| |
| import math |
| import random |
| import string |
| import unittest |
| import io |
| import unittest.mock as mock |
| import itertools |
| import warnings |
| import pickle |
| from copy import deepcopy |
| from itertools import repeat, product |
| from functools import reduce |
| from operator import mul |
| from collections import OrderedDict |
| |
| import torch |
| |
| # TODO: remove this global setting |
| # NN tests use double as the default dtype |
| torch.set_default_dtype(torch.double) |
| |
| from torch._six import inf, nan |
| import torch.backends.cudnn as cudnn |
| import torch.nn as nn |
| import torch.nn.functional as F |
| import torch.nn.init as init |
| import torch.nn.utils.rnn as rnn_utils |
| from torch.nn.utils import clip_grad_norm_, clip_grad_value_ |
| import torch.nn.utils.prune as prune |
| from torch.nn.utils import parameters_to_vector, vector_to_parameters |
| from torch.nn import Parameter |
| from torch.nn.parameter import UninitializedParameter, UninitializedBuffer |
| from torch.nn.parallel._functions import Broadcast |
| from torch.testing import get_all_fp_dtypes |
| from torch.testing._internal.common_utils import freeze_rng_state, run_tests, TestCase, skipIfNoLapack, skipIfRocm, \ |
| TEST_NUMPY, TEST_SCIPY, TEST_WITH_ROCM, download_file, \ |
| get_function_arglist, load_tests, repeat_test_for_types, ALL_TENSORTYPES, \ |
| ALL_TENSORTYPES2, suppress_warnings, TemporaryFileName, TEST_WITH_UBSAN, IS_PPC |
| from torch.testing._internal.common_cuda import TEST_CUDA, TEST_MULTIGPU, TEST_CUDNN, TEST_CUDNN_VERSION |
| from torch.testing._internal.common_nn import NNTestCase, NewModuleTest, CriterionTest, \ |
| module_tests, criterion_tests, loss_reference_fns, \ |
| ctcloss_reference, new_module_tests |
| from torch.testing._internal.common_device_type import instantiate_device_type_tests, dtypes, \ |
| dtypesIfCUDA, skipCUDAIfNoCudnn, skipCUDAIfCudnnVersionLessThan, onlyCUDA, onlyCPU, \ |
| skipCUDAIfRocm, skipCUDAIf, skipCUDAIfNotRocm, onlyOnCPUAndCUDA, \ |
| deviceCountAtLeast, expectedAlertNondeterministic, largeTensorTest |
| from torch.nn import MultiheadAttention |
| |
| from hypothesis import given |
| import torch.testing._internal.hypothesis_utils as hu |
| from torch.testing._internal.common_utils import _assertGradAndGradgradChecks, gradcheck, gradgradcheck |
| from torch.testing._internal.common_utils import dtype2prec_DONTUSE |
| from torch.testing._internal.common_cuda import tf32_on_and_off, tf32_is_not_fp32, tf32_off, tf32_on |
| from torch.types import _TensorOrTensors |
| |
| |
| AMPERE_OR_ROCM = TEST_WITH_ROCM or tf32_is_not_fp32() |
| |
| # load_tests from common_utils is used to automatically filter tests for |
| # sharding on sandcastle. This line silences flake warnings |
| load_tests = load_tests |
| |
| if TEST_SCIPY: |
| from scipy import stats |
| import scipy.ndimage |
| |
| if TEST_NUMPY: |
| import numpy as np |
| |
| DOUBLE_TENSORTYPES = [torch.double] |
| |
| |
| # WARNING: If you add a new top-level test case to this file, you MUST |
| # update test/run_test.py to list it, otherwise it will NOT be run in |
| # CI. |
| |
| |
| class PackedSequenceTest(TestCase): |
| |
| _type_by_name = { |
| 'torch.DoubleTensor': (torch.DoubleTensor, 'double'), |
| 'torch.FloatTensor': (torch.FloatTensor, 'float'), |
| # We leave out `'torch.HalfTensor': (torch.HalfTensor, 'half'),` |
| # because of an error in `pad_packed_sequence` |
| # > AttributeError: 'torch.HalfTensor' object has no attribute 'fill_' |
| 'torch.LongTensor': (torch.LongTensor, 'long'), |
| 'torch.IntTensor': (torch.IntTensor, 'int'), |
| 'torch.ShortTensor': (torch.ShortTensor, 'short'), |
| 'torch.CharTensor': (torch.CharTensor, 'char'), |
| 'torch.ByteTensor': (torch.ByteTensor, 'byte'), |
| } |
| |
| def __init__(self, *args, **kwargs): |
| super(PackedSequenceTest, self).__init__(*args, **kwargs) |
| self.batch_size = 5 |
| self.max_length = 6 |
| |
| def _ordered_sequence(self, tensor_type): |
| """Create ordered list of random sequences""" |
| seqs = [tensor_type(random.randint(1, self.max_length)) |
| for _ in range(self.batch_size)] |
| if tensor_type == torch.ByteTensor: |
| seqs = [s.random_(0, 256) for s in seqs] |
| else: |
| seqs = [s.random_(-128, 128) for s in seqs] |
| ordered = sorted(seqs, key=len, reverse=True) |
| return ordered |
| |
| def _padded_sequence(self, tensor_type): |
| """Create Tensor of random padded sequences""" |
| ordered = self._ordered_sequence(tensor_type) |
| lengths = [len(i) for i in ordered] |
| padded_tensor = rnn_utils.pad_sequence(ordered) |
| return padded_tensor, lengths |
| |
| def test_type_casts(self): |
| """Test type casting of `PackedSequence` against type casting of tensor""" |
| for _, (input_type, _) in self._type_by_name.items(): |
| for expected_type_str, (_, cast_str) in self._type_by_name.items(): |
| for enforce_sorted in [True, False]: |
| padded, lengths = self._padded_sequence(input_type) |
| packed = rnn_utils.pack_padded_sequence( |
| padded, lengths, enforce_sorted=enforce_sorted) |
| # Apply cast to `PackedSequence` instance and unpack |
| masked = getattr(packed, cast_str)() |
| unpacked, lengths_out = rnn_utils.pad_packed_sequence(masked) |
| self.assertEqual(unpacked.type(), expected_type_str) |
| |
| def test_wrong_order(self): |
| a = torch.ones(25, 300) |
| b = torch.ones(22, 300) |
| b_a = rnn_utils.pad_sequence([b, a]) |
| self.assertRaises( |
| RuntimeError, |
| lambda: rnn_utils.pack_padded_sequence(b_a, [22, 25], enforce_sorted=True)) |
| |
| def test_total_length(self): |
| padded, lengths = self._padded_sequence(torch.FloatTensor) |
| max_length = max(lengths) |
| packed = rnn_utils.pack_padded_sequence(padded, lengths) |
| # test ValueError if total_length < max_length |
| for total_length in (-1, 0, max_length - 1): |
| for batch_first in (True, False): |
| def err_fn(): |
| rnn_utils.pad_packed_sequence(packed, batch_first=batch_first, |
| total_length=total_length) |
| self.assertRaisesRegex(ValueError, |
| r'Expected total_length to be at least the ' |
| r'length of the longest sequence in input', |
| err_fn) |
| # test that pad_packed_sequence returns results of correct length |
| for batch_first in (True, False): |
| no_extra_pad, _ = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first) |
| for total_length_delta in (0, 1, 8): |
| total_length = max_length + total_length_delta |
| unpacked, lengths_out = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first, |
| total_length=total_length) |
| self.assertEqual(lengths, lengths_out) |
| self.assertEqual(unpacked.size(1 if batch_first else 0), total_length) |
| if total_length_delta == 0: |
| ref_output = no_extra_pad |
| elif batch_first: |
| extra_pad = no_extra_pad.new_zeros(self.batch_size, total_length_delta) |
| ref_output = torch.cat([no_extra_pad, extra_pad], 1) |
| else: |
| extra_pad = no_extra_pad.new_zeros(total_length_delta, self.batch_size) |
| ref_output = torch.cat([no_extra_pad, extra_pad], 0) |
| self.assertEqual(unpacked, ref_output) |
| |
| def test_to(self): |
| for enforce_sorted in (True, False): |
| padded, lengths = self._padded_sequence(torch.IntTensor) |
| a = rnn_utils.pack_padded_sequence( |
| padded, lengths, enforce_sorted=enforce_sorted).cpu() |
| |
| self.assertIs(a, a.to('cpu')) |
| self.assertIs(a, a.cpu()) |
| self.assertIs(a, a.to('cpu', dtype=torch.int32)) |
| self.assertEqual(a.long(), a.to(torch.int64)) |
| |
| if torch.cuda.is_available(): |
| for cuda in ['cuda', 'cuda:0' if torch.cuda.device_count() == 1 else 'cuda:1']: |
| b = a.cuda(device=cuda) |
| self.assertIs(b, b.to(cuda)) |
| self.assertIs(b, b.cuda()) |
| self.assertEqual(a, b.to('cpu')) |
| self.assertEqual(b, a.to(cuda)) |
| self.assertEqual(a, b.to('cpu', dtype=torch.int32)) |
| self.assertIs(b, b.to(dtype=torch.int32)) |
| self.assertEqual(b.long(), b.to(dtype=torch.int64)) |
| |
| def test_to_memory_format(self): |
| m = torch.nn.Conv2d(in_channels=16, out_channels=32, kernel_size=2, bias=True) |
| m = m.to(memory_format=torch.channels_last) |
| for param in m.parameters(): |
| if param.dim() == 4: |
| self.assertTrue(param.is_contiguous(memory_format=torch.channels_last)) |
| |
| class TestAvgPool(TestCase): |
| def _sum_pool2d(self, x, kernel_size): |
| windows = torch.nn.functional.unfold(x, kernel_size=kernel_size, stride=kernel_size) |
| return torch.sum(windows, dim=1) |
| |
| def _sum_pool3d(self, x, kernel_size): |
| # Because unfold does not support 3D sliding window we will split tensor to multiple tensors and calculate sum |
| h = kernel_size[0] |
| splited_x = [t.sum(0) for t in x.split(h) if t.size(0) == h] |
| # sum_pool2d assumes tensor in (1, 1, n, m) view, so unsqueeze two times |
| splited_x = [self._sum_pool2d(t.unsqueeze(0).unsqueeze(0), kernel_size[1:]) for t in splited_x] |
| joined_x = torch.cat(splited_x) |
| return joined_x.view(1, joined_x.numel()) |
| |
| def _avg_pool2d(self, x, kernel_size): |
| size = reduce((lambda x, y: x * y), kernel_size) |
| return self._sum_pool2d(x, kernel_size) / size |
| |
| def _avg_pool3d(self, x, kernel_size): |
| size = reduce((lambda x, y: x * y), kernel_size) |
| return self._sum_pool3d(x, kernel_size) / size |
| |
| def test_doubletensor_avg_pool2d(self): |
| n, m = 5, 8 |
| input = torch.rand(1, 1, n, m) |
| for i in range(1, n + 1): |
| for j in range(1, m + 1): |
| actual = torch.nn.functional.avg_pool2d(input[0], (i, j)) |
| actual = actual.view(1, actual.numel()) |
| expected = self._avg_pool2d(input, (i, j)) |
| self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5)) |
| |
| def test_avg_pool2d_with_zero_divisor(self): |
| self.assertRaisesRegex(RuntimeError, "divisor must be not zero", |
| lambda: F.avg_pool2d(torch.zeros(3, 3, 3), (2, 2), divisor_override=0)) |
| |
| def test_doubletensor_avg_pool2d_with_divisor(self): |
| n, m = 3, 3 |
| input = torch.rand(1, 1, n, m) |
| for i in range(1, n + 1): |
| for j in range(1, m + 1): |
| for divisor in [1, 7, i * j]: |
| actual = F.avg_pool2d(input[0], (i, j), divisor_override=divisor) |
| actual = actual.view(1, actual.numel()) |
| expected = self._sum_pool2d(input, (i, j)) / divisor |
| self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5)) |
| |
| def test_doubletensor_avg_pool3d(self): |
| h, w, d = 5, 6, 7 |
| input = torch.rand(h, w, d) |
| for i in range(1, h + 1): |
| for j in range(1, w + 1): |
| for k in range(1, d + 1): |
| actual = torch.nn.functional.avg_pool3d(input.unsqueeze(0), (i, j, k)) |
| actual = actual.view(1, actual.numel()) |
| expected = self._avg_pool3d(input, (i, j, k)) |
| self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5)) |
| |
| def test_doubletensor_avg_pool3d_with_divisor(self): |
| h, w, d = 6, 5, 7 |
| input = torch.rand(h, w, d) |
| for i in range(1, h + 1): |
| for j in range(1, w + 1): |
| for k in range(1, d + 1): |
| for divisor in [1, 7, i * j]: |
| actual = torch.nn.functional.avg_pool3d(input.unsqueeze(0), (i, j, k), divisor_override=divisor) |
| actual = actual.view(1, actual.numel()) |
| expected = self._sum_pool3d(input, (i, j, k)) / divisor |
| self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5)) |
| |
| def test_avg_pool3d_with_zero_divisor(self): |
| self.assertRaisesRegex(RuntimeError, "divisor must be not zero", |
| lambda: F.avg_pool3d(torch.zeros(3, 3, 3, 3), (2, 2, 2), divisor_override=0)) |
| |
| def test_avg_pool1d_ceil_mode(self): |
| # Regression test for gh-36977 |
| x = 10 * torch.randn((1, 16, 4)) |
| y = torch.nn.functional.avg_pool1d( |
| x, ceil_mode=True, count_include_pad=True, kernel_size=1, stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| if TEST_CUDA: |
| y = torch.nn.functional.avg_pool1d( |
| x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=1, stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| |
| def test_avg_pool2d_ceil_mode(self): |
| # Regression test for gh-36977 |
| x = 10 * torch.randn((1, 16, 4, 4)) |
| y = torch.nn.functional.avg_pool2d( |
| x, ceil_mode=True, count_include_pad=True, kernel_size=(1, 2), |
| padding=(0, 1), stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| if TEST_CUDA: |
| y = torch.nn.functional.avg_pool2d( |
| x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=(1, 2), |
| padding=(0, 1), stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| |
| def test_avg_pool3d_ceil_mode(self): |
| # Regression test for gh-36977 |
| x = 10 * torch.randn((1, 16, 4, 4, 4)) |
| y = torch.nn.functional.avg_pool3d( |
| x, ceil_mode=True, count_include_pad=True, kernel_size=(1, 2, 3), stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| if TEST_CUDA: |
| y = torch.nn.functional.avg_pool3d( |
| x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=(1, 2, 3), stride=2) |
| self.assertTrue(not torch.isnan(y).any()) |
| |
| |
| class TestNN(NNTestCase): |
| _do_cuda_memory_leak_check = True |
| _do_cuda_non_default_stream = True |
| |
| def _forward(self, module, input: _TensorOrTensors): |
| with freeze_rng_state(): |
| if isinstance(input, tuple): |
| return module(*input) |
| else: |
| return module(input) |
| |
| def _backward(self, module, input: _TensorOrTensors, output, grad_output, create_graph=False): |
| output.backward(grad_output, retain_graph=True, create_graph=create_graph) |
| if isinstance(input, tuple): |
| return tuple(i.grad.data if i.grad is not None else None for i in input) |
| else: |
| return input.grad.data if input.grad is not None else None |
| |
| def _forward_criterion(self, criterion, input, target, extra_args=None): |
| if extra_args is None: |
| extra_args = tuple() |
| if isinstance(input, tuple): |
| args = input + (target,) + extra_args |
| output = criterion(*args) |
| else: |
| output = criterion(input, target, *extra_args) |
| return output |
| |
| def _backward_criterion(self, criterion, input, output, target, gradOutput=None, extra_args=None): |
| if extra_args is None: |
| extra_args = tuple() |
| input_tuple = input if isinstance(input, tuple) else (input,) |
| output_tuple = output if isinstance(output, tuple) else (output,) |
| for i in input_tuple: |
| if i.grad is not None: |
| i.grad.data.zero_() |
| args = input_tuple + (target,) + extra_args |
| if gradOutput is None: |
| gradOutput = torch.ones(()) |
| criterion(*args).backward(gradOutput.to(output_tuple[0])) |
| if isinstance(input, tuple): |
| return tuple(i.grad.data for i in input) |
| else: |
| return input.grad.data |
| |
| def _zero_grad_parameters(self, module): |
| for p in module.parameters(): |
| if p.grad is not None: |
| with torch.no_grad(): |
| p.grad.zero_() |
| p.grad.detach_() |
| |
| def _get_parameters(self, module): |
| params = [] |
| d_params = [] |
| for p in module.parameters(): |
| params.append(p) |
| d_params.append(p.grad) |
| return params, d_params |
| |
| def _create_basic_net(self): |
| class Layer(nn.Module): |
| def __init__(self): |
| super(Layer, self).__init__() |
| self.layer_dummy_param = Parameter(torch.Tensor(3, 5)) |
| self.register_buffer('layer_dummy_buf', torch.zeros(1, 3, 3, 7)) |
| |
| class Net(nn.Module): |
| def __init__(self): |
| super(Net, self).__init__() |
| self.l1 = Layer() |
| self.dummy_param = Parameter(torch.Tensor(3, 5)) |
| self.register_buffer('dummy_buf', torch.zeros(7, 3, 3, 1)) |
| |
| l = Layer() |
| n = Net() |
| s = nn.Sequential(n, n) |
| |
| return l, n, s |
| |
| def test_requires_grad_(self): |
| m = self._create_basic_net()[-1] |
| assert len(list(m.buffers())) > 0, 'invalid test' |
| assert all(not b.requires_grad for b in m.buffers()) > 0, 'invalid test' |
| assert len(list(m.parameters())) > 0, 'invalid test' |
| assert all(p.requires_grad for p in m.parameters()) > 0, 'invalid test' |
| for requires_grad in (False, True): |
| self.assertIs(m.requires_grad_(requires_grad), m) |
| for p in m.parameters(): |
| self.assertEqual(p.requires_grad, requires_grad) |
| for b in m.buffers(): |
| self.assertFalse(b.requires_grad) |
| |
| def test_module_backcompat(self): |
| from torch.serialization import SourceChangeWarning |
| path = download_file('https://download.pytorch.org/test_data/linear.pt') |
| with warnings.catch_warnings(): |
| warnings.simplefilter('ignore', SourceChangeWarning) |
| m = torch.load(path) |
| input = torch.randn(2, 3, dtype=torch.float) |
| self.assertEqual(m(input).size(), (2, 5)) |
| |
| def test_conv_backcompat(self): |
| from torch.serialization import SourceChangeWarning |
| # This file was generated by running on PyTorch 1.0.1 on Python 2: |
| # |
| # import torch |
| # from torch import nn |
| # m = nn.Conv2d(1, 1, 1) |
| # torch.save(m, 'legacy_conv2d.pt') |
| # |
| # NB: This Pickle also contains some Unicode data! |
| path = download_file('https://download.pytorch.org/test_data/legacy_conv2d.pt') |
| with warnings.catch_warnings(): |
| warnings.simplefilter('ignore', SourceChangeWarning) |
| m = torch.load(path, encoding='utf-8') |
| input = torch.randn((1, 1, 1, 1), dtype=torch.float) |
| self.assertEqual(m(input).size(), (1, 1, 1, 1)) |
| |
| def test_share_memory(self): |
| class Net(nn.Module): |
| def __init__(self): |
| super(Net, self).__init__() |
| self.p = nn.Parameter(torch.eye(5)) |
| self.par = nn.ParameterList() |
| self.par.append(nn.Parameter(torch.randn(10))) |
| |
| def forward(self, inp): |
| # NB: dead code |
| return inp.clone() |
| |
| net = Net() |
| for p in net.parameters(): |
| self.assertFalse(p.storage().is_shared()) |
| for b in net.buffers(): |
| self.assertFalse(b.storage().is_shared()) |
| net.share_memory() |
| for p in net.parameters(): |
| self.assertTrue(p.storage().is_shared()) |
| for b in net.buffers(): |
| self.assertTrue(b.storage().is_shared()) |
| |
| def _test_hooks(self, backward_register_fn): |
| module = nn.Sigmoid() |
| input = torch.ones(5, 5, requires_grad=True) |
| |
| counter = { |
| 'forwards': 0, |
| 'backwards': 0 |
| } |
| |
| def fw_hook(inc, h_module, input, output): |
| self.assertIsInstance(input, tuple) |
| self.assertTrue(isinstance(output, torch.Tensor)) |
| self.assertTrue(h_module is module) |
| self.assertEqual(input[0], torch.ones(5, 5)) |
| self.assertEqual(output, torch.Tensor(5, 5).fill_(1 / (1 + 1 / math.e))) |
| counter['forwards'] += inc |
| |
| def bw_hook(inc, h_module, grad_input, grad_output): |
| self.assertIsInstance(grad_input, tuple) |
| self.assertIsInstance(grad_output, tuple) |
| self.assertTrue(h_module is module) |
| self.assertEqual(grad_output[0], torch.ones(5, 5) * 2) |
| counter['backwards'] += inc |
| |
| test_fwd = module.register_forward_hook(lambda *args: fw_hook(1, *args)) |
| |
| module(input) |
| module(input) |
| self.assertEqual(counter['forwards'], 2) |
| self.assertEqual(counter['backwards'], 0) |
| |
| test_bwd = getattr(module, backward_register_fn)( |
| lambda *args: bw_hook(1, *args)) |
| |
| output = module(input) |
| self.assertEqual(counter['forwards'], 3) |
| self.assertEqual(counter['backwards'], 0) |
| |
| output.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| self.assertEqual(counter['forwards'], 3) |
| self.assertEqual(counter['backwards'], 1) |
| |
| output.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| self.assertEqual(counter['forwards'], 3) |
| self.assertEqual(counter['backwards'], 2) |
| |
| test2_fwd = module.register_forward_hook(lambda *args: fw_hook(2, *args)) |
| |
| output = module(input) |
| self.assertEqual(counter['forwards'], 6) |
| self.assertEqual(counter['backwards'], 2) |
| |
| test2_bwd = getattr(module, backward_register_fn)(lambda *args: bw_hook(2, *args)) |
| |
| module(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 9) |
| self.assertEqual(counter['backwards'], 5) |
| |
| test2_bwd.remove() |
| |
| module(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 12) |
| self.assertEqual(counter['backwards'], 6) |
| |
| test2_fwd.remove() |
| |
| module(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 13) |
| self.assertEqual(counter['backwards'], 7) |
| |
| test_fwd.remove() |
| test_bwd.remove() |
| |
| def test_hooks(self): |
| self._test_hooks("register_backward_hook") |
| self._test_hooks("register_full_backward_hook") |
| |
| def test_hook_cpp(self): |
| bn = nn.BatchNorm1d(5) |
| |
| def hook(module, grad_inputs, grad_outputs): |
| self.assertEqual(len(grad_inputs), 1) |
| self.assertEqual(len(grad_outputs), 1) |
| self.assertEqual(module, bn) |
| |
| bn.register_full_backward_hook(hook) |
| output = bn(torch.randn(5, 5, requires_grad=True)) |
| output.sum().backward() |
| |
| def test_hook_invalid_outputs(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| |
| def bw_fail1(self, grad_input, grad_output): |
| return grad_input[:-1] |
| |
| def bw_fail2(self, grad_input, grad_output): |
| return grad_input + (torch.randn(2, 2),) |
| |
| with module.register_backward_hook(bw_fail1): |
| with self.assertRaisesRegex(RuntimeError, 'got 0, but expected 1'): |
| module(input).sum().backward() |
| |
| with module.register_backward_hook(bw_fail2): |
| with self.assertRaisesRegex(RuntimeError, 'got 2, but expected 1'): |
| module(input).sum().backward() |
| |
| def test_hook_requires_grad(self): |
| test_self = self |
| |
| class MyModule(nn.Module): |
| def forward(self, arg1, arg2, arg3): |
| test_self.assertTrue(arg1.requires_grad) |
| test_self.assertFalse(arg2.requires_grad) |
| test_self.assertTrue(arg3.requires_grad) |
| return arg1.sum() + arg2.sum() + arg3.sum() |
| |
| inp = torch.rand(2, requires_grad=True) |
| mod = MyModule() |
| |
| mod(inp, inp.detach(), inp) |
| # Ensure that requires grad is properly propagated |
| mod.register_full_backward_hook(lambda mod, gI, gO: None) |
| mod(inp, inp.detach(), inp) |
| |
| def test_hook_extra_input(self): |
| class MyModule(nn.Module): |
| def forward(self, non_tensor, tensor): |
| return tensor.clone(), non_tensor |
| |
| inp = torch.rand(2, requires_grad=True) |
| mod = MyModule() |
| |
| def hook(mod, grad_input, grad_output): |
| self.assertIsNone(grad_input[0]) |
| self.assertIsInstance(grad_input[1], torch.Tensor) |
| |
| self.assertIsInstance(grad_output[0], torch.Tensor) |
| self.assertIsNone(grad_output[1]) |
| |
| mod.register_full_backward_hook(hook) |
| out, _ = mod(True, inp) |
| out.sum().backward() |
| |
| def test_hook_inplace(self): |
| class MyModule(nn.Module): |
| def forward(self, inp, do_inplace): |
| self.inp = inp |
| if do_inplace: |
| inp += 1 |
| return inp.clone() |
| |
| hook_called = [0] |
| |
| def hook(mod, grad_input, grad_output): |
| hook_called[0] += 1 |
| |
| inp = torch.rand(10, requires_grad=True) |
| mod = MyModule() |
| mod.register_full_backward_hook(hook) |
| |
| # No inplace should work |
| mod(inp, False).sum().backward() |
| self.assertEqual(hook_called[0], 1) |
| |
| # Input inplace error should throw an error (warning during deprecation cycle) |
| with self.assertWarnsRegex(UserWarning, "Output 0 of BackwardHookFunctionBackward is " |
| "a view and is being modified inplace."): |
| mod(inp.clone(), True) |
| |
| # Input inplace error should throw an error if we try to re-use the view after they have |
| # been modified (warning during deprecation cycle) |
| local_inp = inp.clone() |
| out = mod(local_inp, False) |
| local_inp[0] *= 1 |
| with self.assertWarnsRegex(UserWarning, "Output 0 of BackwardHookFunctionBackward is " |
| "a view and its base or another view"): |
| # Any operation involving the view will fail here |
| mod.inp + 2 |
| |
| # Output inplace error should throw an error (warning during deprecation cycle) |
| with self.assertWarnsRegex(UserWarning, "BackwardHookFunctionBackward is a view " |
| "and is being modified inplace."): |
| # This error won't happen once the warning above is a proper error |
| with self.assertRaisesRegex(RuntimeError, "Module backward hook for grad_input is " |
| "called before the grad_output one."): |
| out = mod(inp, False) |
| out += 1 |
| out.sum().backward() |
| |
| def test_hook_non_full_warning(self): |
| def noop(*args): |
| pass |
| |
| a = torch.rand(2, requires_grad=True) |
| b = torch.rand(2, requires_grad=True) |
| |
| # Check invalid input container |
| class MyModule(nn.Module): |
| def forward(self, l): |
| return l[0].clone(), l[1].clone() |
| |
| m = MyModule() |
| m.register_backward_hook(noop) |
| |
| with self.assertWarnsRegex(UserWarning, "does not take as input a single Tensor or a tuple of Tensors"): |
| m([a, b]) |
| |
| # Check invalid output container |
| class MyModule(nn.Module): |
| def forward(self, a, b): |
| return [a.clone(), b.clone()] |
| |
| m = MyModule() |
| m.register_backward_hook(noop) |
| |
| with self.assertWarnsRegex(UserWarning, "does not return a single Tensor or a tuple of Tensors"): |
| m(a, b) |
| |
| # Check invalid output from different Nodes |
| class MyModule(nn.Module): |
| def forward(self, a, b): |
| return a.clone(), b.clone() |
| |
| m = MyModule() |
| m.register_backward_hook(noop) |
| |
| with self.assertWarnsRegex(UserWarning, "outputs are generated by different autograd Nodes"): |
| m(a, b) |
| |
| # Check invalid forward with multiple Nodes |
| class MyModule(nn.Module): |
| def forward(self, a): |
| return a.clone().clone() |
| |
| m = MyModule() |
| m.register_backward_hook(noop) |
| |
| with self.assertWarnsRegex(UserWarning, "the forward contains multiple autograd Nodes"): |
| m(a) |
| |
| def test_hook_backward_size(self): |
| # Make module with multiple operations in forward |
| # And different size for input and outputs |
| class MyModule(nn.Module): |
| def forward(self, arg1, arg2): |
| tmp = arg1.sum() * arg2 |
| tmp = tmp + arg2.sum() * arg1.sum() |
| tmp = tmp.sum().view(1) |
| tmp = tmp.expand(8).contiguous() |
| return tmp |
| |
| module = MyModule() |
| inp1 = torch.randn(5, 5, requires_grad=True) |
| inp2 = torch.randn(10, 10, requires_grad=True) |
| |
| def bw_hook(module, grad_input, grad_output): |
| self.assertEqual(len(grad_input), 2) |
| self.assertEqual(grad_input[0].size(), torch.Size([5, 5])) |
| self.assertEqual(grad_input[1].size(), torch.Size([10, 10])) |
| self.assertEqual(len(grad_output), 1) |
| self.assertEqual(grad_output[0].size(), torch.Size([8])) |
| |
| with module.register_full_backward_hook(bw_hook): |
| module(inp1, inp2).sum().backward() |
| |
| def test_hook_backward_writeable(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| sig_x = torch.nn.functional.sigmoid(input) |
| |
| def bw_hook(module, grad_input, grad_output): |
| for grad in grad_input: |
| self.assertTrue(isinstance(grad, torch.Tensor)) |
| for grad in grad_output: |
| self.assertTrue(isinstance(grad, torch.Tensor)) |
| return tuple(gi * 2 for gi in grad_input) |
| |
| module.register_backward_hook(bw_hook) |
| module(input).backward(torch.ones(5, 5)) |
| expected_grad = sig_x * (1 - sig_x) * 2 |
| self.assertEqual(input.grad, expected_grad) |
| |
| def test_hook_forward_preforward_writable(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| sig_x = torch.nn.functional.sigmoid(input) |
| |
| def forward_pre_hook(m, input): |
| return torch.nn.functional.relu(input[0]) |
| |
| def forward_hook(m, input, output): |
| return -output |
| |
| module.register_forward_pre_hook(forward_pre_hook) |
| module.register_forward_hook(forward_hook) |
| output = module(input) |
| expected_res = -torch.nn.functional.sigmoid(torch.nn.functional.relu(input)) |
| self.assertEqual(output, expected_res) |
| output.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| mask = (input > 0).double() |
| expected_grad = -sig_x * (1 - sig_x) * 2 * mask |
| self.assertEqual(input.grad, expected_grad) |
| |
| def test_to(self): |
| m = nn.Linear(3, 5) |
| self.assertIs(m, m.to('cpu')) |
| self.assertIs(m, m.to('cpu', dtype=torch.float32)) |
| self.assertEqual(m.double(), m.to(torch.float64)) |
| self.assertRaises(RuntimeError, lambda: m.to('cpu', copy=True)) |
| |
| if torch.cuda.is_available(): |
| for cuda in ['cuda', 'cuda:0' if torch.cuda.device_count() == 1 else 'cuda:1']: |
| m2 = m.cuda(device=cuda) |
| self.assertIs(m2, m2.to(cuda)) |
| self.assertEqual(m, m2.to('cpu')) |
| self.assertEqual(m2, m.to(cuda)) |
| self.assertIs(m2, m2.to(dtype=torch.float32)) |
| self.assertEqual(m2.double(), m2.to(dtype=torch.float64)) |
| |
| def test_zero_grad(self): |
| i = torch.randn(2, 5, requires_grad=True) |
| module = nn.Linear(5, 5) |
| for p in module.parameters(): |
| p.requires_grad = False |
| module.zero_grad() |
| |
| module.weight.requires_grad = True |
| module.zero_grad() |
| self.assertIsNone(module.weight.grad) # uninitialized grad |
| |
| module(i).sum().backward() |
| self.assertIsNotNone(module.weight.grad) |
| self.assertGreater(module.weight.grad.data.abs().sum(), 0) |
| module.zero_grad() |
| self.assertEqual(module.weight.grad.data, module.weight.data.clone().zero_()) |
| |
| module.bias.requires_grad = True |
| module.zero_grad() |
| self.assertIsNotNone(module.weight.grad) |
| self.assertIsNone(module.bias.grad) |
| module(i).sum().backward() |
| self.assertIsNotNone(module.weight.grad) |
| self.assertIsNotNone(module.bias.grad) |
| self.assertGreater(module.weight.grad.data.abs().sum(), 0) |
| self.assertGreater(module.bias.grad.data.abs().sum(), 0) |
| module.zero_grad() |
| self.assertEqual(module.weight.grad.data, module.weight.data.clone().zero_()) |
| self.assertEqual(module.bias.grad.data, module.bias.data.clone().zero_()) |
| |
| # Force set to None. |
| module.zero_grad(set_to_none=True) |
| self.assertIsNone(module.weight.grad) |
| |
| |
| def test_no_grad(self): |
| for dtype in [torch.bfloat16, torch.float, torch.double]: |
| module = nn.Conv2d(2, 5, kernel_size=3, padding=1).to(dtype) |
| input = torch.randn(1, 2, 10, 10).to(dtype) |
| x = input |
| y = input.clone() |
| |
| output = module(x) |
| self.assertTrue(output.requires_grad) |
| output.backward(torch.ones(1, 5, 10, 10)) |
| |
| with torch.no_grad(): |
| output2 = module(y) |
| self.assertFalse(output2.requires_grad) |
| self.assertRaises(RuntimeError, lambda: output2.backward(torch.ones(1, 5, 10, 10))) |
| |
| def test_invalid_conv1d(self): |
| for dtype in [torch.bfloat16, torch.float, torch.double]: |
| module = nn.Conv1d(in_channels=3, out_channels=33, kernel_size=10, stride=1, bias=True).to(dtype) |
| input = torch.randn(1, 3, 4).to(dtype) |
| with self.assertRaisesRegex(RuntimeError, |
| r'Calculated padded input size per channel: \(4\). ' + |
| r'Kernel size: \(10\). Kernel size can\'t be greater than actual input size'): |
| module(input) |
| |
| # Negative stride check |
| module = nn.Conv1d(in_channels=3, out_channels=6, kernel_size=3, stride=-1, bias=True).to(dtype) |
| input = torch.randn(1, 3, 4).to(dtype) |
| with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'): |
| module(input) |
| |
| def test_mismatch_shape_conv2d(self): |
| x = torch.randn(1, 10, 1, 28, 28) |
| w = torch.randn(6, 1, 5, 5) |
| |
| with self.assertRaisesRegex(RuntimeError, |
| r'Expected 4-dimensional input for 4-dimensional weight \[6, 1, 5, 5\],' + |
| r' but got 5-dimensional input of size \[1, 10, 1, 28, 28\] instead'): |
| |
| F.conv2d(x, w) |
| |
| def test_invalid_conv2d(self): |
| for dtype in [torch.bfloat16, torch.float, torch.double]: |
| module = torch.nn.Conv2d(1, 1, kernel_size=3, dilation=2, stride=2).to(dtype) |
| input = torch.empty(1, 1, 4, 4).to(dtype) |
| self.assertRaises(RuntimeError, lambda: module(input)) |
| |
| module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, stride=1, bias=True) |
| input = torch.randn(1, 3, 1, 1) |
| with self.assertRaisesRegex(RuntimeError, |
| r'Calculated padded input size per channel: \(1 x 1\). ' + |
| r'Kernel size: \(10 x 10\). Kernel size can\'t be greater than actual input size'): |
| module(input) |
| |
| # Negative stride check |
| module = nn.Conv2d(in_channels=3, out_channels=6, kernel_size=4, stride=-1, bias=True).to(dtype) |
| input = torch.randn(1, 3, 4, 4).to(dtype) |
| with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'): |
| module(input) |
| |
| # Zero stride check |
| module = nn.Conv2d(in_channels=3, out_channels=6, kernel_size=4, stride=0, bias=True).to(dtype) |
| input = torch.randn(1, 3, 4, 4).to(dtype) |
| with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'): |
| module(input) |
| |
| def test_invalid_conv3d(self): |
| for dtype in [torch.bfloat16, torch.float, torch.double]: |
| module = torch.nn.Conv3d(1, 1, kernel_size=3, dilation=2, stride=2).to(dtype) |
| input = torch.empty(1, 1, 4, 4, 4).to(dtype) |
| self.assertRaises(RuntimeError, lambda: module(input)) |
| |
| # Negative stride check |
| module = torch.nn.Conv3d(1, 1, kernel_size=3, stride=-2) |
| input = torch.empty(1, 1, 4, 4, 4) |
| with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'): |
| module(input) |
| |
| def _test_alpha_dropout(self, cls, input): |
| mean = input.mean() |
| std = input.std() |
| |
| for p in [0.2, 0.5, 0.8]: |
| module = cls(p) |
| input_var = input.detach().clone().requires_grad_() |
| output = module(input_var) |
| # output mean should be close to input mean |
| self.assertLess(abs(output.data.mean() - mean), 0.1) |
| # output std should be close to input std |
| self.assertLess(abs(output.data.std() - std), 0.1) |
| output.backward(input) |
| |
| def test_parameters_and_named_parameters(self): |
| def names(named_parameters): |
| return [k for k, _ in named_parameters] |
| |
| l, n, s = self._create_basic_net() |
| |
| self.assertEqual(len(list(l.parameters())), 1) |
| self.assertEqual( |
| names(l.named_parameters()), |
| ['layer_dummy_param']) |
| |
| self.assertEqual(len(list(n.parameters())), 2) |
| self.assertEqual( |
| names(n.named_parameters()), |
| ['dummy_param', 'l1.layer_dummy_param']) |
| |
| self.assertEqual(len(list(n.parameters(recurse=False))), 1) |
| self.assertEqual( |
| names(n.named_parameters(recurse=False)), |
| ['dummy_param']) |
| |
| self.assertEqual(len(list(s.parameters())), 2) |
| self.assertEqual( |
| names(s.named_parameters()), |
| ['0.dummy_param', '0.l1.layer_dummy_param']) |
| |
| def test_buffers_and_named_buffers(self): |
| def names(named_buffers): |
| return [k for k, _ in named_buffers] |
| |
| l, n, s = self._create_basic_net() |
| |
| self.assertEqual(len(list(l.buffers())), 1) |
| self.assertEqual( |
| names(l.named_buffers()), |
| ['layer_dummy_buf']) |
| |
| self.assertEqual(len(list(n.buffers())), 2) |
| self.assertEqual( |
| names(n.named_buffers()), |
| ['dummy_buf', 'l1.layer_dummy_buf']) |
| |
| self.assertEqual(len(list(n.buffers(recurse=False))), 1) |
| self.assertEqual( |
| names(n.named_buffers(recurse=False)), |
| ['dummy_buf']) |
| |
| self.assertEqual(len(list(s.buffers())), 2) |
| self.assertEqual( |
| names(s.named_buffers()), |
| ['0.dummy_buf', '0.l1.layer_dummy_buf']) |
| |
| def test_call_supports_python_dict_output(self): |
| class Net(nn.Module): |
| def __init__(self): |
| super(Net, self).__init__() |
| self.l1 = nn.Linear(10, 20) |
| self.register_backward_hook(self.hook) |
| self.check_backward_hook_flag = False |
| |
| def hook(self, module, grad_out, grad_in): |
| self.check_backward_hook_flag = True |
| |
| def forward(self, inputs): |
| return {"output": self.l1(inputs).sum()} |
| |
| net = Net() |
| model_output = net(torch.randn([5, 10])) |
| model_output["output"].backward() |
| self.assertTrue(net.check_backward_hook_flag) |
| |
| def test_children(self): |
| l1 = nn.Linear(2, 2) |
| l2 = nn.Linear(2, 2) |
| l3 = nn.Linear(2, 2) |
| l4 = nn.Linear(2, 2) |
| subnet = nn.Sequential(l3, l4) |
| s = nn.Sequential(l1, l2, l1, l2, subnet) |
| self.assertEqual(list(s.children()), [l1, l2, subnet]) |
| |
| def test_dir(self): |
| linear = nn.Linear(2, 2) |
| linear._test_submodule = nn.Linear(2, 2) |
| linear._test_parameter = Parameter(torch.Tensor(2, 2)) |
| linear.register_buffer('_test_buffer', torch.Tensor(2, 2)) |
| keys = dir(linear) |
| self.assertIn('_test_submodule', keys) |
| self.assertIn('_test_parameter', keys) |
| self.assertIn('_test_buffer', keys) |
| |
| for key in keys: |
| self.assertTrue(hasattr(linear, key)) |
| |
| def test_repr(self): |
| # no extra information or sub-modules |
| empty_sequential = nn.Sequential() |
| expected_repr_empty = 'Sequential()' |
| self.assertEqual(repr(empty_sequential), expected_repr_empty) |
| |
| # one liner extra information |
| linear = nn.Linear(1, 1) |
| expected_repr_linear = 'Linear(in_features=1, out_features=1, bias=True)' |
| self.assertEqual(repr(linear), expected_repr_linear) |
| |
| # sub-modules repr |
| sequential = nn.Sequential(linear) |
| expected_repr_sequential = 'Sequential(\n' \ |
| ' (0): Linear(in_features=1, out_features=1, bias=True)\n' \ |
| ')' |
| self.assertEqual(repr(sequential), expected_repr_sequential) |
| |
| def test_dir_digit(self): |
| model = nn.Sequential(nn.Linear(2, 2)) |
| keys = dir(model) |
| self.assertNotIn('0', keys) |
| |
| def test_named_children(self): |
| l1 = nn.Linear(2, 2) |
| l2 = nn.Linear(2, 2) |
| l3 = nn.Linear(2, 2) |
| l4 = nn.Linear(2, 2) |
| subnet = nn.Sequential(l3, l4) |
| s = nn.Sequential() |
| with self.assertRaises(KeyError): |
| s.add_module('', l1) |
| with self.assertRaises(KeyError): |
| s.add_module('name.with.dot', l1) |
| s.add_module('layer1', l1) |
| s.add_module('layer2', l2) |
| s.add_module('layer3', l1) |
| s.add_module('layer4', l2) |
| s.add_module('subnet', subnet) |
| self.assertEqual(list(s.named_children()), [('layer1', l1), ('layer2', l2), ('subnet', subnet)]) |
| |
| def test_modules(self): |
| class Net(nn.Module): |
| def __init__(self): |
| super(Net, self).__init__() |
| self.l1 = l |
| self.l2 = l |
| self.param = torch.empty(3, 5) |
| |
| l = nn.Linear(10, 20) |
| n = Net() |
| s = nn.Sequential(n, n, n, n) |
| self.assertEqual(list(s.modules()), [s, n, l]) |
| |
| def test_named_modules(self): |
| class Net(nn.Module): |
| def __init__(self): |
| super(Net, self).__init__() |
| self.l1 = l |
| self.l2 = l |
| self.param = torch.empty(3, 5) |
| self.block = block |
| l = nn.Linear(10, 20) |
| l1 = nn.Linear(10, 20) |
| l2 = nn.Linear(10, 20) |
| block = nn.Sequential() |
| block.add_module('linear1', l1) |
| block.add_module('linear2', l2) |
| n = Net() |
| s = nn.Sequential(n, n, n, n) |
| self.assertEqual(list(s.named_modules()), [('', s), ('0', n), ('0.l1', l), |
| ('0.block', block), ('0.block.linear1', l1), |
| ('0.block.linear2', l2)]) |
| |
| def test_register_buffer_raises_error_if_name_is_not_string(self): |
| m = nn.Module() |
| expected_error = 'buffer name should be a string. Got ' |
| with self.assertRaisesRegex(TypeError, expected_error + 'int'): |
| m.register_buffer(1, torch.rand(5)) |
| with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'): |
| m.register_buffer(None, torch.rand(5)) |
| |
| def test_register_buffer_raises_error_if_attr_exists(self): |
| m = nn.Module() |
| m.attribute_name = 5 |
| with self.assertRaises(KeyError): |
| m.register_buffer('attribute_name', torch.rand(5)) |
| |
| del m.attribute_name |
| m.register_parameter('attribute_name', nn.Parameter()) |
| with self.assertRaises(KeyError): |
| m.register_buffer('attribute_name', torch.rand(5)) |
| |
| del m.attribute_name |
| m.add_module('attribute_name', nn.Module()) |
| with self.assertRaises(KeyError): |
| m.register_buffer('attribute_name', torch.rand(5)) |
| |
| def test_register_buffer_raises_error_if_not_tensor(self): |
| m = nn.Module() |
| with self.assertRaises(TypeError): |
| m.register_buffer('attribute_name', 5) |
| |
| def test_register_buffer_allows_overwriting_with_same_name(self): |
| m = nn.Module() |
| buffer1 = torch.rand(5) |
| buffer2 = buffer1 + 5 |
| buffer3 = None |
| m.register_buffer('buffer_name', buffer1) |
| self.assertEqual(m.buffer_name, buffer1) |
| m.register_buffer('buffer_name', buffer2) |
| self.assertEqual(m.buffer_name, buffer2) |
| m.register_buffer('buffer_name', buffer3) |
| self.assertEqual(m.buffer_name, buffer3) |
| |
| def test_buffer_not_persistent(self): |
| m = nn.Module() |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| self.assertTrue(len(list(m.buffers())) == 1) |
| self.assertTrue(len(m.state_dict()) == 0) |
| |
| def test_buffer_not_persistent_del(self): |
| m = nn.Module() |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| del m.buf |
| self.assertTrue(len(list(m.buffers())) == 0) |
| |
| def test_buffer_not_persistent_overwrite(self): |
| m = nn.Module() |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| m.register_buffer('buf', torch.rand(5)) |
| |
| # can we overwrite a non-persistent buffer with a persistent one? |
| self.assertTrue(len(list(m.buffers())) == 1) |
| self.assertTrue(len(m.state_dict()) == 1) |
| |
| # can we overwrite a persistent buffer with a non-persistent one? |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| self.assertTrue(len(list(m.buffers())) == 1) |
| self.assertTrue(len(m.state_dict()) == 0) |
| |
| def test_buffer_not_persistent_assign(self): |
| m = nn.Module() |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| |
| # Assigning None removes the buffer but if we then assign a new Tensor |
| # to the same property, it should still be marked as a buffer. |
| m.buf = None |
| self.assertTrue(len(list(m.buffers())) == 0) |
| self.assertTrue(len(m.state_dict()) == 0) |
| m.buf = torch.rand(5) |
| self.assertTrue(len(list(m.buffers())) == 1) |
| self.assertTrue(len(m.state_dict()) == 0) |
| |
| # Assigning a Parameter removes the buffer. |
| m.buf = nn.Parameter(torch.rand(5)) |
| self.assertTrue(len(list(m.buffers())) == 0) |
| self.assertTrue(len(m.state_dict()) == 1) |
| |
| def test_buffer_not_persistent_load(self): |
| m = nn.Module() |
| m.register_buffer('buf', torch.rand(5), persistent=False) |
| m.load_state_dict({}) |
| |
| def test_register_parameter_raises_error_if_name_is_not_string(self): |
| m = nn.Module() |
| expected_error = 'parameter name should be a string. Got ' |
| with self.assertRaisesRegex(TypeError, expected_error + 'int'): |
| m.register_parameter(1, nn.Parameter()) |
| with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'): |
| m.register_parameter(None, nn.Parameter()) |
| |
| def test_register_parameter_raises_error_if_attr_exists(self): |
| m = nn.Module() |
| m.attribute_name = 5 |
| with self.assertRaises(KeyError): |
| m.register_parameter('attribute_name', nn.Parameter()) |
| |
| del m.attribute_name |
| m.register_buffer('attribute_name', torch.rand(5)) |
| with self.assertRaises(KeyError): |
| m.register_parameter('attribute_name', nn.Parameter()) |
| |
| del m.attribute_name |
| m.add_module('attribute_name', nn.Module()) |
| with self.assertRaises(KeyError): |
| m.register_parameter('attribute_name', nn.Parameter()) |
| |
| def test_register_parameter_allows_overwriting_with_same_name(self): |
| m = nn.Module() |
| param1 = nn.Parameter(torch.rand(5)) |
| param2 = nn.Parameter(param1.data + 5) |
| param3 = None |
| m.register_parameter('param_name', param1) |
| self.assertEqual(m.param_name, param1) |
| m.register_parameter('param_name', param2) |
| self.assertEqual(m.param_name, param2) |
| m.register_parameter('param_name', param3) |
| self.assertEqual(m.param_name, param3) |
| |
