : mCacheActiveSubInfoList) { |
| if (!activeInfo.isOpportunistic() && groupUuid.equals(activeInfo.getGroupUuid())) { |
| return false; |
| } |
| } |
| } |
| |
| return true; |
| } |
| |
| /** |
| * Set allowing mobile data during voice call. |
| * |
| * @param subId Subscription index |
| * @param rules Data enabled override rules in string format. See {@link DataEnabledOverride} |
| * for details. |
| * @return {@code true} if settings changed, otherwise {@code false}. |
| */ |
| public boolean setDataEnabledOverrideRules(int subId, @NonNull String rules) { |
| if (DBG) logd("[setDataEnabledOverrideRules]+ rules:" + rules + " subId:" + subId); |
| |
| validateSubId(subId); |
| ContentValues value = new ContentValues(1); |
| value.put(SubscriptionManager.DATA_ENABLED_OVERRIDE_RULES, rules); |
| |
| boolean result = updateDatabase(value, subId, true) > 0; |
| |
| if (result) { |
| // Refresh the Cache of Active Subscription Info List |
| refreshCachedActiveSubscriptionInfoList(); |
| notifySubscriptionInfoChanged(); |
| } |
| |
| return result; |
| } |
| |
| /** |
| * Get data enabled override rules. |
| * |
| * @param subId Subscription index |
| * @return Data enabled override rules in string |
| */ |
| @NonNull |
| public String getDataEnabledOverrideRules(int subId) { |
| return TelephonyUtils.emptyIfNull(getSubscriptionProperty(subId, |
| SubscriptionManager.DATA_ENABLED_OVERRIDE_RULES)); |
| } |
| |
| /** |
| * Get active data subscription id. |
| * |
| * @return Active data subscription id |
| * |
| * @hide |
| */ |
| @Override |
| public int getActiveDataSubscriptionId() { |
| final long token = Binder.clearCallingIdentity(); |
| |
| try { |
| PhoneSwitcher phoneSwitcher = PhoneSwitcher.getInstance(); |
| if (phoneSwitcher != null) { |
| int activeDataSubId = phoneSwitcher.getActiveDataSubId(); |
| if (SubscriptionManager.isUsableSubscriptionId(activeDataSubId)) { |
| return activeDataSubId; |
| } |
| } |
| // If phone switcher isn't ready, or active data sub id is not available, use default |
| // sub id from settings. |
| return getDefaultDataSubId(); |
| } finally { |
| Binder.restoreCallingIdentity(token); |
| } |
| } |
| |
| /** |
| * Whether it's supported to disable / re-enable a subscription on a physical (non-euicc) SIM. |
| */ |
| @Override |
| public boolean canDisablePhysicalSubscription() { |
| enforceReadPrivilegedPhoneState("canToggleUiccApplicationsEnablement"); |
| |
| final long identity = Binder.clearCallingIdentity(); |
| try { |
| Phone phone = PhoneFactory.getDefaultPhone(); |
| return phone != null && phone.canDisablePhysicalSubscription(); |
| } finally { |
| Binder.restoreCallingIdentity(identity); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| private void setGlobalSetting(String name, int value) { |
| Settings.Global.putInt(mContext.getContentResolver(), name, value); |
| if (name == Settings.Global.MULTI_SIM_DATA_CALL_SUBSCRIPTION) { |
| invalidateDefaultDataSubIdCaches(); |
| invalidateActiveDataSubIdCaches(); |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } else if (name == Settings.Global.MULTI_SIM_VOICE_CALL_SUBSCRIPTION) { |
| invalidateDefaultSubIdCaches(); |
| invalidateSlotIndexCaches(); |
| } else if (name == Settings.Global.MULTI_SIM_SMS_SUBSCRIPTION) { |
| invalidateDefaultSmsSubIdCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| private static void invalidateDefaultSubIdCaches() { |
| if (sCachingEnabled) { |
| SubscriptionManager.invalidateDefaultSubIdCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| private static void invalidateDefaultDataSubIdCaches() { |
| if (sCachingEnabled) { |
| SubscriptionManager.invalidateDefaultDataSubIdCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| private static void invalidateDefaultSmsSubIdCaches() { |
| if (sCachingEnabled) { |
| SubscriptionManager.invalidateDefaultSmsSubIdCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| protected static void invalidateActiveDataSubIdCaches() { |
| if (sCachingEnabled) { |
| SubscriptionManager.invalidateActiveDataSubIdCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| protected static void invalidateSlotIndexCaches() { |
| if (sCachingEnabled) { |
| SubscriptionManager.invalidateSlotIndexCaches(); |
| } |
| } |
| |
| /** |
| * @hide |
| */ |
| @VisibleForTesting |
| public static void disableCaching() { |
| sCachingEnabled = false; |
| } |
| |
| /** |
| * @hide |
| */ |
| @VisibleForTesting |
| public static void enableCaching() { |
| sCachingEnabled = true; |
| } |
| } |