| def test_add_module_raises_error_if_attr_exists(self): |
| m = nn.Module() |
| m.attribute_name = 5 |
| with self.assertRaises(KeyError): |
| m.add_module('attribute_name', nn.Module()) |
| |
| del m.attribute_name |
| m.register_buffer('attribute_name', torch.rand(5)) |
| with self.assertRaises(KeyError): |
| m.add_module('attribute_name', nn.Module()) |
| |
| del m.attribute_name |
| m.register_parameter('attribute_name', nn.Parameter()) |
| with self.assertRaises(KeyError): |
| m.add_module('attribute_name', nn.Module()) |
| |
| @unittest.expectedFailure |
| def test_getattr_with_property(self): |
| class Model(nn.Module): |
| @property |
| def some_property(self): |
| return self.something_that_doesnt_exist |
| |
| model = Model() |
| |
| with self.assertRaisesRegex( |
| AttributeError, |
| r"'Model' object has no attribute 'something_that_doesnt_exist'"): |
| model.some_property |
| |
| def test_Sequential_getitem(self): |
| l1 = nn.Linear(10, 20) |
| l2 = nn.Linear(20, 30) |
| l3 = nn.Linear(30, 40) |
| l4 = nn.Linear(40, 50) |
| n = nn.Sequential(l1, l2, l3, l4) |
| self.assertIs(n[0], l1) |
| self.assertIs(n[1], l2) |
| self.assertIs(n[2], l3) |
| self.assertIs(n[3], l4) |
| self.assertIs(n[torch.tensor(3, dtype=torch.int64)], l4) |
| self.assertEqual(n[1:], nn.Sequential(l2, l3, l4)) |
| self.assertEqual(n[3:], nn.Sequential(l4)) |
| self.assertEqual(n[:-1], nn.Sequential(l1, l2, l3)) |
| self.assertEqual(n[:-3], nn.Sequential(l1)) |
| self.assertEqual(n[::-1], nn.Sequential(l4, l3, l2, l1)) |
| |
| def test_Sequential_setitem(self): |
| l1 = nn.Linear(10, 20) |
| l2 = nn.Linear(20, 30) |
| l3 = nn.Linear(30, 40) |
| l4 = nn.Linear(40, 50) |
| n = nn.Sequential(l1, l2, l3) |
| n[0] = l4 |
| n[-1] = l4 |
| n[torch.tensor(1, dtype=torch.int16)] = l1 |
| self.assertIs(n[0], l4) |
| self.assertIs(n[1], l1) |
| self.assertIs(n[2], l4) |
| |
| def test_Sequential_setitem_named(self): |
| l1 = nn.Linear(10, 20) |
| l2 = nn.Linear(20, 30) |
| l3 = nn.Linear(30, 40) |
| l4 = nn.Linear(40, 50) |
| n = nn.Sequential(OrderedDict([ |
| ('linear1', l1), |
| ('linear2', l2), |
| ('linear3', l3), |
| ])) |
| |
| n[0] = l4 |
| n[-1] = l4 |
| self.assertEqual(n.linear1, l4) |
| self.assertEqual(n.linear3, l4) |
| |
| def test_Sequential_delitem(self): |
| l1 = nn.Linear(10, 20) |
| l2 = nn.Linear(20, 30) |
| l3 = nn.Linear(30, 40) |
| l4 = nn.Linear(40, 50) |
| n = nn.Sequential(l1, l2, l3, l4) |
| del n[-1] |
| self.assertEqual(n, nn.Sequential(l1, l2, l3)) |
| del n[1::2] |
| self.assertEqual(n, nn.Sequential(l1, l3)) |
| |
| def test_ModuleList(self): |
| modules = [nn.ReLU(), nn.Linear(5, 5)] |
| module_list = nn.ModuleList(modules) |
| |
| def check(): |
| self.assertEqual(len(module_list), len(modules)) |
| for m1, m2 in zip(modules, module_list): |
| self.assertIs(m1, m2) |
| for m1, m2 in zip(modules, module_list.children()): |
| self.assertIs(m1, m2) |
| for i in range(len(modules)): |
| self.assertIs(module_list[i], modules[i]) |
| |
| check() |
| modules += [nn.Conv2d(3, 4, 3)] |
| module_list += [modules[-1]] |
| check() |
| modules.insert(1, nn.Linear(3, 2)) |
| module_list.insert(1, modules[1]) |
| check() |
| modules.append(nn.Tanh()) |
| module_list.append(modules[-1]) |
| check() |
| next_modules = [nn.Linear(5, 5), nn.Sigmoid()] |
| modules.extend(next_modules) |
| module_list.extend(next_modules) |
| check() |
| modules[2] = nn.Conv2d(5, 3, 2) |
| module_list[2] = modules[2] |
| check() |
| modules[-1] = nn.Conv2d(5, 2, 1) |
| module_list[-1] = modules[-1] |
| check() |
| idx = torch.tensor(2, dtype=torch.int32) |
| modules[2] = nn.Conv2d(5, 3, 2) |
| module_list[idx] = modules[2] |
| self.assertIs(module_list[idx], modules[2]) |
| check() |
| self.assertEqual(module_list[1:], nn.ModuleList(modules[1:])) |
| self.assertEqual(module_list[3:], nn.ModuleList(modules[3:])) |
| self.assertEqual(module_list[:-1], nn.ModuleList(modules[:-1])) |
| self.assertEqual(module_list[:-3], nn.ModuleList(modules[:-3])) |
| self.assertEqual(module_list[::-1], nn.ModuleList(modules[::-1])) |
| del module_list[-1] |
| self.assertEqual(module_list, nn.ModuleList(modules[:-1])) |
| del module_list[1::2] |
| self.assertEqual(module_list, nn.ModuleList(modules[:-1][0::2])) |
| |
| with self.assertRaises(TypeError): |
| module_list += nn.ReLU() |
| with self.assertRaises(TypeError): |
| module_list.extend(nn.ReLU()) |
| |
| l1 = nn.Linear(1, 2) |
| l2 = nn.Linear(2, 3) |
| l3 = nn.Linear(3, 2) |
| l4 = nn.Linear(2, 3) |
| subnet = nn.Sequential(l3, l4) |
| s = nn.Sequential( |
| OrderedDict([ |
| ("layer1", l1), |
| ("layer2", l2), |
| ("layer3", l3), |
| ("layer4", l4), |
| ("subnet_layer", subnet) |
| ]) |
| ) |
| modules = list(s.modules()) |
| module_list = nn.ModuleList() |
| module_list.extend(s.modules()) |
| check() |
| |
| def test_ModuleDict(self): |
| modules = OrderedDict([ |
| ('act', nn.ReLU()), |
| ('conv', nn.Conv2d(10, 10, 5)), |
| ('fc', nn.Linear(5, 5)), |
| ]) |
| |
| module_dict = nn.ModuleDict(modules) |
| |
| def check(): |
| self.assertEqual(len(module_dict), len(modules)) |
| for k1, m2 in zip(modules, module_dict.children()): |
| self.assertIs(modules[k1], m2) |
| for k1, k2 in zip(modules, module_dict): |
| self.assertIs(modules[k1], module_dict[k2]) |
| for k in module_dict: |
| self.assertIs(module_dict[k], modules[k]) |
| for k in module_dict.keys(): |
| self.assertIs(module_dict[k], modules[k]) |
| for k, v in module_dict.items(): |
| self.assertIs(modules[k], v) |
| for k1, m2 in zip(modules, module_dict.values()): |
| self.assertIs(modules[k1], m2) |
| for k in modules.keys(): |
| self.assertTrue(k in module_dict) |
| check() |
| |
| modules['conv'] = nn.Conv2d(3, 4, 3) |
| module_dict['conv'] = modules['conv'] |
| check() |
| |
| next_modules = [ |
| ('fc2', nn.Linear(5, 5)), |
| ('act', nn.Sigmoid()), |
| ] |
| modules.update(next_modules) |
| module_dict.update(next_modules) |
| check() |
| |
| next_modules = OrderedDict([ |
| ('fc3', nn.Linear(5, 5)), |
| ('act2', nn.Sigmoid()), |
| ]) |
| modules.update(next_modules) |
| module_dict.update(next_modules) |
| check() |
| |
| next_modules = { |
| 'fc4': nn.Linear(5, 5), |
| 'act3': nn.Sigmoid() |
| } |
| modules.update(next_modules.items()) |
| module_dict.update(next_modules) |
| check() |
| |
| next_modules = nn.ModuleDict([ |
| ('fc5', nn.Linear(5, 5)), |
| ('act4', nn.Sigmoid()), |
| ]) |
| modules.update(next_modules) |
| module_dict.update(next_modules) |
| check() |
| |
| del module_dict['fc'] |
| del modules['fc'] |
| check() |
| |
| with self.assertRaises(TypeError): |
| module_dict.update(nn.ReLU()) |
| |
| with self.assertRaises(TypeError): |
| module_dict.update([nn.ReLU()]) |
| |
| with self.assertRaises(ValueError): |
| module_dict.update([[nn.ReLU()]]) |
| |
| with self.assertRaises(TypeError): |
| module_dict[1] = nn.ReLU() |
| |
| s = nn.Sequential(modules) |
| module_dict = nn.ModuleDict(s.named_children()) |
| check() |
| |
| c = module_dict.pop('conv') |
| self.assertIs(c, modules['conv']) |
| modules.pop('conv') |
| check() |
| |
| module_dict.clear() |
| self.assertEqual(len(module_dict), 0) |
| modules.clear() |
| check() |
| |
| def test_ParameterList(self): |
| def make_param(): |
| return Parameter(torch.randn(10, 10)) |
| parameters = [make_param(), make_param()] |
| param_list = nn.ParameterList(parameters) |
| |
| def check(): |
| self.assertEqual(len(parameters), len(param_list)) |
| for p1, p2 in zip(parameters, param_list): |
| self.assertIs(p1, p2) |
| for p1, p2 in zip(parameters, param_list.parameters()): |
| self.assertIs(p1, p2) |
| for i in range(len(parameters)): |
| self.assertIs(parameters[i], param_list[i]) |
| |
| check() |
| parameters += [make_param()] |
| param_list += [parameters[-1]] |
| check() |
| parameters.append(make_param()) |
| param_list.append(parameters[-1]) |
| check() |
| next_params = [make_param(), make_param()] |
| parameters.extend(next_params) |
| param_list.extend(next_params) |
| check() |
| parameters[2] = make_param() |
| param_list[2] = parameters[2] |
| check() |
| parameters[-1] = make_param() |
| param_list[-1] = parameters[-1] |
| check() |
| idx = torch.tensor(2, dtype=torch.int32) |
| parameters[2] = make_param() |
| param_list[idx] = parameters[2] |
| self.assertIs(param_list[idx], parameters[2]) |
| check() |
| self.assertEqual(param_list[1:], nn.ParameterList(parameters[1:])) |
| self.assertEqual(param_list[3:], nn.ParameterList(parameters[3:])) |
| self.assertEqual(param_list[:-1], nn.ParameterList(parameters[:-1])) |
| self.assertEqual(param_list[:-3], nn.ParameterList(parameters[:-3])) |
| self.assertEqual(param_list[::-1], nn.ParameterList(parameters[::-1])) |
| |
| with self.assertRaises(TypeError): |
| param_list += make_param() |
| with self.assertRaises(TypeError): |
| param_list.extend(make_param()) |
| |
| l1 = nn.Linear(1, 2) |
| l2 = nn.Linear(2, 3) |
| l3 = nn.Linear(3, 2) |
| l4 = nn.Linear(2, 3) |
| subnet = nn.Sequential(l3, l4) |
| s = nn.Sequential( |
| OrderedDict([ |
| ("layer1", l1), |
| ("layer2", l2), |
| ("layer3", l3), |
| ("layer4", l4), |
| ("subnet_layer", subnet) |
| ]) |
| ) |
| parameters = list(s.parameters()) |
| param_list = nn.ParameterList() |
| param_list.extend(s.parameters()) |
| check() |
| |
| def test_ParameterDict(self): |
| parameters = OrderedDict([ |
| ('p1', Parameter(torch.randn(10, 10))), |
| ('p2', Parameter(torch.randn(10, 10))), |
| ('p3', Parameter(torch.randn(10, 10))), |
| ]) |
| |
| parameter_dict = nn.ParameterDict(parameters) |
| |
| def check(): |
| self.assertEqual(len(parameter_dict), len(parameters)) |
| for k1, m2 in zip(parameters, parameter_dict.parameters()): |
| self.assertIs(parameters[k1], m2) |
| for k1, k2 in zip(parameters, parameter_dict): |
| self.assertIs(parameters[k1], parameter_dict[k2]) |
| for k in parameter_dict: |
| self.assertIs(parameter_dict[k], parameters[k]) |
| for k in parameter_dict.keys(): |
| self.assertIs(parameter_dict[k], parameters[k]) |
| for k, v in parameter_dict.items(): |
| self.assertIs(v, parameters[k]) |
| for k1, m2 in zip(parameters, parameter_dict.values()): |
| self.assertIs(parameters[k1], m2) |
| for k in parameters.keys(): |
| self.assertTrue(k in parameter_dict) |
| |
| check() |
| |
| parameters['p4'] = Parameter(torch.randn(10, 10)) |
| parameter_dict['p4'] = parameters['p4'] |
| check() |
| |
| next_parameters = [ |
| ('p5', Parameter(torch.randn(10, 10))), |
| ('p2', Parameter(torch.randn(10, 10))), |
| ] |
| parameters.update(next_parameters) |
| parameter_dict.update(next_parameters) |
| check() |
| |
| next_parameters = OrderedDict([ |
| ('p6', Parameter(torch.randn(10, 10))), |
| ('p5', Parameter(torch.randn(10, 10))), |
| ]) |
| parameters.update(next_parameters) |
| parameter_dict.update(next_parameters) |
| check() |
| |
| next_parameters = { |
| 'p8': Parameter(torch.randn(10, 10)), |
| 'p7': Parameter(torch.randn(10, 10)) |
| } |
| parameters.update(sorted(next_parameters.items())) |
| parameter_dict.update(next_parameters) |
| check() |
| |
| next_parameters = nn.ParameterDict([ |
| ('p10', Parameter(torch.randn(10, 10))), |
| ('p9', Parameter(torch.randn(10, 10))), |
| ]) |
| parameters.update(next_parameters) |
| parameter_dict.update(next_parameters) |
| check() |
| |
| del parameter_dict['p3'] |
| del parameters['p3'] |
| check() |
| |
| with self.assertRaises(TypeError): |
| parameter_dict.update(1) |
| |
| with self.assertRaises(TypeError): |
| parameter_dict.update([1]) |
| |
| with self.assertRaises(ValueError): |
| parameter_dict.update(Parameter(torch.randn(10, 10))) |
| |
| with self.assertRaises(TypeError): |
| parameter_dict[1] = Parameter(torch.randn(10, 10)) |
| |
| p_pop = parameter_dict.pop('p4') |
| self.assertIs(p_pop, parameters['p4']) |
| parameters.pop('p4') |
| check() |
| |
| parameter_dict.clear() |
| self.assertEqual(len(parameter_dict), 0) |
| parameters.clear() |
| check() |
| |
| def test_add_module(self): |
| l = nn.Linear(10, 20) |
| net = nn.Module() |
| net.l = l |
| net.l2 = l |
| net.add_module('empty', None) |
| self.assertEqual(net.l, l) |
| self.assertEqual(net.l2, l) |
| self.assertEqual(net.empty, None) |
| net.add_module('l3', l) |
| self.assertEqual(net.l3, l) |
| l3 = nn.Linear(20, 10) |
| net.add_module('l', l3) |
| self.assertEqual(net.l, l3) |
| self.assertRaises(TypeError, lambda: net.add_module('x', 'non-module')) |
| self.assertRaisesRegex(TypeError, 'module name should be a string. Got int', |
| lambda: net.add_module(1, l)) |
| self.assertRaisesRegex(TypeError, 'module name should be a string. Got NoneType', |
| lambda: net.add_module(None, l)) |
| |
| def test_module_to_argparse(self): |
| net = nn.Sequential(nn.Linear(3, 3)) |
| cpu = torch.device('cpu') |
| with self.assertRaises(TypeError): |
| net.to(cpu, True) |
| with self.assertRaises(TypeError): |
| net.to(torch.long) |
| with self.assertRaises(TypeError): |
| net.to(None, True) |
| with self.assertRaises(TypeError): |
| net.to(cpu, torch.long, True) |
| with self.assertRaises(TypeError): |
| net.to(cpu, dtype=torch.long, non_blocking=True) |
| with self.assertRaises(TypeError): |
| net.to([]) |
| with self.assertRaises(TypeError): |
| net.to({}, non_blocking=True) |
| with self.assertRaises(TypeError): |
| net.to(torch.tensor(3, dtype=torch.long), non_blocking=True) |
| with self.assertRaises(TypeError): |
| net.to(cpu, torch.tensor(3, dtype=torch.long), non_blocking=True) |
| |
| def test_RNN_nonlinearity(self): |
| rnn = torch.nn.RNN(1, 10) |
| self.assertEqual(rnn.nonlinearity, 'tanh') |
| |
| rnn = torch.nn.RNN(1, 10, nonlinearity='relu') |
| self.assertEqual(rnn.nonlinearity, 'relu') |
| |
| with self.assertRaisesRegex(ValueError, 'Unknown nonlinearity'): |
| rnn = torch.nn.RNN(1, 10, nonlinearity='garbage') |
| |
| def test_module_apply_inplace_op(self): |
| def add_one_inplace(t): |
| return t.add_(1.0) |
| |
| # Test that applying an in-place operation to a module would bump |
| # the module's parameters' version counter. |
| m = nn.Linear(20, 10) |
| pvm = m.weight.mul(m.weight) |
| m_weight_version_saved = m.weight._version |
| m = m._apply(add_one_inplace) |
| self.assertGreater(m.weight._version, m_weight_version_saved) |
| with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"): |
| pvm.backward(torch.randn(10, 20)) |
| |
| # Test that applying an in-place operation to a module would bump |
| # the module's parameters' gradients' version counter. |
| m = nn.Linear(20, 10) |
| m.weight.grad = torch.randn(10, 20).requires_grad_() |
| pgm = m.weight.grad.mul(m.weight.grad) |
| m_weight_grad_version_saved = m.weight.grad._version |
| m = m._apply(add_one_inplace) |
| self.assertGreater(m.weight.grad._version, m_weight_grad_version_saved) |
| with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"): |
| pgm.backward(torch.randn(10, 20)) |
| |
| def test_overwrite_module_params_on_conversion(self): |
| # Test that if the conversion function passed to `module._apply()` |
| # changes the TensorImpl type of `module`'s parameters, the `module`'s |
| # parameters are always overwritten, regardless of the value of |
| # `torch.__future__.get_overwrite_module_params_on_conversion()`. |
| m = nn.Linear(20, 10) |
| m.weight.grad = torch.randn(10, 20) |
| weight_ref = m.weight |
| weight_grad_ref = m.weight.grad |
| m = m._apply(lambda t: torch.sparse_coo_tensor(torch.zeros([2, 1]), torch.ones([1]), torch.Size([10, 20]))) |
| self.assertNotEqual(weight_ref.layout, m.weight.layout) |
| self.assertNotEqual(weight_grad_ref.layout, m.weight.grad.layout) |
| |
| # Test that under the current default settings |
| # (`torch.__future__.get_overwrite_module_params_on_conversion() == False`), |
| # a view to a module's parameters is not pointing to the same storage as |
| # its base variable after converting the module to a different dtype. |
| m = nn.Linear(20, 10).float() |
| mw = m.weight[:] |
| m.double() |
| with torch.no_grad(): |
| mw[0][0] = 5 |
| self.assertTrue(mw[0][0].dtype == torch.float) |
| self.assertTrue(mw._base[0][0].dtype == torch.double) |
| |
| try: |
| torch.__future__.set_overwrite_module_params_on_conversion(True) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # a view to a module's parameters is still pointing to the same storage as |
| # its base variable after converting the module to a different dtype. |
| m = nn.Linear(20, 10).float() |
| mw = m.weight[:] |
| m.double() |
| with torch.no_grad(): |
| mw[0][0] = 5 |
| self.assertTrue(mw[0][0] == mw._base[0][0]) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # `float_module.double()` doesn't preserve previous references to |
| # `float_module`'s parameters or gradients. |
| m = nn.Linear(20, 10).float() |
| m.weight.grad = torch.randn(10, 20).float() |
| weight_ref = m.weight |
| weight_grad_ref = m.weight.grad |
| m.double() |
| self.assertNotEqual(weight_ref.dtype, m.weight.dtype) |
| self.assertNotEqual(weight_grad_ref.dtype, m.weight.grad.dtype) |
| |
| def add_one_inplace(t): |
| return t.add_(1.0) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # applying an in-place operation to a module would bump the module's |
| # original parameters' version counter. |
| m = nn.Linear(20, 10) |
| pvm = m.weight.mul(m.weight) |
| weight_ref = m.weight |
| m_weight_version_saved = weight_ref._version |
| m = m._apply(add_one_inplace) |
| # Test that the in-place operation bumps the original parameter's version counter |
| self.assertGreater(weight_ref._version, m_weight_version_saved) |
| with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"): |
| pvm.backward(torch.randn(10, 20)) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # applying an in-place operation to a module would bump the module's |
| # original parameters' gradients' version counter. |
| m = nn.Linear(20, 10) |
| m.weight.grad = torch.randn(10, 20).requires_grad_() |
| pgm = m.weight.grad.mul(m.weight.grad) |
| weight_grad_ref = m.weight.grad |
| m_weight_grad_version_saved = weight_grad_ref._version |
| m = m._apply(add_one_inplace) |
| self.assertGreater(weight_grad_ref._version, m_weight_grad_version_saved) |
| with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"): |
| pgm.backward(torch.randn(10, 20)) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # applying an out-of-place operation to a module doesn't bump |
| # the module's original parameters' version counter. |
| m = nn.Linear(20, 10) |
| weight_ref = m.weight |
| m_weight_version_saved = weight_ref._version |
| m = m._apply(lambda t: torch.randn(t.shape)) |
| self.assertEqual(weight_ref._version, m_weight_version_saved) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # applying an out-of-place operation to a module doesn't bump |
| # the module's original parameters' gradients' version counter. |
| m = nn.Linear(20, 10) |
| m.weight.grad = torch.randn(10, 20).requires_grad_() |
| weight_grad_ref = m.weight.grad |
| m_weight_grad_version_saved = weight_grad_ref._version |
| m = m._apply(lambda t: torch.randn(t.shape)) |
| self.assertEqual(weight_grad_ref._version, m_weight_grad_version_saved) |
| finally: |
| torch.__future__.set_overwrite_module_params_on_conversion(False) |
| |
| def test_type(self): |
| l = nn.Linear(10, 20) |
| net = nn.Module() |
| net.l = l |
| net.l2 = l |
| net.add_module('empty', None) |
| net.register_buffer('indices', torch.LongTensor(1)) |
| net.float() |
| self.assertIsInstance(l.weight.data, torch.FloatTensor) |
| self.assertIsInstance(l.bias.data, torch.FloatTensor) |
| self.assertIsInstance(net.indices, torch.LongTensor) |
| net.double() |
| self.assertIsInstance(l.weight.data, torch.DoubleTensor) |
| self.assertIsInstance(l.bias.data, torch.DoubleTensor) |
| self.assertIsInstance(net.indices, torch.LongTensor) |
| net.to(torch.half) |
| self.assertIsInstance(l.weight.data, torch.HalfTensor) |
| self.assertIsInstance(l.bias.data, torch.HalfTensor) |
| self.assertIsInstance(net.indices, torch.LongTensor) |
| if TEST_CUDA: |
| net.float().cuda() |
| self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor) |
| self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor) |
| self.assertIsInstance(net.indices, torch.cuda.LongTensor) |
| net.cpu() |
| self.assertIsInstance(l.weight.data, torch.FloatTensor) |
| self.assertIsInstance(l.bias.data, torch.FloatTensor) |
| self.assertIsInstance(net.indices, torch.LongTensor) |
| net.to("cuda", torch.double, True) |
| self.assertIsInstance(l.weight.data, torch.cuda.DoubleTensor) |
| self.assertIsInstance(l.bias.data, torch.cuda.DoubleTensor) |
| self.assertIsInstance(net.indices, torch.cuda.LongTensor) |
| net.to(torch.empty(1, device="cuda:0", dtype=torch.half)) |
| self.assertIsInstance(l.weight.data, torch.cuda.HalfTensor) |
| self.assertIsInstance(l.bias.data, torch.cuda.HalfTensor) |
| self.assertIsInstance(net.indices, torch.cuda.LongTensor) |
| net.to(torch.device("cpu"), non_blocking=True) |
| self.assertIsInstance(l.weight.data, torch.HalfTensor) |
| self.assertIsInstance(l.bias.data, torch.HalfTensor) |
| self.assertIsInstance(net.indices, torch.LongTensor) |
| net.to(torch.float) |
| self.assertIsInstance(l.weight.data, torch.FloatTensor) |
| self.assertIsInstance(l.bias.data, torch.FloatTensor) |
| net.to(torch.DoubleTensor(1)) |
| self.assertIsInstance(l.weight.data, torch.DoubleTensor) |
| self.assertIsInstance(l.bias.data, torch.DoubleTensor) |
| if TEST_CUDA: |
| net.to(device='cuda', dtype=torch.float) |
| self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor) |
| self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor) |
| |
| def test_non_leaf_parameters(self): |
| l1 = nn.Linear(10, 10) |
| l2 = nn.Linear(10, 10) |
| |
| def assign_weight(): |
| l2.weight = l1.weight + 2 |
| |
| self.assertRaises(TypeError, assign_weight) |
| # This should work though |
| l2.weight = Parameter(torch.randn(10, 10)) |
| |
| def test_clip_grad_norm(self): |
| l = nn.Linear(10, 10) |
| max_norm = 2 |
| |
| def compute_norm(norm_type): |
| norm_type = float(norm_type) |
| if norm_type != inf: |
| total_norm = 0 |
| for p in l.parameters(): |
| total_norm += p.grad.data.abs().pow(norm_type).sum() |
| return pow(total_norm, 1. / norm_type) |
| else: |
| return max(p.grad.data.abs().max() for p in l.parameters()) |
| |
| def compare_scaling(grads): |
| p_scale = [p.grad.data.div(g).view(-1) for p, g in zip(l.parameters(), grads)] |
| scale = torch.cat(p_scale) |
| self.assertEqual(scale.std(), 0) |
| return scale[0] |
| |
| grads = torch.arange(1., 101).view(10, 10), torch.ones(10).div(1000) |
| for norm_type in [0.5, 1.5, 2, 4, 'inf']: |
| for p, g in zip(l.parameters(), grads): |
| p._grad = g.clone().view_as(p.data) |
| norm_before = compute_norm(norm_type) |
| norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type) |
| norm_after = compute_norm(norm_type) |
| self.assertEqual(norm, norm_before) |
| self.assertEqual(norm_after, max_norm) |
| self.assertLessEqual(norm_after, norm_before) |
| compare_scaling(grads) |
| |
| # Small gradients should be left unchanged |
| grads = torch.rand(10, 10).div(10000), torch.ones(10).div(500) |
| for norm_type in [0.5, 1.5, 2, 4, 'inf']: |
| for p, g in zip(l.parameters(), grads): |
| p.grad.data.copy_(g) |
| norm_before = compute_norm(norm_type) |
| norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type) |
| norm_after = compute_norm(norm_type) |
| self.assertEqual(norm, norm_before) |
| self.assertEqual(norm_before, norm_after) |
| self.assertLessEqual(norm_after, max_norm) |
| scale = compare_scaling(grads) |
| self.assertEqual(scale, 1) |
| |
| # Should accept a single Tensor as input |
| p1, p2 = torch.randn(10, 10), torch.randn(10, 10) |
| g = torch.arange(1., 101).view(10, 10) |
| p1._grad = g.clone() |
| p2._grad = g.clone() |
| for norm_type in [0.5, 1.5, 2, 4, 'inf']: |
| clip_grad_norm_(p1, max_norm, norm_type=norm_type) |
| clip_grad_norm_([p2], max_norm, norm_type=norm_type) |
| self.assertEqual(p1.grad, p2.grad) |
| |
| def test_clip_grad_value(self): |
| l = nn.Linear(10, 10) |
| clip_value = 2.5 |
| |
| grad_w, grad_b = torch.arange(-50., 50).view(10, 10).div_(5), torch.ones(10).mul_(2) |
| for grad_list in [[grad_w, grad_b], [grad_w, None]]: |
| for p, g in zip(l.parameters(), grad_list): |
| p._grad = g.clone().view_as(p.data) if g is not None else g |
| |
| clip_grad_value_(l.parameters(), clip_value) |
| for p in filter(lambda p: p.grad is not None, l.parameters()): |
| self.assertLessEqual(p.grad.data.max(), clip_value) |
| self.assertGreaterEqual(p.grad.data.min(), -clip_value) |
| |
| # Should accept a single Tensor as input |
| p1, p2 = torch.randn(10, 10), torch.randn(10, 10) |
| g = torch.arange(-50., 50).view(10, 10).div_(5) |
| p1._grad = g.clone() |
| p2._grad = g.clone() |
| clip_grad_value_(p1, clip_value) |
| clip_grad_value_([p2], clip_value) |
| self.assertEqual(p1.grad, p2.grad) |
| |
| def test_parameters_to_vector(self): |
| conv1 = nn.Conv2d(3, 10, 5) |
| fc1 = nn.Linear(10, 20) |
| model = nn.Sequential(conv1, fc1) |
| |
| vec = parameters_to_vector(model.parameters()) |
| self.assertEqual(vec.size(0), 980) |
| |
| def test_vector_to_parameters(self): |
| conv1 = nn.Conv2d(3, 10, 5) |
| fc1 = nn.Linear(10, 20) |
| model = nn.Sequential(conv1, fc1) |
| |
| vec = torch.arange(0., 980) |
| vector_to_parameters(vec, model.parameters()) |
| |
| sample = next(model.parameters())[0, 0, 0] |
| self.assertTrue(torch.equal(sample.data, vec.data[:5])) |
| |
| # torch/nn/utils/prune.py |
| @unittest.skipIf(not TEST_NUMPY, "numpy not found") |
| def test_validate_pruning_amount_init(self): |
| r"""Test the first util function that validates the pruning |
| amount requested by the user the moment the pruning method |
| is initialized. This test checks that the expected errors are |
| raised whenever the amount is invalid. |
| The original function runs basic type checking + value range checks. |
| It doesn't check the validity of the pruning amount with |
| respect to the size of the tensor to prune. That's left to |
| `_validate_pruning_amount`, tested below. |
| """ |
| # neither float not int should raise TypeError |
| with self.assertRaises(TypeError): |
| prune._validate_pruning_amount_init(amount="I'm a string") |
| |
| # float not in [0, 1] should raise ValueError |
| with self.assertRaises(ValueError): |
| prune._validate_pruning_amount_init(amount=1.1) |
| with self.assertRaises(ValueError): |
| prune._validate_pruning_amount_init(amount=20.) |
| |
| # negative int should raise ValueError |
| with self.assertRaises(ValueError): |
| prune._validate_pruning_amount_init(amount=-10) |
| |
| # all these should pass without errors because they're valid amounts |
| prune._validate_pruning_amount_init(amount=0.34) |
| prune._validate_pruning_amount_init(amount=1500) |
| prune._validate_pruning_amount_init(amount=0) |
| prune._validate_pruning_amount_init(amount=0.) |
| prune._validate_pruning_amount_init(amount=1) |
| prune._validate_pruning_amount_init(amount=1.) |
| self.assertTrue(True) |
| |
| @unittest.skipIf(not TEST_NUMPY, "numpy not found") |
| def test_validate_pruning_amount(self): |
| r"""Tests the second util function that validates the pruning |
| amount requested by the user, this time with respect to the size |
| of the tensor to prune. The rationale is that if the pruning amount, |
| converted to absolute value of units to prune, is larger than |
| the number of units in the tensor, then we expect the util function |
| to raise a value error. |
| """ |
| # if amount is int and amount > tensor_size, raise ValueError |
| with self.assertRaises(ValueError): |
| prune._validate_pruning_amount(amount=20, tensor_size=19) |
| |
| # amount is a float so this should not raise an error |
| prune._validate_pruning_amount(amount=0.3, tensor_size=0) |
| |
| # this is okay |
| prune._validate_pruning_amount(amount=19, tensor_size=20) |
| prune._validate_pruning_amount(amount=0, tensor_size=0) |
| prune._validate_pruning_amount(amount=1, tensor_size=1) |
| self.assertTrue(True) |
| |
| @unittest.skipIf(not TEST_NUMPY, "numpy not found") |
| def test_compute_nparams_to_prune(self): |
| r"""Test that requested pruning `amount` gets translated into the |
| correct absolute number of units to prune. |
| """ |
| self.assertEqual( |
| prune._compute_nparams_toprune(amount=0, tensor_size=15), |
| 0 |
| ) |
| self.assertEqual( |
| prune._compute_nparams_toprune(amount=10, tensor_size=15), |
| 10 |
| ) |
| # if 1 is int, means 1 unit |
| self.assertEqual( |
| prune._compute_nparams_toprune(amount=1, tensor_size=15), |
| 1 |
| ) |
| # if 1. is float, means 100% of units |
| self.assertEqual( |
| prune._compute_nparams_toprune(amount=1., tensor_size=15), |
| 15 |
| ) |
| self.assertEqual( |
| prune._compute_nparams_toprune(amount=0.4, tensor_size=17), |
| 7 |
| ) |
| |
| def test_random_pruning_sizes(self): |
| r"""Test that the new parameters and buffers created by the pruning |
| method have the same size as the input tensor to prune. These, in |
| fact, correspond to the pruned version of the tensor itself, its |
| mask, and its original copy, so the size must match. |
| """ |
| # fixturize test |
| # TODO: add other modules |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| original_tensor = getattr(m, name) |
| |
| prune.random_unstructured(m, name=name, amount=0.1) |
| # mask has the same size as tensor being pruned |
| self.assertEqual( |
| original_tensor.size(), |
| getattr(m, name + '_mask').size() |
| ) |
| # 'orig' tensor has the same size as the original tensor |
| self.assertEqual( |
| original_tensor.size(), |
| getattr(m, name + '_orig').size() |
| ) |
| # new tensor has the same size as the original tensor |
| self.assertEqual( |
| original_tensor.size(), |
| getattr(m, name).size() |
| ) |
| |
| def test_random_pruning_orig(self): |
| r"""Test that original tensor is correctly stored in 'orig' |
| after pruning is applied. Important to make sure we don't |
| lose info about the original unpruned parameter. |
| """ |
| # fixturize test |
| # TODO: add other modules |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| |
| # tensor prior to pruning |
| original_tensor = getattr(m, name) |
| prune.random_unstructured(m, name=name, amount=0.1) |
| self.assertEqual( |
| original_tensor, |
| getattr(m, name + '_orig') |
| ) |
| |
| def test_random_pruning_new_weight(self): |
| r"""Test that module.name now contains a pruned version of |
| the original tensor obtained from multiplying it by the mask. |
| """ |
| # fixturize test |
| # TODO: add other modules |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| # tensor prior to pruning |
| original_tensor = getattr(m, name) |
| prune.random_unstructured(m, name=name, amount=0.1) |
| # weight = weight_orig * weight_mask |
| self.assertEqual( |
| getattr(m, name), |
| getattr(m, name + '_orig') |
| * getattr(m, name + '_mask').to( |
| dtype=original_tensor.dtype |
| ), |
| ) |
| |
| def test_identity_pruning(self): |
| r"""Test that a mask of 1s does not change forward or backward. |
| """ |
| input_ = torch.ones(1, 5) |
| m = nn.Linear(5, 2) |
| y_prepruning = m(input_) # output prior to pruning |
| |
| # compute grad pre-pruning and check it's equal to all ones |
| y_prepruning.sum().backward() |
| old_grad_weight = m.weight.grad.clone() # don't grab pointer! |
| self.assertEqual(old_grad_weight, torch.ones_like(m.weight)) |
| old_grad_bias = m.bias.grad.clone() |
| self.assertEqual(old_grad_bias, torch.ones_like(m.bias)) |
| |
| # remove grads |
| m.zero_grad() |
| |
| # force the mask to be made of all 1s |
| prune.identity(m, name="weight") |
| |
| # with mask of 1s, output should be identical to no mask |
| y_postpruning = m(input_) |
| self.assertEqual(y_prepruning, y_postpruning) |
| |
| # with mask of 1s, grad should be identical to no mask |
| y_postpruning.sum().backward() |
| self.assertEqual(old_grad_weight, m.weight_orig.grad) |
| self.assertEqual(old_grad_bias, m.bias.grad) |
| |
| # calling forward twice in a row shouldn't change output |
| y1 = m(input_) |
| y2 = m(input_) |
| self.assertEqual(y1, y2) |
| |
| def test_random_pruning_0perc(self): |
| r"""Test that a mask of 1s does not change forward or backward. |
| """ |
| input_ = torch.ones(1, 5) |
| m = nn.Linear(5, 2) |
| y_prepruning = m(input_) # output prior to pruning |
| |
| # compute grad pre-pruning and check it's equal to all ones |
| y_prepruning.sum().backward() |
| old_grad_weight = m.weight.grad.clone() # don't grab pointer! |
| self.assertEqual(old_grad_weight, torch.ones_like(m.weight)) |
| old_grad_bias = m.bias.grad.clone() |
| self.assertEqual(old_grad_bias, torch.ones_like(m.bias)) |
| |
| # remove grads |
| m.zero_grad() |
| |
| # force the mask to be made of all 1s |
| with mock.patch( |
| "torch.nn.utils.prune.RandomUnstructured.compute_mask" |
| ) as compute_mask: |
| compute_mask.return_value = torch.ones_like(m.weight) |
| prune.random_unstructured(m, name='weight', amount=0.9) # amount won't count |
| |
| # with mask of 1s, output should be identical to no mask |
| y_postpruning = m(input_) |
| self.assertEqual(y_prepruning, y_postpruning) |
| |
| # with mask of 1s, grad should be identical to no mask |
| y_postpruning.sum().backward() |
| self.assertEqual(old_grad_weight, m.weight_orig.grad) |
| self.assertEqual(old_grad_bias, m.bias.grad) |
| |
| # calling forward twice in a row shouldn't change output |
| y1 = m(input_) |
| y2 = m(input_) |
| self.assertEqual(y1, y2) |
| |
| def test_random_pruning(self): |
| input_ = torch.ones(1, 5) |
| m = nn.Linear(5, 2) |
| |
| # define custom mask to assign with mock |
| mask = torch.ones_like(m.weight) |
| mask[1, 0] = 0 |
| mask[0, 3] = 0 |
| |
| # check grad is zero for masked weights |
| with mock.patch( |
| "torch.nn.utils.prune.RandomUnstructured.compute_mask" |
| ) as compute_mask: |
| compute_mask.return_value = mask |
| prune.random_unstructured(m, name='weight', amount=0.9) |
| |
| y_postpruning = m(input_) |
| y_postpruning.sum().backward() |
| # weight_orig is the parameter, so it's the tensor that will accumulate the grad |
| self.assertEqual(m.weight_orig.grad, mask) # all 1s, except for masked units |
| self.assertEqual(m.bias.grad, torch.ones_like(m.bias)) |
| |
| # make sure that weight_orig update doesn't modify [1, 0] and [0, 3] |
| old_weight_orig = m.weight_orig.clone() |
| # update weights |
| learning_rate = 1. |
| for p in m.parameters(): |
| p.data.sub_(p.grad.data * learning_rate) |
| # since these are pruned, they should not be updated |
| self.assertEqual(old_weight_orig[1, 0], m.weight_orig[1, 0]) |
| self.assertEqual(old_weight_orig[0, 3], m.weight_orig[0, 3]) |
| |
| def test_random_pruning_forward(self): |
| r"""check forward with mask (by hand). |
| """ |
| input_ = torch.ones(1, 5) |
| m = nn.Linear(5, 2) |
| |
| # define custom mask to assign with mock |
| mask = torch.zeros_like(m.weight) |
| mask[1, 0] = 1 |
| mask[0, 3] = 1 |
| |
| with mock.patch( |
| "torch.nn.utils.prune.RandomUnstructured.compute_mask" |
| ) as compute_mask: |
| compute_mask.return_value = mask |
| prune.random_unstructured(m, name='weight', amount=0.9) |
| |
| yhat = m(input_) |
| self.assertEqual(yhat[0, 0], m.weight_orig[0, 3] + m.bias[0]) |
| self.assertEqual(yhat[0, 1], m.weight_orig[1, 0] + m.bias[1]) |
| |
| def test_remove_pruning_forward(self): |
| r"""Remove pruning and check forward is unchanged from previous |
| pruned state. |
| """ |
| input_ = torch.ones(1, 5) |
| m = nn.Linear(5, 2) |
| |
| # define custom mask to assign with mock |
| mask = torch.ones_like(m.weight) |
| mask[1, 0] = 0 |
| mask[0, 3] = 0 |
| |
| # check grad is zero for masked weights |
| with mock.patch( |
| "torch.nn.utils.prune.RandomUnstructured.compute_mask" |
| ) as compute_mask: |
| compute_mask.return_value = mask |
| prune.random_unstructured(m, name='weight', amount=0.9) |
| |
| y_postpruning = m(input_) |
| |
| prune.remove(m, 'weight') |
| |
| y_postremoval = m(input_) |
| self.assertEqual(y_postpruning, y_postremoval) |
| |
| def test_pruning_id_consistency(self): |
| r"""Test that pruning doesn't change the id of the parameters, which |
| would otherwise introduce issues with pre-existing optimizers that |
| point to old parameters. |
| """ |
| m = nn.Linear(5, 2, bias=False) |
| |
| tensor_id = id(list(m.parameters())[0]) |
| |
| prune.random_unstructured(m, name="weight", amount=0.9) |
| self.assertEqual(tensor_id, id(list(m.parameters())[0])) |
| |
| prune.remove(m, "weight") |
| self.assertEqual(tensor_id, id(list(m.parameters())[0])) |
| |
| def test_random_pruning_pickle(self): |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| prune.random_unstructured(m, name=name, amount=0.1) |
| m_new = pickle.loads(pickle.dumps(m)) |
| self.assertIsInstance(m_new, type(m)) |
| |
| def test_multiple_pruning_calls(self): |
| # if you call pruning twice, the hook becomes a PruningContainer |
| m = nn.Conv3d(2, 2, 2) |
| prune.l1_unstructured(m, name='weight', amount=0.1) |
| weight_mask0 = m.weight_mask # save it for later sanity check |
| |
| # prune again |
| prune.ln_structured(m, name='weight', amount=0.3, n=2, dim=0) |
| hook = next(iter(m._forward_pre_hooks.values())) |
| self.assertIsInstance( |
| hook, |
| torch.nn.utils.prune.PruningContainer |
| ) |
| # check that container._tensor_name is correctly set no matter how |
| # many pruning methods are in the container |
| self.assertEqual(hook._tensor_name, 'weight') |
| |
| # check that the pruning container has the right length |
| # equal to the number of pruning iters |
| self.assertEqual(len(hook), 2) # m.weight has been pruned twice |
| |
| # check that the entries of the pruning container are of the expected |
| # type and in the expected order |
| self.assertIsInstance(hook[0], torch.nn.utils.prune.L1Unstructured) |
| self.assertIsInstance(hook[1], torch.nn.utils.prune.LnStructured) |
| |
| # check that all entries that are 0 in the 1st mask are 0 in the |
| # 2nd mask too |
| self.assertTrue(torch.all(m.weight_mask[weight_mask0 == 0] == 0)) |
| |
| # prune again |
| prune.ln_structured(m, name='weight', amount=0.1, n=float('inf'), dim=1) |
| # check that container._tensor_name is correctly set no matter how |
| # many pruning methods are in the container |
| hook = next(iter(m._forward_pre_hooks.values())) |
| self.assertEqual(hook._tensor_name, 'weight') |
| |
| def test_pruning_container(self): |
| # create an empty container |
| container = prune.PruningContainer() |
| container._tensor_name = 'test' |
| self.assertEqual(len(container), 0) |
| |
| p = prune.L1Unstructured(amount=2) |
| p._tensor_name = 'test' |
| |
| # test adding a pruning method to a container |
| container.add_pruning_method(p) |
| |
| # test error raised if tensor name is different |
| q = prune.L1Unstructured(amount=2) |
| q._tensor_name = 'another_test' |
| with self.assertRaises(ValueError): |
| container.add_pruning_method(q) |
| |
| # test that adding a non-pruning method object to a pruning container |
| # raises a TypeError |
| with self.assertRaises(TypeError): |
| container.add_pruning_method(10) |
| with self.assertRaises(TypeError): |
| container.add_pruning_method('ugh') |
| |
| def test_pruning_container_compute_mask(self): |
| r"""Test `compute_mask` of pruning container with a known `t` and |
| `default_mask`. Indirectly checks that Ln structured pruning is |
| acting on the right axis. |
| """ |
| # create an empty container |
| container = prune.PruningContainer() |
| container._tensor_name = 'test' |
| |
| # 1) test unstructured pruning |
| # create a new pruning method |
| p = prune.L1Unstructured(amount=2) |
| p._tensor_name = 'test' |
| # add the pruning method to the container |
| container.add_pruning_method(p) |
| |
| # create tensor to be pruned |
| t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32) |
| # create prior mask by hand |
| default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]]) |
| # since we are pruning the two lowest magnitude units, the outcome of |
| # the calculation should be this: |
| expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]]) |
| computed_mask = container.compute_mask(t, default_mask) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_mask, computed_mask) |
| |
| # 2) test structured pruning |
| q = prune.LnStructured(amount=1, n=2, dim=0) |
| q._tensor_name = 'test' |
| container.add_pruning_method(q) |
| # since we are pruning the lowest magnitude one of the two rows, the |
| # outcome of the calculation should be this: |
| expected_mask = torch.tensor([[0, 0, 0, 0], [1, 1, 0, 1]]) |
| computed_mask = container.compute_mask(t, default_mask) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_mask, computed_mask) |
| |
| # 2) test structured pruning, along another axis |
| r = prune.LnStructured(amount=1, n=2, dim=1) |
| r._tensor_name = 'test' |
| container.add_pruning_method(r) |
| # since we are pruning the lowest magnitude of the four columns, the |
| # outcome of the calculation should be this: |
| expected_mask = torch.tensor([[0, 1, 1, 0], [0, 1, 0, 1]]) |
| computed_mask = container.compute_mask(t, default_mask) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_mask, computed_mask) |
| |
| def test_l1_unstructured_pruning(self): |
| r"""Test that l1 unstructured pruning actually removes the lowest |
| entries by l1 norm (by hand). It also checks that applying l1 |
| unstructured pruning more than once respects the previous mask. |
| """ |
| m = nn.Linear(4, 2) |
| # modify its weight matrix by hand |
| m.weight = torch.nn.Parameter( |
| torch.tensor( |
| [[1, 2, 3, 4], [-4, -3, -2, -1]], dtype=torch.float32 |
| ) |
| ) |
| |
| prune.l1_unstructured(m, 'weight', amount=2) |
| expected_weight = torch.tensor([[0, 2, 3, 4], [-4, -3, -2, 0]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_weight, m.weight) |
| |
| # check that pruning again removes the next two smallest entries |
| prune.l1_unstructured(m, 'weight', amount=2) |
| expected_weight = torch.tensor([[0, 0, 3, 4], [-4, -3, 0, 0]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_weight, m.weight) |
| |
| def test_l1_unstructured_pruning_with_importance_scores(self): |
| r"""Test that l1 unstructured pruning actually removes the lowest |
| entries of importance scores and not the parameter by l1 norm (by hand). |
| It also checks that applying l1 unstructured pruning more than once |
| respects the previous mask. |
| """ |
| m = nn.Linear(4, 2) |
| # modify its weight matrix by hand |
| m.weight = torch.nn.Parameter( |
| torch.tensor( |
| [[1, 2, 3, 4], [-4, -3, -2, -1]], dtype=torch.float32 |
| ) |
| ) |
| importance_scores = torch.tensor( |
| [[4, 2, 1, 3], [-3, -1, -2, -4]], dtype=torch.float32 |
| ) |
| |
| prune.l1_unstructured(m, 'weight', amount=2, importance_scores=importance_scores) |
| expected_weight = torch.tensor([[1, 2, 0, 4], [-4, 0, -2, -1]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_weight, m.weight) |
| |
| # check that pruning again removes two entries of m.weight that are colocated with |
| # the next two smallest absolute values of importance scores. |
| prune.l1_unstructured(m, 'weight', amount=2, importance_scores=importance_scores) |
| expected_weight = torch.tensor([[1, 0, 0, 4], [-4, 0, 0, -1]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_weight, m.weight) |
| |
| def test_unstructured_pruning_same_magnitude(self): |
| r"""Since it may happen that the tensor to prune has entries with the |
| same exact magnitude, it is important to check that pruning happens |
| consistenly based on the bottom % of weights, and not by threshold, |
| which would instead kill off *all* units with magnitude = threshold. |
| """ |
| AMOUNT = 0.2 |
| p = prune.L1Unstructured(amount=AMOUNT) |
| # create a random tensors with entries in {-2, 0, 2} |
| t = 2 * torch.randint(low=-1, high=2, size=(10, 7)) |
| nparams_toprune = prune._compute_nparams_toprune(AMOUNT, t.nelement()) |
| |
| computed_mask = p.compute_mask(t, default_mask=torch.ones_like(t)) |
| nparams_pruned = torch.sum(computed_mask == 0) |
| self.assertEqual(nparams_toprune, nparams_pruned) |
| |
| def test_random_structured_pruning_amount(self): |
| AMOUNT = 0.6 |
| AXIS = 2 |
| p = prune.RandomStructured(amount=AMOUNT, dim=AXIS) |
| t = 2 * torch.randint(low=-1, high=2, size=(5, 4, 2)).to( |
| dtype=torch.float32 |
| ) |
| nparams_toprune = prune._compute_nparams_toprune(AMOUNT, t.shape[AXIS]) |
| |
| computed_mask = p.compute_mask(t, default_mask=torch.ones_like(t)) |
| # check that 1 column is fully prune, the others are left untouched |
| remaining_axes = [_ for _ in range(len(t.shape)) if _ != AXIS] |
| per_column_sums = sorted( |
| torch.sum(computed_mask == 0, axis=remaining_axes) |
| ) |
| assert per_column_sums == [0, 20] |
| |
| def test_ln_structured_pruning(self): |
| r"""Check Ln structured pruning by hand. |
| """ |
| m = nn.Conv2d(3, 1, 2) |
| m.weight.data = torch.Tensor( |
| [[[[1., 2.], [1., 2.5]], |
| [[0.5, 1.], [0.1, 0.1]], |
| [[-3., -5.], [0.1, -1.]]]] |
| ) |
| # expected effect of pruning 1 of the 3 channels by L2-norm |
| expected_mask_axis1 = torch.ones_like(m.weight) |
| expected_mask_axis1[:, 1] = 0. |
| |
| prune.ln_structured(m, 'weight', amount=1, n=2, dim=1) |
| self.assertEqual(expected_mask_axis1, m.weight_mask) |
| |
| # expected effect of pruning 1 of the 2 columns along axis -1 by L1-norm |
| expected_mask_axis3 = expected_mask_axis1 |
| expected_mask_axis3[:, :, :, 0] = 0. |
| |
| prune.ln_structured(m, 'weight', amount=1, n=1, dim=-1) |
| self.assertEqual(expected_mask_axis3, m.weight_mask) |
| |
| def test_ln_structured_pruning_importance_scores(self): |
| r"""Check Ln structured pruning by hand. |
| """ |
| m = nn.Conv2d(3, 1, 2) |
| m.weight.data = torch.Tensor( |
| [[[[1., 2.], [1., 2.5]], |
| [[0.5, 1.], [0.1, 0.1]], |
| [[-3., -5.], [0.1, -1.]]]] |
| ) |
| importance_scores = torch.Tensor( |
| [[[[10., 1.], [10., 1.]], |
| [[30., 3.], [30., 3.]], |
| [[-20., -2.], [-20., -2.]]]] |
| ) |
| # expected effect of pruning 1 of the 3 channels by L2-norm |
| expected_mask_axis1 = torch.ones_like(m.weight) |
| expected_mask_axis1[:, 0] = 0. |
| |
| prune.ln_structured(m, 'weight', amount=1, n=2, dim=1, importance_scores=importance_scores) |
| self.assertEqual(expected_mask_axis1, m.weight_mask) |
| |
| # expected effect of pruning 1 of the 2 columns along axis -1 by L1-norm |
| expected_mask_axis3 = expected_mask_axis1 |
| expected_mask_axis3[:, :, :, 1] = 0. |
| |
| prune.ln_structured(m, 'weight', amount=1, n=1, dim=-1, importance_scores=importance_scores) |
| self.assertEqual(expected_mask_axis3, m.weight_mask) |
| |
| def test_remove_pruning(self): |
| r"""`prune.remove` removes the hook and the reparametrization |
| and makes the pruning final in the original parameter. |
| """ |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| # first prune |
| prune.random_unstructured(m, name, amount=0.5) |
| self.assertIn(name + "_orig", dict(m.named_parameters())) |
| self.assertIn(name + "_mask", dict(m.named_buffers())) |
| self.assertNotIn(name, dict(m.named_parameters())) |
| self.assertTrue(hasattr(m, name)) |
| pruned_t = getattr(m, name) |
| |
| # then remove pruning |
| prune.remove(m, name) |
| self.assertIn(name, dict(m.named_parameters())) |
| self.assertNotIn(name + "_orig", dict(m.named_parameters())) |
| self.assertNotIn(name + "_mask", dict(m.named_buffers())) |
| final_t = getattr(m, name) |
| |
| self.assertEqual(pruned_t, final_t) |
| |
| def test_remove_pruning_exception(self): |
| r"""Removing from an unpruned tensor throws an assertion error |
| """ |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| # check that the module isn't pruned |
| self.assertFalse(prune.is_pruned(m)) |
| # since it isn't pruned, pruning can't be removed from it |
| with self.assertRaises(ValueError): |
| prune.remove(m, name) |
| |
| |
| def test_global_pruning(self): |
| r"""Test that global l1 unstructured pruning over 2 parameters removes |
| the `amount=4` smallest global weights across the 2 parameters. |
| """ |
| m = nn.Linear(4, 2) |
| n = nn.Linear(3, 1) |
| # modify the weight matrices by hand |
| m.weight = torch.nn.Parameter( |
| torch.tensor([[1, 2, 3, 4], [-4, -3, -2, -1]]).to( |
| dtype=torch.float32) |
| ) |
| n.weight = torch.nn.Parameter( |
| torch.tensor([[0, 0.1, -2]]).to( |
| dtype=torch.float32) |
| ) |
| |
| params_to_prune = ( |
| (m, 'weight'), |
| (n, 'weight'), |
| ) |
| |
| # prune the 4 smallest weights globally by L1 magnitude |
| prune.global_unstructured( |
| params_to_prune, |
| pruning_method=prune.L1Unstructured, |
| amount=4 |
| ) |
| |
| expected_mweight = torch.tensor([[0, 2, 3, 4], [-4, -3, -2, 0]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_mweight, m.weight) |
| |
| expected_nweight = torch.tensor([[0, 0, -2]]).to(dtype=n.weight.dtype) |
| self.assertEqual(expected_nweight, n.weight) |
| |
| def test_global_pruning_importance_scores(self): |
| r"""Test that global l1 unstructured pruning over 2 parameters removes |
| the `amount=4` smallest global weights across the 2 parameters. |
| """ |
| m = nn.Linear(4, 2) |
| n = nn.Linear(3, 1) |
| # modify the weight matrices by hand |
| m.weight = torch.nn.Parameter( |
| torch.tensor([[1, 2, 3, 4], [-4, -3, -2, -1]]).to( |
| dtype=torch.float32) |
| ) |
| m_importance_scores = torch.tensor( |
| [[4, 2, 1, 3], [-3, -1, -2, -4]], dtype=torch.float32 |
| ) |
| n.weight = torch.nn.Parameter( |
| torch.tensor([[0, 0.1, -2]]).to( |
| dtype=torch.float32) |
| ) |
| n_importance_scores = torch.tensor([[0, 10., -0.2]]).to(dtype=torch.float32) |
| |
| params_to_prune = ( |
| (m, 'weight'), |
| (n, 'weight'), |
| ) |
| importance_scores = { |
| (m, 'weight'): m_importance_scores, |
| (n, 'weight'): n_importance_scores, |
| } |
| |
| # prune the 4 smallest weights globally by L1 magnitude |
| prune.global_unstructured( |
| params_to_prune, |
| pruning_method=prune.L1Unstructured, |
| amount=4, |
| importance_scores=importance_scores, |
| ) |
| |
| expected_m_weight = torch.tensor([[1, 2, 0, 4], [-4, 0, -2, -1]]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(expected_m_weight, m.weight) |
| |
| expected_n_weight = torch.tensor([[0, 0.1, 0]]).to(dtype=n.weight.dtype) |
| self.assertEqual(expected_n_weight, n.weight) |
| |
| def test_custom_from_mask_pruning(self): |
| r"""Test that the CustomFromMask is capable of receiving |
| as input at instantiation time a custom mask, and combining it with |
| the previous default mask to generate the correct final mask. |
| """ |
| # new mask |
| mask = torch.tensor([[0, 1, 1, 0], [0, 0, 1, 1]]) |
| # old mask |
| default_mask = torch.tensor([[0, 0, 0, 0], [1, 1, 1, 1]]) |
| |
| # some tensor (not actually used) |
| t = torch.rand_like(mask.to(dtype=torch.float32)) |
| |
| p = prune.CustomFromMask(mask=mask) |
| |
| computed_mask = p.compute_mask(t, default_mask) |
| expected_mask = torch.tensor([[0, 0, 0, 0], [0, 0, 1, 1]]).to( |
| dtype=t.dtype |
| ) |
| |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(computed_mask, expected_mask) |
| |
| def test_pruning_rollback(self): |
| r"""Test that if something fails when the we try to compute the mask, |
| then the model isn't left in some intermediate half-pruned state. |
| The try/except statement in `apply` should handle rolling back |
| to the previous state before pruning began. |
| """ |
| modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)] |
| names = ['weight', 'bias'] |
| |
| for m in modules: |
| for name in names: |
| with self.subTest(m=m, name=name): |
| |
| with mock.patch( |
| "torch.nn.utils.prune.L1Unstructured.compute_mask" |
| ) as compute_mask: |
| compute_mask.side_effect = Exception('HA!') |
| with self.assertRaises(Exception): |
| prune.l1_unstructured(m, name=name, amount=0.9) |
| |
| self.assertTrue( |
| name in dict(m.named_parameters()) |
| ) |
| self.assertFalse( |
| name + '_mask' in dict(m.named_buffers()) |
| ) |
| self.assertFalse( |
| name + '_orig' in dict(m.named_parameters()) |
| ) |
| |
| def test_pruning_serialization_model(self): |
| # create a model |
| model = torch.nn.Sequential( |
| torch.nn.Linear(10, 10), |
| torch.nn.ReLU(), |
| torch.nn.Linear(10, 1), |
| ) |
| # check that everything looks normal before pruning |
| self.assertNotIn('0.weight_orig', model.state_dict()) |
| self.assertNotIn('0.weight_mask', model.state_dict()) |
| self.assertIn('0.weight', model.state_dict()) |
| |
| # prune one of its parameters |
| prune.l1_unstructured(module=model[0], name='weight', amount=0.9) |
| |
| # check that the original weight and the new mask are present |
| self.assertIn('0.weight_orig', model.state_dict()) |
| self.assertIn('0.weight_mask', model.state_dict()) |
| self.assertNotIn('0.weight', model.state_dict()) |
| self.assertTrue(hasattr(model[0], 'weight')) |
| |
| pruned_weight = model[0].weight |
| |
| with TemporaryFileName() as fname: |
| torch.save(model, fname) |
| new_model = torch.load(fname) |
| |
| # check that the original weight and the new mask are present |
| self.assertIn('0.weight_orig', new_model.state_dict()) |
| self.assertIn('0.weight_mask', new_model.state_dict()) |
| self.assertNotIn('0.weight', new_model.state_dict()) |
| self.assertTrue(hasattr(new_model[0], 'weight')) |
| |
| self.assertEqual(pruned_weight, new_model[0].weight) |
| |
| def test_pruning_serialization_state_dict(self): |
| # create a model |
| model = torch.nn.Sequential( |
| torch.nn.Linear(10, 10), |
| torch.nn.ReLU(), |
| torch.nn.Linear(10, 1), |
| ) |
| # check that everything looks normal before pruning |
| self.assertNotIn('0.weight_orig', model.state_dict()) |
| self.assertNotIn('0.weight_mask', model.state_dict()) |
| self.assertIn('0.weight', model.state_dict()) |
| |
| # prune one of its parameters |
| prune.l1_unstructured(module=model[0], name='weight', amount=0.9) |
| |
| # check that the original weight and the new mask are present |
| self.assertIn('0.weight_orig', model.state_dict()) |
| self.assertIn('0.weight_mask', model.state_dict()) |
| self.assertNotIn('0.weight', model.state_dict()) |
| self.assertTrue(hasattr(model[0], 'weight')) |
| |
| pruned_weight = model[0].weight |
| |
| # make pruning permanent and restore parameter names as in base |
| # architecture |
| prune.remove(module=model[0], name='weight') |
| |
| # check that the original weight and the new mask are no longer present |
| self.assertNotIn('0.weight_orig', model.state_dict()) |
| self.assertNotIn('0.weight_mask', model.state_dict()) |
| self.assertIn('0.weight', model.state_dict()) |
| |
| # save the state dict of model and reload it into new_model |
| new_model = torch.nn.Sequential( |
| torch.nn.Linear(10, 10), |
| torch.nn.ReLU(), |
| torch.nn.Linear(10, 1), |
| ) |
| with TemporaryFileName() as fname: |
| torch.save(model.state_dict(), fname) |
| new_model.load_state_dict(torch.load(fname)) |
| |
| # check that the original weight and the new mask are not present in |
| # new_model either. |
| self.assertNotIn('0.weight_orig', new_model.state_dict()) |
| self.assertNotIn('0.weight_mask', new_model.state_dict()) |
| self.assertIn('0.weight', new_model.state_dict()) |
| |
| self.assertEqual(pruned_weight, new_model[0].weight) |
| |
| def test_prune(self): |
| # create a new pruning method |
| p = prune.L1Unstructured(amount=2) |
| # create tensor to be pruned |
| t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32) |
| # create prior mask by hand |
| default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]]) |
| # since we are pruning the two lowest magnitude units, the outcome of |
| # the calculation should be this: |
| expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]]) |
| pruned_tensor = p.prune(t, default_mask) |
| self.assertEqual(t * expected_mask, pruned_tensor) |
| |
| def test_prune_importance_scores(self): |
| # create a new pruning method |
| p = prune.L1Unstructured(amount=2) |
| # create tensor to be pruned |
| t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32) |
| importance_scores = torch.tensor( |
| [[1, 2, 3, 4], [1.5, 1.6, 1.7, 1.8]] |
| ).to(dtype=torch.float32) |
| # create prior mask by hand |
| default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]]) |
| # since we are pruning the two lowest magnitude units, the outcome of |
| # the calculation should be this: |
| expected_mask = torch.tensor([[0, 1, 1, 0], [0, 1, 0, 1]]) |
| pruned_tensor = p.prune(t, default_mask, importance_scores=importance_scores) |
| self.assertEqual(t * expected_mask, pruned_tensor) |
| |
| def test_prune_importance_scores_mimic_default(self): |
| # create a new pruning method |
| p = prune.L1Unstructured(amount=2) |
| # create tensor to be pruned |
| t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32) |
| # create prior mask by hand |
| default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]]) |
| # since we are pruning the two lowest magnitude units, the outcome of |
| # the calculation should be this: |
| expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]]) |
| pruned_tensor_without_importance_scores = p.prune(t, default_mask) |
| pruned_tensor_with_importance_scores = p.prune(t, default_mask, importance_scores=t) |
| self.assertEqual(pruned_tensor_without_importance_scores, pruned_tensor_with_importance_scores) |
| self.assertEqual(t * expected_mask, pruned_tensor_without_importance_scores) |
| |
| def test_rnn_pruning(self): |
| l = torch.nn.LSTM(32, 32) |
| # This Module has 4 parameters called: |
| # 'weight_ih_l0', 'weight_hh_l0', 'bias_ih_l0', 'bias_hh_l0' |
| |
| # Pruning one of them causes one of the weights to become a tensor |
| prune.l1_unstructured(l, 'weight_ih_l0', 0.5) |
| assert ( |
| sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]) |
| == 3 |
| ) |
| |
| # Removing the pruning reparametrization restores the Parameter |
| prune.remove(l, 'weight_ih_l0') |
| assert ( |
| sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]) |
| == 4 |
| ) |
| |
| # Make sure that, upon removal of the reparametrization, the |
| # `._parameters` and `.named_parameters` contain the right params. |
| # Specifically, the original weight ('weight_ih_l0') should be placed |
| # back in the parameters, while the reparametrization component |
| # ('weight_ih_l0_orig') should be removed. |
| assert 'weight_ih_l0' in l._parameters |
| assert l._parameters['weight_ih_l0'] is not None |
| assert 'weight_ih_l0_orig' not in l._parameters |
| assert 'weight_ih_l0' in dict(l.named_parameters()) |
| assert dict(l.named_parameters())['weight_ih_l0'] is not None |
| assert 'weight_ih_l0_orig' not in dict(l.named_parameters()) |
| |
| |
| def test_rnn_weight_norm(self): |
| def check_weight_norm(l, name, num_params): |
| # This Module has 4 or 5 parameters called: |
| # 'weight_ih_l0', 'weight_hh_l0', 'bias_ih_l0', 'bias_hh_l0', weight_hr_l0 |
| |
| # Applying weight norm on one of them causes it to become a tensor |
| l = torch.nn.utils.weight_norm(l, name=name) |
| self.assertEqual( |
| sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]), |
| num_params - 1, |
| ) |
| |
| # Removing the weight norm reparametrization restores the Parameter |
| l = torch.nn.utils.remove_weight_norm(l, name=name) |
| self.assertEqual( |
| sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]), |
| num_params, |
| ) |
| |
| # Make sure that, upon removal of the reparametrization, the |
| # `._parameters` and `.named_parameters` contain the right params. |
| # Specifically, the original weight ('weight_ih_l0') should be placed |
| # back in the parameters, while the reparametrization components |
| # ('weight_ih_l0_v' and 'weight_ih_l0_g') should be removed. |
| self.assertTrue(name in l._parameters) |
| self.assertIsNotNone(l._parameters[name]) |
| self.assertTrue(name + '_v' not in l._parameters) |
| self.assertTrue(name + '_g' not in l._parameters) |
| self.assertTrue(name in dict(l.named_parameters())) |
| self.assertIsNotNone(dict(l.named_parameters())[name]) |
| self.assertTrue(name + '_v' not in dict(l.named_parameters())) |
| self.assertTrue(name + '_g' not in dict(l.named_parameters())) |
| |
| check_weight_norm(torch.nn.LSTM(32, 32), 'weight_ih_l0', 4) |
| check_weight_norm(torch.nn.LSTM(32, 32, proj_size=16), 'weight_hr_l0', 5) |
| |
| |
| def test_weight_norm(self): |
| input = torch.randn(3, 5) |
| m = nn.Linear(5, 7) |
| expected_output = m(input) |
| |
| # add weight normalization |
| m = torch.nn.utils.weight_norm(m) |
| self.assertEqual(m.weight_v.size(), m.weight.size()) |
| self.assertEqual(m.weight_g.size(), (7, 1)) |
| self.assertEqual(m(input), expected_output) |
| |
| # remove weight norm |
| m = torch.nn.utils.remove_weight_norm(m) |
| self.assertFalse(hasattr(m, 'weight_g')) |
| self.assertFalse(hasattr(m, 'weight_v')) |
| self.assertEqual(m(input), expected_output) |
| |
| # test with dim=1 |
| m = torch.nn.utils.weight_norm(m, dim=1) |
| self.assertEqual(m.weight_v.size(), m.weight.size()) |
| self.assertEqual(m.weight_g.size(), (1, 5)) |
| self.assertEqual(m(input), expected_output) |
| |
| # test with dim=None |
| m = nn.Linear(5, 7) |
| expected_output = m(input) |
| m = torch.nn.utils.weight_norm(m, dim=None) |
| self.assertEqual(m(input), expected_output) |
| |
| with self.assertRaisesRegex(RuntimeError, 'register two weight_norm hooks'): |
| m = torch.nn.utils.weight_norm(m) |
| m = torch.nn.utils.weight_norm(m) |
| |
| def test_parameterlistdict_setting_attributes(self): |
| with warnings.catch_warnings(record=True) as w: |
| mod = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)])) |
| self.assertTrue(len(w) == 0) |
| |
| with warnings.catch_warnings(record=True) as w: |
| mod.train() |
| mod.eval() |
| self.assertTrue(len(w) == 0) |
| |
| with self.assertWarnsRegex(UserWarning, |
| r"Setting attributes on ParameterList is not supported"): |
| torch.nn.utils.weight_norm(mod, "0") |
| |
| with warnings.catch_warnings(record=True) as w: |
| mod = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))}) |
| self.assertTrue(len(w) == 0) |
| |
| with warnings.catch_warnings(record=True) as w: |
| mod.train() |
| mod.eval() |
| self.assertTrue(len(w) == 0) |
| |
| with self.assertWarnsRegex(UserWarning, |
| r"Setting attributes on ParameterDict is not supported"): |
| torch.nn.utils.weight_norm(mod, "b") |
| |
| def test_parameterlistdict_pickle(self): |
| m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)])) |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)])) |
| del m._initialized |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| # Test whether loading from older checkpoints works without triggering warnings |
| m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)])) |
| del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))}) |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))}) |
| del m._initialized |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| # Test whether loading from older checkpoints works without triggering warnings |
| m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))}) |
| del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set |
| with warnings.catch_warnings(record=True) as w: |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertTrue(len(w) == 0) |
| |
| def test_weight_norm_pickle(self): |
| m = torch.nn.utils.weight_norm(nn.Linear(5, 7)) |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertIsInstance(m, nn.Linear) |
| |
| def test_spectral_norm(self): |
| input = torch.randn(3, 5) |
| m = nn.Linear(5, 7) |
| m = torch.nn.utils.spectral_norm(m) |
| |
| self.assertEqual(m.weight_u.size(), torch.Size([m.weight.size(0)])) |
| # weight_orig should be trainable |
| self.assertTrue(hasattr(m, 'weight_orig')) |
| self.assertTrue('weight_orig' in m._parameters) |
| # weight_u should be just a reused buffer |
| self.assertTrue(hasattr(m, 'weight_u')) |
| self.assertTrue('weight_u' in m._buffers) |
| self.assertTrue('weight_v' in m._buffers) |
| # weight should be a plain attribute, not counted as a buffer or a param |
| self.assertFalse('weight' in m._buffers) |
| self.assertFalse('weight' in m._parameters) |
| # it should also be sharing storage as `weight_orig` |
| self.assertEqual(m.weight_orig.storage(), m.weight.storage()) |
| self.assertEqual(m.weight_orig.size(), m.weight.size()) |
| self.assertEqual(m.weight_orig.stride(), m.weight.stride()) |
| |
| m = torch.nn.utils.remove_spectral_norm(m) |
| self.assertFalse(hasattr(m, 'weight_orig')) |
| self.assertFalse(hasattr(m, 'weight_u')) |
| # weight should be converted back as a parameter |
| self.assertTrue(hasattr(m, 'weight')) |
| self.assertTrue('weight' in m._parameters) |
| |
| with self.assertRaisesRegex(RuntimeError, 'register two spectral_norm hooks'): |
| m = torch.nn.utils.spectral_norm(m) |
| m = torch.nn.utils.spectral_norm(m) |
| |
| # test correctness in training/eval modes and cpu/multi-gpu settings |
| for apply_dp in (True, False): |
| if apply_dp: |
| if not TEST_MULTIGPU: |
| continue |
| device = torch.device('cuda:0') |
| |
| def maybe_wrap(m): |
| return torch.nn.DataParallel(m, [0, 1]) |
| else: |
| device = torch.device('cpu') |
| |
| def maybe_wrap(m): |
| return m |
| |
| for requires_grad in (True, False): |
| m = nn.Linear(3, 4).to(device) |
| m.weight.requires_grad_(requires_grad) |
| m = torch.nn.utils.spectral_norm(m) |
| wrapped_m = maybe_wrap(m) |
| self.assertTrue(hasattr(m, 'weight_u')) |
| u0 = m.weight_u.clone() |
| v0 = m.weight_v.clone() |
| |
| # TEST TRAINING BEHAVIOR |
| |
| # assert that u and v are updated |
| input = torch.randn(2, 3, device=device) |
| out = wrapped_m(input) |
| self.assertNotEqual(u0, m.weight_u) |
| self.assertNotEqual(v0, m.weight_v) |
| |
| # assert that backprop reaches weight_orig |
| # can't use gradcheck because the function changes as we |
| # activate through it in training mode |
| if requires_grad: |
| torch.autograd.grad(out.sum(), m.weight_orig) |
| |
| # test backward works with multiple forwards |
| # it uses training mode so we need to reset `u` and `v` vectors |
| # to same value at beginning for finite difference test to pass |
| saved_u = m.weight_u.clone() |
| saved_v = m.weight_v.clone() |
| |
| def fn(input): |
| m.weight_u.data.copy_(saved_u) |
| m.weight_v.data.copy_(saved_v) |
| out0 = wrapped_m(input) |
| out1 = wrapped_m(input) |
| return out0 + out1 |
| |
| gradcheck(fn, (input.clone().requires_grad_(),), check_batched_grad=False) |
| |
| # test removing |
| pre_remove_out = wrapped_m(input) |
| m = torch.nn.utils.remove_spectral_norm(m) |
| self.assertEqual(wrapped_m(input), pre_remove_out) |
| |
| m = torch.nn.utils.spectral_norm(m) |
| for _ in range(3): |
| pre_remove_out = wrapped_m(input) |
| m = torch.nn.utils.remove_spectral_norm(m) |
| self.assertEqual(wrapped_m(input), pre_remove_out) |
| |
| # TEST EVAL BEHAVIOR |
| |
| m = torch.nn.utils.spectral_norm(m) |
| wrapped_m(input) |
| last_train_out = wrapped_m(input) |
| last_train_u = m.weight_u.clone() |
| last_train_v = m.weight_v.clone() |
| wrapped_m.zero_grad() |
| wrapped_m.eval() |
| |
| eval_out0 = wrapped_m(input) |
| # assert eval gives same result as last training iteration |
| self.assertEqual(eval_out0, last_train_out) |
| # assert doing more iteartion in eval don't change things |
| self.assertEqual(eval_out0, wrapped_m(input)) |
| self.assertEqual(last_train_u, m.weight_u) |
| self.assertEqual(last_train_v, m.weight_v) |
| |
| # FIXME: the code below is flaky when executed with DataParallel |
| # see https://github.com/pytorch/pytorch/issues/13818 |
| if apply_dp: |
| continue |
| |
| # test backward works with multiple forwards in mixed training |
| # and eval modes |
| # it uses training mode so we need to reset `u` and `v` vectors |
| # to same value at beginning for finite difference test to pass |
| saved_u = m.weight_u.clone() |
| saved_v = m.weight_v.clone() |
| |
| def fn(input): |
| m.weight_u.data.copy_(saved_u) |
| m.weight_v.data.copy_(saved_v) |
| wrapped_m.train() |
| out0 = wrapped_m(input) |
| wrapped_m.eval() |
| out1 = wrapped_m(input) |
| wrapped_m.train() |
| out2 = wrapped_m(input) |
| wrapped_m.eval() |
| out3 = wrapped_m(input) |
| return out0 + out1 + out2 + out3 |
| |
| gradcheck(fn, (input.clone().requires_grad_(),)) |
| |
| # assert that backprop reaches weight_orig in eval |
| if requires_grad: |
| def fn(weight): |
| return wrapped_m(input) |
| |
| gradcheck(fn, (m.weight_orig,)) |
| |
| @skipIfNoLapack |
| def test_spectral_norm_load_state_dict(self): |
| inp = torch.randn(2, 3) |
| for activate_times in (0, 3): |
| # Test backward compatibility |
| # At version None -> 1: weight becomes not a buffer and v vector becomes a buffer |
| m = nn.Linear(3, 5) |
| snm = torch.nn.utils.spectral_norm(m) |
| snm.train() |
| for _ in range(activate_times): |
| snm(inp) |
| |
| version_latest_ref_state_dict = deepcopy(snm.state_dict()) |
| self.assertEqual({'weight_orig', 'bias', 'weight_u', 'weight_v'}, set(version_latest_ref_state_dict.keys())) |
| |
| # test that non-strict loading works |
| non_strict_state_dict = deepcopy(version_latest_ref_state_dict) |
| non_strict_state_dict['nonsense'] = 'nonsense' |
| with self.assertRaisesRegex(RuntimeError, r'Unexpected key\(s\) in state_dict: "nonsense"'): |
| snm.load_state_dict(non_strict_state_dict, strict=True) |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict['weight_orig'] |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict['weight_u'] |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict['weight_v'] |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| non_strict_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict._metadata['']['spectral_norm'] # remove metadata info |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict['weight'] # remove W buffer |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| del non_strict_state_dict['bias'] |
| snm.load_state_dict(non_strict_state_dict, strict=False) |
| |
| # craft a version None state_dict |
| version_none_state_dict = deepcopy(version_latest_ref_state_dict) |
| self.assertIn('spectral_norm', version_none_state_dict._metadata['']) |
| del version_none_state_dict._metadata['']['spectral_norm'] # remove metadata info |
| del version_none_state_dict['weight_v'] # remove v vector |
| version_none_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer |
| |
| # normal state_dict |
| for version_latest_with_metadata in [True, False]: |
| version_latest_state_dict = deepcopy(version_latest_ref_state_dict) |
| |
| if not version_latest_with_metadata: |
| # We want to still load a user-crafted state_dict, one without metadata |
| del version_latest_state_dict._metadata['']['spectral_norm'] |
| |
| # test that re-wrapping does not matter |
| m = torch.nn.utils.remove_spectral_norm(snm) |
| snm = torch.nn.utils.spectral_norm(m) |
| |
| snm.load_state_dict(version_latest_ref_state_dict) |
| with torch.no_grad(): |
| snm.eval() |
| out0_eval = snm(inp) |
| snm.train() |
| out1_train = snm(inp) |
| out2_train = snm(inp) |
| snm.eval() |
| out3_eval = snm(inp) |
| |
| # test that re-wrapping does not matter |
| m = torch.nn.utils.remove_spectral_norm(snm) |
| snm = torch.nn.utils.spectral_norm(m) |
| |
| snm.load_state_dict(version_none_state_dict) |
| if activate_times > 0: |
| # since in loading version None state dict, we assume that the |
| # values in the state dict have gone through at lease one |
| # forward, we only test for equivalence when activate_times > 0. |
| with torch.no_grad(): |
| snm.eval() |
| self.assertEqual(out0_eval, snm(inp)) |
| snm.train() |
| self.assertEqual(out1_train, snm(inp)) |
| self.assertEqual(out2_train, snm(inp)) |
| snm.eval() |
| self.assertEqual(out3_eval, snm(inp)) |
| |
| # test that re-wrapping does not matter |
| m = torch.nn.utils.remove_spectral_norm(snm) |
| snm = torch.nn.utils.spectral_norm(m) |
| |
| # Test normal loading |
| snm.load_state_dict(version_latest_state_dict) |
| with torch.no_grad(): |
| snm.eval() |
| self.assertEqual(out0_eval, snm(inp)) |
| snm.train() |
| self.assertEqual(out1_train, snm(inp)) |
| self.assertEqual(out2_train, snm(inp)) |
| snm.eval() |
| self.assertEqual(out3_eval, snm(inp)) |
| |
| def test_spectral_norm_dim(self): |
| inp = torch.randn(2, 3, 10, 12) |
| m = nn.ConvTranspose2d(3, 4, (5, 6)) |
| m = torch.nn.utils.spectral_norm(m) |
| # this should not run into incompatible shapes |
| x = m(inp) |
| # check that u refers to the same dimension |
| self.assertEqual(m.weight_u.shape, m.weight_orig[0, :, 0, 0].shape) |
| |
| def test_spectral_norm_forward(self): |
| input = torch.randn(3, 5) |
| m = nn.Linear(5, 7) |
| m = torch.nn.utils.spectral_norm(m) |
| # naive forward |
| _weight, _bias, _u = m.weight_orig, m.bias, m.weight_u |
| _weight_mat = _weight.view(_weight.size(0), -1) |
| _v = torch.mv(_weight_mat.t(), _u) |
| _v = F.normalize(_v, dim=0, eps=1e-12) |
| _u = torch.mv(_weight_mat, _v) |
| _u = F.normalize(_u, dim=0, eps=1e-12) |
| _weight.data /= torch.dot(_u, torch.matmul(_weight_mat, _v)) |
| out_hat = torch.nn.functional.linear(input, _weight, _bias) |
| expect_out = m(input) |
| self.assertEqual(expect_out, out_hat) |
| |
| def test_spectral_norm_pickle(self): |
| m = torch.nn.utils.spectral_norm(nn.Linear(5, 7)) |
| m = pickle.loads(pickle.dumps(m)) |
| self.assertIsInstance(m, nn.Linear) |
| |
| def test_threshold_int(self): |
| x = torch.tensor([-3, -2, -1, 0, 1, 2, 3]) |
| expected = torch.tensor([99, 99, 99, 99, 1, 2, 3]) |
| self.assertEqual(F.threshold(x, 0, 99), expected) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| def test_embedding_max_norm_unsorted_repeating_indices(self): |
| def create_embedding(device): |
| # Seed RNG so we get the same Embedding each time |
| torch.manual_seed(0) |
| return torch.nn.Embedding( |
| num_embeddings=20, |
| embedding_dim=64, |
| max_norm=1.0).to(device) |
| |
| ix = torch.arange(2, device='cpu', dtype=torch.long).repeat(2000) |
| out_cpu = create_embedding('cpu')(ix) |
| |
| ix = ix.to('cuda') |
| out = create_embedding('cuda')(ix) |
| self.assertEqual(out.cpu(), out_cpu) |
| |
| def test_embedding_sparse_basic(self): |
| embedding = nn.Embedding(10, 20, sparse=True) |
| input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long) |
| embedding(input).sum().backward() |
| self.assertTrue(embedding.weight.grad.is_sparse) |
| self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape) |
| |
| def test_embedding_sparse_empty_tensor(self): |
| embedding = nn.Embedding(0, 0, sparse=True) |
| input = torch.tensor([], dtype=torch.int64) |
| embedding(input).sum().backward() |
| self.assertTrue(embedding.weight.grad.is_sparse) |
| self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape) |
| |
| embedding = nn.Embedding(10, 0, sparse=True) |
| input = torch.LongTensor([[0, 2, 4, 5], [4, 3, 0, 9]]) |
| embedding(input).sum().backward() |
| self.assertTrue(embedding.weight.grad.is_sparse) |
| self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape) |
| |
| def test_move_sparse_half_embedding(self): |
| embedding = nn.Embedding(10, 3, sparse=True) |
| self.assertEqual(embedding.weight.device.type, 'cpu') |
| self.assertEqual(embedding.weight.dtype, torch.float64) |
| embedding.to(torch.float16) |
| self.assertEqual(embedding.weight.dtype, torch.float16) |
| self.assertEqual(embedding.embedding_dim, 3) |
| self.assertEqual(embedding.num_embeddings, 10) |
| |
| if torch.cuda.is_available(): |
| embedding.to('cuda') |
| self.assertEqual(embedding.weight.device.type, 'cuda') |
| embedding.to('cpu') |
| self.assertEqual(embedding.weight.device.type, 'cpu') |
| |
| def test_embedding_max_norm(self): |
| embedding = nn.Embedding(22, 5, max_norm=1.0) |
| input = torch.tensor([2, 8, 8, 6], dtype=torch.long) |
| output = embedding(input) |
| self.assertEqual(output[1], output[2]) |
| self.assertTrue(output.data.norm(p=2, dim=1).le(1).all()) |
| |
| def test_embedding_from_pretrained(self): |
| a = torch.Tensor([[1, 2, 3], [4, 5, 6]]) |
| embedding = nn.Embedding.from_pretrained(a) |
| self.assertEqual(a, embedding.weight.data) |
| |
| input = torch.LongTensor([0, 1]) |
| output = embedding(input) |
| self.assertEqual(a, output) |
| |
| def test_embedding_from_pretrained_padding_idx(self): |
| padding_idx = 2 |
| embeddings = torch.rand(4, 3, requires_grad=True) |
| embedding_nn = nn.Embedding.from_pretrained(embeddings, padding_idx=padding_idx) |
| self.assertEqual(embedding_nn.weight[padding_idx].sum(), 0) |
| |
| def test_embedding_from_pretrained_options(self): |
| a = torch.Tensor([[1, 2, 3], [4, 5, 6]]) |
| opts = { |
| "max_norm": 2., |
| "norm_type": .5, |
| "scale_grad_by_freq": False, |
| "sparse": True |
| } |
| embedding = nn.Embedding.from_pretrained(a, **opts) |
| input = torch.LongTensor([0, 1]) |
| output = embedding(input) |
| # test output and that weight matrix was renormalized |
| self.assertEqual(a, output) |
| self.assertTrue(a.ne(torch.arange(1, 7, dtype=a.dtype).view(2, 3)).all()) |
| self.assertTrue(output.data.norm(p=opts["norm_type"], dim=1).le(opts["max_norm"]).all()) |
| |
| def test_embedding_functional(self): |
| a = torch.tensor([ |
| [1, 3, 2], |
| [0, 2, 1] |
| ], dtype=torch.long) |
| embeddings = torch.rand(4, 3, requires_grad=True) |
| |
| embed_old = torch.nn.Embedding(4, 3) |
| embed_old.weight.data = embeddings.data |
| res_old = embed_old(a) |
| |
| res_F = F.embedding(a, embeddings) |
| self.assertEqual(res_old, res_F) |
| |
| embed_old = torch.nn.Embedding(4, 3) |
| embed_old = embed_old.from_pretrained(embeddings, padding_idx=2) |
| res_old = embed_old(a) |
| res_F = F.embedding(a, embeddings, padding_idx=2) |
| |
| self.assertEqual(res_old, res_F) |
| |
| @unittest.skipUnless('fbgemm' in torch.backends.quantized.supported_engines, |
| 'Linear_FP16_weight requires FBGEMM. FBGEMM is only optimized for CPUs' |
| ' with instruction set support avx2 or newer.') |
| def test_fb_fc_packed(self): |
| X = np.random.rand(16, 16).astype(np.float32) - 0.5 |
| W = np.random.rand(16, 16).astype(np.float32) - 0.5 |
| b = np.random.rand(16).astype(np.float32) - 0.5 |
| |
| def fc_op(X, W, b): |
| return np.dot(X, W.T) + b |
| |
| x_tensor = torch.tensor(X) |
| w_tensor = torch.tensor(W) |
| b_tensor = torch.tensor(b) |
| packed_w_tensor = torch.fbgemm_pack_gemm_matrix_fp16(w_tensor) |
| actual_output = torch.fbgemm_linear_fp16_weight(x_tensor, packed_w_tensor, b_tensor) |
| expected_output = fc_op(X, W, b) |
| torch.testing.assert_allclose(expected_output, actual_output.cpu(), atol=1e-3, rtol=1e-3) |
| |
| def test_embeddingbag_from_pretrained(self): |
| a = torch.Tensor([[1, 2, 3], [4, 5, 6]]) |
| embeddingbag = nn.EmbeddingBag.from_pretrained(a) |
| self.assertEqual(a, embeddingbag.weight.data) |
| |
| input = torch.LongTensor([[0, 1]]) |
| output = embeddingbag(input) |
| self.assertEqual(a.mean(0, keepdim=True), output) |
| |
| def test_embeddingbag_from_pretrained_options(self): |
| a = torch.Tensor([[1, 2, 3], [4, 5, 6]]) |
| opts = { |
| "max_norm": 2., |
| "norm_type": .5, |
| "scale_grad_by_freq": False, |
| "mode": "max", |
| "sparse": False |
| } |
| embeddingbag = nn.EmbeddingBag.from_pretrained(a, **opts) |
| |
| input = torch.LongTensor([[0, 1]]) |
| output = embeddingbag(input) |
| self.assertEqual(a.max(0, keepdim=True)[0], output) |
| self.assertTrue(a.ne(torch.arange(1, 7, dtype=a.dtype).view(2, 3)).all()) |
| self.assertTrue(a.norm(p=opts["norm_type"], dim=1).le(opts["max_norm"]).all()) |
| |
| def test_fractional_max_pool2d(self): |
| x = torch.randn(1, 2, 7, 7, requires_grad=True) |
| samples = x.new(1, 2, 2).uniform_() |
| |
| def func(x): |
| return F.fractional_max_pool2d( |
| x, (2, 2), output_size=(3, 3), _random_samples=samples) |
| |
| self.assertEqual(func(x).shape, (1, 2, 3, 3)) |
| gradcheck(func, [x]) |
| gradgradcheck(func, [x]) |
| |
| x = torch.randn(2, 7, 7, requires_grad=True) |
| samples = x.new(2, 2).uniform_() |
| self.assertEqual(func(x).shape, (2, 3, 3)) |
| gradcheck(func, [x]) |
| gradgradcheck(func, [x]) |
| |
| def test_AlphaDropout(self): |
| # generate random tensor with zero mean and unit std |
| input = torch.randn(5000) |
| self._test_alpha_dropout(nn.AlphaDropout, input) |
| |
| def test_FeatureAlphaDropout(self): |
| b = random.randint(1, 5) |
| w = random.randint(1, 5) |
| h = random.randint(1, 5) |
| d = random.randint(1, 2) |
| num_features = 1000 |
| input = torch.randn(num_features, b, d, w, h) |
| self._test_alpha_dropout(nn.FeatureAlphaDropout, input) |
| |
| def test_pad_scalar_error(self): |
| inputs = torch.tensor(0., requires_grad=True) |
| self.assertRaises(AssertionError, lambda: F.pad(inputs, (1, 1))) |
| self.assertRaises(AssertionError, lambda: F.pad(inputs, (1,))) |
| |
| @unittest.skipIf(not TEST_NUMPY, "numpy not found") |
| def test_multihead_attention(self): |
| def _scaled_dot_attn_ref(Q, K, V, dims, unseen_mask=None, key_padding_mask=None): |
| """ Numpy-based reference implementation of scaled dot attention |
| for testing""" |
| |
| QKT = _batchmatmul( |
| Q, |
| np.transpose(K, axes=[0, 1, 3, 2]) |
| / np.sqrt(dims[3], dtype=np.float32), # divide by sqrt(d_head) |
| ) |
| b1, b2, s1, s2 = QKT.shape |
| if unseen_mask is not None or key_padding_mask is not None: |
| # assert s1 == s2 |
| for i in range(b1): |
| for j in range(b2): |
| for m in range(s1): |
| for n in range(s2): |
| if unseen_mask is not None and unseen_mask[m][n] == 0: |
| QKT[i, j, m, n] = -np.inf |
| if key_padding_mask is not None and key_padding_mask[i][n]: |
| QKT[i, j, m, n] = -np.inf |
| |
| reference = _softmax(QKT) |
| ref_attn_weight = reference |
| ref_attn_weight = np.sum(ref_attn_weight, axis=1) / b2 |
| reference = _batchmatmul(reference, V) |
| return reference, ref_attn_weight |
| |
| def _batchmatmul(a, b): # batchmatmul over 4 dim matrix |
| """ Numpy-based batch matrix multiply over 4 dim matrix""" |
| assert a.shape[0] == b.shape[0] |
| assert a.shape[1] == b.shape[1] |
| retval = np.zeros( |
| (a.shape[0], a.shape[1], a.shape[2], b.shape[3]), dtype=np.float32 |
| ) |
| for i in range(a.shape[0]): |
| for j in range(a.shape[1]): |
| retval[i, j, :, :] = np.matmul(a[i, j, :, :], b[i, j, :, :]) |
| return retval |
| |
| def _softmax(x): # softmax over 4 dim matrix |
| """ Numpy-based reference softmax over 4 dim matrix""" |
| np.seterr(invalid='ignore') |
| output = np.zeros(x.shape, dtype=np.float64) |
| for i in range(x.shape[0]): |
| for j in range(x.shape[1]): |
| for k in range(x.shape[2]): |
| x_curr = x[i, j, k, :] |
| e_x = np.exp(x_curr - np.amax(x_curr)) |
| output[i, j, k, :] = e_x / np.sum(e_x) |
| return output |
| |
| def _split_heads_ref(X, dims, nheads, d_head): |
| X_split = np.reshape(X, dims[:2] + [nheads, d_head]) |
| X_split_transposed = np.transpose(X_split, [0, 2, 1, 3]) |
| reference = np.reshape(X_split_transposed, [dims[0], nheads, dims[1], d_head]) |
| return reference |
| |
| def _combine_heads_ref(X, dims, nheads, d_head): |
| X_transposed = np.transpose(X, [0, 2, 1, 3]) |
| reference = np.reshape(X_transposed, dims[:2] + [nheads * d_head]) |
| return reference |
| |
| def _fc(X, X_weight, X_bias): |
| X_fc_b = X_bias.detach().numpy() |
| X_fc_w = X_weight.detach().numpy() |
| return np.matmul(X, np.transpose(X_fc_w)) + X_fc_b |
| |
| def _create_src_lengths_mask(batch_size, src_lengths): |
| """ |
| Generate boolean mask to prevent attention beyond the end of source |
| Inputs: |
| batch_size : int |
| src_lengths : [batch_size] of sentence lengths |
| Outputs: |
| [batch_size, max_src_len] |
| """ |
| max_srclen = src_lengths.max() |
| src_indices = torch.arange(0, max_srclen).unsqueeze(0).to(src_lengths) |
| src_indices = src_indices.expand(batch_size, max_srclen) |
| src_lengths = src_lengths.unsqueeze(dim=1).expand(batch_size, max_srclen) |
| # returns [batch_size, max_seq_len] |
| return (src_indices < src_lengths).int().detach() |
| |
| def _multihead_attn_test_helper(add_key_padding_mask=False, add_bias_kv=False, add_zero_attn=False, |
| saved_kv=False, same_embed_dim=False, byte_mask=False): |
| for _ in range(100): |
| batch_sz, seq_len = [random.randint(2, 10) for r in range(2)] |
| d_head = random.randint(3, 10) |
| nheads = random.randint(3, 10) |
| d_model = d_head * nheads |
| if same_embed_dim: |
| kv_dim = d_model |
| else: |
| kv_dim = random.randint(5, 20) |
| dims = [batch_sz, seq_len, kv_dim] |
| |
| saved_k = None |
| saved_k_tensor = None |
| saved_v = None |
| saved_v_tensor = None |
| if saved_kv: |
| saved_k = np.random.rand(batch_sz * nheads, seq_len, d_head) |
| saved_k_tensor = torch.from_numpy(saved_k).to(torch.get_default_dtype()) |
| saved_v = np.random.rand(batch_sz * nheads, seq_len, d_head) |
| saved_v_tensor = torch.from_numpy(saved_v).to(torch.get_default_dtype()) |
| |
| key_padding_mask = None |
| key_padding_mask_tensor = None |
| if add_key_padding_mask: |
| seq_mask = np.random.randint(0, 2, (1, seq_len)) |
| key_padding_mask = (np.repeat(seq_mask, batch_sz, axis=0) == 1) |
| key_padding_mask_tensor = torch.from_numpy(key_padding_mask) |
| if byte_mask: |
| key_padding_mask_tensor = key_padding_mask_tensor.byte() |
| decoder_state = np.random.rand(batch_sz, d_model) |
| K = np.random.rand(*dims) |
| V = K |
| Q = np.expand_dims(decoder_state, 1) |
| attn_mask = np.random.randint(0 , 2, size=(1, seq_len)) |
| attn_mask_tensor = torch.from_numpy(attn_mask).float() |
| if byte_mask: |
| attn_mask_tensor = (attn_mask_tensor == 0).byte() |
| else: |
| attn_mask_tensor.masked_fill_(attn_mask_tensor == 0, float('-inf')) |
| attn_mask_tensor.masked_fill_(attn_mask_tensor > 0, float('0.0')) |
| attn_mask_tensor = attn_mask_tensor.double() |
| |
| decoder_state_tensor = torch.from_numpy(decoder_state).to(torch.get_default_dtype()) |
| source_hid_tensor = torch.from_numpy(K).to(torch.get_default_dtype()).transpose(0, 1) |
| |
| multihead_attn_module = MultiheadAttention(d_model, nheads, |
| add_bias_kv=add_bias_kv, |
| add_zero_attn=add_zero_attn, |
| kdim=kv_dim, vdim=kv_dim) |
| |
| if add_bias_kv: |
| bias_k = multihead_attn_module.bias_k.detach().numpy() |
| bias_v = multihead_attn_module.bias_v.detach().numpy() |
| else: |
| bias_k = None |
| bias_v = None |
| |
| _Q = decoder_state_tensor.unsqueeze(1).transpose(0, 1) |
| _V = source_hid_tensor |
| _K = source_hid_tensor |
| |
| if multihead_attn_module._qkv_same_embed_dim: |
| result, result_weight = torch.nn.functional.multi_head_attention_forward( |
| _Q, _K, _V, |
| d_model, nheads, |
| multihead_attn_module.in_proj_weight, multihead_attn_module.in_proj_bias, |
| multihead_attn_module.bias_k, multihead_attn_module.bias_v, |
| multihead_attn_module.add_zero_attn, multihead_attn_module.dropout, |
| multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias, |
| multihead_attn_module.training, key_padding_mask_tensor, True, attn_mask_tensor, |
| static_k=saved_k_tensor, static_v=saved_v_tensor) |
| else: |
| result, result_weight = torch.nn.functional.multi_head_attention_forward( |
| _Q, _K, _V, |
| d_model, nheads, |
| None, multihead_attn_module.in_proj_bias, |
| multihead_attn_module.bias_k, multihead_attn_module.bias_v, |
| multihead_attn_module.add_zero_attn, multihead_attn_module.dropout, |
| multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias, |
| multihead_attn_module.training, key_padding_mask_tensor, True, attn_mask_tensor, |
| True, multihead_attn_module.q_proj_weight, |
| multihead_attn_module.k_proj_weight, multihead_attn_module.v_proj_weight, |
| static_k=saved_k_tensor, static_v=saved_v_tensor) |
| |
| result = result.squeeze(0).detach().numpy() |
| |
| if multihead_attn_module._qkv_same_embed_dim: |
| q_proj_weight = multihead_attn_module.in_proj_weight[:d_model] |
| k_proj_weight = multihead_attn_module.in_proj_weight[d_model:(d_model * 2)] |
| v_proj_weight = multihead_attn_module.in_proj_weight[(d_model * 2):] |
| else: |
| q_proj_weight = multihead_attn_module.q_proj_weight |
| k_proj_weight = multihead_attn_module.k_proj_weight |
| v_proj_weight = multihead_attn_module.v_proj_weight |
| |
| Q_fc = _fc(Q, q_proj_weight, multihead_attn_module.in_proj_bias[:d_model]) |
| K_fc = _fc(K, k_proj_weight, multihead_attn_module.in_proj_bias[d_model:(d_model * 2)]) |
| V_fc = _fc(V, v_proj_weight, multihead_attn_module.in_proj_bias[(d_model * 2):]) |
| |
| if add_bias_kv: |
| K_fc = np.concatenate((K_fc, np.repeat(bias_k, K_fc.shape[0], axis=0)), axis=1) |
| V_fc = np.concatenate((V_fc, np.repeat(bias_v, V_fc.shape[0], axis=0)), axis=1) |
| if attn_mask is not None: |
| attn_mask = np.concatenate((attn_mask, np.ones([1, 1])), axis=1) |
| if key_padding_mask is not None: |
| key_padding_mask = np.concatenate((key_padding_mask, np.full((batch_sz, 1), False, dtype=bool)), axis=1) |
| dims[1] += 1 |
| Q_split = _split_heads_ref( |
| Q_fc, [batch_sz, 1, d_model], nheads, d_head |
| ) |
| |
| if saved_k is not None: |
| K_split = np.reshape(saved_k, [dims[0], nheads, dims[1], d_head]) |
| else: |
| K_split = _split_heads_ref(K_fc, dims, nheads, d_head) |
| |
| if saved_v is not None: |
| V_split = np.reshape(saved_v, [dims[0], nheads, dims[1], d_head]) |
| else: |
| V_split = _split_heads_ref(V_fc, dims, nheads, d_head) |
| |
| if add_zero_attn: |
| dims[1] += 1 |
| K_split = np.concatenate((K_split, np.zeros([K_split.shape[0], K_split.shape[1], 1, K_split.shape[3]])), axis=2) |
| V_split = np.concatenate((V_split, np.zeros([V_split.shape[0], V_split.shape[1], 1, V_split.shape[3]])), axis=2) |
| |
| if attn_mask is not None: |
| attn_mask = np.concatenate((attn_mask, np.ones([1, 1])), axis=1) |
| |
| if key_padding_mask is not None: |
| key_padding_mask = np.concatenate((key_padding_mask, np.full((batch_sz, 1), False, dtype=bool)), axis=1) |
| attn_heads, ref_attn_weight = _scaled_dot_attn_ref( |
| Q=Q_split, |
| K=K_split, |
| V=V_split, |
| dims=Q_split.shape, |
| unseen_mask=attn_mask, |
| key_padding_mask=key_padding_mask |
| ) |
| combined_attn_heads = _combine_heads_ref( |
| X=attn_heads, dims=[batch_sz, 1], nheads=nheads, d_head=d_head |
| ) |
| |
| reference = _fc(combined_attn_heads, multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias) |
| reference = np.squeeze(reference, axis=1) |
| |
| # result = reference |
| self.assertEqual(tuple(result.shape), (batch_sz, d_model)) |
| np.testing.assert_allclose(result, reference, atol=1e-5) |
| |
| # result_weight = ref_attn_weight |
| result_weight = result_weight.detach().numpy() |
| self.assertEqual(tuple(result_weight.shape), tuple(ref_attn_weight.shape)) |
| np.testing.assert_allclose(result_weight, ref_attn_weight, atol=1e-5) |
| |
| def test_multihead_attn_add_bias_kv(): |
| _multihead_attn_test_helper(add_bias_kv=True) |
| |
| def test_multihead_attn_add_zero_attn(): |
| _multihead_attn_test_helper(add_zero_attn=True) |
| |
| def test_multihead_attn_no_masking(): |
| _multihead_attn_test_helper() |
| |
| def test_multihead_attn_key_padding_mask(): |
| _multihead_attn_test_helper(add_key_padding_mask=True) |
| |
| def test_multihead_attn_saved_kv(): |
| _multihead_attn_test_helper(saved_kv=True) |
| |
| def test_multihead_attn_add_bias_kv_zero_attn(): |
| _multihead_attn_test_helper(add_key_padding_mask=True, add_bias_kv=True, |
| add_zero_attn=True) |
| |
| def test_multihead_attn_all_arguments1(): |
| _multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True, saved_kv=True) |
| |
| def test_multihead_attn_all_arguments2(): |
| _multihead_attn_test_helper(add_key_padding_mask=True, add_bias_kv=True, |
| add_zero_attn=True, saved_kv=True) |
| |
| def test_multihead_attn_all_arguments3(): |
| _multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True, |
| saved_kv=True, same_embed_dim=True) |
| |
| def test_multihead_attn_all_arguments4(): |
| _multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True, |
| saved_kv=True, same_embed_dim=True, byte_mask=True) |
| |
| test_multihead_attn_add_zero_attn() # Test MultiheadAttention with add_zero_attn |
| test_multihead_attn_add_bias_kv() # Test MultiheadAttention with add_bias_kv |
| test_multihead_attn_no_masking() # Test MultiheadAttention without masking |
| test_multihead_attn_key_padding_mask() # Test MultiheadAttention with src lengths |
| test_multihead_attn_saved_kv() # Test MultiheadAttention with static kv. |
| test_multihead_attn_add_bias_kv_zero_attn() # Test MultiheadAttention with bias_kv and zero_attn. |
| test_multihead_attn_all_arguments1() # Test MultiheadAttention with all the argument. |
| with self.assertRaisesRegex(AssertionError, "bias cannot be added to static key."): |
| test_multihead_attn_all_arguments2() # Test MultiheadAttention with all the argument. |
| test_multihead_attn_all_arguments3() # Test MultiheadAttention with all the argument. |
| test_multihead_attn_all_arguments4() # Test MultiheadAttention with all the argument. |
| |
| def test_multihead_attn_3d_attn_mask(self): |
| embed_dim = 8 |
| num_heads = 4 |
| batch_size = 8 |
| src_len = 3 |
| tgt_len = 2 |
| |
| query = torch.rand(batch_size, tgt_len, embed_dim) # [N, T, D] |
| key = torch.rand(batch_size, src_len, embed_dim) # [N, S, D] |
| value = key # [N, S, D] |
| attn_mask = torch.randint(0, 2, (batch_size, tgt_len, src_len)).float() # [N, T, S] |
| attn_mask = attn_mask.masked_fill(attn_mask == 0, float('-inf')).masked_fill(attn_mask == 1, float(0.0)) |
| |
| mta_model = torch.nn.MultiheadAttention(embed_dim, num_heads) |
| |
| # Generate 3D results |
| attn_mask_3d = torch.repeat_interleave(attn_mask, num_heads, dim=0) # [N * H, T, S] |
| output_3d = mta_model(query.transpose(0, 1), key.transpose(0, 1), value.transpose(0, 1), attn_mask=attn_mask_3d)[0] |
| output_3d = output_3d.transpose(0, 1) # [N, T, D] |
| |
| for i in range(0, batch_size): |
| output_2d = mta_model(query[i].unsqueeze(0).transpose(0, 1), |
| key[i].unsqueeze(0).transpose(0, 1), |
| value[i].unsqueeze(0).transpose(0, 1), |
| attn_mask=attn_mask[i])[0] |
| |
| # output_2d in shape of [T, 1, D] |
| self.assertEqual(output_3d[i].unsqueeze(0).transpose(0, 1), output_2d) |
| |
| def test_normalize(self): |
| inputs = torch.randn(1, 3, 4, 4, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,))) |
| self.assertTrue(gradcheck(lambda x: F.normalize(x, p=2, dim=-2), (inputs,))) |
| |
| inputs = torch.randn((), requires_grad=True) |
| self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,))) |
| |
| def test_adaptive_pooling_input_size(self): |
| for numel in (2, 3): |
| for pool_type in ('Max', 'Avg'): |
| cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel) |
| module_cls = getattr(nn, cls_name) |
| output_size = (2,) * numel |
| module = module_cls(output_size) |
| |
| input = torch.randn(output_size) |
| self.assertRaises(ValueError, lambda: module(input)) |
| |
| def test_adaptive_pooling_size_none(self): |
| for numel in (2, 3): |
| for pool_type in ('Max', 'Avg'): |
| cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel) |
| module_cls = getattr(nn, cls_name) |
| output_size = (2,) * (numel - 1) + (None,) |
| module = module_cls(output_size) |
| |
| input = torch.randn((4,) * (numel + 1)) |
| output = module(input) |
| self.assertEqual(output.size(), (4,) + (2,) * (numel - 1) + (4,)) |
| |
| def test_adaptive_pooling_avg_nhwc(self): |
| device_list = ['cpu'] |
| if TEST_CUDA: |
| device_list.append('cuda') |
| |
| for device in device_list: |
| input = torch.randint(1, 10, (4, 8, 8, 8), dtype=torch.float32).to(device) |
| input = input.contiguous(memory_format=torch.channels_last).requires_grad_() |
| grad = torch.randint(1, 10, (4, 8, 7, 7), dtype=torch.float32).to(device) |
| pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device) |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device) |
| |
| out = pool(input) |
| out.backward(grad) |
| ref_out = ref_pool(ref_input) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| def test_adaptive_pooling_avg_nhwc_non_contiguous(self): |
| device_list = ['cpu'] |
| if TEST_CUDA: |
| device_list.append('cuda') |
| |
| for device in device_list: |
| input = torch.randint(1, 10, (4, 8, 8, 8), dtype=torch.float32).to(device) |
| input = input.contiguous(memory_format=torch.channels_last) |
| input = input[:, ::2, :, :].requires_grad_() |
| grad = torch.randint(1, 10, (4, 8, 7, 7), dtype=torch.float32).to(device) |
| grad = grad[:, ::2, :, :] |
| pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device) |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device) |
| |
| out = pool(input) |
| out.backward(grad) |
| ref_out = ref_pool(ref_input) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @largeTensorTest('12GB', device='cuda') |
| def test_adaptive_pooling_avg_nhwc_launch_config_backward(self): |
| input = torch.randint(1, 10, (1, 32, 2 ** 17 + 1, 32), dtype=torch.float32, device="cuda") |
| input = input.contiguous(memory_format=torch.channels_last).requires_grad_() |
| grad = torch.randint(1, 10, (1, 32, 10, 32), dtype=torch.float32, device="cuda") |
| |
| pool = torch.nn.AdaptiveAvgPool2d((10, 32)).cuda() |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_pool = torch.nn.AdaptiveAvgPool2d((10, 32)).cuda() |
| |
| out = pool(input) |
| out.backward(grad) |
| ref_out = ref_pool(ref_input) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @largeTensorTest('12GB', device='cuda') |
| def test_adaptive_pooling_avg_nhwc_launch_config_forward(self): |
| input = torch.randint(1, 10, (1, 32, 16, 16), dtype=torch.float32, device="cuda") |
| input = input.contiguous(memory_format=torch.channels_last).requires_grad_() |
| pool = torch.nn.AdaptiveAvgPool2d((2 ** 17 + 1, 32)).cuda() |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_pool = torch.nn.AdaptiveAvgPool2d((2 ** 17 + 1, 32)).cuda() |
| |
| out = pool(input) |
| ref_out = ref_pool(ref_input) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out) |
| |
| @unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported") |
| def test_broadcast_double_backwards_gpu(self): |
| tensors = (torch.randn(4, 4, device='cuda', requires_grad=True), |
| torch.randn(4, 4, device='cuda', requires_grad=True), |
| torch.randn(4, 4, device='cuda', requires_grad=True)) |
| # TODO(#50743): the following segfaults with check_batched_grad=True |
| _assertGradAndGradgradChecks(self, lambda *i: Broadcast.apply((0, 1), *i), tensors, |
| check_batched_grad=False) |
| |
| @unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported") |
| def test_broadcast_not_requiring_grad(self): |
| variables = [ |
| torch.randn(1, 2, device='cuda', requires_grad=True), |
| torch.randn(1, 2, device='cuda', requires_grad=False), |
| torch.randn(1, 2, device='cuda', requires_grad=False), |
| torch.randn(1, 2, device='cuda', requires_grad=True), |
| torch.randn(1, 2, device='cuda', requires_grad=True), |
| ] |
| broadcasted_variables = Broadcast.apply((0, 1), *variables) |
| for output_idx, broadcasted_var in enumerate(broadcasted_variables): |
| input_var = variables[output_idx % len(variables)] |
| self.assertEqual(input_var.requires_grad, broadcasted_var.requires_grad) |
| |
| @unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported") |
| def test_broadcast_no_grad(self): |
| x = torch.randn(1, 2, dtype=torch.float32, requires_grad=True, device='cuda') |
| with torch.no_grad(): |
| broadcasted = Broadcast.apply((0, 1), x) |
| self.assertTrue(x.requires_grad) |
| for output in broadcasted: |
| self.assertFalse(output.requires_grad) |
| |
| def test_state_dict(self): |
| l = nn.Linear(5, 5) |
| block = nn.Module() |
| block.conv = nn.Conv2d(3, 3, 3, bias=False) |
| net = nn.Module() |
| net.linear1 = l |
| net.linear2 = l |
| net.bn = nn.BatchNorm2d(2) |
| net.block = block |
| net.add_module('empty', None) |
| |
| state_dict = net.state_dict() |
| self.assertEqual(len(state_dict), 10) |
| self.assertEqual(len(state_dict._metadata), 6) |
| self.assertIn('', state_dict._metadata) |
| self.assertIn('linear1', state_dict._metadata) |
| self.assertIn('linear1.weight', state_dict) |
| self.assertIn('linear1.bias', state_dict) |
| self.assertIn('linear2', state_dict._metadata) |
| self.assertIn('linear2.weight', state_dict) |
| self.assertIn('linear2.bias', state_dict) |
| self.assertIn('block', state_dict._metadata) |
| self.assertIn('block.conv', state_dict._metadata) |
| self.assertIn('block.conv.weight', state_dict) |
| self.assertIn('block.conv.weight', state_dict) |
| self.assertNotIn('block.conv.bias', state_dict) |
| self.assertIn('bn', state_dict._metadata) |
| self.assertIn('bn.weight', state_dict) |
| self.assertIn('bn.bias', state_dict) |
| self.assertIn('bn.running_var', state_dict) |
| self.assertIn('bn.running_mean', state_dict) |
| self.assertIn('bn.num_batches_tracked', state_dict) |
| self.assertFalse(any(k.startswith('empty') for k in state_dict.keys())) |
| for k, v in state_dict.items(): |
| param = net |
| for component in k.split('.'): |
| param = getattr(param, component) |
| if isinstance(param, Parameter): |
| param = param.data |
| self.assertEqual(v.data_ptr(), param.data_ptr()) |
| |
| l = nn.Linear(5, 5) |
| state_dict = l.state_dict() |
| self.assertEqual(len(state_dict), 2) |
| self.assertEqual(len(state_dict._metadata), 1) |
| self.assertIn('', state_dict._metadata) |
| self.assertTrue(state_dict._metadata['']['version'] >= 0) |
| self.assertEqual(state_dict['weight'].data_ptr(), l.weight.data_ptr()) |
| self.assertEqual(state_dict['bias'].data_ptr(), l.bias.data_ptr()) |
| |
| def test_load_state_dict(self): |
| l = nn.Linear(5, 5) |
| block = nn.Module() |
| block.conv1 = nn.Conv2d(3, 3, 3, bias=True) |
| block.conv2 = nn.Conv2d(3, 3, 3, bias=False) |
| net = nn.Module() |
| net.linear1 = l |
| net.linear2 = l |
| net.bn = nn.BatchNorm2d(2) |
| net.block = block |
| net.add_module('empty', None) |
| |
| state_dict = net.state_dict() |
| state_dict.update({ |
| 'linear1.weight': torch.ones(5, 5), |
| 'block.conv1.bias': torch.arange(1, 4), |
| 'bn.running_mean': torch.randn(2), |
| }) |
| incompatible_keys = net.load_state_dict(state_dict) |
| self.assertEqual(len(incompatible_keys.missing_keys), 0) |
| self.assertEqual(len(incompatible_keys.unexpected_keys), 0) |
| self.assertNotIn('Incompatible', str(incompatible_keys)) |
| self.assertNotIn('Incompatible', repr(incompatible_keys)) |
| self.assertEqual(net.linear1.weight.data, state_dict['linear1.weight']) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(net.block.conv1.bias.data, state_dict['block.conv1.bias']) |
| self.assertEqual(net.bn.running_mean, state_dict['bn.running_mean']) |
| |
| state_dict = net.state_dict() |
| state_dict.update({'extra': torch.ones(5)}) |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict)) |
| incompatible_keys = net.load_state_dict(state_dict, strict=False) |
| self.assertEqual(len(incompatible_keys.missing_keys), 0) |
| self.assertEqual(len(incompatible_keys.unexpected_keys), 1) |
| self.assertIn('extra', incompatible_keys.unexpected_keys) |
| self.assertIn('Incompatible', str(incompatible_keys)) |
| self.assertIn('Incompatible', repr(incompatible_keys)) |
| |
| state_dict = net.state_dict() |
| state_dict.update({'extra.param': torch.ones(5)}) |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict)) |
| incompatible_keys = net.load_state_dict(state_dict, strict=False) |
| self.assertEqual(len(incompatible_keys.missing_keys), 0) |
| self.assertEqual(len(incompatible_keys.unexpected_keys), 1) |
| self.assertIn('extra.param', incompatible_keys.unexpected_keys) |
| |
| state_dict = net.state_dict() |
| del state_dict['linear1.weight'] |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict)) |
| incompatible_keys = net.load_state_dict(state_dict, strict=False) |
| self.assertEqual(len(incompatible_keys.missing_keys), 1) |
| self.assertEqual(len(incompatible_keys.unexpected_keys), 0) |
| self.assertIn('linear1.weight', incompatible_keys.missing_keys) |
| state_dict.update({'extra.param': torch.ones(5)}) |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict)) |
| incompatible_keys = net.load_state_dict(state_dict, strict=False) |
| self.assertEqual(len(incompatible_keys.missing_keys), 1) |
| self.assertEqual(len(incompatible_keys.unexpected_keys), 1) |
| self.assertIn('linear1.weight', incompatible_keys.missing_keys) |
| self.assertIn('extra.param', incompatible_keys.unexpected_keys) |
| |
| state_dict = net.state_dict() |
| state_dict.update({'bn.running_mean': torch.rand(14, 4)}) # wrong size |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict)) |
| self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict, strict=False)) |
| |
| state_dict = net.state_dict() |
| old_state_dict = deepcopy(state_dict) |
| state_dict = { |
| 'linear1.weight': torch.ones(5, 5), |
| 'block.conv1.bias': torch.arange(1, 4), |
| 'bn.running_mean': torch.randn(2), |
| 'nonexistent_key': torch.rand(3) |
| } |
| net.load_state_dict(state_dict, strict=False) |
| self.assertEqual(net.linear1.weight.data, state_dict['linear1.weight']) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(net.block.conv1.bias.data, state_dict['block.conv1.bias']) |
| self.assertEqual(net.bn.running_mean, state_dict['bn.running_mean']) |
| new_state_dict = net.state_dict() |
| del old_state_dict['linear1.weight'] |
| del old_state_dict['block.conv1.bias'] |
| del old_state_dict['bn.running_mean'] |
| for k, v, in old_state_dict.items(): |
| self.assertTrue(v.equal(new_state_dict[k])) |
| |
| def test_load_state_dict_BC(self): |
| # BatchNormNd |
| # Added num_batches_tracked buffer at version 2. For state dict with |
| # earlier versions or no versions, it should provide default value of 0. |
| bn = nn.BatchNorm2d(3) |
| state_dict = bn.state_dict() |
| del state_dict['num_batches_tracked'] |
| state_dict._metadata['']['version'] = 1 # version 1 |
| bn.load_state_dict(state_dict) |
| self.assertEqual(bn.num_batches_tracked.dtype, torch.long) |
| self.assertEqual(bn.num_batches_tracked.item(), 0) |
| del state_dict._metadata['']['version'] # no version |
| bn.load_state_dict(state_dict) |
| self.assertEqual(bn.num_batches_tracked.dtype, torch.long) |
| self.assertEqual(bn.num_batches_tracked.item(), 0) |
| |
| def test_load_state_dict_ref_cycle(self): |
| # load_state_dict shouldn't cause a reference cycle involving Tensors |
| import gc |
| |
| m = torch.nn.LSTM(16, 16, bidirectional=True) |
| |
| gc.collect() |
| m.load_state_dict(deepcopy(m).state_dict()) |
| refcycles = gc.collect() |
| |
| self.assertEqual(refcycles, 0) |
| |
| def test_load_state_dict_custom(self): |
| |
| class CustomState(nn.Module): |
| def __init__(self): |
| super(CustomState, self).__init__() |
| self.param = torch.nn.Parameter(torch.ones(1)) |
| self.sub = torch.nn.Linear(5, 5) |
| |
| def _save_to_state_dict(self, destination, prefix, keep_vars): |
| destination[prefix + "serialized"] = self.param.data + 1 |
| |
| def _load_from_state_dict(self, state_dict, prefix, local_metadata, |
| strict, missing_keys, unexpected_keys, |
| error_msgs): |
| # skip some of the error handling |
| self.param.data.copy_(state_dict[prefix + "serialized"] - 1) |
| |
| # use sequential to verify nesting |
| m = nn.Sequential(CustomState()) |
| with torch.no_grad(): |
| m[0].param[0] = 10 |
| m[0].sub.weight[0, 0] = 555 |
| state_dict = m.state_dict() |
| self.assertEqual(state_dict["0.serialized"].item(), 11) |
| self.assertIn("0.sub.weight", state_dict) |
| self.assertNotIn("0.param", state_dict) |
| del m |
| mm = nn.Sequential(CustomState()) |
| self.assertEqual(mm[0].param[0].item(), 1) |
| mm.load_state_dict(state_dict) |
| self.assertEqual(mm[0].param[0].item(), 10) |
| self.assertEqual(mm[0].sub.weight[0, 0].item(), 555) |
| |
| def test_parameter_assignment(self): |
| l = nn.Linear(5, 5) |
| |
| def num_params(): |
| return len(list(l.parameters())) |
| |
| self.assertEqual(num_params(), 2) |
| |
| new_param = Parameter(torch.randn(5, 5)) |
| l.param_name = new_param |
| self.assertEqual(num_params(), 3) |
| self.assertObjectIn(new_param, l.parameters()) |
| |
| var = torch.randn(5, 5) |
| l.var_name = var |
| self.assertEqual(num_params(), 3) |
| self.assertNotIn(id(var), map(id, l.parameters())) |
| |
| # Make sure Variables are not saved as parameters |
| l.variable_attr = torch.empty(5, 5) |
| self.assertEqual(num_params(), 3) |
| l.param_attr = Parameter(torch.empty(5, 5)) |
| self.assertEqual(num_params(), 4) |
| |
| # It shouldn't be possible to replace a parameter with a Variable |
| def assign_var(): |
| l.param_attr = torch.empty(5, 5) |
| |
| self.assertRaises(TypeError, assign_var) |
| # But replacing it with None should be fine |
| l.param_attr = None |
| self.assertEqual(num_params(), 3) |
| |
| def test_assignment(self): |
| l = nn.Module() |
| a = nn.Parameter(torch.randn(2)) |
| b = nn.Parameter(torch.randn(3)) |
| c = nn.Parameter(torch.randn(4)) |
| q = nn.Linear(4, 4) |
| r = nn.Linear(5, 5) |
| w = nn.Linear(6, 6) |
| |
| def test_assignments(get_list, a, b, c): |
| # Check that None can be shadowed |
| l.a = None |
| self.assertIsNone(l.a) |
| self.assertIn('a', l.__dict__) |
| l.a = a |
| self.assertIs(l.a, a) |
| self.assertEqual(get_list(), [a]) |
| self.assertNotIn('a', l.__dict__) |
| |
| # Assign second object |
| l.b = None |
| self.assertIsNone(l.b) |
| self.assertIn('b', l.__dict__) |
| l.b = b |
| self.assertIs(l.b, b) |
| self.assertEqual(get_list(), [a, b]) |
| self.assertNotIn('b', l.__dict__) |
| |
| # Remove and add the object back. Order should be unchanged. |
| l.a = None |
| self.assertIsNone(l.a) |
| self.assertEqual(get_list(), [b]) |
| l.a = a |
| self.assertIs(l.a, a) |
| self.assertEqual(get_list(), [a, b]) |
| |
| # Replace object with another one. Order should be unchanged. |
| l.a = c |
| self.assertIs(l.a, c) |
| self.assertEqual(get_list(), [c, b]) |
| |
| # Remove and reassign an attribute. It should appear at the end of the list now. |
| del l.a |
| self.assertFalse(hasattr(l, 'a')) |
| l.a = a |
| self.assertIs(l.a, a) |
| self.assertEqual(get_list(), [b, a]) |
| |
| test_assignments(lambda: list(l.parameters()), a, b, c) |
| del l.a, l.b |
| self.assertEqual(list(l.parameters()), []) |
| |
| test_assignments(lambda: list(l.children()), q, r, w) |
| del l.a, l.b |
| self.assertEqual(list(l.children()), []) |
| |
| buf = torch.randn(10) |
| l.register_buffer('buf', buf) |
| self.assertIs(l.buf, buf) |
| l.buf = None |
| self.assertIs(l.buf, None) |
| self.assertNotIn('buf', l.__dict__) # should be stored in l._buffers |
| l.buf = buf |
| self.assertIn('buf', l.state_dict()) |
| self.assertEqual(l.state_dict()['buf'], buf) |
| |
| def test_Conv2d_inconsistent_types(self): |
| inputs = torch.randn(4, 1, 7, 7, dtype=torch.float) |
| weights = torch.randn(1, 1, 3, 3, dtype=torch.double) |
| # inconsistent types should raise an exception |
| self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights)) |
| # but it should work with the same type |
| nn.functional.conv2d(inputs.float(), weights.float()) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_Conv2d_inconsistent_types_on_GPU_without_cudnn(self): |
| inputs = torch.randn(4, 1, 7, 7, dtype=torch.float, device="cuda") |
| weights = torch.randn(1, 1, 3, 3, dtype=torch.double, device="cuda") |
| bias = torch.randn(1, dtype=torch.double, device="cuda") |
| |
| with torch.backends.cudnn.flags(enabled=False): |
| # inconsistent types should raise an exception |
| self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights)) |
| self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights.float(), bias)) |
| |
| # but it should work with the same type |
| nn.functional.conv2d(inputs.float(), weights.float(), bias.float()) |
| |
| def test_Conv2d_1x1(self): |
| in_channels = 2 |
| out_channels = 2 |
| mod = torch.nn.Conv2d(2, 2, 1, bias=False).to(dtype=torch.double) |
| input = torch.randn(1, in_channels, 5, 5, requires_grad=True, dtype=torch.double) |
| for enabled in (False, True): |
| with torch.backends.mkldnn.flags(enabled=enabled): |
| gradcheck(F.conv2d, (input, mod.weight)) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @unittest.skipIf(not TEST_CUDNN, 'CUDNN not available') |
| def test_cudnn_non_contiguous(self): |
| x = torch.randn(192, 16, 50).cuda() |
| x = x.permute(0, 2, 1).contiguous().permute(0, 2, 1) |
| m = torch.nn.Conv1d( |
| in_channels=16, |
| out_channels=32, |
| kernel_size=2, |
| bias=True).cuda() |
| result = m(x) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @unittest.skipIf(not TEST_CUDNN, 'CUDNN not available') |
| def test_Conv2d_inconsistent_types_on_GPU_with_cudnn(self): |
| inputs = torch.randn(4, 1, 7, 7, dtype=torch.float, device="cuda") |
| weights = torch.randn(1, 1, 3, 3, dtype=torch.double, device="cuda") |
| bias = torch.randn(1, dtype=torch.double, device="cuda") |
| |
| with torch.backends.cudnn.flags(enabled=True): |
| # inconsistent types should raise an exception |
| self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights)) |
| self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights.float(), bias)) |
| |
| # but it should work with the same type |
| nn.functional.conv2d(inputs.float(), weights.float(), bias.float()) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @unittest.skipIf(not TEST_CUDNN, 'CUDNN not available') |
| @repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM)) |
| def test_Conv2d_deterministic_cudnn(self, dtype=torch.float): |
| inputs = torch.randn(2, 3, 5, 5, device="cuda", dtype=dtype, requires_grad=True) |
| with cudnn.flags(enabled=True, benchmark=True, deterministic=True): |
| conv1 = torch.nn.Conv2d(3, 3, 3).to("cuda", dtype) |
| conv2 = torch.nn.Conv2d(3, 3, 3).to("cuda", dtype) |
| conv2.bias.data.copy_(conv1.bias.data) |
| conv2.weight.data.copy_(conv1.weight.data) |
| out1 = conv1(inputs) |
| out2 = conv2(inputs) |
| self.assertEqual(out1, out2, atol=0.0, rtol=0) |
| y = torch.randn(out1.size(), device="cuda", dtype=dtype) |
| out1.backward(y) |
| out2.backward(y) |
| self.assertEqual(conv1.bias.grad.data, conv2.bias.grad.data, atol=0.0, rtol=0) |
| self.assertEqual(conv1.weight.grad.data, conv2.weight.grad.data, atol=0.0, rtol=0) |
| |
| def test_Conv2d_missing_argument(self): |
| c = nn.Conv2d(3, 3, 3) |
| self.assertRaises(TypeError, lambda: c(None)) |
| |
| def test_Conv2d_backward_twice(self): |
| input = torch.randn(2, 3, 5, 5) |
| c = nn.Conv2d(3, 3, 3) |
| o1 = c(input) |
| o1.sum().backward() |
| self.assertRaisesRegex(RuntimeError, 'Specify retain_graph=True', |
| lambda: o1.sum().backward()) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM)) |
| def test_Conv2d_large_workspace(self, dtype=torch.float): |
| # These sizes require huge cuDNN workspaces. Make sure we choose a |
| # reasonable algorithm that does not run out of memory |
| sizes = [ |
| (1, 256, 109, 175), |
| (1, 256, 80, 128), |
| (1, 256, 120, 192), |
| ] |
| |
| def run_test(benchmark): |
| with torch.backends.cudnn.flags(benchmark=benchmark): |
| conv = torch.nn.Conv2d(256, 256, kernel_size=3, padding=1).to("cuda", dtype) |
| for size in sizes: |
| x = torch.randn(size, device="cuda", dtype=dtype) |
| out = conv(x.detach().clone().requires_grad_()) |
| out.backward(torch.ones_like(out)) |
| |
| run_test(benchmark=False) |
| run_test(benchmark=True) |
| |
| def test_conv_modules_raise_error_on_incorrect_input_size(self): |
| for dtype in [torch.bfloat16, torch.double, torch.float]: |
| modules = [nn.Conv1d(3, 8, 3).to(dtype), nn.ConvTranspose1d(3, 8, 3).to(dtype), |
| nn.Conv2d(3, 8, 3).to(dtype), nn.ConvTranspose2d(3, 8, 3).to(dtype), |
| nn.Conv3d(3, 8, 3).to(dtype), nn.ConvTranspose3d(3, 8, 3).to(dtype)] |
| |
| invalid_input_dims = [(2, 4), (2, 4), |
| (3, 5), (3, 5), |
| (4, 6), (4, 6)] |
| |
| for invalid_dims, module in zip(invalid_input_dims, modules): |
| for dims in invalid_dims: |
| input = torch.empty(torch.Size((3, ) * dims)) |
| self.assertRaises(RuntimeError, lambda: module(input)) |
| |
| def test_conv_shapecheck(self): |
| def test(should_raise, module, input_size, dtype): |
| input = torch.empty(3, *input_size).to(dtype) |
| if should_raise: |
| self.assertRaises(RuntimeError, lambda: module(input)) |
| else: |
| # just run it to ensure no exception raised. |
| module(input) |
| |
| for dtype in [torch.bfloat16, torch.float, torch.double]: |
| # Conv1d |
| test(True, nn.Conv1d(1, 1, 3).to(dtype), (1, 2), dtype) |
| test(True, nn.Conv1d(1, 1, 3, stride=2).to(dtype), (1, 2), dtype) |
| test(False, nn.Conv1d(1, 1, 2).to(dtype), (1, 2), dtype) |
| test(False, nn.Conv1d(1, 1, 2, stride=2).to(dtype), (1, 2), dtype) |
| test(False, nn.Conv1d(1, 1, 3, stride=2, padding=1).to(dtype), (1, 2), dtype) |
| |
| # Conv2d |
| test(True, nn.Conv2d(1, 1, (3, 3)).to(dtype), (1, 2, 2), dtype) |
| test(False, nn.Conv2d(1, 1, (3, 3)).to(dtype), (1, 3, 3), dtype) |
| test(False, nn.Conv2d(1, 1, (3, 3), padding=1).to(dtype), (1, 2, 2), dtype) |
| |
| # Conv3D |
| test(True, nn.Conv3d(1, 1, (3, 3, 3)).to(dtype), (1, 2, 2, 2), dtype) |
| test(False, nn.Conv3d(1, 1, (3, 3, 3)).to(dtype), (1, 3, 3, 3), dtype) |
| test(False, nn.Conv3d(1, 1, (3, 3, 3), padding=1).to(dtype), (1, 2, 2, 2), dtype) |
| |
| def test_ConvTranspose2d_output_size(self): |
| m = nn.ConvTranspose2d(3, 4, 3, 3, 0, 2) |
| i = torch.randn(2, 3, 6, 6) |
| for h in range(15, 22): |
| for w in range(15, 22): |
| if 18 <= h <= 20 and 18 <= w <= 20: |
| output = m(i, output_size=(h, w)) |
| self.assertEqual(output.size()[2:], (h, w)) |
| else: |
| self.assertRaises(ValueError, lambda: m(i, (h, w))) |
| |
| def test_ConvTranspose2d_output_size_downsample_upsample(self): |
| b, c, hid_c = 2, 3, 2 |
| for h in range(13, 24): |
| for w in range(13, 17): |
| for k in range(2, 5): |
| for d in range(1, 5): |
| for s in range(1, 4): |
| for p in range(3): |
| conv = nn.Conv2d( |
| in_channels=c, |
| out_channels=hid_c, |
| kernel_size=k, |
| stride=s, |
| padding=p, |
| dilation=d, |
| ) |
| |
| t_conv = nn.ConvTranspose2d( |
| in_channels=hid_c, |
| out_channels=c, |
| kernel_size=k, |
| stride=s, |
| padding=p, |
| dilation=d, |
| ) |
| |
| i = torch.randn(b, c, h, w) |
| |
| out = t_conv(conv(i), output_size=i.shape) |
| |
| self.assertEqual(out.size()[2:], i.size()[2:]) |
| |
| def test_ConvTranspose3d_correct_output_size(self): |
| # Check that ConvTranspose3d can take a 5d output_size. |
| m = nn.ConvTranspose3d(2, 2, 2) |
| i = torch.rand(1, 2, 1, 1, 1) |
| out = m(i, output_size=(1, 2, 2, 2, 2)) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_ConvTranspose2d_half_cublas_gemm(self): |
| with torch.backends.cudnn.flags(enabled=False): |
| inputs = torch.randn(1, 1, 16, 16, device='cuda', dtype=torch.half) |
| deconv = nn.ConvTranspose2d( |
| 1, 1, 3, stride=2, padding=1, output_padding=1).cuda().half() |
| output = deconv(inputs) |
| output.mean().backward() |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @repeat_test_for_types([torch.half, torch.float]) |
| def test_ConvTranspose2d_large_output_padding(self, dtype=torch.half): |
| net1 = torch.nn.ConvTranspose2d(128, 64, kernel_size=3, stride=2, padding=1, output_padding=1)\ |
| .to(device='cuda', dtype=dtype) |
| net2 = torch.nn.ConvTranspose2d(64, 32, kernel_size=3, stride=2, padding=1, output_padding=1)\ |
| .to(device='cuda', dtype=dtype) |
| net3 = torch.nn.ConvTranspose2d(32, 3, kernel_size=3, stride=2, padding=1, output_padding=1)\ |
| .to(device='cuda', dtype=dtype) |
| x = torch.rand(1, 128, 6, 6, device='cuda', dtype=dtype, requires_grad=True) |
| x = net1(x) |
| x = net2(x) |
| x = net3(x) |
| x.backward(torch.randn_like(x)) |
| torch.cuda.synchronize() |
| |
| # For https://github.com/pytorch/pytorch/pull/1273 |
| # Almost identical to the above `test_Conv2d_naive_groups` |
| def test_Conv2d_groups_nobias(self): |
| dev_dtypes = [("cpu", torch.float)] |
| if TEST_CUDA: |
| dev_dtypes += [("cuda", torch.float), ("cuda", torch.half)] |
| if AMPERE_OR_ROCM: |
| dev_dtypes += [("cuda", torch.bfloat16)] |
| for device, dtype in dev_dtypes: |
| m = nn.Conv2d(4, 4, kernel_size=3, groups=2, bias=False).to(device, dtype) |
| i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True) |
| output = m(i) |
| grad_output = torch.randn(2, 4, 4, 4, device=device, dtype=dtype) |
| output.backward(grad_output) |
| |
| m1 = nn.Conv2d(2, 2, kernel_size=3, bias=False).to(device, dtype) |
| m1.weight.data.copy_(m.weight.data[:2]) |
| i1 = i.data[:, :2].contiguous().requires_grad_(True) |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :2].contiguous()) |
| |
| m2 = nn.Conv2d(2, 2, kernel_size=3, bias=False).to(device, dtype) |
| m2.weight.data.copy_(m.weight.data[2:]) |
| i2 = i.data[:, 2:].contiguous().requires_grad_(True) |
| output2 = m2(i2) |
| output2.backward(grad_output[:, 2:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1)) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0), |
| atol=1e-1 if dtype == torch.half else dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| # Almost identical to the above `test_Conv2d_naive_groups` |
| # Covering special case when group > 1, input-channel / group < 16 and output-channel is multiple of 16 |
| # See also https://github.com/pytorch/pytorch/pull/18463#issuecomment-476563686 |
| # and https://github.com/pytorch/pytorch/pull/18463#issuecomment-477001024 |
| def test_Conv2d_groups_nobias_v2(self): |
| torch.manual_seed(123) |
| dev_dtypes = [("cpu", torch.float)] |
| if TEST_CUDA: |
| dev_dtypes += [("cuda", torch.float), ("cuda", torch.half)] |
| if AMPERE_OR_ROCM: |
| dev_dtypes += [("cuda", torch.bfloat16)] |
| for device, dtype in dev_dtypes: |
| m = nn.Conv2d(4, 16, kernel_size=3, groups=2, bias=False).to(device, dtype) |
| i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True) |
| output = m(i) |
| grad_output = torch.randn(2, 16, 4, 4, device=device, dtype=dtype) |
| output.backward(grad_output) |
| |
| m1 = nn.Conv2d(2, 8, kernel_size=3, bias=False).to(device, dtype) |
| m1.weight.data.copy_(m.weight.data[:8]) |
| i1 = i.data[:, :2].contiguous().requires_grad_(True) |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :8].contiguous()) |
| |
| m2 = nn.Conv2d(2, 8, kernel_size=3, bias=False).to(device, dtype) |
| m2.weight.data.copy_(m.weight.data[8:]) |
| i2 = i.data[:, 2:].contiguous().requires_grad_(True) |
| output2 = m2(i2) |
| output2.backward(grad_output[:, 8:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1)) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0), |
| atol=1e-1 if dtype == torch.half else dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| # CPU-only test for group conv3d fast implementation using bmm |
| # See: https://github.com/pytorch/pytorch/pull/36355 |
| def test_Conv3d_groups_nobias(self): |
| torch.manual_seed(123) |
| m = nn.Conv3d(4, 16, kernel_size=3, groups=2, bias=False).to("cpu", torch.float) |
| i = torch.randn(2, 4, 6, 6, 6, device="cpu", dtype=torch.float, requires_grad=True) |
| output = m(i) |
| grad_output = torch.randn(2, 16, 4, 4, 4, device="cpu", dtype=torch.float) |
| output.backward(grad_output) |
| |
| m1 = nn.Conv3d(2, 8, kernel_size=3, bias=False).to("cpu", torch.float) |
| m1.weight.data.copy_(m.weight.data[:8]) |
| i1 = i.data[:, :2].contiguous().requires_grad_(True) |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :8].contiguous()) |
| |
| m2 = nn.Conv3d(2, 8, kernel_size=3, bias=False).to("cpu", torch.float) |
| m2.weight.data.copy_(m.weight.data[8:]) |
| i2 = i.data[:, 2:].contiguous().requires_grad_(True) |
| output2 = m2(i2) |
| output2.backward(grad_output[:, 8:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1)) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[torch.float], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0), |
| atol=dtype2prec_DONTUSE[torch.float], rtol=dtype2prec_DONTUSE[torch.float]) |
| |
| def test_Conv3d_groups_wbias(self): |
| torch.manual_seed(123) |
| m = nn.Conv3d(4, 16, kernel_size=3, groups=2, bias=True).to("cpu", torch.float) |
| i = torch.randn(2, 4, 6, 6, 6, device="cpu", dtype=torch.float, requires_grad=True) |
| output = m(i) |
| grad_output = torch.randn(2, 16, 4, 4, 4, device="cpu", dtype=torch.float) |
| output.backward(grad_output) |
| |
| m1 = nn.Conv3d(2, 8, kernel_size=3, bias=True).to("cpu", torch.float) |
| m1.weight.data.copy_(m.weight.data[:8]) |
| m1.bias.data.copy_(m.bias.data[:8]) |
| i1 = i.data[:, :2].contiguous().requires_grad_(True) |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :8].contiguous()) |
| |
| m2 = nn.Conv3d(2, 8, kernel_size=3, bias=True).to("cpu", torch.float) |
| m2.weight.data.copy_(m.weight.data[8:]) |
| m2.bias.data.copy_(m.bias.data[8:]) |
| i2 = i.data[:, 2:].contiguous().requires_grad_(True) |
| output2 = m2(i2) |
| output2.backward(grad_output[:, 8:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1)) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[torch.float], |
| rtol=dtype2prec_DONTUSE[torch.float]) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0), |
| atol=dtype2prec_DONTUSE[torch.float], |
| rtol=dtype2prec_DONTUSE[torch.float]) |
| self.assertEqual(m.bias.grad.data, |
| torch.cat([m1.bias.grad.data, m2.bias.grad.data], 0), |
| atol=dtype2prec_DONTUSE[torch.float], rtol=dtype2prec_DONTUSE[torch.float]) |
| |
| # Very similar to test_Conv2d_naive_groups but with special care to handle |
| # the number of groups == number of input channels |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @repeat_test_for_types(ALL_TENSORTYPES) |
| def test_Conv2d_depthwise_naive_groups_cuda(self, dtype=torch.float): |
| for depth_multiplier in [1, 2]: |
| m = nn.Conv2d(2, 2 * depth_multiplier, kernel_size=3, groups=2).to("cuda", dtype) |
| i = torch.randn(2, 2, 6, 6, device="cuda", dtype=dtype).div_(2).requires_grad_() |
| output = m(i) |
| grad_output = torch.randn(2, 2 * depth_multiplier, 4, 4, device="cuda", dtype=dtype) / 2 |
| output.backward(grad_output) |
| |
| offset = 1 * depth_multiplier |
| |
| m1 = nn.Conv2d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype) |
| m1.weight.data = m.weight.data[:offset].clone() |
| m1.bias.data = m.bias.data[:offset].clone() |
| i1 = i.detach()[:, :1].clone().requires_grad_() |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :offset].contiguous()) |
| |
| m2 = nn.Conv2d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype) |
| m2.weight.data.copy_(m.weight.data[offset:]) |
| m2.bias.data.copy_(m.bias.data[offset:]) |
| i2 = i.detach()[:, 1:].clone().requires_grad_() |
| output2 = m2(i2) |
| output2.backward(grad_output[:, offset:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.bias.grad.data, |
| torch.cat([m1.bias.grad.data, |
| m2.bias.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, |
| m2.weight.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @repeat_test_for_types(ALL_TENSORTYPES) |
| def test_Conv3d_depthwise_naive_groups_cuda(self, dtype=torch.float): |
| for depth_multiplier in [1, 2]: |
| m = nn.Conv3d(2, 2 * depth_multiplier, kernel_size=3, groups=2).to("cuda", dtype) |
| i = torch.randn(2, 2, 6, 6, 6, device="cuda", dtype=dtype).div_(2).requires_grad_() |
| output = m(i) |
| grad_output = torch.randn(2, 2 * depth_multiplier, 4, 4, 4, device="cuda", dtype=dtype) / 2 |
| output.backward(grad_output) |
| |
| offset = 1 * depth_multiplier |
| |
| m1 = nn.Conv3d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype) |
| m1.weight.data = m.weight.data[:offset].clone() |
| m1.bias.data = m.bias.data[:offset].clone() |
| i1 = i.detach()[:, :1].clone().requires_grad_() |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :offset].contiguous()) |
| |
| m2 = nn.Conv3d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype) |
| m2.weight.data.copy_(m.weight.data[offset:]) |
| m2.bias.data.copy_(m.bias.data[offset:]) |
| i2 = i.detach()[:, 1:].clone().requires_grad_() |
| output2 = m2(i2) |
| output2.backward(grad_output[:, offset:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.bias.grad.data, |
| torch.cat([m1.bias.grad.data, |
| m2.bias.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, |
| m2.weight.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| def test_MaxUnpool2d_output_size(self): |
| m = nn.MaxPool2d(3, stride=2, return_indices=True) |
| mu = nn.MaxUnpool2d(3, stride=2) |
| big_t = torch.rand(1, 1, 6, 6) |
| big_t[0][0][4][4] = 100 |
| output_big, indices_big = m(big_t) |
| self.assertRaises(RuntimeError, lambda: mu(output_big, indices_big)) |
| |
| small_t = torch.rand(1, 1, 5, 5) |
| for i in range(0, 4, 2): |
| for j in range(0, 4, 2): |
| small_t[:, :, i, j] = 100 |
| output_small, indices_small = m(small_t) |
| for h in range(3, 10): |
| for w in range(3, 10): |
| if 4 <= h <= 6 and 4 <= w <= 6: |
| size = (h, w) |
| if h == 6: |
| size = (1, 1) + size |
| |
| mu(output_small, indices_small, output_size=size) |
| else: |
| self.assertRaises(ValueError, lambda: mu(output_small, indices_small, (h, w))) |
| |
| def test_container_copy(self): |
| class Model(nn.Module): |
| def __init__(self): |
| super(Model, self).__init__() |
| self.linear = nn.Linear(4, 5) |
| |
| def forward(self, input): |
| return self.linear(input) |
| |
| input = torch.randn(2, 4) |
| |
| model = Model() |
| model_cp = deepcopy(model) |
| self.assertEqual(model(input).data, model_cp(input).data) |
| |
| model_cp.linear.weight.data[:] = 2 |
| self.assertNotEqual(model(input).data, model_cp(input).data) |
| |
| def test_RNN_cell(self): |
| # this is just a smoke test; these modules are implemented through |
| # autograd so no Jacobian test is needed |
| for module in (nn.RNNCell, nn.GRUCell): |
| for bias in (True, False): |
| input = torch.randn(3, 10) |
| hx = torch.randn(3, 20) |
| cell = module(10, 20, bias=bias) |
| for _ in range(6): |
| hx = cell(input, hx) |
| |
| hx.sum().backward() |
| |
| def _test_loss_equal_input_target_shape(self, cast): |
| # Tests losses whose inputs should have the same size. |
| losses = { |
| 'mse_loss': lambda x, y: F.mse_loss(x, y), |
| 'l1_loss': lambda x, y: F.l1_loss(x, y), |
| 'smooth_l1_loss': lambda x, y: F.smooth_l1_loss(x, y), |
| 'kl_div': lambda x, y: F.kl_div(x, y), |
| 'poisson_nll_loss': lambda x, y: F.poisson_nll_loss(x, y), |
| } |
| |
| input = cast(torch.randn(3, 5)) |
| target = cast(torch.randn(5, 3)) |
| for _name, fn in losses.items(): |
| self.assertRaises(Exception, lambda: fn(input, target)) |
| |
| def test_loss_equal_input_target_shape(self): |
| self._test_loss_equal_input_target_shape(lambda x: x) |
| |
| def test_mse_loss_size_warning(self): |
| i = torch.randn((10, 1), requires_grad=True) |
| t = torch.randn((10,)) |
| with warnings.catch_warnings(record=True) as w: |
| # Ensure warnings are being shown |
| warnings.simplefilter("always") |
| # Trigger Warning |
| F.mse_loss(i, t) |
| # Check warning occurs |
| self.assertEqual(len(w), 1) |
| self.assertIn('Please ensure they have the same size.', str(w[0])) |
| |
| def test_poisson_nll_loss_reduction_modes(self): |
| input = torch.tensor([0.5, 1.5, 2.5]) |
| target = torch.tensor([1., 2., 3.]) |
| component_wise_loss = torch.exp(input) - target * input |
| self.assertEqual(component_wise_loss, |
| F.poisson_nll_loss(input, target, reduction='none')) |
| self.assertEqual(torch.sum(component_wise_loss), |
| F.poisson_nll_loss(input, target, reduction='sum')) |
| self.assertEqual(torch.mean(component_wise_loss), |
| F.poisson_nll_loss(input, target, reduction='mean')) |
| with self.assertRaisesRegex(ValueError, 'is not valid'): |
| F.poisson_nll_loss(input, target, reduction='total') |
| |
| def test_gaussian_nll_loss_reduction_modes(self): |
| input = torch.tensor([[0.5, 1.5, 2.5], [2., 4., 6.]]) |
| target = torch.tensor([[1., 2., 3.], [4., 5., 6.]]) |
| var = torch.tensor([[0.5, 1., 1.5], [1., 1.5, 2.]]) |
| component_wise_loss = 0.5 * (torch.sum(torch.log(var) + (input - target)**2 / var, dim=1)) |
| self.assertEqual(component_wise_loss, |
| F.gaussian_nll_loss(input, target, var, reduction='none')) |
| self.assertEqual(torch.sum(component_wise_loss), |
| F.gaussian_nll_loss(input, target, var, reduction='sum')) |
| self.assertEqual(torch.mean(component_wise_loss), |
| F.gaussian_nll_loss(input, target, var, reduction='mean')) |
| with self.assertRaisesRegex(ValueError, 'is not valid'): |
| F.gaussian_nll_loss(input, target, var, reduction='total') |
| |
| def test_gaussian_nll_loss_args(self): |
| input = torch.randn(3, 5) |
| with self.assertRaisesRegex(ValueError, 'input and target must have same size'): |
| target = torch.randn(3, 6) |
| var = torch.ones(3, 5) |
| torch.nn.functional.gaussian_nll_loss(input, target, var) |
| with self.assertRaisesRegex(ValueError, 'var is of incorrect size'): |
| target = torch.randn(3, 5) |
| var = torch.ones(3, 3) |
| torch.nn.functional.gaussian_nll_loss(input, target, var) |
| with self.assertRaisesRegex(ValueError, 'var has negative entry/entries'): |
| var = -1 * torch.ones(3, 5) |
| torch.nn.functional.gaussian_nll_loss(input, target, var) |
| |
| def test_KLDivLoss_batch_mean(self): |
| input_shape = (2, 5) |
| log_prob1 = F.log_softmax(torch.randn(input_shape), 1) |
| prob2 = F.softmax(torch.randn(input_shape), 1) |
| |
| loss = nn.KLDivLoss(reduction='batchmean') |
| l = loss(log_prob1, prob2) |
| |
| loss_none_reduce = nn.KLDivLoss(reduction='sum')(log_prob1, prob2) |
| expected = loss_none_reduce / input_shape[0] |
| |
| self.assertEqual(l, expected) |
| |
| def test_KLDivLoss_batch_mean_log_target(self): |
| input_shape = (2, 5) |
| log_prob1 = F.log_softmax(torch.randn(input_shape), 1) |
| log_prob2 = F.log_softmax(torch.randn(input_shape), 1) |
| |
| loss = nn.KLDivLoss(reduction='batchmean', log_target=True) |
| l = loss(log_prob1, log_prob2) |
| |
| loss_none_reduce = nn.KLDivLoss(reduction='sum', log_target=True)(log_prob1, log_prob2) |
| expected = loss_none_reduce / input_shape[0] |
| |
| self.assertEqual(l, expected) |
| |
| def test_CTCLoss_typechecks(self): |
| target_lengths = torch.tensor([30, 25, 20]) |
| input_lengths = torch.tensor([50, 50, 50]) |
| targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int) |
| log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2) |
| with self.assertRaises(RuntimeError): |
| _input_lengths = input_lengths.to(dtype=torch.float) |
| torch.nn.functional.ctc_loss(log_probs, targets, _input_lengths, target_lengths) |
| with self.assertRaises(RuntimeError): |
| target_lengths = target_lengths.to(dtype=torch.float) |
| torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_CTCLoss_lengthchecks_cuda(self): |
| target_lengths = [30, 25, 20] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (3, 29), dtype=torch.long, device='cuda') |
| log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2) |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths) |
| |
| def test_CTCLoss_lengthchecks_cpu(self): |
| target_lengths = [30, 25, 20] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (3, 29), dtype=torch.int) |
| log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2) |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_CTCLoss_long_targets(self): |
| input_length = 4000 |
| vocab_size = 3 |
| batch_size = 4 |
| target_length = 1200 |
| |
| log_probs = torch.randn(input_length, batch_size, vocab_size).log_softmax(2).requires_grad_() |
| targets = torch.randint(low=1, high=vocab_size - 1, size=(batch_size, target_length), dtype=torch.long) |
| input_lengths = batch_size * [input_length] |
| target_lengths = batch_size * [target_length] |
| |
| res_cpu = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, |
| reduction='sum', zero_infinity=True) |
| grad_out = torch.randn_like(res_cpu) |
| grad_cpu, = torch.autograd.grad(res_cpu, log_probs, grad_out) |
| |
| with torch.backends.cudnn.flags(enabled=False): |
| res_gpu = torch.nn.functional.ctc_loss(log_probs.cuda(), targets.cuda(), input_lengths, target_lengths, |
| reduction='sum', zero_infinity=True) |
| grad_gpu, = torch.autograd.grad(res_gpu, log_probs, grad_out.cuda()) |
| self.assertEqual(res_cpu, res_gpu, atol=1e-4, rtol=0) |
| self.assertEqual(grad_cpu, grad_gpu, atol=1e-4, rtol=0) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_CTCLoss_zero_infinity(self): |
| target_lengths = [60, 25, 20] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int, device='cuda') |
| log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2).requires_grad_() |
| res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, |
| reduction='sum', zero_infinity=True) |
| with torch.backends.cudnn.flags(enabled=False): |
| res2 = torch.nn.functional.ctc_loss(log_probs, targets.cuda().long(), input_lengths, target_lengths, |
| reduction='sum', zero_infinity=True) |
| res_cpu = torch.nn.functional.ctc_loss(log_probs.cpu(), targets.cpu(), input_lengths, target_lengths, |
| reduction='sum', zero_infinity=True) |
| |
| self.assertEqual(res2, res, atol=1e-4, rtol=0) |
| self.assertEqual(res_cpu, res.cpu(), atol=1e-4, rtol=0) |
| g1, = torch.autograd.grad(res, log_probs) |
| g2, = torch.autograd.grad(res2, log_probs) |
| g3, = torch.autograd.grad(res_cpu, log_probs) |
| self.assertEqual(g2, g3, atol=1e-4, rtol=0) |
| self.assertEqual(g1, g2, atol=1e-4, rtol=0) |
| self.assertTrue((g1 == g1).all().item()) # check that we don't have NaN |
| |
| def test_RNN_cell_no_broadcasting(self): |
| def test(cell_module, input, hx, input_size, hidden_size): |
| cell = cell_module(input_size, hidden_size) |
| self.assertRaises(RuntimeError, lambda: cell(input, hx)) |
| |
| def test_all(hidden_size, bad_hx, good_hx, input_size, input): |
| test(nn.RNNCell, input, bad_hx, input_size, hidden_size) |
| test(nn.GRUCell, input, bad_hx, input_size, hidden_size) |
| test(nn.LSTMCell, input, (bad_hx, good_hx), input_size, hidden_size) |
| test(nn.LSTMCell, input, (good_hx, bad_hx), input_size, hidden_size) |
| |
| hidden_size = 20 |
| input_size = 10 |
| input = torch.randn(3, input_size) |
| bad_hx = torch.randn(1, hidden_size) |
| good_hx = torch.randn(3, hidden_size) |
| |
| # Test hidden/input batch size broadcasting |
| test_all(hidden_size, bad_hx, good_hx, input_size, input) |
| |
| # Test hx's hidden_size vs module's hidden_size broadcasting |
| bad_hx = torch.randn(3, 1) |
| test_all(hidden_size, bad_hx, good_hx, input_size, input) |
| |
| # Test input's input_size vs module's input_size broadcasting |
| bad_input = torch.randn(3, 1) |
| test_all(hidden_size, good_hx, good_hx, input_size, bad_input) |
| |
| def test_invalid_dropout_p(self): |
| v = torch.ones(1) |
| self.assertRaises(ValueError, lambda: nn.Dropout(-0.1)) |
| self.assertRaises(ValueError, lambda: nn.Dropout(1.1)) |
| self.assertRaises(ValueError, lambda: nn.Dropout2d(-0.1)) |
| self.assertRaises(ValueError, lambda: nn.Dropout2d(1.1)) |
| self.assertRaises(ValueError, lambda: nn.Dropout3d(-0.1)) |
| self.assertRaises(ValueError, lambda: nn.Dropout3d(1.1)) |
| self.assertRaises(ValueError, lambda: F.dropout(v, -0.1)) |
| self.assertRaises(ValueError, lambda: F.dropout(v, 1.1)) |
| |
| def test_pad_sequence(self): |
| def pad(tensor, length): |
| return torch.cat( |
| [tensor.data, tensor.data.new( |
| length - tensor.size(0), *tensor.size()[1:]).zero_()]) |
| |
| # single dimensional |
| a = torch.tensor([1, 2, 3]) |
| b = torch.tensor([4, 5]) |
| c = torch.tensor([6]) |
| |
| # batch_first = true |
| expected = torch.tensor([[4, 5, 0], [1, 2, 3], [6, 0, 0]]) |
| padded = rnn_utils.pad_sequence([b, a, c], True) |
| self.assertEqual(padded, expected) |
| |
| # batch_first = false |
| padded = rnn_utils.pad_sequence([b, a, c]) |
| self.assertEqual(padded, expected.transpose(0, 1)) |
| |
| # pad with non-zero value |
| expected = torch.tensor([[4, 5, 1], [1, 2, 3], [6, 1, 1]]) |
| padded = rnn_utils.pad_sequence([b, a, c], True, 1) |
| self.assertEqual(padded, expected) |
| |
| # Test pad sorted sequence |
| expected = torch.tensor([[1, 2, 3], [4, 5, 0], [6, 0, 0]]) |
| padded = rnn_utils.pad_sequence([a, b, c], True) |
| self.assertEqual(padded, expected) |
| |
| # more dimensions |
| maxlen = 9 |
| for num_dim in (0, 1, 2, 3): |
| sequences = [] |
| trailing_dims = [4] * num_dim |
| for i in range(1, maxlen + 1): |
| seq_len = i * i |
| sequences.append(torch.rand(seq_len, 5, *trailing_dims)) |
| random.shuffle(sequences) |
| expected = [] |
| for seq in sequences: |
| expected.append(pad(seq, maxlen * maxlen)) |
| # batch first = true |
| expected = torch.stack(expected) |
| padded = rnn_utils.pad_sequence(sequences, True) |
| self.assertEqual(padded, expected) |
| |
| # batch first = false |
| padded = rnn_utils.pad_sequence(sequences) |
| self.assertEqual(padded, expected.transpose(0, 1)) |
| |
| def test_pack_sequence(self): |
| def _compatibility_test(sequences, lengths, batch_first, enforce_sorted=False): |
| padded = rnn_utils.pad_sequence(sequences, batch_first) |
| packed = rnn_utils.pack_sequence(sequences, enforce_sorted) |
| unpacked = rnn_utils.pad_packed_sequence(packed, batch_first) |
| self.assertEqual(padded, unpacked[0]) |
| pack_padded = rnn_utils.pack_padded_sequence( |
| padded, lengths, batch_first, enforce_sorted) |
| self.assertEqual(packed, pack_padded) |
| |
| # single dimensional |
| a = torch.tensor([1, 2, 3]) |
| b = torch.tensor([4, 5]) |
| c = torch.tensor([6]) |
| packed = rnn_utils.pack_sequence([a, b, c], enforce_sorted=False) |
| expected = torch.tensor([1, 4, 6, 2, 5, 3]) |
| self.assertEqual(packed.batch_sizes, [3, 2, 1]) |
| self.assertEqual(packed.data.data, expected) |
| self.assertEqual(packed.sorted_indices, [0, 1, 2]) |
| self.assertEqual(packed.unsorted_indices, [0, 1, 2]) |
| |
| packed_unsorted = rnn_utils.pack_sequence([b, c, a], enforce_sorted=False) |
| self.assertEqual(packed_unsorted.batch_sizes, [3, 2, 1]) |
| self.assertEqual(packed_unsorted.data.data, expected) |
| self.assertEqual(packed_unsorted.sorted_indices, [2, 0, 1]) |
| self.assertEqual(packed_unsorted.unsorted_indices, [1, 2, 0]) |
| |
| # single dimensional, enforce_sorted = True |
| packed_enforce_sorted = rnn_utils.pack_sequence([a, b, c], enforce_sorted=True) |
| self.assertEqual(packed_enforce_sorted.batch_sizes, [3, 2, 1]) |
| self.assertEqual(packed_enforce_sorted.data.data, expected) |
| self.assertTrue(packed_enforce_sorted.sorted_indices is None) |
| self.assertTrue(packed_enforce_sorted.unsorted_indices is None) |
| |
| with self.assertRaisesRegex(RuntimeError, 'must be sorted in decreasing order'): |
| rnn_utils.pack_sequence([b, c, a], enforce_sorted=True) |
| |
| with self.assertRaisesRegex(RuntimeError, 'You can pass `enforce_sorted=False`'): |
| rnn_utils.pack_sequence([b, c, a], enforce_sorted=True) |
| |
| # more dimensions |
| maxlen = 9 |
| for num_dim in (0, 1, 2, 3): |
| sequences = [] |
| lengths = [] |
| trailing_dims = [4] * num_dim |
| for i in range(maxlen, 0, -1): |
| seq_len = i * i |
| lengths.append(seq_len) |
| sequences.append(torch.rand(seq_len, 5, *trailing_dims)) |
| unsorted_sequences = [s.clone() for s in sequences] |
| random.shuffle(unsorted_sequences) |
| unsorted_sequences_lengths = [t.size(0) for t in unsorted_sequences] |
| |
| # compatibility with other utilities |
| for batch_first in (True, False): |
| for enforce_sorted in (True, False): |
| _compatibility_test(sequences, lengths, batch_first, enforce_sorted) |
| _compatibility_test(unsorted_sequences, unsorted_sequences_lengths, |
| batch_first) |
| |
| def test_pack_padded_sequence(self): |
| def generate_test_case(sorted_lengths, should_shuffle): |
| def pad(tensor, length): |
| return torch.cat([tensor, tensor.new(length - tensor.size(0), *tensor.size()[1:]).zero_()]) |
| |
| max_length = sorted_lengths[0] |
| batch_sizes = [sum(map(bool, filter(lambda x: x >= i, sorted_lengths))) |
| for i in range(1, max_length + 1)] |
| offset = 0 |
| padded = torch.cat([pad(i * 100 + torch.arange(1., 5 * l + 1).view(l, 1, 5), max_length) |
| for i, l in enumerate(sorted_lengths, 1)], 1) |
| expected_data = [[torch.arange(1., 6) + (i + 1) * 100 + 5 * n for i in range(batch_size)] |
| for n, batch_size in enumerate(batch_sizes)] |
| expected_data = list(itertools.chain.from_iterable(expected_data)) |
| expected_data = torch.stack(expected_data, dim=0) |
| |
| if should_shuffle: |
| # Shuffle the padded sequence to create an unsorted sequence |
| permutation = list(range(len(sorted_lengths))) |
| random.shuffle(permutation) |
| |
| unsorted_indices = torch.tensor(permutation) |
| padded = padded.index_select(1, unsorted_indices) |
| lengths = torch.tensor(sorted_lengths).index_select(0, unsorted_indices) |
| else: |
| unsorted_indices = None |
| lengths = sorted_lengths |
| |
| return padded.requires_grad_(), lengths, expected_data, batch_sizes, unsorted_indices |
| |
| test_cases = [ |
| # sorted_lengths, should_shuffle |
| [[10, 8, 4, 2, 2, 2, 1], False], |
| [[11, 10, 8, 6, 4, 3, 1], False], |
| [[11, 10, 8, 6, 4, 3, 1], True], |
| ] |
| |
| for test_case, batch_first in itertools.product(test_cases, (True, False)): |
| sorted_lengths, should_shuffle = test_case |
| padded, lengths, expected_data, batch_sizes, unsorted_indices = generate_test_case( |
| sorted_lengths, should_shuffle) |
| |
| src = padded |
| if batch_first: |
| src = src.transpose(0, 1) |
| |
| # check output |
| packed = rnn_utils.pack_padded_sequence(src, lengths, batch_first=batch_first, |
| enforce_sorted=not should_shuffle) |
| self.assertEqual(packed.data.data, expected_data) |
| self.assertEqual(packed.batch_sizes, batch_sizes) |
| self.assertEqual(packed.unsorted_indices, unsorted_indices) |
| |
| # test inverse |
| unpacked, unpacked_len = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first) |
| self.assertEqual(unpacked, src) |
| self.assertEqual(unpacked_len, lengths) |
| |
| # check grad |
| if padded.grad is not None: |
| padded.grad.data.zero_() |
| grad_output = unpacked.data.clone().normal_() |
| unpacked.backward(grad_output) |
| if batch_first: |
| grad_output.transpose_(0, 1) |
| for i, l in enumerate(lengths): |
| self.assertEqual(padded.grad.data[:l, i], grad_output[:l, i]) |
| if l < 10: |
| self.assertEqual(padded.grad.data[l:, i].abs().sum(), 0) |
| |
| # test error messages |
| with self.assertRaisesRegex(RuntimeError, 'You can pass `enforce_sorted=False`'): |
| packed = rnn_utils.pack_padded_sequence(torch.randn(3, 3), [1, 3, 2]) |
| with self.assertRaisesRegex(RuntimeError, 'empty tensor'): |
| packed = rnn_utils.pack_padded_sequence(torch.randn(0, 0), []) |
| |
| def test_LSTM_cell(self): |
| # this is just a smoke test; these modules are implemented through |
| # autograd so no Jacobian test is needed |
| for bias in (True, False): |
| input = torch.randn(3, 10) |
| hx = torch.randn(3, 20) |
| cx = torch.randn(3, 20) |
| lstm = nn.LSTMCell(10, 20, bias=bias) |
| for _ in range(6): |
| hx, cx = lstm(input, (hx, cx)) |
| |
| (hx + cx).sum().backward() |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_pack_sequence_batch_sizes_throw(self): |
| with self.assertRaisesRegex(ValueError, r"batch_sizes should always be on CPU"): |
| m = nn.LSTM(3, 4, bidirectional=True, num_layers=2).to('cuda') |
| a = torch.rand(5, 3, device='cuda') |
| b = torch.tensor([1, 1, 1, 1, 1], device='cuda') |
| input = nn.utils.rnn.PackedSequence(a, b) |
| |
| def test_Transformer_cell(self): |
| # this is just a smoke test; these modules are implemented through |
| # autograd so no Jacobian test is needed |
| d_model = 512 |
| nhead = 16 |
| num_encoder_layers = 4 |
| num_decoder_layers = 3 |
| dim_feedforward = 256 |
| dropout = 0.3 |
| bsz = 8 |
| seq_length = 35 |
| tgt_length = 15 |
| |
| transformer = nn.Transformer(d_model, nhead, num_encoder_layers, num_decoder_layers, |
| dim_feedforward, dropout) |
| src = torch.randn(seq_length, bsz, d_model) |
| src_mask = transformer.generate_square_subsequent_mask(seq_length).double() |
| tgt = torch.randn(tgt_length, bsz, d_model) |
| tgt_mask = transformer.generate_square_subsequent_mask(tgt_length).double() |
| memory_mask = torch.randn(tgt_length, seq_length).double() |
| src_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5 |
| tgt_key_padding_mask = torch.rand(bsz, tgt_length) >= 0.5 |
| memory_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5 |
| |
| output = transformer(src, tgt, |
| src_mask=src_mask, |
| tgt_mask=tgt_mask, |
| memory_mask=memory_mask, |
| src_key_padding_mask=src_key_padding_mask, |
| tgt_key_padding_mask=tgt_key_padding_mask, |
| memory_key_padding_mask=memory_key_padding_mask) |
| output.sum().backward() |
| |
| def test_transformerencoderlayer(self): |
| # this is a deterministic test for TransformerEncoderLayer |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| bsz = 2 |
| |
| model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout) |
| |
| # set constant weights of the model |
| for idx, p in enumerate(model.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[20, 30, 40, 50]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.258703, 0.127985, -0.697881, 0.170862]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| # 0 values are NOT masked. This shouldn't mask anything. |
| mask = torch.Tensor([[0]]) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| result = result.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| # 1 values are masked. Since there is only 1 input embedding this |
| # will result in nan. |
| mask = torch.Tensor([[1]]) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| result = result.detach().numpy() |
| self.assertTrue(np.isnan(result).all()) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.272644, 0.119035, -0.691669, 0.153486]], |
| [[2.272644, 0.119035, -0.691669, 0.153486]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| # all 0 which is no masking |
| mask = torch.Tensor([[0, 0]]) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| result = result.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| mask = torch.Tensor([[1, 0]]) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor([[[2.301516, 0.092249, -0.679101, 0.103088]], |
| [[2.301516, 0.092249, -0.679101, 0.103088]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.428589, 0.020835, -0.602055, -0.085249], |
| [2.427987, 0.021213, -0.602496, -0.084103]], |
| [[2.424689, 0.019155, -0.604793, -0.085672], |
| [2.413863, 0.022211, -0.612486, -0.072490]], |
| [[2.433774, 0.021598, -0.598343, -0.087548], |
| [2.425104, 0.019748, -0.604515, -0.084839]], |
| [[2.436185, 0.022682, -0.596625, -0.087261], |
| [2.433556, 0.021891, -0.598509, -0.086832]], |
| [[2.416246, 0.017512, -0.610712, -0.082961], |
| [2.422901, 0.024187, -0.606178, -0.074929]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| # all 0 |
| mask = torch.zeros([2, 5]) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| result = result.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| mask[0, 1] = 1 |
| mask[1, 3] = 1 |
| mask[1, 4] = 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor([[[2.429026, 0.020793, -0.601741, -0.085642], |
| [2.428811, 0.021445, -0.601912, -0.084252]], |
| [[2.425009, 0.019155, -0.604566, -0.085899], |
| [2.415408, 0.02249 , -0.611415, -0.073]], |
| [[2.434199, 0.021682, -0.598039, -0.087699], |
| [2.42598, 0.019941, -0.603896, -0.085091]], |
| [[2.436457, 0.022736, -0.59643 , -0.08736], |
| [2.434021, 0.022093, -0.598179, -0.08679]], |
| [[2.416531, 0.017498, -0.610513, -0.083181], |
| [2.4242, 0.024653, -0.605266, -0.074959]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| def test_transformerencoderlayer_gelu(self): |
| # this is a deterministic test for TransformerEncoderLayer with gelu activation |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| bsz = 2 |
| activation = "gelu" |
| |
| model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout, activation) |
| |
| # set constant weights of the model |
| for idx, p in enumerate(model.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[20, 30, 40, 50]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.249815, 0.131006, -0.702199, 0.177868]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.264103, 0.121417, -0.696012, 0.159724]], |
| [[2.264103, 0.121417, -0.696012, 0.159724]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]]) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.42163188, 0.03227153, -0.60714219, -0.05908082], |
| [2.42151276, 0.03302179, -0.60722523, -0.05762651]], |
| [[2.41926761, 0.02974034, -0.60879519, -0.0621269], |
| [2.41626395, 0.03539356, -0.61087842, -0.04978623]], |
| [[2.42382808, 0.03218872, -0.6055963, -0.06073591], |
| [2.41983477, 0.03085259, -0.60840145, -0.06046414]], |
| [[2.42500749, 0.03328855, -0.60476388, -0.0595334], |
| [2.4237977, 0.03290575, -0.60561789, -0.05940082]], |
| [[2.41383916, 0.02686345, -0.61256377, -0.06380707], |
| [2.42000277, 0.03800944, -0.60824798, -0.04754947]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| def test_transformerdecoderlayer(self): |
| # this is a deterministic test for TransformerDecoderLayer |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| bsz = 2 |
| seq_length = 5 |
| tgt_length = 3 |
| |
| model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout) |
| |
| # set constant weights of the model |
| for idx, p in enumerate(model.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.314351, 0.094805, -0.671322, 0.101977]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]) |
| memory_input = torch.Tensor([[[1, 2, 3, 4]]]) |
| result = model(decoder_input, memory_input) |
| result = result.detach().numpy() |
| ref_output = torch.Tensor([[[2.422245, 0.051716, -0.606338, -0.024756]], |
| [[2.422245, 0.051716, -0.606338, -0.024756]]]) |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]) |
| memory_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.343536, 0.085561, -0.654954, 0.074991]], |
| [[2.343536, 0.085561, -0.654954, 0.074991]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]]) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # key_padding_mask |
| key_padding_mask = torch.zeros(2, 3) == 1 |
| result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # key_padding_mask |
| key_padding_mask[0, 2] = 1 |
| key_padding_mask[1, 1] = 1 |
| key_padding_mask[1, 2] = 1 |
| result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430025, 0.027643, -0.601164, -0.073476], |
| [2.4323, 0.029375, -0.599553, -0.071881]], |
| [[2.428523, 0.026838, -0.602226, -0.07391], |
| [2.432634, 0.029842, -0.599318, -0.071253]], |
| [[2.432278, 0.028152, -0.599555, -0.074139], |
| [2.432659, 0.029244, -0.599294, -0.072382]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # memory_key_padding_mask |
| key_padding_mask = torch.zeros(2, 5) == 1 |
| result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| # memory_key_padding_mask |
| key_padding_mask[0, 4] = 1 |
| key_padding_mask[1, 3] = 1 |
| key_padding_mask[1, 4] = 1 |
| result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.429757, 0.027358, -0.601351, -0.073816], |
| [2.432692, 0.028583, -0.599263, -0.073634]], |
| [[2.428247, 0.02662, -0.602419, -0.074123], |
| [2.432657, 0.029055, -0.599293, -0.072732]], |
| [[2.431515, 0.027687, -0.600096, -0.074459], |
| [2.433075, 0.028543, -0.598987, -0.073985]]]) |
| result = result.detach().numpy() |
| ref_output = ref_output.detach().numpy() |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| np.testing.assert_allclose(result, ref_output, atol=1e-5) |
| |
| def test_transformerdecoderlayer_gelu(self): |
| # this is a deterministic test for TransformerDecoderLayer with gelu activation |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| bsz = 2 |
| seq_length = 5 |
| tgt_length = 3 |
| activation = "gelu" |
| |
| model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout, activation) |
| |
| # set constant weights of the model |
| for idx, p in enumerate(model.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]) |
| memory_input = torch.Tensor([[[1, 2, 3, 4]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.415448, 0.054389, -0.610932, -0.0156613]], |
| [[2.415448, 0.054389, -0.610932, -0.0156613]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]) |
| memory_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.338531, 0.087709, -0.65776, 0.080646]], |
| [[2.338531, 0.087709, -0.65776, 0.080646]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]]) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]]) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.42049104, 0.03443088, -0.60793706, -0.05436271], |
| [2.42210631, 0.03546578, -0.60679895, -0.05357488]], |
| [[2.41907674, 0.0336104, -0.60892977, -0.05490462], |
| [2.42216881, 0.03586554, -0.6067524, -0.05289126]], |
| [[2.42205716, 0.03488046, -0.60683681, -0.05460596], |
| [2.42240309, 0.0354595, -0.60659063, -0.05378816]]]) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| def test_transformerencoder(self): |
| def get_a_test_layer(use_cuda, activation): |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| device = torch.device("cuda" if use_cuda else "cpu") |
| |
| layer = nn.TransformerEncoderLayer( |
| d_model, |
| nhead, |
| dim_feedforward=dim_feedforward, |
| dropout=dropout, |
| activation=activation).to(device) |
| |
| with torch.no_grad(): |
| # set constant weights of the model |
| for idx, p in enumerate(layer.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| return layer |
| |
| # this is a deterministic test for TransformerEncoder |
| activation = "relu" |
| use_cuda = torch.cuda.is_available() |
| device = torch.device("cuda" if use_cuda else "cpu") |
| |
| encoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation) |
| |
| model = nn.TransformerEncoder(encoder_layer, 1).to(device) |
| |
| # deterministic input |
| encoder_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]] |
| ).to(device) |
| result = model(encoder_input) |
| ref_output = torch.Tensor([[[2.428589, 0.020835, -0.602055, -0.085249], |
| [2.427987, 0.021213, -0.602496, -0.084103]], |
| [[2.424689, 0.019155, -0.604793, -0.085672], |
| [2.413863, 0.022211, -0.612486, -0.072490]], |
| [[2.433774, 0.021598, -0.598343, -0.087548], |
| [2.425104, 0.019748, -0.604515, -0.084839]], |
| [[2.436185, 0.022682, -0.596625, -0.087261], |
| [2.433556, 0.021891, -0.598509, -0.086832]], |
| [[2.416246, 0.017512, -0.610712, -0.082961], |
| [2.422901, 0.024187, -0.606178, -0.074929]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # all 0 |
| mask = torch.zeros([2, 5]).to(device) == 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| mask[0, 1] = 1 |
| mask[1, 3] = 1 |
| mask[1, 4] = 1 |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor([[[2.429026, 0.020793, -0.601741, -0.085642], |
| [2.428811, 0.021445, -0.601912, -0.084252]], |
| [[2.425009, 0.019155, -0.604566, -0.085899], |
| [2.415408, 0.02249, -0.611415, -0.073]], |
| [[2.434199, 0.021682, -0.598039, -0.087699], |
| [2.42598, 0.019941, -0.603896, -0.085091]], |
| [[2.436457, 0.022736, -0.59643, -0.08736], |
| [2.434021, 0.022093, -0.598179, -0.08679]], |
| [[2.416531, 0.017498, -0.610513, -0.083181], |
| [2.4242, 0.024653, -0.605266, -0.074959]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # test case 2, multiple layers no norm |
| model = nn.TransformerEncoder(encoder_layer, 2).to(device) |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor( |
| [[[2.419051, 0.017446, -0.608738, -0.085003], |
| [2.419102, 0.017452, -0.608703, -0.085026]], |
| [[2.419043, 0.017445, -0.608744, -0.084999], |
| [2.419052, 0.017446, -0.608738, -0.085004]], |
| [[2.419067, 0.017448, -0.608727, -0.085010], |
| [2.419098, 0.017452, -0.608706, -0.085024]], |
| [[2.419072, 0.017449, -0.608724, -0.085012], |
| [2.419119, 0.017455, -0.608691, -0.085034]], |
| [[2.419019, 0.017442, -0.608761, -0.084989], |
| [2.419075, 0.017449, -0.608722, -0.085014]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| model = nn.TransformerEncoder(encoder_layer, 6).to(device) |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor( |
| [[[2.419101, 0.017453, -0.608703, -0.085025], |
| [2.419101, 0.017453, -0.608704, -0.085025]], |
| [[2.419101, 0.017453, -0.608703, -0.085025], |
| [2.419101, 0.017453, -0.608704, -0.085025]], |
| [[2.419101, 0.017453, -0.608703, -0.085025], |
| [2.419101, 0.017453, -0.608704, -0.085025]], |
| [[2.419101, 0.017453, -0.608703, -0.085025], |
| [2.419101, 0.017453, -0.608704, -0.085025]], |
| [[2.419101, 0.017453, -0.608703, -0.085025], |
| [2.419101, 0.017453, -0.608704, -0.085025]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # test case 3, multiple layers with norm |
| # d_model = 4 |
| norm = nn.LayerNorm(4) |
| model = nn.TransformerEncoder(encoder_layer, 2, norm=norm).to(device) |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor( |
| [[[1.695949, -0.357635, -0.893077, -0.445238], |
| [1.695955, -0.357639, -0.893050, -0.445266]], |
| [[1.695948, -0.357634, -0.893082, -0.445233], |
| [1.695950, -0.357635, -0.893077, -0.445238]], |
| [[1.695951, -0.357636, -0.893069, -0.445246], |
| [1.695955, -0.357639, -0.893052, -0.445264]], |
| [[1.695952, -0.357636, -0.893066, -0.445249], |
| [1.695957, -0.357641, -0.893041, -0.445276]], |
| [[1.695946, -0.357632, -0.893095, -0.445220], |
| [1.695952, -0.357637, -0.893065, -0.445251]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| model = nn.TransformerEncoder(encoder_layer, 6, norm=norm).to(device) |
| result = model(encoder_input, src_key_padding_mask=mask) |
| ref_output = torch.Tensor( |
| [[[1.695955, -0.357639, -0.893051, -0.445265], |
| [1.695955, -0.357639, -0.893051, -0.445265]], |
| [[1.695955, -0.357639, -0.893051, -0.445265], |
| [1.695955, -0.357639, -0.893051, -0.445265]], |
| [[1.695955, -0.357639, -0.893051, -0.445265], |
| [1.695955, -0.357639, -0.893051, -0.445265]], |
| [[1.695955, -0.357639, -0.893051, -0.445265], |
| [1.695955, -0.357639, -0.893051, -0.445265]], |
| [[1.695955, -0.357639, -0.893051, -0.445265], |
| [1.695955, -0.357639, -0.893051, -0.445265]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| |
| def test_transformerdecoder(self): |
| def get_a_test_layer(use_cuda, activation): |
| d_model = 4 |
| nhead = 2 |
| dim_feedforward = 16 |
| dropout = 0.0 |
| device = torch.device("cuda" if use_cuda else "cpu") |
| |
| layer = nn.TransformerDecoderLayer( |
| d_model, |
| nhead, |
| dim_feedforward=dim_feedforward, |
| dropout=dropout, |
| activation=activation).to(device) |
| |
| with torch.no_grad(): |
| # set constant weights of the model |
| for idx, p in enumerate(layer.parameters()): |
| x = p.data |
| sz = x.view(-1).size(0) |
| shape = x.shape |
| x = torch.cos(torch.arange(0, sz).float().view(shape)) |
| p.data.copy_(x) |
| |
| return layer |
| |
| # this is a deterministic test for TransformerDecoder |
| activation = "relu" |
| use_cuda = torch.cuda.is_available() |
| device = torch.device("cuda" if use_cuda else "cpu") |
| |
| decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation) |
| |
| model = nn.TransformerDecoder(decoder_layer, 1).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]).to(device) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.314351, 0.094805, -0.671322, 0.101977]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]).to(device) |
| memory_input = torch.Tensor([[[1, 2, 3, 4]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.422245, 0.051716, -0.606338, -0.024756]], |
| [[2.422245, 0.051716, -0.606338, -0.024756]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]).to(device) |
| memory_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.343536, 0.085561, -0.654954, 0.074991]], |
| [[2.343536, 0.085561, -0.654954, 0.074991]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]] |
| ).to(device) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]] |
| ).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # key_padding_mask |
| key_padding_mask = torch.zeros(2, 3).to(device) == 1 |
| result = model(decoder_input, |
| memory_input, |
| tgt_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # key_padding_mask |
| key_padding_mask[0, 2] = 1 |
| key_padding_mask[1, 1] = 1 |
| key_padding_mask[1, 2] = 1 |
| result = model(decoder_input, |
| memory_input, |
| tgt_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430025, 0.027643, -0.601164, -0.073476], |
| [2.4323, 0.029375, -0.599553, -0.071881]], |
| [[2.428523, 0.026838, -0.602226, -0.07391], |
| [2.432634, 0.029842, -0.599318, -0.071253]], |
| [[2.432278, 0.028152, -0.599555, -0.074139], |
| [2.432659, 0.029244, -0.599294, -0.072382]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # memory_key_padding_mask |
| key_padding_mask = torch.zeros(2, 5).to(device) == 1 |
| result = model(decoder_input, |
| memory_input, |
| memory_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.430065, 0.027862, -0.601136, -0.073096], |
| [2.431935, 0.028907, -0.599809, -0.072488]], |
| [[2.428457, 0.027053, -0.602275, -0.073462], |
| [2.431970, 0.029387, -0.599789, -0.071621]], |
| [[2.431934, 0.028196, -0.599802, -0.073809], |
| [2.432306, 0.028858, -0.599542, -0.072846]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # memory_key_padding_mask |
| key_padding_mask[0, 4] = 1 |
| key_padding_mask[1, 3] = 1 |
| key_padding_mask[1, 4] = 1 |
| result = model(decoder_input, |
| memory_input, |
| memory_key_padding_mask=key_padding_mask) |
| ref_output = torch.Tensor([[[2.429757, 0.027358, -0.601351, -0.073816], |
| [2.432692, 0.028583, -0.599263, -0.073634]], |
| [[2.428247, 0.02662, -0.602419, -0.074123], |
| [2.432657, 0.029055, -0.599293, -0.072732]], |
| [[2.431515, 0.027687, -0.600096, -0.074459], |
| [2.433075, 0.028543, -0.598987, -0.073985]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # multiple layers no norm |
| model = nn.TransformerDecoder(decoder_layer, 2).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]).to(device) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.31316, 0.0950293, -0.671995, 0.102802]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # multiple layers no norm |
| model = nn.TransformerDecoder(decoder_layer, 6).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]] |
| ).to(device) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]] |
| ).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.42794, 0.026164, -0.60263, -0.0747591], |
| [2.43113, 0.0279516, -0.600376, -0.0736896]], |
| [[2.42794, 0.026164, -0.60263, -0.0747591], |
| [2.43113, 0.0279516, -0.600376, -0.0736896]], |
| [[2.42794, 0.026164, -0.60263, -0.0747591], |
| [2.43113, 0.0279516, -0.600376, -0.0736896]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # multiple layers with norm |
| # d_model = 4 |
| norm = nn.LayerNorm(4) |
| model = nn.TransformerDecoder(decoder_layer, 2, norm=norm).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]).to(device) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[1.66166, -0.326986, -1.01466, -0.320017]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # multiple layers with norm |
| model = nn.TransformerDecoder(decoder_layer, 6, norm=norm).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]] |
| ).to(device) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]] |
| ).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[1.69559, -0.357291, -0.894741, -0.443553], |
| [1.69571, -0.357363, -0.894154, -0.444196]], |
| [[1.69559, -0.357291, -0.894741, -0.443553], |
| [1.69571, -0.357363, -0.894154, -0.444196]], |
| [[1.69559, -0.357291, -0.894741, -0.443553], |
| [1.69571, -0.357363, -0.894154, -0.444196]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5) |
| |
| # gelu activation test cases |
| activation = "gelu" |
| use_cuda = torch.cuda.is_available() |
| device = torch.device("cuda" if use_cuda else "cpu") |
| |
| decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation) |
| |
| model = nn.TransformerDecoder(decoder_layer, 1).to(device) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[20, 30, 40, 50]]]).to(device) |
| memory_input = torch.Tensor([[[60, 70, 80, 90]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]] |
| ).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]).to(device) |
| memory_input = torch.Tensor([[[1, 2, 3, 4]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.415448, 0.054389, -0.610932, -0.0156613]], |
| [[2.415448, 0.054389, -0.610932, -0.0156613]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[1, 2, 3, 4]], |
| [[5, 6, 7, 8]]]).to(device) |
| memory_input = torch.Tensor([[[9, 10, 11, 12]], |
| [[11, 12, 13, 14]]]).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.338531, 0.087709, -0.65776, 0.080646]], |
| [[2.338531, 0.087709, -0.65776, 0.080646]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| # deterministic input |
| decoder_input = torch.Tensor([[[0.4517, 0.6793, 0.5313, 0.0034], |
| [0.2678, 0.3677, 0.4459, 0.7166]], |
| [[0.8100, 0.3716, 0.4096, 0.1976], |
| [0.6958, 0.8844, 0.6081, 0.8315]], |
| [[0.0494, 0.9343, 0.5955, 0.3830], |
| [0.5404, 0.3464, 0.9378, 0.6200]]] |
| ).to(device) |
| memory_input = torch.Tensor([[[0.7462, 0.6653, 0.5679, 0.4891], |
| [0.5387, 0.1655, 0.3565, 0.0471]], |
| [[0.8335, 0.2799, 0.5031, 0.2947], |
| [0.1402, 0.0318, 0.7636, 0.1346]], |
| [[0.6333, 0.9344, 0.1376, 0.9938], |
| [0.8924, 0.2872, 0.6692, 0.2944]], |
| [[0.9897, 0.6915, 0.3154, 0.1733], |
| [0.8645, 0.3513, 0.3064, 0.0767]], |
| [[0.8117, 0.2366, 0.4838, 0.7881], |
| [0.3718, 0.4945, 0.9511, 0.0864]]] |
| ).to(device) |
| result = model(decoder_input, memory_input) |
| ref_output = torch.Tensor( |
| [[[2.42049104, 0.03443088, -0.60793706, -0.05436271], |
| [2.42210631, 0.03546578, -0.60679895, -0.05357488]], |
| [[2.41907674, 0.0336104, -0.60892977, -0.05490462], |
| [2.42216881, 0.03586554, -0.6067524, -0.05289126]], |
| [[2.42205716, 0.03488046, -0.60683681, -0.05460596], |
| [2.42240309, 0.0354595, -0.60659063, -0.05378816]]]).to(device) |
| self.assertEqual(tuple(result.shape), tuple(ref_output.shape)) |
| torch.testing.assert_allclose(result, ref_output) |
| |
| |
| @unittest.skipIf(not (TEST_CUDNN and TEST_MULTIGPU), 'CUDNN or multi-gpu not available') |
| def test_cudnn_rnn_dropout_states_device(self): |
| rnn = nn.RNN(10, 20, num_layers=2, dropout=.5) |
| device = 1 |
| input = torch.randn(5, 4, 10).cuda(device) |
| rnn.cuda(device) |
| hx = torch.randn(2, 4, 20).cuda(device) |
| output = rnn(input, hx) |
| |
| @unittest.skipIf(not TEST_CUDNN, 'CUDNN not available') |
| @skipIfRocm |
| def test_cudnn_weight_format(self): |
| rnns = [ |
| nn.LSTM(10, 20, batch_first=True), |
| nn.LSTM(10, 20, batch_first=True, proj_size=10), |
| nn.GRU(10, 20, batch_first=True), |
| nn.RNN(10, 20, batch_first=True) |
| ] |
| first_warn = True |
| for rnn in rnns: |
| rnn.cuda() |
| input = torch.randn(5, 4, 10, requires_grad=True, device="cuda") |
| hx = torch.randn(1, 5, 20, requires_grad=True, device="cuda") |
| all_vars = [input, hx] + list(rnn.parameters()) |
| if isinstance(rnn, nn.LSTM): |
| # LSTM with projections has different hx size |
| if rnn.proj_size > 0: |
| hx = torch.randn(1, 5, 10, requires_grad=True, device="cuda") |
| all_vars[1] = hx |
| cx = torch.randn(1, 5, 20, requires_grad=True, device="cuda") |
| all_vars[2:2] = [cx] |
| hx = (hx, cx) |
| |
| output = rnn(input, hx) |
| output[0].sum().backward() |
| grads = [v.grad.data.clone() for v in all_vars] |
| for v in all_vars: |
| v.grad.data.zero_() |
| |
| # Weights will no longer view onto the same chunk of memory |
| weight = all_vars[4] |
| weight_data = weight.data.clone() |
| with torch.no_grad(): |
| weight.set_(weight_data) |
| |
| for _ in range(2): |
| with warnings.catch_warnings(record=True) as w: |
| output_noncontig = rnn(input, hx) |
| if first_warn: |
| self.assertEqual(len(w), 1) |
| self.assertIn('weights are not part of single contiguous chunk of memory', w[0].message.args[0]) |
| first_warn = False |
| warnings.resetwarnings() |
| output_noncontig[0].sum().backward() |
| grads_noncontig = [v.grad.data.clone() for v in all_vars] |
| for v in all_vars: |
| v.grad.data.zero_() |
| self.assertEqual(output, output_noncontig) |
| self.assertEqual(grads_noncontig, grads) |
| |
| # Make sure these still share storage |
| weight_data[:] = 4 |
| self.assertEqual(weight_data, all_vars[4].data) |
| |
| @unittest.skipIf(not TEST_CUDNN, 'CUDNN not available') |
| def test_cudnn_weight_tying(self): |
| rnns = [ |
| nn.LSTM(10, 20, batch_first=True, bidirectional=True), |
| nn.LSTM(10, 20, batch_first=True, bidirectional=True, proj_size=10), |
| nn.GRU(10, 20, batch_first=True, bidirectional=True), |
| nn.RNN(10, 20, batch_first=True, bidirectional=True) |
| ] |
| for rnn in rnns: |
| rnn.bias_ih_l0_reverse = rnn.bias_ih_l0 |
| rnn.cuda() |
| input = torch.randn(5, 4, 10, requires_grad=True, device="cuda") |
| hx = torch.randn(2, 5, 20, requires_grad=True, device="cuda") |
| all_vars = [input, hx] + list(rnn.parameters()) |
| opt = torch.optim.SGD(rnn.parameters(), lr=0.1) |
| opt.zero_grad() |
| if isinstance(rnn, nn.LSTM): |
| # LSTM with projections has different hx size |
| if rnn.proj_size > 0: |
| hx = torch.randn(2, 5, 10, requires_grad=True, device="cuda") |
| all_vars[1] = hx |
| cx = torch.randn(2, 5, 20, requires_grad=True, device="cuda") |
| all_vars[2:2] = [cx] |
| hx = (hx, cx) |
| |
| with warnings.catch_warnings(record=True) as w: |
| output = rnn(input, hx) |
| output[0].sum().backward() |
| |
| opt.step() |
| with warnings.catch_warnings(record=True) as w: |
| output_cuda = rnn(input, hx) |
| rnn.cpu() |
| hx = (hx[0].cpu(), hx[1].cpu()) if isinstance(rnn, nn.LSTM) else hx.cpu() |
| output_cpu = rnn(input.cpu(), hx) |
| self.assertEqual(output_cuda, output_cpu) |
| |
| def test_transformer_args_check(self): |
| model_name = 'Transformer' |
| d_model = 128 |
| nhead = 4 |
| num_encoder_layers = 2 |
| num_decoder_layers = 3 |
| dim_feedforward = 65 |
| dropout = 0.3 |
| bsz = 3 |
| seq_len = 35 |
| tgt_len = 15 |
| activations = ["relu", "gelu"] |
| |
| wrong_bsz = 7 |
| wrong_d_model = 63 |
| wrong_nhead = 5 |
| wrong_activation = "abc" |
| |
| def test(encoder_input_shape, decoder_input_shape, |
| src_mask_len=None, tgt_mask_len=None, memory_mask_size=None, |
| src_key_padding_mask_size=None, tgt_key_padding_mask_size=None, |
| memory_key_padding_mask_size=None): |
| encoder_input = torch.randn(encoder_input_shape) |
| decoder_input = torch.randn(decoder_input_shape) |
| model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, |
| num_decoder_layers, dim_feedforward, dropout) |
| |
| if src_mask_len is not None: |
| src_mask = model.generate_square_subsequent_mask(src_mask_len) |
| else: |
| src_mask = None |
| |
| if tgt_mask_len is not None: |
| tgt_mask = model.generate_square_subsequent_mask(tgt_mask_len) |
| else: |
| tgt_mask = None |
| |
| if memory_mask_size is not None: |
| memory_task = torch.rand(memory_mask_size) |
| else: |
| memory_task = None |
| |
| if src_key_padding_mask_size is not None: |
| src_key_padding_mask = torch.rand(src_key_padding_mask_size) >= 0.5 |
| else: |
| src_key_padding_mask = None |
| |
| if tgt_key_padding_mask_size is not None: |
| tgt_key_padding_mask = torch.rand(tgt_key_padding_mask_size) >= 0.5 |
| else: |
| tgt_key_padding_mask = None |
| |
| if memory_key_padding_mask_size is not None: |
| memory_key_padding_mask = torch.rand(memory_key_padding_mask_size) >= 0.5 |
| else: |
| memory_key_padding_mask = None |
| |
| with self.assertRaises(RuntimeError): |
| model(encoder_input, decoder_input, |
| src_mask=src_mask, |
| tgt_mask=tgt_mask, |
| memory_mask=memory_task, |
| src_key_padding_mask=src_key_padding_mask, |
| tgt_key_padding_mask=tgt_key_padding_mask, |
| memory_key_padding_mask=memory_key_padding_mask) |
| |
| |
| correct_encoder_input_shape = (seq_len, bsz, d_model) |
| correct_decoder_input_shape = (tgt_len, bsz, d_model) |
| |
| def update_shape(shape, dim, new_dim_size): |
| new_shape = list(shape) |
| new_shape[dim] = new_dim_size |
| return tuple(new_shape) |
| |
| # Incorrect encoder_input batch size |
| encoder_input_shape = update_shape(correct_encoder_input_shape, 1, wrong_bsz) |
| decoder_input_shape = correct_decoder_input_shape |
| test(encoder_input_shape, decoder_input_shape) |
| |
| # Incorrect decoder_input batch size |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = update_shape(correct_decoder_input_shape, 1, wrong_bsz) |
| test(encoder_input_shape, decoder_input_shape) |
| |
| # Incorrect encoder_input input size |
| encoder_input_shape = update_shape(correct_encoder_input_shape, 2, wrong_d_model) |
| decoder_input_shape = correct_decoder_input_shape |
| test(encoder_input_shape, decoder_input_shape) |
| |
| # Incorrect decoder_input input size |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = update_shape(correct_decoder_input_shape, 2, wrong_d_model) |
| test(encoder_input_shape, decoder_input_shape) |
| |
| # Incorrect nhead |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| with self.assertRaises(AssertionError): |
| model = getattr(nn, model_name)(d_model, wrong_nhead, num_encoder_layers, |
| num_decoder_layers, dim_feedforward, dropout) |
| |
| # Incorrect src_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| wrong_src_mask_size = seq_len + 1 |
| test(encoder_input_shape, decoder_input_shape, src_mask_len=wrong_src_mask_size) |
| |
| # Incorrect tgt_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| wrong_tgt_mask_size = tgt_len + 1 |
| test(encoder_input_shape, decoder_input_shape, tgt_mask_len=wrong_tgt_mask_size) |
| |
| # Incorrect memory_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| wrong_tgt_mask_size = tgt_len + 1 |
| test(encoder_input_shape, decoder_input_shape, |
| memory_mask_size=(wrong_tgt_mask_size, wrong_src_mask_size)) |
| |
| # Incorrect src_key_padding_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| with self.assertRaises(AssertionError): |
| test(encoder_input_shape, decoder_input_shape, |
| src_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size)) |
| |
| # Incorrect tgt_key_padding_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| with self.assertRaises(AssertionError): |
| test(encoder_input_shape, decoder_input_shape, |
| tgt_key_padding_mask_size=(wrong_bsz, wrong_tgt_mask_size)) |
| |
| # Incorrect memory_key_padding_mask |
| encoder_input_shape = correct_encoder_input_shape |
| decoder_input_shape = correct_decoder_input_shape |
| with self.assertRaises(AssertionError): |
| test(encoder_input_shape, decoder_input_shape, |
| memory_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size)) |
| |
| # Correct activations |
| for activation in activations: |
| model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers, |
| dim_feedforward, dropout, activation) |
| # Incorrect activation |
| with self.assertRaises(RuntimeError): |
| model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers, |
| dim_feedforward, dropout, wrong_activation) |
| |
| def test_transformer_layer_args_check(self): |
| model_names = ['TransformerEncoderLayer', 'TransformerDecoderLayer'] |
| d_model = 128 |
| nhead = 4 |
| dim_feedforward = 65 |
| dropout = 0.3 |
| bsz = 3 |
| seq_len = 35 |
| tgt_len = 15 |
| activations = ["relu", "gelu"] |
| |
| wrong_activation = "abc" |
| |
| encoder_input_shape = (seq_len, bsz, d_model) |
| decoder_input_shape = (tgt_len, bsz, d_model) |
| |
| encoder_input = torch.randn(encoder_input_shape) |
| decoder_input = torch.randn(decoder_input_shape) |
| |
| for model_name in model_names: |
| for activation in activations: |
| model = getattr(nn, model_name)(d_model, nhead, dim_feedforward, |
| dropout, activation) |
| # Incorrect activation |
| for model_name in model_names: |
| with self.assertRaises(RuntimeError): |
| model = getattr(nn, model_name)(d_model, nhead, dim_feedforward, |
| dropout, wrong_activation) |
| |
| def test_rnn_args_check(self): |
| input_size = 3 |
| hidden_size = 5 |
| num_layers = 2 |
| batch_size = 4 |
| seq_len = 6 |
| num_directions = 1 |
| bad_size = 7 # prime number so that no size can divide it. |
| |
| def test(input_shape, hidden_shape, mode): |
| for input, hidden in get_inputs(input_shape, hidden_shape, mode): |
| model = getattr(nn, mode)(input_size, hidden_size, num_layers) |
| self.assertRaises(RuntimeError, lambda: model(input, hidden)) |
| |
| correct_input_shape = (seq_len, batch_size, input_size) |
| correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size) |
| |
| def update_shape(shape, dim, new_dim_size): |
| new_shape = list(shape) |
| new_shape[dim] = new_dim_size |
| return tuple(new_shape) |
| |
| def get_inputs(input_shape, hidden_shape, mode): |
| '''returns list( tuple(input, hidden) ) |
| where input, hidden are inputs to a model''' |
| input = torch.randn(input_shape) |
| hidden = torch.randn(hidden_shape) |
| if mode != 'LSTM': |
| return [(input, hidden)] |
| if hidden_shape == correct_hidden_shape: |
| return [(input, (hidden, hidden))] |
| good_hidden = torch.randn(correct_hidden_shape) |
| return [ |
| (input, (hidden, good_hidden)), |
| (input, (good_hidden, hidden)), |
| ] |
| |
| rnn_modes = ['RNN', 'GRU', 'LSTM'] |
| for mode in rnn_modes: |
| # Incorrect input batch size |
| input_shape = update_shape(correct_input_shape, 1, bad_size) |
| hidden_shape = correct_hidden_shape |
| test(input_shape, hidden_shape, mode) |
| |
| # Incorrect hidden batch size |
| input_shape = correct_input_shape |
| hidden_shape = update_shape(correct_hidden_shape, 1, bad_size) |
| test(input_shape, hidden_shape, mode) |
| |
| # Incorrect input size |
| input_shape = update_shape(correct_input_shape, 2, bad_size) |
| hidden_shape = correct_hidden_shape |
| test(input_shape, hidden_shape, mode) |
| |
| # Incorrect hidden size |
| input_shape = correct_input_shape |
| hidden_shape = update_shape(correct_hidden_shape, 2, bad_size) |
| test(input_shape, hidden_shape, mode) |
| |
| # Incorrect hidden[0] |
| input_shape = correct_input_shape |
| hidden_shape = update_shape(correct_hidden_shape, 0, bad_size) |
| test(input_shape, hidden_shape, mode) |
| |
| def test_projections_lstm_args_check(self): |
| input_size = 3 |
| hidden_size = 5 |
| proj_size = 2 |
| num_layers = 2 |
| batch_size = 4 |
| seq_len = 6 |
| num_directions = 1 |
| bad_size = 7 # prime number so that no size can divide it. |
| |
| def test(input_shape, hidden_h_shape, hidden_c_shape): |
| for input, hidden in get_inputs(input_shape, hidden_h_shape, hidden_c_shape): |
| model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size) |
| self.assertRaises(RuntimeError, lambda: model(input, hidden)) |
| |
| correct_input_shape = (seq_len, batch_size, input_size) |
| correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size) |
| correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size) |
| |
| def update_shape(shape, dim, new_dim_size): |
| new_shape = list(shape) |
| new_shape[dim] = new_dim_size |
| return tuple(new_shape) |
| |
| def get_inputs(input_shape, hidden_h_shape, hidden_c_shape): |
| '''returns list( tuple(input, hidden) ) |
| where input, hidden are inputs to a model''' |
| input = torch.randn(input_shape) |
| hidden_h = torch.randn(hidden_h_shape) |
| hidden_c = torch.randn(hidden_c_shape) |
| return [(input, (hidden_h, hidden_c))] |
| |
| # Incorrect input batch size |
| input_shape = update_shape(correct_input_shape, 1, bad_size) |
| test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape) |
| |
| # Incorrect hidden batch size |
| input_shape = correct_input_shape |
| hidden_h_shape = update_shape(correct_hidden_h_shape, 1, bad_size) |
| hidden_c_shape = update_shape(correct_hidden_c_shape, 1, bad_size) |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| # Incorrect input size |
| input_shape = update_shape(correct_input_shape, 2, bad_size) |
| test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape) |
| |
| # Incorrect hidden size |
| input_shape = correct_input_shape |
| hidden_h_shape = update_shape(correct_hidden_h_shape, 2, bad_size) |
| hidden_c_shape = update_shape(correct_hidden_c_shape, 2, bad_size) |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| # Incorrect hidden[0] |
| input_shape = correct_input_shape |
| hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size) |
| hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size) |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| # Incorrect proj size = hidden size |
| input_shape = correct_input_shape |
| hidden_h_shape = update_shape(correct_hidden_h_shape, 0, hidden_size) |
| hidden_c_shape = correct_hidden_c_shape |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| # Incorrect proj size != hidden size |
| input_shape = correct_input_shape |
| hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size) |
| hidden_c_shape = correct_hidden_c_shape |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| # Incorrect cell size != hidden size |
| input_shape = correct_input_shape |
| hidden_h_shape = correct_hidden_h_shape |
| hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size) |
| test(input_shape, hidden_h_shape, hidden_c_shape) |
| |
| @unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported") |
| def test_rnn_check_device(self): |
| input_size = 3 |
| hidden_size = 5 |
| num_layers = 2 |
| batch_size = 4 |
| seq_len = 6 |
| num_directions = 1 |
| |
| correct_input_shape = (seq_len, batch_size, input_size) |
| correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size) |
| rnn_modes = ['RNN', 'GRU', 'LSTM'] |
| |
| for mode in rnn_modes: |
| model = getattr(nn, mode)(input_size, hidden_size, num_layers) |
| input = torch.randn(correct_input_shape) |
| hidden = torch.randn(correct_hidden_shape) |
| |
| # input and weights are not at the same device |
| with self.assertRaisesRegex(RuntimeError, |
| "Input and parameter tensors are not at the same device"): |
| model(input.to('cuda:0')) |
| |
| # input and hiddens are not at the same device |
| with self.assertRaisesRegex(RuntimeError, |
| r"Input and hidden tensors are not at the same device"): |
| if mode == 'LSTM': |
| model(input, (hidden.to('cuda:0'), hidden.to('cuda:0'))) |
| else: |
| model(input, (hidden.to('cuda:0'))) |
| |
| # hidden tensors are not at the same CUDA device |
| if mode == 'LSTM': |
| with self.assertRaisesRegex(RuntimeError, |
| "Input and hidden tensors are not at the same device"): |
| model(input.to('cuda:0'), (hidden.to('cuda:0'), hidden.to('cuda:1'))) |
| |
| @unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported") |
| def test_projections_lstm_check_device(self): |
| input_size = 3 |
| hidden_size = 5 |
| proj_size = 2 |
| num_layers = 2 |
| batch_size = 4 |
| seq_len = 6 |
| num_directions = 1 |
| |
| correct_input_shape = (seq_len, batch_size, input_size) |
| correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size) |
| correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size) |
| |
| model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size) |
| input = torch.randn(correct_input_shape) |
| hidden_h = torch.randn(correct_hidden_h_shape) |
| hidden_c = torch.randn(correct_hidden_c_shape) |
| |
| # input and weights are not at the same device |
| with self.assertRaisesRegex(RuntimeError, |
| "Input and parameter tensors are not at the same device"): |
| model(input.to('cuda:0')) |
| |
| # input and hiddens are not at the same device |
| with self.assertRaisesRegex(RuntimeError, |
| r"Input and hidden tensors are not at the same device"): |
| model(input, (hidden_h.to('cuda:0'), hidden_c.to('cuda:0'))) |
| |
| # hidden tensors are not at the same CUDA device |
| with self.assertRaisesRegex(RuntimeError, |
| "Input and hidden tensors are not at the same device"): |
| model(input.to('cuda:0'), (hidden_h.to('cuda:0'), hidden_c.to('cuda:1'))) |
| |
| def test_rnn_initial_hidden_state(self): |
| rnn_modes = ['RNN', 'GRU', 'LSTM'] |
| for mode in rnn_modes: |
| rnn = getattr(nn, mode)(30, 20, 2) |
| input = torch.randn(10, 32, 30) |
| hidden = torch.zeros(2, 32, 20) |
| |
| if mode == 'LSTM': |
| hidden = (hidden, hidden) |
| output1, hidden1 = rnn(input, hidden) |
| output2, hidden2 = rnn(input) |
| self.assertEqual(output1, output2) |
| self.assertEqual(hidden1, hidden2) |
| |
| def test_projections_lstm_initial_hidden_state(self): |
| for bidir in [False, True]: |
| rnn = nn.LSTM(30, 20, 2, bidirectional=bidir, proj_size=10) |
| num_dirs = 2 if bidir else 1 |
| input = torch.randn(10, 32, 30) |
| hidden_h = torch.zeros(2 * num_dirs, 32, 10) |
| hidden_c = torch.zeros(2 * num_dirs, 32, 20) |
| hidden = (hidden_h, hidden_c) |
| output1, hidden1 = rnn(input, hidden) |
| output2, hidden2 = rnn(input) |
| self.assertEqual(output1, output2) |
| self.assertEqual(hidden1, hidden2) |
| |
| def test_projections_errors_on_gru_and_rnn(self): |
| error_msg = "proj_size argument is only supported for LSTM, not RNN or GRU" |
| for mode in ['RNN', 'GRU']: |
| with self.assertRaisesRegex(ValueError, error_msg): |
| rnn = getattr(nn, mode)(30, 20, 2, proj_size=10) |
| |
| def _test_RNN_cpu_vs_cudnn(self, dropout, dtype=torch.double): |
| |
| def forward_backward(cuda, rnn, input_val, grad_output, weights_val, hx_val, grad_hy, |
| cx_val=None, grad_cy=None): |
| is_lstm = isinstance(rnn, nn.LSTM) |
| |
| for x_layer, y_layer in zip(rnn.all_weights, weights_val): |
| for x, y in zip(x_layer, y_layer): |
| x.data.copy_(y.data) |
| |
| if isinstance(input_val, rnn_utils.PackedSequence): |
| input = rnn_utils.PackedSequence( |
| input_val.data.data.requires_grad_(True), input_val.batch_sizes) |
| input_var = input.data |
| else: |
| input = input_val.clone().requires_grad_(True) |
| input_var = input |
| if is_lstm: |
| if cx_val is None: |
| hx = (hx_val.clone().requires_grad_(True), |
| hx_val.add(1).requires_grad_(True)) |
| else: |
| hx = (hx_val.clone().requires_grad_(True), |
| cx_val.add(1).requires_grad_(True)) |
| else: |
| hx = hx_val.clone().requires_grad_(True) |
| |
| if cuda: |
| rnn.cuda() |
| input_var.data = input_var.data.cuda() |
| if is_lstm: |
| hx[0].data = hx[0].data.cuda() |
| hx[1].data = hx[1].data.cuda() |
| else: |
| hx.data = hx.data.cuda() |
| grad_hy = grad_hy.cuda() |
| if grad_cy is not None: |
| grad_cy = grad_cy.cuda() |
| grad_output = grad_output.cuda() |
| |
| output, hy = rnn(input, hx) |
| |
| if isinstance(output, rnn_utils.PackedSequence): |
| output = output.data |
| |
| if is_lstm: |
| if grad_cy is None: |
| torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_hy + 1]) |
| else: |
| torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_cy + 1]) |
| else: |
| torch.autograd.backward([output, hy], [grad_output, grad_hy]) |
| |
| return {'output': output.data, |
| 'hy': hy[0].data if is_lstm else hy.data, |
| 'weights': rnn.all_weights, |
| 'grad_input': input_var.grad.data, |
| 'grad_hx': hx[0].grad.data if is_lstm else hx.grad.data, |
| 'cy': hy[1].data if is_lstm else None, |
| 'grad_cx': hx[1].grad.data if is_lstm else None} |
| |
| input_size = 10 |
| hidden_size = 6 |
| proj_size = 3 |
| num_layers = 2 |
| seq_length = 7 |
| batch = 6 |
| |
| def make_noncontig(tensor): |
| ndim = tensor.dim() |
| return torch.stack([tensor.clone().zero_(), tensor], ndim).select(ndim, 1) |
| |
| def compare_cpu_gpu(outputs_cpu, outputs_gpu): |
| self.assertEqual(list(outputs_cpu.keys()), list(outputs_gpu.keys())) |
| for key in outputs_cpu.keys(): |
| if key != 'weights': |
| self.assertEqual(outputs_cpu[key], outputs_gpu[key], atol=5e-5, rtol=0, msg=key) |
| |
| # check grad weights separately, as nested dict |
| for cpu_layer_weight, gpu_layer_weight in zip(outputs_cpu['weights'], outputs_gpu['weights']): |
| for (cpu_weight, gpu_weight) in zip(cpu_layer_weight, gpu_layer_weight): |
| self.assertEqual(cpu_weight.grad.data, gpu_weight.grad.data, atol=5e-5, rtol=0) |
| |
| for module in (nn.RNN, nn.LSTM, nn.GRU): |
| for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \ |
| in product((True, False), repeat=6): |
| |
| num_directions = 2 if bidirectional else 1 |
| if batch_first: |
| input_val = torch.randn(batch, seq_length, input_size, dtype=dtype) |
| grad_output = torch.randn(batch, seq_length, hidden_size * num_directions, dtype=dtype) |
| else: |
| input_val = torch.randn(seq_length, batch, input_size, dtype=dtype) |
| grad_output = torch.randn(seq_length, batch, hidden_size * num_directions, dtype=dtype) |
| |
| hx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype) |
| grad_hy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype) |
| |
| if not contig: |
| grad_output = make_noncontig(grad_output) |
| grad_hy = make_noncontig(grad_hy) |
| input_var = make_noncontig(input_val) |
| hx_val = make_noncontig(hx_val) |
| |
| if variable_len: |
| lengths = [7, 5, 5, 2, 1, 1] |
| if lens_as_tensor: |
| lengths = torch.tensor(lengths, dtype=torch.long) |
| input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first) |
| grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data |
| |
| rnn = module(input_size, |
| hidden_size, |
| num_layers, |
| bias=bias, |
| dropout=dropout, |
| bidirectional=bidirectional, |
| batch_first=batch_first).to(dtype) |
| |
| outputs_cpu = forward_backward( |
| False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy) |
| |
| rnn_gpu = module(input_size, |
| hidden_size, |
| num_layers, |
| bias=bias, |
| dropout=dropout, |
| bidirectional=bidirectional, |
| batch_first=batch_first).to(dtype) |
| |
| outputs_gpu = forward_backward( |
| True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy) |
| |
| compare_cpu_gpu(outputs_cpu, outputs_gpu) |
| |
| for nonlinearity in ('tanh', 'relu'): |
| hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype) |
| input_val = torch.randn(seq_length, batch, input_size, dtype=dtype) |
| grad_output = torch.randn( |
| seq_length, batch, hidden_size * num_directions, dtype=dtype) |
| grad_hy = torch.randn( |
| num_layers * num_directions, batch, hidden_size, dtype=dtype) |
| |
| rnn = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype) |
| outputs_cpu = forward_backward(False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy) |
| |
| rnn_gpu = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype) |
| outputs_gpu = forward_backward(True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy) |
| |
| compare_cpu_gpu(outputs_cpu, outputs_gpu) |
| |
| # checking LSTM with projections |
| for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \ |
| in product((True, False), repeat=6): |
| num_directions = 2 if bidirectional else 1 |
| if batch_first: |
| input_val = torch.randn(batch, seq_length, input_size, dtype=dtype) |
| grad_output = torch.randn(batch, seq_length, proj_size * num_directions, dtype=dtype) |
| else: |
| input_val = torch.randn(seq_length, batch, input_size, dtype=dtype) |
| grad_output = torch.randn(seq_length, batch, proj_size * num_directions, dtype=dtype) |
| |
| hx_val = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype) |
| cx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype) |
| grad_hy = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype) |
| grad_cy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype) |
| |
| if not contig: |
| grad_output = make_noncontig(grad_output) |
| grad_hy = make_noncontig(grad_hy) |
| grad_cy = make_noncontig(grad_cy) |
| input_var = make_noncontig(input_val) |
| hx_val = make_noncontig(hx_val) |
| cx_val = make_noncontig(cx_val) |
| |
| if variable_len: |
| lengths = [7, 5, 5, 2, 1, 1] |
| if lens_as_tensor: |
| lengths = torch.tensor(lengths, dtype=torch.long) |
| input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first) |
| grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data |
| |
| rnn = nn.LSTM(input_size, |
| hidden_size, |
| num_layers, |
| bias=bias, |
| dropout=dropout, |
| bidirectional=bidirectional, |
| batch_first=batch_first, |
| proj_size=proj_size).to(dtype) |
| |
| outputs_cpu = forward_backward( |
| False, rnn, input_val, grad_output, rnn.all_weights, |
| hx_val, grad_hy, cx_val, grad_cy) |
| |
| rnn_gpu = nn.LSTM(input_size, |
| hidden_size, |
| num_layers, |
| bias=bias, |
| dropout=dropout, |
| bidirectional=bidirectional, |
| batch_first=batch_first, |
| proj_size=proj_size).to(dtype) |
| # LSTM with projections is not supported with MIOpen |
| if TEST_WITH_ROCM and dtype == torch.float: |
| with self.assertRaisesRegex(RuntimeError, |
| "LSTM with projections is not supported with MIOpen"): |
| outputs_gpu = forward_backward( |
| True, rnn_gpu, input_val, grad_output, rnn.all_weights, |
| hx_val, grad_hy, cx_val, grad_cy) |
| else: |
| outputs_gpu = forward_backward( |
| True, rnn_gpu, input_val, grad_output, rnn.all_weights, |
| hx_val, grad_hy, cx_val, grad_cy) |
| compare_cpu_gpu(outputs_cpu, outputs_gpu) |
| |
| @unittest.skipIf(not TEST_CUDNN, "needs cudnn") |
| def test_RNN_cpu_vs_cudnn_no_dropout(self): |
| if TEST_WITH_ROCM: |
| dtype = torch.float |
| else: |
| dtype = torch.double |
| self._test_RNN_cpu_vs_cudnn(0, dtype) |
| |
| @unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1") |
| def test_RNN_cpu_vs_cudnn_with_dropout(self): |
| # Because of dropout randomness, can only compare dropout=0 and dropout=1 |
| self._test_RNN_cpu_vs_cudnn(1) |
| |
| @unittest.skipIf(not TEST_CUDNN, "needs cudnn") |
| def test_RNN_cudnn_weight_norm(self): |
| input_size = 10 |
| hidden_size = 6 |
| num_layers = 2 |
| seq_length = 7 |
| batch = 6 |
| |
| # runs on CPU to acquire expected output |
| def check_weight_norm(m, name): |
| input = torch.randn(seq_length, batch, input_size) |
| expected_output = m(input) |
| |
| # adds weight normalization |
| m = torch.nn.utils.weight_norm(m, name=name) |
| |
| # moves to CUDA |
| m = m.cuda() |
| input = input.cuda() |
| |
| # otherwise, subsequent warnings will be hidden, and further tests rely on them |
| warnings.simplefilter("always") |
| self.assertEqual(m(input), expected_output) |
| |
| # remove weight norm |
| m = torch.nn.utils.remove_weight_norm(m, name=name) |
| self.assertEqual(m(input), expected_output) |
| |
| check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers), 'weight_hh_l0') |
| check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers, proj_size=3), 'weight_hr_l0') |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_partial_flat_weights(self): |
| input_size = 10 |
| hidden_size = 6 |
| num_layers = 2 |
| |
| m = nn.LSTM(input_size, hidden_size, num_layers) |
| inp = torch.randn(3, 2, 10) |
| out_expected = m(inp) |
| # deletes an attribute of original LSTM |
| weight_orig = m.weight_hh_l0 |
| del m.weight_hh_l0 |
| self.assertFalse(hasattr(m, "weight_hh_l0")) |
| # verifies that moving to CUDA with only some attributes defined |
| # does not throw an error |
| m.cuda() |
| # recompute the weight and make sure that module can be used |
| m.weight_hh_l0 = weight_orig.cuda() |
| inp = inp.cuda() |
| # otherwise, subsequent warnings will be hidden, and further tests rely on them |
| warnings.simplefilter("always") |
| self.assertEqual(m(inp)[0].cpu(), out_expected[0]) |
| |
| |
| @unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1") |
| def test_RNN_dropout(self): |
| # checking the assumption that cuDNN sticks dropout in between |
| # RNN layers |
| for p in (0, 0.276, 0.731, 1): |
| for train in (True, False): |
| for cuda in (True, False): |
| rnn = nn.RNN(10, 1000, 2, bias=False, dropout=p, nonlinearity='relu') |
| if cuda: |
| rnn.cuda() |
| |
| if train: |
| rnn.train() |
| else: |
| rnn.eval() |
| rnn.weight_ih_l0.data.fill_(1) |
| rnn.weight_hh_l0.data.fill_(1) |
| rnn.weight_ih_l1.data.fill_(1) |
| rnn.weight_hh_l1.data.fill_(1) |
| input = torch.ones(1, 1, 10) |
| hx = torch.zeros(2, 1, 1000) |
| if cuda: |
| input = input.cuda() |
| hx = hx.cuda() |
| |
| output, hy = rnn(input, hx) |
| self.assertEqual(output.data.min(), output.data.max()) |
| output_val = output.data[0][0][0] |
| if p == 0 or not train: |
| self.assertEqual(output_val, 10000) |
| elif p == 1: |
| self.assertEqual(output_val, 0) |
| else: |
| self.assertGreater(output_val, 8000) |
| self.assertLess(output_val, 12000) |
| denorm_mod = (output_val * (1 - p)) % 10 |
| self.assertLess(min(denorm_mod, 10 - denorm_mod), 1e-2) |
| |
| self.assertEqual(hy[0].data.min(), hy[0].data.max()) |
| self.assertEqual(hy[1].data.min(), hy[1].data.max()) |
| self.assertEqual(hy.data[0][0][0], 10) |
| self.assertEqual(hy.data[1][0][0], output_val) |
| |
| @unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1") |
| def test_RNN_dropout_state(self): |
| for p in (0, 0.1234): |
| for train in (True, False): |
| for cuda in (True, False): |
| rnn = nn.RNN(100, 100, 2, bias=False, dropout=p, nonlinearity='relu') |
| if cuda: |
| rnn.cuda() |
| |
| if train: |
| rnn.train() |
| else: |
| rnn.eval() |
| input = torch.rand(1, 1, 100) |
| hx = torch.rand(2, 1, 100) |
| if cuda: |
| input = input.cuda() |
| hx = hx.cuda() |
| |
| output1, hy1 = rnn(input, hx) |
| output2, hy2 = rnn(input, hx) |
| |
| buf = io.BytesIO() |
| rnn_pickle = torch.save(rnn, buf) |
| buf.seek(0) |
| rnn2 = torch.load(buf) |
| rnn2.flatten_parameters() |
| output3, hy3 = rnn2(input, hx) |
| |
| if p == 0 or not train: |
| self.assertEqual(output1, output2) |
| self.assertEqual(output1, output3) |
| self.assertEqual(hy1, hy2) |
| self.assertEqual(hy1, hy3) |
| else: |
| self.assertNotEqual(output1, output2) |
| self.assertNotEqual(output1, output3) |
| self.assertNotEqual(hy1, hy2) |
| self.assertNotEqual(hy1, hy3) |
| |
| @unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1") |
| def test_RNN_change_dropout(self): |
| for train, cuda in product((True, False), repeat=2): |
| rnn = nn.RNN(100, 100, 2, dropout=0, nonlinearity='relu') |
| input = torch.rand(3, 2, 100) |
| if cuda: |
| input.data = input.data.cuda() |
| rnn.cuda() |
| |
| if train: |
| rnn.train() |
| else: |
| rnn.eval() |
| |
| prev_output = None |
| for p in (0, 0.5, 0, 0.7, 0.2, 1, 0.2, 0): |
| rnn.dropout = p |
| output1, hy1 = rnn(input) |
| output2, hy2 = rnn(input) |
| |
| if p == 0 or p == 1 or not train: |
| self.assertEqual(output1, output2) |
| self.assertEqual(hy1, hy2) |
| else: |
| self.assertNotEqual(output1, output2) |
| self.assertNotEqual(hy1, hy2) |
| |
| if prev_output is not None: |
| if not train: |
| self.assertEqual(output1.data, prev_output) |
| self.assertEqual(output2.data, prev_output) |
| else: |
| self.assertNotEqual(output1.data, prev_output) |
| self.assertNotEqual(output2.data, prev_output) |
| prev_output = output1.data |
| |
| def test_inplace_thnn(self): |
| modules = [nn.ReLU, nn.ELU, nn.SELU, nn.CELU, nn.RReLU] |
| for mod in modules: |
| r = mod(inplace=True) |
| input = torch.randn(5, 5, requires_grad=True) |
| output = r(input + 0) |
| grad_output = torch.randn(5, 5) |
| grad_output_clone = grad_output.clone() |
| output.backward(grad_output) |
| self.assertEqual(grad_output, grad_output_clone) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM)) |
| def test_noncontig_conv_grad_cuda(self, dtype=torch.float): |
| # FIXME: remove after adding non-contiguous grad tests for all modules |
| module = nn.Conv2d(3, 5, kernel_size=3, padding=1).to("cuda", dtype) |
| input = torch.randn(2, 3, 10, 10, dtype=dtype, device="cuda", requires_grad=True) |
| output = module(input) |
| |
| grad = torch.randn(2, 2, 5, 10, 10, dtype=dtype, device="cuda")[:, 1] |
| assert not grad.is_contiguous() |
| output.backward(grad, retain_graph=True) |
| self.assertIsNotNone(input.grad) |
| result = input.grad.data.clone() |
| input.grad.data.zero_() |
| |
| output.backward(grad.contiguous()) |
| self.assertEqual(result, input.grad.data, atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| def test_pixel_shuffle_unshuffle(self): |
| def _test_pixel_shuffle_unshuffle_helper(num_input_dims, valid_channels_dim=True, |
| upscale_factor=None): |
| # Function to imperatively ensure pixels are shuffled to the correct locations. |
| # Used to validate the batch operations in pixel_shuffle. |
| def _verify_pixel_shuffle(input, output, upscale_factor): |
| for c in range(output.size(-3)): |
| for h in range(output.size(-2)): |
| for w in range(output.size(-1)): |
| height_idx = h // upscale_factor |
| weight_idx = w // upscale_factor |
| channel_idx = (upscale_factor * (h % upscale_factor)) + (w % upscale_factor) + \ |
| (c * upscale_factor ** 2) |
| self.assertEqual(output[..., c, h, w], input[..., channel_idx, height_idx, weight_idx]) |
| |
| upscale_factor = random.randint(2, 5) if upscale_factor is None else upscale_factor |
| # If valid_channels_dim=False, add 1 to make channels dim indivisible by upscale_factor ** 2. |
| channels = random.randint(1, 4) * upscale_factor ** 2 + (0 if valid_channels_dim else 1) |
| height = random.randint(5, 10) |
| width = random.randint(5, 10) |
| |
| if num_input_dims == 1: |
| input = torch.rand(channels, requires_grad=True) |
| elif num_input_dims == 2: |
| input = torch.rand(height, width, requires_grad=True) |
| else: |
| batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)] |
| input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True) |
| ps = nn.PixelShuffle(upscale_factor) |
| pus = nn.PixelUnshuffle(downscale_factor=upscale_factor) |
| |
| if num_input_dims >= 3 and valid_channels_dim and upscale_factor > 0: |
| output = ps(input) |
| _verify_pixel_shuffle(input, output, upscale_factor) |
| output.backward(output.data) |
| self.assertEqual(input.data, input.grad.data) |
| |
| # Ensure unshuffle properly inverts shuffle. |
| unshuffle_output = pus(output) |
| self.assertEqual(input, unshuffle_output) |
| else: |
| self.assertRaises(RuntimeError, lambda: ps(input)) |
| |
| def _test_pixel_unshuffle_error_case_helper(num_input_dims, valid_height_dim=True, valid_width_dim=True, |
| downscale_factor=None): |
| downscale_factor = random.randint(2, 5) if downscale_factor is None else downscale_factor |
| channels = random.randint(1, 4) |
| # If valid_height_dim=False, add 1 to make height dim indivisible by downscale_factor. |
| height = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_height_dim else 1) |
| # If valid_width_dim=False, add 1 to make width dim indivisible by downscale_factor. |
| width = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_width_dim else 1) |
| |
| if num_input_dims == 1: |
| input = torch.rand(channels, requires_grad=True) |
| elif num_input_dims == 2: |
| input = torch.rand(height, width, requires_grad=True) |
| else: |
| batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)] |
| input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True) |
| |
| pus = nn.PixelUnshuffle(downscale_factor) |
| self.assertRaises(RuntimeError, lambda: pus(input)) |
| |
| def _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims): |
| # For 1D - 2D, this is an error case. |
| # For 3D - 5D, this is a success case for pixel_shuffle + pixel_unshuffle. |
| _test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims) |
| |
| # Error cases for pixel_shuffle. |
| _test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, valid_channels_dim=False) |
| _test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=0) |
| _test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=-2) |
| |
| # Error cases for pixel_unshuffle. |
| _test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_height_dim=False) |
| _test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_width_dim=False) |
| _test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=0) |
| _test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=-2) |
| |
| def test_pixel_shuffle_unshuffle_1D(): |
| _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=1) |
| |
| def test_pixel_shuffle_unshuffle_2D(): |
| _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=2) |
| |
| def test_pixel_shuffle_unshuffle_3D(): |
| _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=3) |
| |
| def test_pixel_shuffle_unshuffle_4D(): |
| _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=4) |
| |
| def test_pixel_shuffle_unshuffle_5D(): |
| _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=5) |
| |
| test_pixel_shuffle_unshuffle_1D() |
| test_pixel_shuffle_unshuffle_2D() |
| test_pixel_shuffle_unshuffle_3D() |
| test_pixel_shuffle_unshuffle_4D() |
| test_pixel_shuffle_unshuffle_5D() |
| |
| def test_elu_inplace_view(self): |
| v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True) |
| |
| def func(root): |
| x = root.clone() |
| view = x.narrow(0, 1, 2) |
| res = F.elu(view, inplace=True) |
| self.assertIs(res, view) |
| return x |
| |
| gradcheck(func, [v]) |
| gradgradcheck(func, [v]) |
| |
| def test_relu_inplace_view(self): |
| v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True) |
| |
| def func(root): |
| x = root.clone() |
| view = x.narrow(0, 1, 2) |
| res = F.relu(view, inplace=True) |
| self.assertIs(res, view) |
| return x |
| |
| gradcheck(func, [v]) |
| gradgradcheck(func, [v]) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| def test_PReLU_backward_requires_grad_false(self): |
| m = nn.PReLU().to('cuda') |
| x = torch.randn(2, 3, 4, 5, requires_grad=False, device='cuda') |
| y = m(x) |
| y.mean().backward() |
| self.assertEqual(x.grad, None) |
| |
| @unittest.skipIf( |
| not TEST_NUMPY or not TEST_SCIPY, "Numpy or Scipy not found") |
| def test_gelu(self): |
| def _test_gelu(n, m, dtype, contiguous, atol=None, rtol=None): |
| numpy_dtype = { |
| torch.bfloat16: torch.float, torch.float: torch.float, torch.double: torch.double |
| }[dtype] |
| devices = ['cpu'] if dtype != torch.bfloat16 else [] + \ |
| ['cuda'] if TEST_CUDA else [] |
| |
| def _gelu_ref(X): |
| return X * stats.norm.cdf(X) |
| |
| for d in devices: |
| if contiguous: |
| X = torch.rand(n, m, dtype=dtype, requires_grad=True, device=d) |
| else: |
| X = torch.rand(n, m, dtype=dtype, requires_grad=True, device=d)[:, ::2] |
| res = F.gelu(X) |
| ref = _gelu_ref(X.to(numpy_dtype).cpu().detach().numpy()) |
| self.assertEqual(res, ref, rtol=rtol, atol=atol) |
| if dtype != torch.bfloat16: |
| gradcheck(F.gelu, [X], eps=1e-4) |
| |
| for n in range(1, 10): |
| for m in range(1, 10): |
| _test_gelu(n, m, torch.bfloat16, True, 1e-2, 0) |
| _test_gelu(n, m, torch.bfloat16, False, 1e-2, 0) |
| _test_gelu(n, m, torch.float32, True) |
| _test_gelu(n, m, torch.float32, False) |
| _test_gelu(n, m, torch.float64, True) |
| _test_gelu(n, m, torch.float64, False) |
| |
| |
| def test_bce_loss_always_nonnegative(self): |
| target = torch.ones(5) |
| input = torch.ones(5) |
| self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0) |
| |
| target = torch.zeros(5) |
| input = torch.zeros(5) |
| self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0) |
| |
| def test_bce_with_logits_raises_if_target_and_input_are_different_size(self): |
| target = torch.rand(5) |
| input = torch.rand(5, 1) |
| with self.assertRaises(ValueError): |
| nn.BCEWithLogitsLoss()(input, target) |
| |
| target = torch.rand(5, 1) |
| input = torch.rand(5) |
| with self.assertRaises(ValueError): |
| nn.BCEWithLogitsLoss()(input, target) |
| |
| def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss(self): |
| sigmoid = nn.Sigmoid() |
| |
| target = torch.rand(64, 4) |
| output = torch.rand(64, 4) - 0.5 |
| |
| self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target)) |
| |
| weight = torch.rand(4) |
| self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target)) |
| |
| target = torch.zeros(4, 1, dtype=torch.float) |
| output = torch.empty(4, 1, dtype=torch.float).fill_(-100) |
| |
| self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target)) |
| |
| self.assertEqual(nn.BCEWithLogitsLoss(reduction='none')(output, target), |
| nn.BCELoss(reduction='none')(sigmoid(output), target)) |
| |
| weight = torch.rand(1, dtype=torch.float) |
| self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target)) |
| |
| def test_bce_loss_input_range(self): |
| bceloss = nn.BCELoss() |
| |
| target = torch.rand(25, 25) |
| output_valid = torch.rand(25, 25) |
| output_too_negative = output_valid - 1.0 |
| output_too_positive = output_valid + 1.0 |
| |
| loss_valid = bceloss(output_valid, target) |
| with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'): |
| loss_too_negative = bceloss(output_too_negative, target) |
| with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'): |
| loss_too_positive = bceloss(output_too_positive, target) |
| |
| def test_bce_loss_size_mismatch(self): |
| bceloss = nn.BCELoss() |
| a = torch.rand(25) |
| b = torch.rand(25, 1) |
| with self.assertRaisesRegex(ValueError, r'Using a target size \('): |
| bceloss(a, b) |
| |
| def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss_large_tensors_with_grad(self): |
| x_size = 1024 |
| y_size = 256 |
| target = torch.rand(x_size, y_size) |
| |
| for reduction in ['none', 'mean', 'sum']: |
| output_sig = torch.rand(x_size, y_size) - 0.5 |
| output_logits = output_sig.clone().detach() |
| |
| output_sig.requires_grad = True |
| output_logits.requires_grad = True |
| weight = torch.rand(y_size) |
| |
| loss_sig = nn.BCELoss(weight, reduction=reduction)( |
| torch.sigmoid(output_sig), target |
| ) |
| loss_logits = nn.BCEWithLogitsLoss(weight, reduction=reduction)( |
| output_logits, target |
| ) |
| |
| self.assertEqual(loss_logits, loss_sig) |
| |
| if reduction == 'none': |
| grad = torch.rand(x_size, y_size) |
| loss_sig.backward(grad) |
| loss_logits.backward(grad) |
| else: |
| loss_sig.backward() |
| loss_logits.backward() |
| |
| self.assertEqual(output_sig.grad, output_logits.grad) |
| |
| def test_bce_with_logits_has_correct_grad_at_zero(self): |
| output = torch.zeros(3, 1, requires_grad=True) |
| target = torch.zeros(3, 1) |
| nn.BCEWithLogitsLoss(reduction='sum')(output, target).backward() |
| expected_grad = torch.empty(3, 1).fill_(0.5) |
| self.assertEqual(output.grad, expected_grad) |
| |
| def test_bce_with_logits_broadcasts_weights(self): |
| target = torch.rand(16, 4) |
| output = torch.rand(16, 4) - 0.5 |
| |
| weight = torch.rand(4) |
| out1 = nn.BCEWithLogitsLoss(weight)(output, target) |
| |
| weight = weight.expand(16, 4).contiguous() |
| out2 = nn.BCEWithLogitsLoss(weight)(output, target) |
| |
| self.assertEqual(out1, out2) |
| |
| weight = torch.rand(16, 1) |
| out1 = nn.BCEWithLogitsLoss(weight)(output, target) |
| |
| weight = weight.expand(16, 4).contiguous() |
| out2 = nn.BCEWithLogitsLoss(weight)(output, target) |
| |
| self.assertEqual(out1, out2) |
| |
| def test_bce_with_logits_ones_in_pos_weights_are_the_same_as_none(self): |
| target = torch.rand(64, 4) |
| output = torch.rand(64, 4) - 0.5 |
| pos_weight = torch.ones(64, 4) |
| |
| self.assertEqual(nn.BCEWithLogitsLoss()(output, target), |
| nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target)) |
| |
| def test_bce_with_logits_broadcasts_pos_weights(self): |
| target = torch.rand(64, 4) |
| output = torch.rand(64, 4) - 0.5 |
| pos_weight = torch.rand(4) |
| out1 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target) |
| |
| pos_weight1 = pos_weight.expand(1, 4) |
| out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight1)(output, target) |
| |
| pos_weight2 = pos_weight.expand(64, 4) |
| out3 = nn.BCEWithLogitsLoss(pos_weight=pos_weight2)(output, target) |
| |
| self.assertEqual(out1, out2) |
| self.assertEqual(out1, out3) |
| |
| def test_bce_with_logits_with_pos_weight_has_correct_grad_at_zero(self): |
| output = torch.zeros(3, 1, requires_grad=True) |
| target = torch.zeros(3, 1) |
| pos_weight = torch.ones(3, 1) |
| nn.BCEWithLogitsLoss(pos_weight=pos_weight, reduction='sum')(output, target).backward() |
| expected_grad = torch.empty(3, 1).fill_(0.5) |
| grad = output.grad |
| self.assertEqual(grad, expected_grad) |
| |
| def test_bce_with_logits_stability(self): |
| output = torch.tensor([0., -120.]) |
| target = torch.tensor([0., 1.]) |
| pos_weight = torch.tensor([1., 1.]) |
| |
| out1 = nn.BCEWithLogitsLoss()(output, target) |
| self.assertTrue(torch.isfinite(out1).all().item()) |
| |
| out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target) |
| self.assertTrue(torch.isfinite(out2).all().item()) |
| |
| def test_bce_loss_broadcasts_weights(self): |
| sigmoid = nn.Sigmoid() |
| target = torch.rand(16, 4) |
| output = torch.rand(16, 4) - 0.5 |
| |
| weight = torch.rand(4) |
| out1 = nn.BCELoss(weight)(sigmoid(output), target) |
| |
| weight = weight.expand(16, 4).contiguous() |
| out2 = nn.BCELoss(weight)(sigmoid(output), target) |
| |
| self.assertEqual(out1, out2) |
| |
| weight = torch.rand(16, 1) |
| out1 = nn.BCELoss(weight)(sigmoid(output), target) |
| |
| weight = weight.expand(16, 4).contiguous() |
| out2 = nn.BCELoss(weight)(sigmoid(output), target) |
| |
| self.assertEqual(out1, out2) |
| |
| def test_elu_inplace_gradgrad(self): |
| v = torch.randn(8, requires_grad=True) |
| |
| def func(root): |
| x = root.clone() |
| return F.elu(x, inplace=True) |
| |
| gradcheck(func, [v]) |
| gradgradcheck(func, [v]) |
| |
| def test_hardtanh_inplace_gradgrad(self): |
| v = torch.randn(8, requires_grad=True) |
| |
| def func(root): |
| x = root.clone() |
| return F.hardtanh(x, inplace=True) |
| |
| gradcheck(func, [v]) |
| gradgradcheck(func, [v]) |
| |
| # test hardtanh backward froo large tensor |
| def test_hardtanh_backward(self): |
| x = torch.randn(128, 10000, requires_grad=True) |
| grad = torch.randn(128, 10000) |
| z = torch.zeros(128, 10000) |
| y = F.hardtanh(x) |
| y.backward(grad) |
| # ref backward path for hardtanh |
| mask = (x > -1) & (x < 1) |
| x_grad_ref = torch.where(mask, grad, z) |
| self.assertEqual(x.grad, x_grad_ref) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @unittest.skipIf(not TEST_CUDNN, "needs cudnn") |
| @skipIfRocm |
| def test_batchnorm_cudnn_nhwc(self): |
| def run_test(input, grad_output): |
| c = input.size(1) |
| mod = nn.BatchNorm2d(c).cuda().float() |
| mod.weight.data.uniform_() |
| mod.bias.data.uniform_() |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_mod = nn.BatchNorm2d(c).cuda().float() |
| ref_mod.load_state_dict(mod.state_dict()) |
| out = mod(input) |
| out.backward(grad_output) |
| ref_out = ref_mod(ref_input) |
| ref_out.backward(ref_grad) |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out) |
| self.assertEqual(mod.weight.grad, ref_mod.weight.grad) |
| self.assertEqual(mod.bias.grad, ref_mod.bias.grad) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| input = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda") |
| input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_() |
| |
| grad = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda") |
| grad = grad.contiguous(memory_format=torch.channels_last) |
| run_test(input, grad) |
| # see #42588, grad is channels_last contiguous, but grad.suggest_memory_format (rightly) return "contiguous" |
| # not channels_last |
| input = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda") |
| input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_() |
| grad = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda") |
| grad = grad.permute(0, 2, 1, 3) |
| run_test(input, grad) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| def test_batchnorm_cudnn_half(self): |
| # THNN |
| input = torch.randint(1, 10, (2, 3, 2, 2), dtype=torch.half, device="cuda", requires_grad=True) |
| m = nn.BatchNorm2d(3).half().cuda() |
| thnn_output = m(input) |
| thnn_output.sum().backward() |
| thnn_input_grad = input.grad.data.clone() |
| self.assertEqualTypeString(thnn_output, input) |
| # cuDNN |
| if TEST_CUDNN: |
| input.grad = None |
| m = m.float() |
| cudnn_output = m(input) |
| cudnn_output.sum().backward() |
| cudnn_input_grad = input.grad.data.clone() |
| self.assertEqualTypeString(cudnn_output, input) |
| self.assertEqual(cudnn_output, thnn_output) |
| self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| def test_batchnorm_nonaffine_cuda_half_input(self): |
| input = torch.randn(16, 3, 24, 24, dtype=torch.half, device="cuda") |
| m = nn.BatchNorm2d(3, affine=False).cuda().float() # keep running stats in FP32 |
| output = m(input) |
| self.assertEqualTypeString(output, input) |
| m.eval() |
| output = m(input) |
| self.assertEqualTypeString(output, input) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @repeat_test_for_types([torch.float, torch.half]) |
| def test_batchnorm_large_batch(self, dtype=torch.float): |
| bn = nn.BatchNorm2d(1).to('cuda', dtype) |
| data = torch.rand(880801, 1, 1, 1, device="cuda", dtype=dtype) |
| out = bn(data).sum().backward() |
| |
| def test_batchnorm_raises_error_if_less_than_one_value_per_channel(self): |
| x = torch.rand(10)[None, :, None] |
| with self.assertRaises(ValueError): |
| torch.nn.BatchNorm1d(10)(x) |
| |
| def test_batchnorm_raises_error_if_running_mean_is_not_same_size_as_input(self): |
| input = torch.rand(2, 10) |
| running_var = torch.rand(10) |
| wrong_sizes = [9, 11] |
| for size in wrong_sizes: |
| with self.assertRaises(RuntimeError): |
| F.batch_norm(input, torch.rand(size), running_var) |
| |
| def test_batchnorm_raises_error_if_running_var_is_not_same_size_as_input(self): |
| input = torch.rand(2, 10) |
| running_mean = torch.rand(10) |
| wrong_sizes = [9, 11] |
| for size in wrong_sizes: |
| with self.assertRaises(RuntimeError): |
| F.batch_norm(input, running_mean, torch.rand(size)) |
| |
| def test_batchnorm_raises_error_if_weight_is_not_same_size_as_input(self): |
| input = torch.rand(2, 10) |
| running_mean = torch.rand(10) |
| running_var = torch.rand(10) |
| wrong_sizes = [9, 11] |
| for size in wrong_sizes: |
| with self.assertRaises(RuntimeError): |
| F.batch_norm(input, running_mean, running_var, weight=Parameter(torch.rand(size))) |
| |
| def test_batchnorm_raises_error_if_bias_is_not_same_size_as_input(self): |
| input = torch.rand(2, 10) |
| running_mean = torch.rand(10) |
| running_var = torch.rand(10) |
| wrong_sizes = [9, 11] |
| for size in wrong_sizes: |
| with self.assertRaises(RuntimeError): |
| F.batch_norm(input, running_mean, running_var, bias=Parameter(torch.rand(size))) |
| |
| def test_batchnorm_buffer_update_when_stats_are_not_tracked(self): |
| input_size = (32, 4) |
| # Instantiate BN with buffers that are not None |
| bn = nn.BatchNorm1d(input_size[1], track_running_stats=True) |
| # Use buffers for normalization but don't update them |
| bn.track_running_stats = False |
| # Store initial values |
| num_batches = bn.num_batches_tracked.clone() |
| running_mean = bn.running_mean.clone() |
| running_var = bn.running_var.clone() |
| # Forward random tensor |
| _ = bn(torch.rand(input_size)) |
| # Ensure none of the buffers has been updated |
| self.assertTrue(torch.equal(num_batches, bn.num_batches_tracked)) |
| self.assertTrue(torch.equal(running_mean, bn.running_mean)) |
| self.assertTrue(torch.equal(running_var, bn.running_var)) |
| |
| def test_pairwise_distance(self): |
| input1 = torch.randn(4, 4, requires_grad=True) |
| input2 = torch.randn(4, 4, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x, y: F.pairwise_distance(x, y), (input1, input2))) |
| |
| def test_pdist(self): |
| for device, trans in itertools.product(device_(), [False, True]): |
| inp = torch.randn(4, 5, dtype=torch.double, device=device, requires_grad=True) |
| if trans: |
| inp = inp.transpose(0, 1) |
| for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]: |
| self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,))) |
| |
| def test_pdist_zeros(self): |
| """Test that grad is still valid when dist is 0""" |
| for device in device_(): |
| inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True).repeat([2, 1]) |
| for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]: |
| self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,))) |
| |
| def test_pdist_empty_row(self): |
| for device in device_(): |
| inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True) |
| self.assertTrue(gradcheck(F.pdist, (inp,))) |
| |
| def test_pdist_empty_col(self): |
| for device in device_(): |
| inp = torch.randn(4, 0, dtype=torch.double, device=device, requires_grad=True) |
| self.assertTrue(gradcheck(F.pdist, (inp,))) |
| |
| @unittest.expectedFailure |
| def test_pdist_cpu_gradgrad_unimplemented(self): |
| inp = torch.randn(4, 5, requires_grad=True) |
| gradgradcheck(F.pdist, (inp,)) |
| |
| @unittest.expectedFailure |
| def test_pdist_cuda_gradgrad_unimplemented(self): |
| inp = torch.randn(4, 5, device='cuda', requires_grad=True) |
| gradgradcheck(F.pdist, (inp,)) |
| |
| def test_cosine_embedding_loss_with_diff_type(self): |
| for device in device_(): |
| input1 = torch.tensor([[2, 3, 4], [6, 2, 4]], dtype=torch.double, device=device) |
| input2 = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device) |
| target = torch.tensor([1, -1], dtype=torch.int, device=device) |
| expected = torch.nn.functional.cosine_embedding_loss(input1, input2, target) |
| for dt1 in torch.testing.get_all_math_dtypes(device): |
| for dt2 in torch.testing.get_all_math_dtypes(device): |
| for dt3 in torch.testing.get_all_math_dtypes(device): |
| # dt3 is used as dtype for target = [1, -1], so let's skip unsigned type |
| if dt3 == torch.uint8: |
| continue |
| if dt1.is_complex or dt2.is_complex or dt3.is_complex: |
| continue |
| input1 = input1.to(dt1) |
| input2 = input2.to(dt2) |
| target = target.to(dt3) |
| result = torch.nn.functional.cosine_embedding_loss(input1, input2, target) |
| self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0) |
| |
| def test_kl_div_with_diff_type(self): |
| for device in device_(): |
| input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device) |
| target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device) |
| expected = torch.nn.functional.kl_div(input, target) |
| for input_dtype in torch.testing.get_all_math_dtypes(device): |
| if input_dtype.is_complex: |
| continue |
| for target_dtype in [torch.float32, torch.float64, torch.float16]: |
| if (torch.device(device).type == 'cpu' and target_dtype == torch.float16): |
| continue |
| input = input.to(input_dtype) |
| target = target.to(target_dtype) |
| result = torch.nn.functional.kl_div(input, target) |
| self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0) |
| |
| def test_kl_div_with_diff_type_log_target(self): |
| for device in device_(): |
| input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device) |
| target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device).log() |
| expected = torch.nn.functional.kl_div(input, target, log_target=True) |
| for input_dtype in torch.testing.get_all_math_dtypes(device): |
| if input_dtype.is_complex: |
| continue |
| for target_dtype in [torch.float32, torch.float64, torch.float16]: |
| if (torch.device(device).type == 'cpu' and target_dtype == torch.float16): |
| continue |
| input = input.to(input_dtype) |
| target = target.to(target_dtype) |
| result = torch.nn.functional.kl_div(input, target, log_target=True) |
| self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0) |
| |
| def test_kl_div_log_softmax_target(self): |
| for device in device_(): |
| a = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device) |
| b = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device) |
| self.assertEqual( |
| F.kl_div(F.log_softmax(a, 1), F.log_softmax(b, 1), reduction='none', log_target=True), |
| torch.zeros_like(a) |
| ) |
| |
| def test_cosine_embedding_loss_no_reduce(self): |
| input1 = torch.randn(15, 10, requires_grad=True) |
| input2 = torch.randn(15, 10, requires_grad=True) |
| target = torch.randn(15).sign() |
| self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss( |
| x, y, z, reduction='none'), (input1, input2, target))) |
| self.assertEqual(F.cosine_embedding_loss(input1, input2, target, reduction='none'), |
| loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target, reduction='none')) |
| |
| def test_cosine_embedding_loss_margin_no_reduce(self): |
| input1 = torch.randn(15, 10, requires_grad=True) |
| input2 = torch.randn(15, 10, requires_grad=True) |
| target = torch.randn(15).sign() |
| self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss( |
| x, y, z, margin=0.5, reduction='none'), (input1, input2, target))) |
| self.assertEqual(F.cosine_embedding_loss(input1, input2, target, margin=0.5, reduction='none'), |
| loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target, |
| margin=0.5, reduction='none')) |
| |
| def test_margin_ranking_loss_no_reduce(self): |
| input1 = torch.randn(15).mul_(10).requires_grad_() |
| input2 = torch.randn(15).mul_(10).requires_grad_() |
| target = torch.randn(15).sign() |
| self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss( |
| x, y, z, reduction='none'), (input1, input2, target))) |
| self.assertEqual(F.margin_ranking_loss(input1, input2, target, reduction='none'), |
| loss_reference_fns['MarginRankingLoss'](input1, input2, target, reduction='none')) |
| |
| def test_margin_ranking_loss_margin_no_reduce(self): |
| input1 = torch.randn(15).mul_(10).requires_grad_() |
| input2 = torch.randn(15).mul_(10).requires_grad_() |
| target = torch.randn(15).sign() |
| self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss( |
| x, y, z, margin=0.5, reduction='none'), (input1, input2, target))) |
| self.assertEqual(F.margin_ranking_loss(input1, input2, target, margin=0.5, reduction='none'), |
| loss_reference_fns['MarginRankingLoss'](input1, input2, target, margin=0.5, reduction='none')) |
| |
| def test_triplet_margin_loss(self): |
| input1 = torch.randn(5, 10, requires_grad=True) |
| input2 = torch.randn(5, 10, requires_grad=True) |
| input3 = torch.randn(5, 10, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss( |
| x1, x2, x3), (input1, input2, input3))) |
| self.assertEqual(F.triplet_margin_loss(input1, input2, input3), |
| loss_reference_fns['TripletMarginLoss'](input1, input2, input3)) |
| |
| def test_triplet_margin_loss_swap(self): |
| input1 = torch.randn(5, 10, requires_grad=True) |
| input2 = torch.randn(5, 10, requires_grad=True) |
| input3 = torch.randn(5, 10, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss( |
| x1, x2, x3, swap=True), (input1, input2, input3))) |
| self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True), |
| loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True)) |
| |
| def test_triplet_margin_loss_no_reduce(self): |
| input1 = torch.randn(5, 10, requires_grad=True) |
| input2 = torch.randn(5, 10, requires_grad=True) |
| input3 = torch.randn(5, 10, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss( |
| x1, x2, x3, reduction='none'), (input1, input2, input3))) |
| self.assertEqual(F.triplet_margin_loss(input1, input2, input3, reduction='none'), |
| loss_reference_fns['TripletMarginLoss'](input1, input2, input3, reduction='none')) |
| |
| def test_triplet_margin_loss_swap_no_reduce(self): |
| input1 = torch.randn(5, 10, requires_grad=True) |
| input2 = torch.randn(5, 10, requires_grad=True) |
| input3 = torch.randn(5, 10, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss( |
| x1, x2, x3, swap=True, reduction='none'), (input1, input2, input3))) |
| self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True, reduction='none'), |
| loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True, reduction='none')) |
| |
| def test_pointwise_loss_target_grad_none_reduction(self): |
| i = torch.randn(5, 10) |
| t = torch.randn(5, 10, requires_grad=True) |
| self.assertEqual(F.mse_loss(i, t, reduction='none').size(), t.size()) |
| self.assertEqual(F.l1_loss(i, t, reduction='none').size(), t.size()) |
| |
| def test_pointwise_loss_broadcast(self): |
| losses = { |
| 'mse_loss': lambda x, y, r: F.mse_loss(x, y, reduction=r), |
| 'l1_loss': lambda x, y, r: F.l1_loss(x, y, reduction=r), |
| 'smooth_l1_loss': lambda x, y, r: F.smooth_l1_loss(x, y, reduction=r), |
| } |
| |
| input = torch.randn(2, 1, requires_grad=True) |
| for _name, fn in losses.items(): |
| for requires_grad in [True, False]: |
| # When target.requires_grad=True, its impl is in Python, while the other is in TH. |
| target = torch.randn(2, 10, requires_grad=requires_grad) |
| for reduction in ['none', 'mean', 'sum']: |
| l = fn(input, target, reduction) |
| if reduction == 'none': |
| self.assertEqual(l.size(), target.size()) |
| self.assertTrue(gradcheck(fn, (input, target, reduction))) |
| |
| # https://github.com/pytorch/pytorch/issues/27692 reports |
| # that l1_loss get a wrong result for big batch size |
| def test_l1_loss_correct(self): |
| for dtype in [torch.float, torch.cfloat]: |
| for N in range(1, 50, 10): |
| input = torch.rand(N, 3, 1024, 1024, dtype=dtype) |
| self.assertEqual( |
| torch.nn.L1Loss()(input, torch.zeros_like(input)), |
| input.abs().mean()) |
| |
| def test_smoothl1loss_negative_beta_not_supported(self): |
| with self.assertRaises(RuntimeError): |
| F.smooth_l1_loss(torch.randn(2, 2), torch.randn(2, 2), beta=-1.0) |
| |
| def test_cosine_similarity(self): |
| input1 = torch.randn(4, 4, requires_grad=True) |
| input2 = torch.randn(4, 4, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y), (input1, input2))) |
| |
| input1 = torch.randn(4, 5, 6, requires_grad=True) |
| input2 = torch.randn(4, 5, 6, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=0), (input1, input2))) |
| self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=-1), (input1, input2))) |
| |
| input1 = torch.randn((), requires_grad=True) |
| input2 = torch.randn((), requires_grad=True) |
| self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=0), (input1, input2))) |
| self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=-1), (input1, input2))) |
| |
| # Check cosine_similarity input/output shapes |
| input_size = (1, 3, 2, 1) |
| expected_size = (1, 2, 1) |
| input1 = torch.randn(input_size, requires_grad=True) |
| input2 = torch.randn(input_size, requires_grad=True) |
| self.assertEqual(F.cosine_similarity(input1, input2, dim=1).size(), expected_size) |
| |
| # Check numerical precision, issue #18057 |
| vv1 = torch.tensor(list([float(i) for i in range(84)])).unsqueeze(0) |
| vv2 = torch.tensor(list([float(i) for i in range(84)])).unsqueeze(0) |
| out = F.cosine_similarity(vv1, vv2) |
| self.assertLessEqual(out, 1.0) |
| |
| # Check dividing by 0. |
| input1 = torch.randn(10).requires_grad_() |
| input2 = torch.zeros_like(input1).requires_grad_() |
| torch.cosine_similarity(input1, input2, 0).sum().backward() |
| self.assertEqual(input1.grad, torch.zeros_like(input1)) |
| self.assertEqual(input2.grad, input1 * 1e8) |
| |
| def test_grid_sample_error_checking(self): |
| input = torch.empty(1, 1, 2, 2) |
| grid = torch.empty(1, 1, 1, 2) |
| |
| # assert no error |
| F.grid_sample(input, grid, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "but got: 'garbage'"): |
| F.grid_sample(input, grid, mode='garbage', align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "but got: 'garbage'"): |
| F.grid_sample(input, grid, padding_mode='garbage', align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "expected input and grid to have same dtype"): |
| F.grid_sample(input.float(), grid.double(), align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "expected 4D or 5D input"): |
| F.grid_sample(input[0], grid, align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "grid with same number of dimensions"): |
| F.grid_sample(input, torch.empty(1, 1, 1, 1, 3), align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "expected grid and input to have same batch size"): |
| F.grid_sample(input, torch.empty(2, 1, 1, 2), align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "expected grid to have size 2 in last dimension"): |
| F.grid_sample(input, torch.empty(1, 1, 1, 3), align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "expected input to have non-empty spatial dimensions"): |
| F.grid_sample(torch.empty(1, 1, 0, 2), grid, align_corners=False) |
| |
| with self.assertRaisesRegex(RuntimeError, "bicubic interpolation only supports 4D input"): |
| F.grid_sample(torch.empty(1, 1, 2, 2, 2), torch.empty(1, 1, 1, 1, 3), mode='bicubic') |
| |
| if TEST_CUDA: |
| with self.assertRaisesRegex(RuntimeError, "expected input and grid to be on same device"): |
| F.grid_sample(input.cuda(), grid, align_corners=False) |
| |
| def test_affine_grid_error_checking(self): |
| # 2D affine |
| theta = torch.empty(1, 2, 3, dtype=torch.double) |
| size = torch.Size([1, 1, 2, 2]) |
| |
| # assert no error |
| F.affine_grid(theta, size, align_corners=False) |
| |
| # check for warning for empty span along dimension |
| with warnings.catch_warnings(record=True) as w: |
| # Ensure warnings are being shown |
| warnings.simplefilter("always") |
| # Should not trigger warning |
| F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=False) |
| # Check no warning occurs |
| self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w))) |
| # Should trigger warning |
| F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=True) |
| # Check warning occurs |
| self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w))) |
| |
| with self.assertRaisesRegex(ValueError, "Expected theta to have floating point type"): |
| F.affine_grid(theta.int(), size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"): |
| F.affine_grid(theta[0], size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"): |
| F.affine_grid(theta.unsqueeze(0), size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"): |
| F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"): |
| F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False) |
| |
| # 3D affine |
| theta = torch.empty(1, 3, 4, dtype=torch.double) |
| size = torch.Size([1, 1, 2, 2, 2]) |
| |
| # assert no error |
| F.affine_grid(theta, size, align_corners=False) |
| |
| # check for warning for empty span along dimension |
| with warnings.catch_warnings(record=True) as w: |
| # Ensure warnings are being shown |
| warnings.simplefilter("always") |
| # Should not trigger warning |
| F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=False) |
| # Check no warning occurs |
| self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w))) |
| # Should trigger warning |
| F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=True) |
| # Check warning occurs |
| self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w))) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"): |
| F.affine_grid(theta[0], size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"): |
| F.affine_grid(theta.unsqueeze(0), size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"): |
| F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False) |
| |
| with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"): |
| F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False) |
| |
| with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"): |
| F.affine_grid(theta, torch.Size([1, 2, 2]), align_corners=False) |
| |
| with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"): |
| F.affine_grid(theta, torch.Size([1, 1, 2, 2, 2, 2]), align_corners=False) |
| |
| def test_grid_sample(self): |
| def test(N, C, H, W, mode, padding_mode, align_corners): |
| def test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners): |
| for grid_dim_contig_order in [(0, 1, 2, 3), (0, 3, 1, 2), (3, 0, 1, 2), (0, 2, 1, 3)]: |
| # grid_dim_contig_order specifies the dimension order that can |
| # make grid to be contiguous. |
| # i.e., grid.permute(grid_dim_contig_order) is contiguous. |
| # e.g., with grid_dim_contig_order=[0, 3, 1, 2], grid should be |
| # initialized with contiguous tensor of shape [N, 2, H, W] |
| # and permuted to [N, H, W, 2] afterwards. |
| grid_shape = [N, H, W, 2] |
| grid_init_shape = [grid_shape[d] for d in grid_dim_contig_order] |
| grid_fwd_permute = [None, None, None, None] |
| for i, d in enumerate(grid_dim_contig_order): |
| grid_fwd_permute[d] = i |
| |
| def get_grid(device='cpu', data=None): |
| if data is not None: |
| assert list(data.shape) == grid_shape |
| data = data.permute(grid_dim_contig_order).to(device) |
| else: |
| data = torch.randn(grid_init_shape, device=device) |
| grid = data.permute(grid_fwd_permute) |
| assert grid.permute(grid_dim_contig_order).is_contiguous() |
| return grid |
| |
| input_cpu = torch.randn(C, N, IH, IW).transpose(0, 1).requires_grad_() |
| grid_cpu = get_grid().requires_grad_() |
| out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertTrue(out_cpu.size() == torch.Size([N, C, H, W])) |
| |
| gradients = torch.randn_like(out_cpu) |
| out_cpu.backward(gradients) |
| |
| |
| # Compare against unvectorized CPU fallback |
| |
| # NOTE [ grid_sample CPU fallback ] |
| # grid_sample uses AVX for 2d images, but that requires 32-bit indexing for |
| # 32-bit floats. So we also have a fallback that is used only for float tensors |
| # requiring 64-bit indexing. That requires too much memory to run on CI, so we |
| # also export the fallback and test it here to ensure feature parity with |
| # the vectorized version. |
| input_fallback = input_cpu.float().detach_().requires_grad_() |
| grid_fallback = grid_cpu.float().detach_().requires_grad_() |
| out_fallback = torch._grid_sampler_2d_cpu_fallback( |
| input_fallback, grid_fallback, |
| F.GRID_SAMPLE_INTERPOLATION_MODES[mode], |
| F.GRID_SAMPLE_PADDING_MODES[padding_mode], |
| align_corners) |
| self.assertEqual(out_fallback, out_cpu.float(), atol=1e-5, rtol=5e-5) |
| |
| out_fallback.backward(gradients.float()) |
| self.assertEqual(input_fallback.grad, input_cpu.grad.float(), atol=1e-4, rtol=5e-5) |
| self.assertEqual(grid_fallback.grad, grid_cpu.grad.float(), atol=1e-4, rtol=5e-5) |
| |
| if TEST_CUDA: |
| input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_() |
| grid_cuda = get_grid('cuda', grid_cpu.detach()).requires_grad_() |
| out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertEqual(out_cpu, out_cuda) |
| |
| out_cuda.backward(gradients.cuda()) |
| self.assertEqual(input_cpu.grad, input_cuda.grad) |
| self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0) |
| |
| # check that zero-dimensional input strides don't error out |
| base_input = torch.randn(N, C, 1, IW) |
| input_cpu = base_input.expand_as(input_cuda).requires_grad_() |
| out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| |
| input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_() |
| out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertEqual(out_cpu, out_cuda) |
| |
| # test same size output |
| test_shape(N, C, H, W, H, W, mode, padding_mode, align_corners) |
| |
| # test larger output |
| N = random.randint(2, 8) |
| C = random.randint(2, 8) |
| IH = random.randint(2, 8) |
| IW = random.randint(2, 8) |
| H = random.randint(IH + 1, 12) |
| W = random.randint(IW + 1, 12) |
| test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners) |
| |
| # test smaller output |
| N = random.randint(2, 8) |
| C = random.randint(2, 8) |
| IH = random.randint(2, 8) |
| IW = random.randint(2, 8) |
| H = random.randint(2, IH) |
| W = random.randint(2, IW) |
| test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners) |
| |
| # test 1x1 inpput |
| N = random.randint(2, 8) |
| C = random.randint(2, 8) |
| IH = 1 |
| IW = 1 |
| H = random.randint(2, 5) |
| W = random.randint(2, 5) |
| test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners) |
| |
| # testing empty grid |
| N = random.randint(2, 8) |
| C = random.randint(2, 8) |
| IH = random.randint(2, 8) |
| IW = random.randint(2, 8) |
| W = random.randint(3, IW + 2) |
| test_shape(N, C, IH, IW, 0, W, mode, padding_mode, align_corners) |
| |
| # testing empty channel |
| N = random.randint(2, 8) |
| IH = random.randint(2, 8) |
| IW = random.randint(2, 8) |
| H = random.randint(3, IH + 2) |
| W = random.randint(3, IW + 2) |
| test_shape(N, 0, IH, IW, H, W, mode, padding_mode, align_corners) |
| |
| # testing empty batch |
| C = random.randint(2, 8) |
| IH = random.randint(2, 8) |
| IW = random.randint(2, 8) |
| H = random.randint(3, IH + 2) |
| W = random.randint(3, IW + 2) |
| test_shape(0, C, IH, IW, H, W, mode, padding_mode, align_corners) |
| |
| for mode in ('bilinear', 'nearest', 'bicubic'): |
| for padding_mode in ('zeros', 'border', 'reflection'): |
| for align_corners in (True, False): |
| # test known input on CPU |
| input = torch.arange(1., 11).view(1, 1, 2, 5) |
| grid = torch.tensor( |
| [[[-0.9, -4.1], [0, 0.2000], [1, -1], [-0.333, 1e-6], [0.5, 1.0]], |
| [[-1.0, -0.5], [0, 0.3333], [1, -1], [-0.200, 1e-6], [1.5, 0.5]]]).view(1, 2, 5, 2) |
| if mode == 'bilinear': |
| if padding_mode == 'zeros': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[0.0000, 6.0000000000, 5.0000, 4.8340, 9.0000], |
| [2.2500, 6.3332500450, 5.0000, 5.1000, 0.0000]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[0.0000, 6.5000000000, 1.2500, 4.6675000191, 4.6250], |
| [0.5000, 7.1665000916, 1.2500, 5.0000000000, 0.0000]]).view(1, 1, 2, 5) |
| elif padding_mode == 'border': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[1.2000, 6.0000000000, 5.0000, 4.8340, 9.0000], |
| [2.2500, 6.3332500450, 5.0000, 5.1000, 8.7500]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[1.0000, 6.5000000000, 5.0000, 4.6675000191, 9.2500], |
| [1.0000, 7.1665000916, 5.0000, 5.0000000000, 10.0000]]).view(1, 1, 2, 5) |
| elif padding_mode == 'reflection': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[3.4500, 6.0000000000, 5.0000, 4.8340, 9.0000], |
| [2.2500, 6.3332500450, 5.0000, 5.1000, 7.7500]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[3.0000004768, 6.5000000000, 5.0000, 4.6675000191, 9.2500], |
| [1.0000000000, 7.1665000916, 5.0000, 5.0000000000, 9.2500]]).view(1, 1, 2, 5) |
| else: |
| raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode)) |
| elif mode == 'nearest': |
| if padding_mode == 'zeros': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[0., 8., 5., 7., 9.], |
| [1., 8., 5., 8., 0.]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[0., 8., 5., 7., 0.], |
| [1., 8., 5., 8., 0.]]).view(1, 1, 2, 5) |
| elif padding_mode == 'border': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[1., 8., 5., 7., 9.], |
| [1., 8., 5., 8., 10.]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[1., 8., 5., 7., 9.], |
| [1., 8., 5., 8., 10.]]).view(1, 1, 2, 5) |
| elif padding_mode == 'reflection': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[1., 8., 5., 7., 9.], |
| [1., 8., 5., 8., 9.]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[1., 8., 5., 7., 9.], |
| [1., 8., 5., 8., 9.]]).view(1, 1, 2, 5) |
| else: |
| raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode)) |
| elif mode == 'bicubic': |
| if padding_mode == 'zeros': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[-0.10424726, 7.1400003, 5.0000, 5.7842274, 9.0000], |
| [2.4492188, 7.4814040, 5.0000, 6.0277520, 0.0000]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[0.00000, 7.6287503, 1.0625, 5.5977230, 5.3270264], |
| [0.40625, 8.0288770, 1.0625, 5.9375067, -0.3515625]]).view(1, 1, 2, 5) |
| elif padding_mode == 'border': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[1.1520010, 6.0599990, 5.0000, 4.870930, 9.0000000], |
| [2.1328125, 6.4258375, 5.0000, 5.076003, 8.8671875]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[0.894531, 6.6050020, 4.625, 4.7138715, 9.800781], |
| [0.906250, 7.2822485, 4.625, 5.0000052, 10.00000]]).view(1, 1, 2, 5) |
| elif padding_mode == 'reflection': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[3.1822524, 6.239998, 5.0000, 4.8709273, 9.00000], |
| [1.7812500, 6.703594, 5.0000, 5.0760007, 8.21875]]).view(1, 1, 2, 5) |
| else: |
| groundtruth = torch.tensor( |
| [[2.7993753, 6.6050020, 4.25, 4.7138715, 10.269531], |
| [0.8125000, 7.2822485, 4.25, 5.0000052, 9.332031]]).view(1, 1, 2, 5) |
| else: |
| raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode)) |
| |
| else: |
| raise AssertionError("missing groundtruth test for interpolation mode '{}'".format(mode)) |
| output = F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertEqual(output, groundtruth, atol=1e-5, rtol=0, |
| msg="groundtruth comparison failed for mode={}, " |
| "padding_mode={}".format(mode, padding_mode)) |
| |
| # See NOTE [ grid_sample CPU fallback ] |
| output = torch._grid_sampler_2d_cpu_fallback( |
| input.float(), grid.float(), |
| F.GRID_SAMPLE_INTERPOLATION_MODES[mode], |
| F.GRID_SAMPLE_PADDING_MODES[padding_mode], |
| align_corners) |
| self.assertEqual(output, groundtruth.float(), atol=1e-5, rtol=0) |
| |
| # explicit check for gradient edge cases |
| input = torch.arange(0., 5).expand((1, 1, 5, 5)).requires_grad_() |
| grid = torch.tensor( |
| [[[1.0, 1.0], [1.0, -1.0], [0.8, 0.8], [0.8, -0.8]], |
| [[-1.0, -1.0], [-1.0, 1.0], [-0.8, -0.8], [-0.8, 0.8]]]).view(1, 2, 4, 2).requires_grad_() |
| if mode == 'bilinear': |
| if padding_mode == 'zeros': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[-8., -8.], [-8., 0.], [2., 0.], [2., 0.]], |
| [[2., 0.], [2., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[-5., -5.], [-5., 5.], [-10., -10.], [-10., 10.]], |
| [[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2) |
| elif padding_mode == 'border': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]], |
| [[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]], |
| [[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2) |
| elif padding_mode == 'reflection': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]], |
| [[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]], |
| [[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2) |
| else: |
| raise AssertionError("missing gradient groundtruth test for padding mode '{}'".format(padding_mode)) |
| elif mode == 'nearest': |
| groundtruth = torch.tensor( |
| [[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]], |
| [[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2) |
| elif mode == 'bicubic': |
| if padding_mode == 'zeros': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[-4.5, -6.], [-4.5, 6.], [2.725679, 0.740878], [2.725679, -0.740878]], |
| [[1.5, 0.], [1.5, 0.], [1.927921, -0.05688], [1.927921, 0.05688]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[-5.859375, -5.888672], [-5.859375, 5.888672], [-5.6250, -7.5000], [-5.6250, 7.5000]], |
| [[-0.234375, -0.263672], [-0.234375, 0.263672], [1.8750, 0.], [1.8750, 0.]]]] |
| ).view(1, 2, 4, 2) |
| elif padding_mode == 'border': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]], |
| [[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]], |
| [[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]]]]).view(1, 2, 4, 2) |
| elif padding_mode == 'reflection': |
| if align_corners: |
| groundtruth = torch.tensor( |
| [[[[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]], |
| [[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]]]]).view(1, 2, 4, 2) |
| else: |
| groundtruth = torch.tensor( |
| [[[[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]], |
| [[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]]]]).view(1, 2, 4, 2) |
| else: |
| raise AssertionError("missing gradient groundtruth test for padding mode '{}'".format(padding_mode)) |
| else: |
| raise AssertionError("missing gradient groundtruth test for interpolation mode '{}'".format(mode)) |
| F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners).sum().backward() |
| self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0, |
| msg="gradient groundtruth comparison failed for mode={}, " |
| "padding_mode={}".format(mode, padding_mode)) |
| |
| # See NOTE [ grid_sample CPU fallback ] |
| grid.grad.zero_() |
| torch._grid_sampler_2d_cpu_fallback( |
| input.float(), grid.float(), |
| F.GRID_SAMPLE_INTERPOLATION_MODES[mode], |
| F.GRID_SAMPLE_PADDING_MODES[padding_mode], |
| align_corners).sum().backward() |
| self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0) |
| |
| # do gradcheck |
| N = random.randint(2, 8) |
| C = random.randint(2, 6) |
| H = random.randint(2, 8) |
| W = random.randint(2, 8) |
| input = torch.randn(N, C, H, W, requires_grad=True) |
| grid = torch.randn(N, H, W, 2, requires_grad=True) |
| self.assertTrue(gradcheck( |
| lambda inp, grid: F.grid_sample(inp, grid, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners), |
| (input, grid))) |
| |
| test(N, C, H, W, mode, padding_mode, align_corners=align_corners) |
| if TEST_CUDNN: |
| with cudnn.flags(enabled=False): |
| test(N, C, H, W, mode, padding_mode, align_corners=align_corners) |
| |
| def test_grid_sample_3d(self): |
| def test(N, C, D, H, W, mode, padding_mode, align_corners): |
| def test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners): |
| input_cpu = torch.randn(C, N, ID, IH, IW).transpose(0, 1).requires_grad_() |
| grid_cpu = torch.randn(D, N, H, W, 3).transpose(0, 1).requires_grad_() |
| out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertTrue(out_cpu.size() == torch.Size([N, C, D, H, W])) |
| |
| gradients = torch.randn_like(out_cpu) |
| out_cpu.backward(gradients) |
| |
| if TEST_CUDA: |
| input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_() |
| grid_cuda = grid_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_() |
| out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertEqual(out_cpu, out_cuda) |
| |
| out_cuda.backward(gradients.cuda()) |
| self.assertEqual(input_cpu.grad, input_cuda.grad) |
| self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0) |
| |
| # check that zero-dimensional input strides don't error out |
| base_input = torch.randn(N, C, 1, IH, IW) |
| input_cpu = base_input.expand_as(input_cuda).requires_grad_() |
| grid_cpu = torch.randn(N, D, H, W, 3, requires_grad=True) |
| out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| |
| input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_() |
| grid_cuda = grid_cpu.detach().cuda().requires_grad_() |
| out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners) |
| self.assertEqual(out_cpu, out_cuda) |
| |
| # test same size output |
| test_shape(N, C, D, H, W, D, H, W, mode, padding_mode, align_corners) |
| |
| # test larger output |
| N = random.randint(2, 7) |
| C = random.randint(2, 5) |
| ID = random.randint(2, 7) |
| IH = random.randint(2, 7) |
| IW = random.randint(2, 7) |
| D = random.randint(ID + 1, 10) |
| H = random.randint(IH + 1, 10) |
| W = random.randint(IW + 1, 10) |
| test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners) |
| |
| # test smaller output |
| N = random.randint(2, 7) |
| C = random.randint(2, 5) |
| ID = random.randint(2, 7) |
| IH = random.randint(2, 7) |
| IW = random.randint(2, 7) |
| D = random.randint(2, ID) |
| H = random.randint(2, IH) |
| W = random.randint(2, IW) |
| test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners) |
| |
| # test 1x1 inpput |
| N = random.randint(2, 7) |
| C = random.randint(2, 7) |
| ID = 1 |
| IH = 1 |
| IW = 1 |
| H = random.randint(2, 5) |
| W = random.randint(2, 5) |
| test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners) |
| |
| # testing empty grid |
| N = random.randint(2, 7) |
| C = random.randint(2, 5) |
| ID = random.randint(2, 7) |
| IH = random.randint(2, 7) |
| IW = random.randint(2, 7) |
| D = random.randint(3, ID + 2) |
| W = random.randint(3, IW + 2) |
| test_shape(N, C, ID, IH, IW, D, 0, W, mode, padding_mode, align_corners) |
| |
| # testing empty channel |
| N = random.randint(2, 7) |
| ID = random.randint(2, 5) |
| IH = random.randint(2, 7) |
| IW = random.randint(2, 7) |
| D = random.randint(3, ID + 2) |
| H = random.randint(3, IH + 2) |
| W = random.randint(3, IW + 2) |
| test_shape(N, 0, ID, IH, IW, D, H, W, mode, padding_mode, align_corners) |
| |
| # testing empty batch |
| C = random.randint(2, 5) |
| ID = random.randint(2, 7) |
| IH = random.randint(2, 7) |
| IW = random.randint(2, 7) |
| D = random.randint(3, ID + 2) |
| H = random.randint(3, IH + 2) |
| W = random.randint(3, IW + 2) |
| test_shape(0, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners) |
| |
| for mode in ('bilinear', 'nearest'): |
| for padding_mode in ('zeros', 'border', 'reflection'): |
| for align_corners in (True, False): |
| # do gradcheck |
| N = random.randint(2, 5) |
| C = random.randint(2, 4) |
| D = random.randint(2, 5) |
| H = random.randint(2, 5) |
| W = random.randint(2, 5) |
| input = torch.randn(N, C, D, H, W, requires_grad=True) |
| grid = torch.randn(N, D, H, W, 3, requires_grad=True) |
| self.assertTrue(gradcheck( |
| lambda inp, grid: F.grid_sample(inp, grid, mode=mode, padding_mode=padding_mode, |
| align_corners=align_corners), |
| (input, grid))) |
| |
| test(N, C, D, H, W, mode, padding_mode, align_corners) |
| |
| def test_affine_grid(self): |
| # test known input on CPU |
| input = torch.arange(1., 7).view(1, 2, 3) |
| output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=True) |
| groundtruth = torch.Tensor( |
| [[[0, -3], [2, 5]], [[4, 7], [6, 15]]]).view(1, 2, 2, 2) |
| self.assertEqual(output, groundtruth) |
| output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=False) |
| groundtruth = torch.Tensor( |
| [[[1.5, 1.5], [2.5, 5.5]], [[3.5, 6.5], [4.5, 10.5]]]).view(1, 2, 2, 2) |
| self.assertEqual(output, groundtruth) |
| |
| for align_corners in (True, False): |
| # do gradcheck |
| N = random.randint(1, 8) |
| C = random.randint(1, 8) |
| H = random.randint(1, 8) |
| W = random.randint(1, 8) |
| sz = torch.Size([N, C, H, W]) |
| inp = torch.randn(N, 2, 3, requires_grad=True) |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| self.assertTrue(gradcheck( |
| lambda inp: F.affine_grid(inp, sz, align_corners=align_corners), |
| (inp,))) |
| |
| # test CPU against CUDA |
| if TEST_CUDA: |
| N = random.randint(1, 8) |
| C = random.randint(1, 8) |
| H = random.randint(1, 8) |
| W = random.randint(1, 8) |
| sz = torch.Size([N, C, H, W]) |
| for align_corners in (True, False): |
| input_cpu = torch.randn(N, 2, 3, requires_grad=True) |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners) |
| gradients = torch.randn(out_cpu.size()) |
| out_cpu.backward(gradients) |
| input_gpu = input_cpu.detach().cuda().requires_grad_() |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners) |
| out_cuda.backward(gradients.cuda()) |
| self.assertEqual(out_cpu, out_cuda) |
| self.assertEqual(input_cpu.grad, input_gpu.grad) |
| |
| def test_affine_grid_3d(self): |
| # test known input on CPU |
| input = torch.arange(1., 13).view(1, 3, 4) |
| output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=True) |
| groundtruth = torch.Tensor( |
| [[[[[-2, -10, -18], [0, 0, 0]], [[2, 2, 2], [4, 12, 20]]], |
| [[[4, 4, 4], [6, 14, 22]], [[8, 16, 24], [10, 26, 42]]]]]).view(1, 2, 2, 2, 3) |
| self.assertEqual(output, groundtruth) |
| output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=False) |
| groundtruth = torch.Tensor( |
| [[[[[1, -1, -3], [2, 4, 6]], [[3, 5, 7], [4, 10, 16]]], |
| [[[4, 6, 8], [5, 11, 17]], [[6, 12, 18], [7, 17, 27]]]]]).view(1, 2, 2, 2, 3) |
| self.assertEqual(output, groundtruth) |
| |
| for align_corners in (True, False): |
| # do gradcheck |
| N = random.randint(1, 8) |
| C = random.randint(1, 8) |
| D = random.randint(1, 8) |
| H = random.randint(1, 8) |
| W = random.randint(1, 8) |
| sz = torch.Size([N, C, D, H, W]) |
| inp = torch.randn(N, 3, 4, requires_grad=True) |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| self.assertTrue(gradcheck( |
| lambda inp: F.affine_grid(inp, sz, align_corners=align_corners), |
| (inp,))) |
| |
| # test CPU against CUDA |
| if TEST_CUDA: |
| N = random.randint(1, 8) |
| C = random.randint(1, 8) |
| D = random.randint(1, 8) |
| H = random.randint(1, 8) |
| W = random.randint(1, 8) |
| sz = torch.Size([N, C, D, H, W]) |
| for align_corners in (True, False): |
| input_cpu = torch.randn(N, 3, 4, requires_grad=True) |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners) |
| gradients = torch.randn(out_cpu.size()) |
| out_cpu.backward(gradients) |
| input_gpu = input_cpu.detach().cuda().requires_grad_() |
| with warnings.catch_warnings(record=True): |
| warnings.simplefilter("always") # python2 requires this so other tests can trigger |
| out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners) |
| out_cuda.backward(gradients.cuda()) |
| self.assertEqual(out_cpu, out_cuda) |
| self.assertEqual(input_cpu.grad, input_gpu.grad) |
| |
| def test_channel_shuffle(self): |
| # 3D tensor |
| x = torch.tensor( |
| [[[1, 2], |
| [5, 6], |
| [9, 10], |
| [13, 14], |
| ]] |
| ) |
| y_ref = torch.tensor( |
| [[[1, 2], |
| [9, 10], |
| [5, 6], |
| [13, 14], |
| ]] |
| ) |
| # ChannelsFirst |
| y = F.channel_shuffle(x, 2) |
| self.assertEqual(y, y_ref) |
| # ChannelsLast not supported for 3dim |
| |
| # 4D tensor |
| x = torch.tensor( |
| [[[[1, 2], |
| [3, 4]], |
| [[5, 6], |
| [7, 8]], |
| [[9, 10], |
| [11, 12]], |
| [[13, 14], |
| [15, 16]], |
| ]] |
| ) |
| y_ref = torch.tensor( |
| [[[[1, 2], |
| [3, 4]], |
| [[9, 10], |
| [11, 12]], |
| [[5, 6], |
| [7, 8]], |
| [[13, 14], |
| [15, 16]], |
| ]] |
| ) |
| # ChannelsFirst NCHW |
| y = F.channel_shuffle(x, 2) |
| self.assertEqual(y, y_ref) |
| # ChannelsLast NHWC |
| y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last), 2) |
| y = y.contiguous(memory_format=torch.contiguous_format) |
| self.assertEqual(y, y_ref) |
| |
| # 5D tensor |
| x = torch.tensor( |
| [[[[[1, 2], |
| [3, 4]]], |
| [[[5, 6], |
| [7, 8]]], |
| [[[9, 10], |
| [11, 12]]], |
| [[[13, 14], |
| [15, 16]]], |
| ]] |
| ) |
| y_ref = torch.tensor( |
| [[[[[1, 2], |
| [3, 4]]], |
| [[[9, 10], |
| [11, 12]]], |
| [[[5, 6], |
| [7, 8]]], |
| [[[13, 14], |
| [15, 16]]], |
| ]] |
| ) |
| # ChannelsFirst NCHW |
| y = F.channel_shuffle(x, 2) |
| self.assertEqual(y, y_ref) |
| # ChannelsLast NHWC |
| y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last_3d), 2) |
| y = y.contiguous(memory_format=torch.contiguous_format) |
| self.assertEqual(y, y_ref) |
| |
| def test_upsamplingNearest1d(self): |
| m = nn.Upsample(size=4, mode='nearest') |
| in_t = torch.ones(1, 1, 2) |
| in_uint8_t = torch.ones(1, 1, 2, dtype=torch.uint8) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| out_uint8_t = m(in_t) |
| self.assertEqual(torch.ones(1, 1, 4), out_t.data) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(torch.ones(1, 1, 4, dtype=torch.uint8), out_uint8_t.data) |
| |
| input = torch.randn(1, 1, 2, requires_grad=True) |
| gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input]) |
| |
| def test_upsamplingLinear1d(self): |
| for align_corners in [True, False]: |
| kwargs = dict(mode='linear', align_corners=align_corners) |
| |
| # test float scale factor up & downsampling |
| for scale_factor in [0.5, 1.5, 2]: |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs) |
| in_t = torch.ones(1, 1, 2) |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| self.assertEqual(torch.ones(1, 1, out_size), out_t.data) |
| |
| input = torch.randn(1, 1, 2, requires_grad=True) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), (input,)) |
| |
| def test_upsamplingLinear1d_spatial_invariance(self): |
| m = nn.Upsample(scale_factor=3, mode='linear', align_corners=False) |
| in_t_9 = torch.zeros(1, 1, 9) |
| in_t_9[:, :, :4].normal_() |
| with warnings.catch_warnings(record=True) as w: |
| out_t_9 = m(in_t_9) |
| out_t_5 = m(in_t_9[:, :, :5]) |
| self.assertEqual(out_t_9[:, :, :15], out_t_5) |
| |
| def test_upsamplingNearest2d(self): |
| for memory_format in [torch.contiguous_format, torch.channels_last]: |
| m = nn.Upsample(size=4, mode='nearest') |
| in_t = torch.ones(1, 1, 2, 2).contiguous(memory_format=memory_format) |
| in_uint8_t = torch.ones(1, 1, 2, 2, dtype=torch.uint8).contiguous(memory_format=memory_format) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| out_uint8_t = m(in_uint8_t) |
| self.assertEqual(torch.ones(1, 1, 4, 4).contiguous(memory_format=memory_format), out_t.data) |
| self.assertEqual(torch.ones(1, 1, 4, 4, dtype=torch.uint8).contiguous(memory_format=memory_format), out_uint8_t.data) |
| |
| # test forward when input's height is not same as width |
| m = nn.Upsample(size=(4, 2), mode='nearest') |
| in_t = torch.ones(1, 1, 2, 1).contiguous(memory_format=memory_format) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| self.assertEqual(torch.ones(1, 1, 4, 2).contiguous(memory_format=memory_format), out_t.data) |
| |
| # test backward when input's height is not same as width |
| input = torch.ones(1, 1, 2, 1, requires_grad=True).contiguous(memory_format=memory_format) |
| gradcheck(lambda x: F.interpolate(x, size=(4, 2), mode='nearest'), [input]) |
| gradgradcheck(lambda x: F.interpolate(x, size=(4, 2), mode='nearest'), [input]) |
| |
| input = torch.randn(1, 1, 2, 2, requires_grad=True).contiguous(memory_format=memory_format) |
| self.assertEqual( |
| F.interpolate(input, 4, mode='nearest'), |
| F.interpolate(input, scale_factor=2, mode='nearest')) |
| gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input]) |
| gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input]) |
| |
| def test_upsamplingBilinear2d(self): |
| for align_corners in [True, False]: |
| kwargs = dict(mode='bilinear', align_corners=align_corners) |
| |
| # test float scale factor up & downsampling |
| for scale_factor in [0.5, 1.5, 2]: |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs) |
| in_t = torch.ones(1, 1, 2, 2) |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| self.assertEqual(torch.ones(1, 1, out_size, out_size), out_t.data) |
| |
| input = torch.randn(1, 1, 2, 2, requires_grad=True) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input]) |
| |
| def test_upsamplingBicubic2d(self): |
| # test output against known input: align_corners=False result must match opencv |
| in_t = torch.arange(8.).view(1, 2, 2, 2) |
| expected_out_t = torch.Tensor( |
| [[[[-0.31641, 0.01562, 0.56250, 0.89453], |
| [0.34766, 0.67969, 1.22656, 1.55859], |
| [1.44141, 1.77344, 2.32031, 2.65234], |
| [2.10547, 2.43750, 2.98438, 3.31641]], |
| |
| [[3.68359, 4.01562, 4.56250, 4.89453], |
| [4.34766, 4.67969, 5.22656, 5.55859], |
| [5.44141, 5.77344, 6.32031, 6.65234], |
| [6.10547, 6.43750, 6.98438, 7.31641]]]]) |
| out_t = F.interpolate(in_t, scale_factor=2, mode='bicubic', align_corners=False) |
| torch.set_printoptions(precision=5) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(out_t, expected_out_t, atol=1e-5, rtol=0) |
| |
| |
| device_list = ['cpu'] |
| if TEST_CUDA: |
| device_list.append('cuda') |
| |
| for align_corners in [True, False]: |
| kwargs = dict(mode='bicubic', align_corners=align_corners) |
| # test float scale factor up & downsampling |
| for device in device_list: |
| for scale_factor in [0.5, 1.5, 2]: |
| in_t = torch.ones(2, 2, 2, 2).to(device) |
| out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs) |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| self.assertEqual(torch.ones(2, 2, out_size, out_size), out_t.data, |
| atol=1e-5, rtol=0) |
| |
| input = torch.randn(2, 2, 2, 2, requires_grad=True) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input]) |
| |
| def test_upsampling_not_recompute_scale_factor(self): |
| # test output against known input: result must match opencv |
| in_t = torch.arange(8.).view(1, 2, 2, 2) |
| expected_out_t = torch.Tensor( |
| [[[[-0.32725, -0.08843, 0.37933, 0.79744], |
| [0.15039, 0.38921, 0.85697, 1.27508], |
| [1.08591, 1.32473, 1.79249, 2.21060], |
| [1.92213, 2.16095, 2.62871, 3.04682]], |
| |
| [[3.67275, 3.91157, 4.37933, 4.79744], |
| [4.15039, 4.38921, 4.85697, 5.27508], |
| [5.08591, 5.32473, 5.79249, 6.21060], |
| [5.92213, 6.16095, 6.62871, 7.04682]]]]) |
| if IS_PPC: |
| # Both OpenCV and PyTorch give a slightly different result on PPC |
| expected_out_t = torch.Tensor( |
| [[[[-0.32725, -0.08843, 0.37933, 0.79744], |
| [0.15039, 0.38921, 0.85697, 1.27508], |
| [1.08591, 1.32473, 1.79249, 2.21060], |
| [1.92212, 2.16094, 2.62870, 3.04681]], |
| |
| [[3.67275, 3.91157, 4.37933, 4.79743], |
| [4.15039, 4.38921, 4.85697, 5.27508], |
| [5.08591, 5.32473, 5.79249, 6.21059], |
| [5.92212, 6.16094, 6.62870, 7.04680]]]]) |
| out_t = F.interpolate(in_t, scale_factor=2.3, mode='bicubic', align_corners=False, recompute_scale_factor=False) |
| torch.set_printoptions(precision=5) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(out_t, expected_out_t, atol=1e-4, rtol=0) |
| |
| device_list = ['cpu'] |
| if TEST_CUDA: |
| device_list.append('cuda') |
| |
| for align_corners in [True, False]: |
| kwargs = dict(mode='bicubic', align_corners=align_corners) |
| # test float scale factor up & downsampling |
| for device in device_list: |
| for scale_factor in [0.6, 1.6, 2.3]: |
| in_t = torch.ones(2, 2, 2, 2).to(device) |
| out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs) |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| self.assertEqual(torch.ones(2, 2, out_size, out_size), out_t.data, atol=1e-5, rtol=0) |
| |
| input = torch.randn(2, 2, 2, 2, requires_grad=True) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input]) |
| |
| def test_upsamplingBilinear2d_spatial_invariance(self): |
| m = nn.Upsample(scale_factor=3, mode='bilinear', align_corners=False) |
| in_t_9 = torch.zeros(1, 1, 9, 9) |
| in_t_9[:, :, :4, :4].normal_() |
| with warnings.catch_warnings(record=True) as w: |
| out_t_9 = m(in_t_9) |
| out_t_5 = m(in_t_9[:, :, :5, :5]) |
| self.assertEqual(out_t_9[:, :, :15, :15], out_t_5) |
| |
| def test_upsamplingNearest3d(self): |
| for memory_format in [torch.contiguous_format, torch.channels_last_3d]: |
| m = nn.Upsample(size=4, mode='nearest') |
| in_t = torch.ones(1, 1, 2, 2, 2).contiguous(memory_format=memory_format) |
| in_uint8_t = torch.ones(1, 1, 2, 2, 2, dtype=torch.uint8).contiguous(memory_format=memory_format) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| out_uint8_t = m(in_uint8_t) |
| self.assertEqual(torch.ones(1, 1, 4, 4, 4).contiguous(memory_format=memory_format), out_t.data) |
| self.assertEqual(torch.ones(1, 1, 4, 4, 4, dtype=torch.uint8).contiguous(memory_format=memory_format), out_uint8_t.data) |
| |
| input = torch.randn(1, 1, 2, 2, 2, requires_grad=True).contiguous(memory_format=memory_format) |
| gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input]) |
| |
| def test_upsamplingTrilinear3d(self): |
| for align_corners in [True, False]: |
| kwargs = dict(mode='trilinear', align_corners=align_corners) |
| |
| # test float scale factor up & downsampling |
| for scale_factor in [0.5, 1.5, 2]: |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs) |
| in_t = torch.ones(1, 1, 2, 2, 2) |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| with warnings.catch_warnings(record=True) as w: |
| out_t = m(in_t) |
| self.assertEqual(torch.ones(1, 1, out_size, out_size, out_size), out_t.data) |
| |
| input = torch.randn(1, 1, 2, 2, 2, requires_grad=True) |
| self.assertEqual( |
| F.interpolate(input, (out_size, out_size, out_size), **kwargs), |
| F.interpolate(input, scale_factor=scale_factor, **kwargs)) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input]) |
| gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input]) |
| |
| def test_upsamplingTrilinear3d_spatial_invariance(self): |
| m = nn.Upsample(scale_factor=3, mode='trilinear', align_corners=False) |
| in_t_9 = torch.zeros(1, 1, 9, 9, 9) |
| in_t_9[:, :, :4, :4, :4].normal_() |
| with warnings.catch_warnings(record=True) as w: |
| out_t_9 = m(in_t_9) |
| out_t_5 = m(in_t_9[:, :, :5, :5, :5]) |
| self.assertEqual(out_t_9[:, :, :15, :15, :15], out_t_5) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| def test_interpolate_illegal_memory_access(self): |
| in_s = 45 |
| out_s = 14 |
| |
| input = torch.ones((1, 1, in_s), device='cuda', requires_grad=True) |
| # note we allocated grad_output to be larger so out of bound access |
| # woudl be visible in grad_input |
| grad = torch.ones((1, 1, out_s * 2), device='cuda', requires_grad=True) |
| grad = grad[:, :, :out_s] |
| |
| input_ref = input.detach().cpu().requires_grad_() |
| grad_ref = grad.cpu() |
| |
| out = F.interpolate(input, size=(out_s,), mode='nearest') |
| out.backward(grad) |
| |
| out_ref = F.interpolate(input_ref, size=(out_s,), mode='nearest') |
| out_ref.backward(grad_ref) |
| |
| self.assertEqual(out_ref, out) |
| self.assertEqual(input_ref.grad, input.grad) |
| |
| def test_interpolate(self): |
| def _test_interpolate_helper(in_t, scale_factor, layer): |
| out_size = int(math.floor(in_t.shape[-1] * scale_factor)) |
| dim = len(in_t.shape) - 2 |
| out_shape = [1, 1] + [out_size] * dim |
| with warnings.catch_warnings(record=True) as w: |
| out_t = layer(in_t) |
| self.assertEqual(torch.ones(out_shape), out_t) |
| |
| self.assertEqual( |
| F.interpolate(in_t, (out_size,) * dim, **kwargs), |
| F.interpolate(in_t, scale_factor=scale_factor, **kwargs)) |
| gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t]) |
| gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t]) |
| |
| def _make_input(dim, device): |
| size = [1, 1] |
| size += [2] * dim |
| return torch.ones(size, requires_grad=True, device=device) |
| |
| device_list = ['cpu'] |
| if TEST_CUDA: |
| device_list.append('cuda') |
| |
| for device in device_list: |
| for scale_factor in [0.5, 1.5, 2]: |
| for mode in ['nearest', 'area']: |
| kwargs = dict(mode=mode) |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device) |
| for input in [_make_input(1, device), _make_input(2, device), _make_input(3, device)]: |
| _test_interpolate_helper(input, scale_factor, m) |
| |
| for align_corners in [True, False]: |
| kwargs = dict(mode='linear', align_corners=align_corners) |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device) |
| _test_interpolate_helper(_make_input(1, device), scale_factor, m) |
| |
| kwargs = dict(mode='bilinear', align_corners=align_corners) |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device) |
| _test_interpolate_helper(_make_input(2, device), scale_factor, m) |
| |
| kwargs = dict(mode='bicubic', align_corners=align_corners) |
| |
| def m(t): |
| return F.interpolate(t, scale_factor=scale_factor, **kwargs).to(device) |
| _test_interpolate_helper(_make_input(2, device), scale_factor, m) |
| |
| kwargs = dict(mode='trilinear', align_corners=align_corners) |
| m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device) |
| _test_interpolate_helper(_make_input(3, device), scale_factor, m) |
| |
| def test_linear_broadcasting(self): |
| m = nn.Linear(5, 8) |
| inp = torch.randn(2, 3, 5) |
| expected = m(inp.view(6, 5)).view(2, 3, 8) |
| self.assertEqual(expected, m(inp)) |
| |
| def test_bilinear(self): |
| module = nn.Bilinear(10, 10, 8) |
| input1 = torch.randn(4, 10, requires_grad=True) |
| input2 = torch.randn(4, 10, requires_grad=True) |
| grad_output = torch.randn(4, 8) |
| |
| res = module(input1, input2) |
| expected = (torch.einsum("bi,kij,bj->bk", input1, module.weight, input2) + |
| module.bias) |
| self.assertEqual(res, expected) |
| grads = torch.autograd.grad(res, [module.weight, module.bias, input1, input2], grad_output) |
| grads_expected = torch.autograd.grad(expected, [module.weight, module.bias, input1, input2], grad_output) |
| for g, ge in zip(grads, grads_expected): |
| self.assertEqual(g, ge) |
| |
| def test_bilinear_no_bias(self): |
| module = nn.Bilinear(10, 10, 8) |
| module_no_bias = nn.Bilinear(10, 10, 8, False) |
| |
| module.bias.data.zero_() |
| module.weight.data.copy_(module_no_bias.weight) |
| |
| input1 = torch.randn(4, 10, requires_grad=True) |
| input2 = torch.randn(4, 10, requires_grad=True) |
| grad_output = torch.randn(4, 8) |
| |
| def run(net): |
| input1.grad = input2.grad = None |
| output = net(input1, input2) |
| output.backward(grad_output) |
| |
| return output.data, input1.grad.data, input2.grad.data |
| |
| out, g1, g2 = run(module) |
| out_nb, g1_nb, g2_nb = run(module_no_bias) |
| |
| self.assertEqual(out, out_nb) |
| self.assertEqual(g1, g1_nb) |
| self.assertEqual(g2, g2_nb) |
| |
| _assertGradAndGradgradChecks(self, |
| lambda x1, x2: F.bilinear(x1, x2, module_no_bias.weight, module_no_bias.bias), |
| (input1, input2)) |
| |
| def test_bilinear_broadcasting(self): |
| m = nn.Bilinear(5, 6, 8) |
| input1 = torch.randn(2, 3, 5) |
| input2 = torch.randn(2, 3, 6) |
| expected = m(input1.view(6, 5), input2.view(6, 6)).view(2, 3, 8) |
| self.assertEqual(expected, m(input1, input2)) |
| |
| def test_conv_tbc(self): |
| inp = torch.randn(9, 4, 5, requires_grad=True) |
| weight = torch.randn(3, 5, 6, requires_grad=True) |
| bias = torch.randn(6, requires_grad=True) |
| |
| gradcheck(lambda i, w, b, pad: F.conv_tbc(i, w, b, pad), (inp, weight, bias, 3)) |
| |
| def run_conv_double_back_test(self, kern, stride, padding, chan_in, chan_out, batch_size, |
| inp_size, dilation, no_weight, groups=1, use_cuda=False, |
| use_bias=True, dtype=torch.double): |
| if use_cuda: |
| device = torch.device("cuda") |
| else: |
| device = torch.device("cpu") |
| |
| x = torch.randn(batch_size, chan_in, inp_size, inp_size, device=device, |
| dtype=dtype, requires_grad=True) |
| weight = torch.randn(chan_out, chan_in // groups, kern, kern, device=device, |
| dtype=dtype, requires_grad=not no_weight) |
| if use_bias: |
| bias = torch.randn(chan_out, device=device, dtype=dtype, requires_grad=True) |
| else: |
| bias = None |
| |
| def func(*inputs): |
| if use_bias: |
| lx, lweight, lbias = inputs |
| else: |
| lx, lweight = inputs |
| lbias = None |
| # We disable cudnn during forward to avoid finite difference imprecision issues |
| with cudnn.flags(enabled=False): |
| out = F.conv2d(lx, lweight, lbias, stride, padding, dilation, groups) |
| return out |
| |
| if use_bias: |
| inputs = x, weight, bias |
| else: |
| inputs = x, weight |
| |
| dummy_out = func(*inputs) |
| grad_y = torch.randn_like(dummy_out, device=device, dtype=dtype, requires_grad=True) |
| |
| # Issue #15353: test mkldnn double backward, don't run gradgradcheck due |
| # to imprecision issues |
| if dtype == torch.float: |
| g, = torch.autograd.grad(dummy_out.sum(), x, create_graph=True) |
| return g.requires_grad |
| |
| return gradgradcheck(func, inputs, (grad_y,)) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @unittest.skipIf(not TEST_CUDNN, "needs cudnn") |
| @skipIfRocm |
| def test_grouped_conv_cudnn_nhwc_support(self): |
| # in order to catch the hols in grouped convolution in nhwc support for earlier cudnn version |
| input = torch.randn((16, 16, 8, 8), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last) |
| weight = torch.randn((8, 4, 3, 3), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last) |
| out = torch.cudnn_convolution(input, weight, None, (1, 1), (1, 1), (1, 1), 4, False, False) |
| input = torch.randn((16, 8, 8, 8), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last) |
| out = torch.cudnn_convolution_transpose(input, weight, None, (1, 1), (0, 0), (1, 1), (1, 1), 4, False, False) |
| |
| @unittest.expectedFailure |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @unittest.skipIf(not TEST_CUDNN, "needs cudnn") |
| @skipIfRocm |
| def test_conv_cudnn_memory_layout_dominance(self): |
| # desired behavior here is to have the memory_layout of conv.weight to |
| # dominante the layout of output. |
| # which is not the same as current behavior, we'll fix this in |
| # following up PRs and remove the `expectedFailure` tag |
| input = torch.randint(1, 10, (2, 8, 4, 4), dtype=torch.float32, device="cuda", requires_grad=True) |
| conv = nn.Conv2d(8, 4, 3).cuda().float() |
| |
| out = conv(input) |
| self.assertTrue(out.is_contiguous()) |
| |
| input = input.contiguous(memory_format=torch.channels_last) |
| out = conv(input) |
| self.assertTrue(out.is_contiguous()) |
| |
| conv.weight.data = conv.weight.contiguous(memory_format=torch.channels_last) |
| out = conv(input) |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| |
| input = input.contiguous() |
| out = conv(input) |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| |
| def test_conv_double_backward(self): |
| batch_size = 2 |
| for kern, inp_size, dilations in [(3, 6, [1, 2]), (3, 7, [1]), (4, 9, [1])]: |
| for stride, padding, chan_in, chan_out, dilation in \ |
| product([1, 2], [0, 1, 2], [2], [3], dilations): |
| for no_weight in (True, False): |
| for dtype in (torch.float, torch.double): |
| result = self.run_conv_double_back_test(kern, stride, |
| padding, chan_in, chan_out, |
| batch_size, inp_size, dilation, |
| no_weight, dtype=dtype) |
| self.assertTrue(result, |
| "Conv double backward test failed with parameters:" + |
| "\nkern: " + str(kern) + |
| "\nstride: " + str(stride) + |
| "\npadding: " + str(padding) + |
| "\nchan_in: " + str(chan_in) + |
| "\nchan_out: " + str(chan_out) + |
| "\nbatch_size: " + str(batch_size) + |
| "\ninp_size: " + str(inp_size) + |
| "\ndilation: " + str(dilation) + |
| "\ndtype: " + str(dtype)) |
| |
| def test_conv_double_backward_no_bias(self): |
| kern = 3 |
| stride = 2 |
| chan_in, chan_out = 2, 4 |
| batch_size = 2 |
| inp_size = 5 |
| padding = 1 |
| dilation = 1 |
| no_weight = False |
| use_bias = True |
| result = self.run_conv_double_back_test(kern, stride, |
| padding, chan_in, chan_out, |
| batch_size, inp_size, dilation, |
| no_weight, use_bias=use_bias) |
| self.assertTrue(result, |
| "Conv double backward test failed with parameters:" + |
| "\nkern: " + str(kern) + |
| "\nstride: " + str(stride) + |
| "\npadding: " + str(padding) + |
| "\nchan_in: " + str(chan_in) + |
| "\nchan_out: " + str(chan_out) + |
| "\nbatch_size: " + str(batch_size) + |
| "\ninp_size: " + str(inp_size) + |
| "\ndilation: " + str(dilation)) |
| |
| def test_conv_double_backward_groups(self): |
| kern = 3 |
| stride = 1 |
| padding = 2 |
| chan_in, chan_out = 2, 4 |
| batch_size = 2 |
| inp_size = 6 |
| dilation = 1 |
| no_weight = False |
| groups = 2 |
| result = self.run_conv_double_back_test(kern, stride, |
| padding, chan_in * groups, chan_out * groups, |
| batch_size, inp_size, dilation, |
| no_weight, groups=groups) |
| self.assertTrue(result, |
| "Conv double backward test failed with parameters:" + |
| "\nkern: " + str(kern) + |
| "\nstride: " + str(stride) + |
| "\npadding: " + str(padding) + |
| "\nchan_in: " + str(chan_in) + |
| "\nchan_out: " + str(chan_out) + |
| "\nbatch_size: " + str(batch_size) + |
| "\ninp_size: " + str(inp_size) + |
| "\ndilation: " + str(dilation) + |
| "\ngroups: " + str(groups)) |
| |
| def test_conv_double_backward_stride(self): |
| batch_size = 2 |
| |
| # Cannot provide ggW when stride is > 1 |
| for kern, inp_size, dilations in [(3, 5, [1, 2]), (3, 7, [1])]: |
| for stride, padding, chan_in, chan_out, dilation in product([2], [0, 1], [1], [2], dilations): |
| no_weight = False |
| self.run_conv_double_back_test(kern, stride, |
| padding, chan_in, chan_out, |
| batch_size, inp_size, dilation, |
| no_weight) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| def test_cudnn_noncontiguous_weight(self): |
| # Noncontiguous weights must be contiguous() before being |
| # passed to cuDNN |
| input = torch.tensor([1, 1, 1], dtype=torch.double, device="cuda").view(1, 1, 3) |
| weights1 = torch.tensor([1], dtype=torch.double, device="cuda").expand(1, 1, 2) |
| weights2 = torch.tensor([1], dtype=torch.double, device="cuda").expand(1, 1, 2).contiguous() |
| self.assertEqual(F.conv1d(input, weights1, bias=None, stride=2, dilation=2), |
| F.conv1d(input, weights2, bias=None, stride=2, dilation=2)) |
| |
| @unittest.skipIf(not TEST_CUDA, "CUDA unavailable") |
| @repeat_test_for_types(DOUBLE_TENSORTYPES) |
| def test_conv_double_backward_cuda(self, dtype=torch.double): |
| # Double backward only runs with DoubleTensor due to precison reason |
| batch_size = 1 |
| for kern, inp_size, dilations in [(3, 5, [1, 2]), (4, 9, [1])]: |
| for stride, padding, chan_in, chan_out, dilation in product([1], [2], [2], [3], dilations): |
| no_weight = stride == 2 |
| result = self.run_conv_double_back_test(kern, stride, |
| padding, chan_in, chan_out, |
| batch_size, inp_size, dilation, |
| no_weight, use_cuda=True, dtype=dtype) |
| self.assertTrue(result, |
| "Conv double backward test failed with parameters:" + |
| "\nkern: " + str(kern) + |
| "\nstride: " + str(stride) + |
| "\npadding: " + str(padding) + |
| "\nchan_in: " + str(chan_in) + |
| "\nchan_out: " + str(chan_out) + |
| "\nbatch_size: " + str(batch_size) + |
| "\ninp_size: " + str(inp_size) + |
| "\ndilation: " + str(dilation)) |
| |
| def run_grad_conv_test(self, func_forward, func_backward, dim=1, gradient='input'): |
| for kern, inp_size in [(3, 6), (3, 7), (4, 9)]: |
| for batch, stride, padding, chan_in, chan_out, dilation in \ |
| product([1, 2], [1, 2], [0, 1, 2], [2], [3], [1]): |
| |
| for has_bias in [True, False]: |
| input_shape = [batch, chan_in] |
| weight_shape = [chan_out, chan_in] |
| for _ in range(dim): |
| input_shape.append(inp_size) |
| weight_shape.append(kern) |
| |
| input = torch.randn(input_shape, requires_grad=True) |
| weight = torch.randn(weight_shape, requires_grad=True) |
| if has_bias: |
| bias = torch.randn([chan_out], requires_grad=True) |
| output = func_forward(input, weight, stride=stride, padding=padding, dilation=dilation, bias=bias) |
| |
| gradient_o = torch.randn(output.shape) |
| gradient_w = torch.autograd.grad(output, input if (gradient == 'input') else weight, gradient_o) |
| |
| self.assertEqual(gradient_w[0], |
| func_backward( |
| input_shape if (gradient == 'input') else input, |
| weight_shape if (gradient == 'weight') else weight, |
| gradient_o, |
| stride=stride, |
| padding=padding, |
| dilation=dilation)) |
| |
| def test_grad_conv1d_input(self): |
| self.run_grad_conv_test(F.conv1d, F.grad.conv1d_input, 1, 'input') |
| |
| def test_grad_conv1d_weight(self): |
| self.run_grad_conv_test(F.conv1d, F.grad.conv1d_weight, 1, 'weight') |
| |
| def test_grad_conv2d_input(self): |
| self.run_grad_conv_test(F.conv2d, F.grad.conv2d_input, 2, 'input') |
| |
| def test_grad_conv2d_weight(self): |
| self.run_grad_conv_test(F.conv2d, F.grad.conv2d_weight, 2, 'weight') |
| |
| def test_grad_conv3d_input(self): |
| self.run_grad_conv_test(F.conv3d, F.grad.conv3d_input, 3, 'input') |
| |
| def test_grad_conv3d_weight(self): |
| self.run_grad_conv_test(F.conv3d, F.grad.conv3d_weight, 3, 'weight') |
| |
| @unittest.skipIf(not torch._nnpack_available(), "NNPACK unavailable") |
| def test_nnpack_conv(self): |
| for kern, inp_size in [(3, 6), (3, 7), (4, 9)]: |
| for batch, stride, padding, chan_in, chan_out in \ |
| product([1, 2, 3, 4], [1, 2], [0, 1, 2], [2], [3]): |
| |
| for has_bias in [True, False]: |
| input_shape = [batch, chan_in] |
| weight_shape = [chan_out, chan_in] |
| for _ in range(2): |
| input_shape.append(inp_size) |
| weight_shape.append(kern) |
| |
| input = torch.randn(input_shape, requires_grad=True, dtype=torch.float) |
| weight = torch.randn(weight_shape, requires_grad=True, dtype=torch.float) |
| if has_bias: |
| bias = torch.randn([chan_out], requires_grad=True, dtype=torch.float) |
| output = torch._nnpack_spatial_convolution(input, weight, stride=stride, padding=padding, bias=bias) |
| output_expected = torch.nn.functional.conv2d(input, weight, stride=stride, padding=padding, bias=bias) |
| self.assertEqual(output, output_expected, atol=3e-4, rtol=0) |
| |
| gradient_o = torch.randn(output.shape, dtype=torch.float) |
| |
| grads = torch.autograd.grad(output, [input, weight], gradient_o) |
| grads_expected = torch.autograd.grad(output_expected, [input, weight], gradient_o) |
| for gr, gr_expected in zip(grads, grads_expected): |
| self.assertEqual(gr, gr_expected, atol=3e-4, rtol=0) |
| |
| def test_fold_invalid_arg(self): |
| # input wrong dimension |
| |
| fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3)) |
| with self.assertRaisesRegex(NotImplementedError, r"Only 3D input Tensors are supported"): |
| fold(torch.randn(1, 5)) |
| |
| # input.size(1) not divisible by \prod(kernel_size) |
| |
| fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3)) |
| with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"): |
| fold(torch.randn(1, 5, 9)) |
| |
| with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"): |
| fold(torch.randn(1, 19, 9)) |
| |
| # input.size(2) not matching the total number of sliding blocks |
| |
| with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"): |
| fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3)) |
| fold(torch.randn(1, 6, 10)) |
| |
| with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"): |
| fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2)) |
| fold(torch.randn(1, 6, 5)) |
| |
| with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"): |
| fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2), dilation=(1, 2), padding=(2, 0)) |
| fold(torch.randn(1, 6, 5)) # should be 4 * 1 = 4 sliding blocks |
| |
| def test_unfold_invalid_arg(self): |
| # input wrong dimension |
| |
| unfold = nn.Unfold(kernel_size=(2, 3)) |
| with self.assertRaisesRegex(NotImplementedError, r"Only 4D input Tensors are supported"): |
| unfold(torch.randn(1, 5, 2)) |
| |
| # calculated output shape is too small |
| |
| with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"): |
| unfold = nn.Unfold(kernel_size=(2, 3)) |
| unfold(torch.randn(1, 2, 2, 2)) |
| |
| with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"): |
| unfold = nn.Unfold(kernel_size=(5, 3), padding=(1, 1)) |
| unfold(torch.randn(1, 2, 2, 3)) |
| |
| with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"): |
| unfold = nn.Unfold(kernel_size=(1, 3), padding=(1, 1), dilation=(1, 2)) |
| unfold(torch.randn(1, 2, 2, 2)) |
| |
| def test_conv_padding_mode(self): |
| with self.assertRaisesRegex(ValueError, "padding_mode must be one of"): |
| nn.Conv2d(3, 3, 3, padding_mode="xyz") |
| |
| with self.assertRaisesRegex(ValueError, "padding_mode must be one of"): |
| nn.Conv2d(3, 3, 3, padding_mode=3) |
| |
| with self.assertRaisesRegex(ValueError, "Only \"zeros\" "): |
| nn.ConvTranspose2d(3, 3, 3, padding_mode="reflect") |
| |
| def test_softmin(self): |
| x = torch.randn(2, 16) |
| self.assertEqual(F.softmin(x, 1), F.softmax(-x, 1)) |
| self.assertEqual(F.softmin(x, 0), F.softmax(-x, 0)) |
| |
| def test_log_softmax_cpu(self, dtype=torch.bfloat16): |
| inputf = torch.rand(32, 100, device="cpu", dtype=torch.float, requires_grad=True) |
| input = inputf.to(dtype).detach().requires_grad_(True) |
| outf = F.log_softmax(inputf, dim=-1) |
| out = F.log_softmax(input, dim=-1) |
| self.assertEqual(out.dtype, dtype) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(out, outf, atol=0.1, rtol=0) |
| |
| out.sum().backward() |
| outf.sum().backward() |
| self.assertEqual(input.grad.dtype, dtype) |
| self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0.1, rtol=0) |
| |
| def test_adaptive_log_softmax(self): |
| # args validation |
| with self.assertRaises(ValueError): |
| _ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 15], div_value=2.) |
| |
| with self.assertRaises(ValueError): |
| _ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 10], div_value=2.) |
| |
| with self.assertRaises(ValueError): |
| _ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 25], div_value=2.) |
| |
| with self.assertRaisesRegex(ValueError, "cutoffs should be a sequence of unique,"): |
| _ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 20], div_value=2.) |
| |
| # not raise |
| _ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 19], div_value=2.) |
| |
| # input shapes |
| with self.assertRaisesRegex(RuntimeError, r"Input and target should have the same size"): |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.) |
| x = torch.randn(2, 16) |
| y = torch.tensor([0, 5, 10]) |
| asfm(x, y) |
| |
| # out-of-bound targets |
| with self.assertRaisesRegex(RuntimeError, r"Target values should be in"): |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.) |
| x = torch.randn(2, 16) |
| y = torch.tensor([0, 20]) |
| asfm(x, y) |
| |
| # cluster sizes |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.) |
| x = torch.randn(2, 16) |
| y = torch.tensor([0, 17]) |
| |
| self.assertEqual(asfm.head.weight.size(), (5 + 3, 16)) # 5 targets in head, 3 clusters, dimensionality 16 |
| self.assertEqual(asfm.tail[0][1].weight.size(), (5, 8)) # 5 targets in this cluster, dimensionality 8 |
| self.assertEqual(asfm.tail[1][1].weight.size(), (5, 4)) |
| self.assertEqual(asfm.tail[2][1].weight.size(), (5, 2)) |
| |
| self.assertEqual(asfm(x, y).output.size(), (2, )) |
| |
| # log_probs actually returns log_proba |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 4, [2], div_value=2.) |
| x = torch.randn(4, 8) |
| logprob_out = asfm.log_prob(x) |
| |
| self.assertEqual(torch.exp(logprob_out).data.sum(1), torch.ones(4)) |
| |
| # forward returns the same thing as log_probs |
| for v in [0, 1, 2, 3]: |
| y = torch.full((4,), v, dtype=torch.long) |
| out, loss = asfm(x, y) |
| |
| self.assertEqual(out, logprob_out.gather(1, y.unsqueeze(1)).squeeze()) |
| self.assertEqual(loss, F.nll_loss(logprob_out, y)) |
| |
| # predict |
| x = torch.randn(64, 8).abs_() |
| |
| # argmax in shortlist |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True) |
| asfm.head.weight.data.abs_() |
| asfm.head.bias.data.abs_() |
| asfm.head.weight.data[asfm.shortlist_size:, :].zero_() |
| |
| out = asfm.predict(x) |
| self.assertEqual(out, asfm.log_prob(x).argmax(dim=1)) |
| |
| # argmax outside of shortlist |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True) |
| asfm.head.weight.data.abs_() |
| asfm.head.bias.data.abs_() |
| asfm.head.weight.data[:asfm.shortlist_size, :].zero_() |
| |
| out = asfm.predict(x) |
| self.assertEqual(out, asfm.log_prob(x).argmax(dim=1)) |
| |
| # half of the argmax in shortlist, half in clusters |
| asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True) |
| asfm.head.weight.data.abs_() |
| asfm.head.bias.data.abs_() |
| |
| x[:32, :asfm.shortlist_size].zero_() |
| x[32:, asfm.shortlist_size:].zero_() |
| |
| asfm.head.weight.data[:asfm.shortlist_size, asfm.shortlist_size:].zero_() |
| asfm.head.weight.data[asfm.shortlist_size:, :asfm.shortlist_size].zero_() |
| |
| out = asfm.predict(x) |
| self.assertEqual(out, asfm.log_prob(x).argmax(dim=1)) |
| |
| def test_cross_entropy_loss(self, dtype=torch.bfloat16): |
| loss_cpu = nn.CrossEntropyLoss().cpu() |
| inputf = torch.randn(15, 10, device="cpu", dtype=torch.float, requires_grad=True) |
| input = inputf.to(dtype).detach().requires_grad_(True) |
| target = torch.empty(15, dtype=torch.long).random_(10) |
| |
| outf = loss_cpu(inputf, target) |
| out = loss_cpu(input, target) |
| self.assertEqual(out.dtype, dtype) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(out, outf, atol=1e-1, rtol=0) |
| |
| outf.backward() |
| out.backward() |
| self.assertEqual(input.grad.dtype, dtype) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(input.grad, inputf.grad, atol=1e-1, rtol=0) |
| |
| @unittest.skipIf(not torch.cuda.is_available(), "CUDA not available") |
| def test_convert_sync_batchnorm(self): |
| module = torch.nn.Sequential( |
| torch.nn.BatchNorm1d(100), |
| torch.nn.InstanceNorm1d(100) |
| ).cuda() |
| |
| # necessary to have an anchor point for comparison, in case the |
| # convert_sync_batchnorm updates in place |
| comp_module = torch.nn.Sequential( |
| torch.nn.BatchNorm1d(100), |
| torch.nn.InstanceNorm1d(100) |
| ).cuda() |
| comp_module.load_state_dict(module.state_dict()) |
| |
| sync_bn_module = torch.nn.SyncBatchNorm.convert_sync_batchnorm(module) |
| children = list(sync_bn_module.children()) |
| self.assertEqual(children[0].__class__, torch.nn.SyncBatchNorm) |
| self.assertEqual(children[1].__class__, torch.nn.InstanceNorm1d) |
| |
| for layer, converted_layer in zip(comp_module.children(), sync_bn_module.children()): |
| for key in layer.state_dict().keys(): |
| self.assertEqual(layer.state_dict()[key].device, converted_layer.state_dict()[key].device) |
| self.assertEqual(layer.state_dict()[key], converted_layer.state_dict()[key]) |
| |
| def test_functional_grad_conv(self): |
| # Conv 1D |
| input = torch.randn(1, 1, 5, requires_grad=True) |
| weight = torch.randn(1, 1, 3, requires_grad=True) |
| output = F.conv1d(input, weight, dilation=2) |
| grad_output = torch.randn(output.shape) |
| |
| grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0] |
| grad_input_functional = torch.nn.grad.conv1d_input(input.shape, weight, grad_output, dilation=2) |
| self.assertEqual(grad_input_functional, grad_input_autograd) |
| |
| # Conv 2D |
| input = torch.randn(1, 1, 5, 5, requires_grad=True) |
| weight = torch.randn(1, 1, 3, 3, requires_grad=True) |
| output = F.conv2d(input, weight, dilation=2) |
| grad_output = torch.randn(output.shape) |
| |
| grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0] |
| grad_input_functional = torch.nn.grad.conv2d_input(input.shape, weight, grad_output, dilation=2) |
| self.assertEqual(grad_input_functional, grad_input_autograd) |
| |
| # Conv 3D |
| input = torch.randn(1, 1, 5, 5, 5, requires_grad=True) |
| weight = torch.randn(1, 1, 3, 3, 3, requires_grad=True) |
| output = F.conv3d(input, weight, dilation=2) |
| grad_output = torch.randn(output.shape) |
| |
| grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0] |
| grad_input_functional = torch.nn.grad.conv3d_input(input.shape, weight, grad_output, dilation=2) |
| self.assertEqual(grad_input_functional, grad_input_autograd) |
| |
| # Warning for _grad_input_padding |
| with warnings.catch_warnings(record=True) as w: |
| torch.nn.grad._grad_input_padding(torch.rand(1, 2, 3), [1, 2, 5], (1,), (0,), (3,)) |
| self.assertEqual(len(w), 1) |
| |
| def test_flatten(self): |
| tensor_input = torch.randn(2, 1, 2, 3) |
| |
| # Flatten Tensor |
| |
| flatten = nn.Flatten(start_dim=1, end_dim=-1) |
| tensor_output = flatten(tensor_input) |
| self.assertEqual(tensor_output.size(), torch.Size([2, 6])) |
| |
| def test_unflatten(self): |
| tensor_input = torch.randn(2, 50) |
| |
| # Unflatten Tensor (unflattened_size as a tuple of ints and list of ints) |
| |
| for us in ((2, 5, 5), [2, 5, 5]): |
| unflatten = nn.Unflatten(dim=1, unflattened_size=us) |
| tensor_output = unflatten(tensor_input) |
| self.assertEqual(tensor_output.size(), torch.Size([2, 2, 5, 5])) |
| |
| # Unflatten NamedTensor |
| |
| unflatten = nn.Unflatten(dim='features', unflattened_size=(('C', 2), ('H', 5), ('W', 5))) |
| named_tensor_input = tensor_input.refine_names('N', 'features') |
| named_tensor_output = unflatten(named_tensor_input) |
| self.assertEqual(named_tensor_output.size(), torch.Size([2, 2, 5, 5])) |
| |
| def test_unflatten_invalid_arg(self): |
| # Wrong type for unflattened_size (tuple of floats) |
| |
| with self.assertRaisesRegex( |
| TypeError, |
| r"unflattened_size must be tuple of ints, but found element of type float at pos 2"): |
| nn.Unflatten(dim=1, unflattened_size=(2, 5, 5.0)) |
| |
| # Wrong type for unflattened_size (list of lists and list of tuples) |
| for us in ([['C', 2], ['W', 5], ['H', 5]], [('C', 2), ('W', 5), ('H', 5)]): |
| with self.assertRaisesRegex( |
| TypeError, |
| r"unflattened_size must be a tuple of tuples, but found type list"): |
| nn.Unflatten(dim='features', unflattened_size=us) |
| |
| # Wrong type for unflattened_size (tuple of lists) |
| |
| with self.assertRaisesRegex( |
| TypeError, |
| r"unflattened_size must be tuple of tuples, but found element of type list at pos 0"): |
| nn.Unflatten(dim='features', unflattened_size=(['C', 2], ['W', 5], ['H', 5])) |
| |
| # Wrong type for unflattened_size (tuple of dicts) |
| |
| with self.assertRaisesRegex( |
| TypeError, |
| r"unflattened_size must be tuple of tuples, but found element of type dict at pos 0"): |
| nn.Unflatten(dim='features', unflattened_size=({'C': 2}, {'W': 5}, {'H': 5})) |
| |
| def test_layer_norm_grads_with_create_graph_flag(self): |
| atol = 1e-5 |
| rtol = 1e-3 |
| |
| x = torch.randn((4, 4, 16), requires_grad=True) |
| layer_norm = nn.LayerNorm((16,), 1e-5, True) |
| with torch.no_grad(): |
| layer_norm.weight = torch.nn.Parameter(0.1 * torch.ones_like(layer_norm.weight)) |
| |
| grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0] |
| grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0] |
| |
| self.assertTrue(torch.allclose(grads1, grads2, rtol, atol)) |
| |
| if TEST_CUDA: |
| x = x.to('cuda') |
| layer_norm = layer_norm.to('cuda') |
| |
| grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0] |
| grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0] |
| |
| self.assertTrue(torch.allclose(grads1, grads2, rtol, atol)) |
| |
| |
| class TestNNInit(TestCase): |
| def setUp(self): |
| super(TestNNInit, self).setUp() |
| random.seed(123) |
| |
| def _is_normal(self, tensor, mean, std): |
| samples = tensor.view(-1).tolist() |
| p_value = stats.kstest(samples, 'norm', args=(mean, std))[1] |
| return p_value > 0.0001 |
| |
| def _is_trunc_normal(self, tensor, mean, std, a, b): |
| # scipy's trunc norm is suited for data drawn from N(0, 1), |
| # so we need to transform our data to test it using scipy. |
| z_samples = (tensor.view(-1) - mean) / std |
| z_samples = z_samples.tolist() |
| a0 = (a - mean) / std |
| b0 = (b - mean) / std |
| p_value = stats.kstest(z_samples, 'truncnorm', args=(a0, b0))[1] |
| return p_value > 0.0001 |
| |
| def _is_uniform(self, tensor, a, b): |
| samples = tensor.view(-1).tolist() |
| p_value = stats.kstest(samples, 'uniform', args=(a, (b - a)))[1] |
| return p_value > 0.0001 |
| |
| def _create_random_nd_tensor(self, dims, size_min, size_max): |
| size = [random.randint(size_min, size_max) for _ in range(dims)] |
| tensor = torch.zeros(size) |
| return tensor |
| |
| def _random_float(self, a, b): |
| return (b - a) * random.random() + a |
| |
| def test_calculate_gain_linear(self): |
| for fn in ['linear', 'conv1d', 'conv2d', 'conv3d', 'conv_transpose2d', 'conv_transpose2d', 'conv_transpose3d']: |
| gain = init.calculate_gain(fn) |
| self.assertEqual(gain, 1) |
| |
| def test_calculate_gain_nonlinear(self): |
| for fn in ['sigmoid', 'tanh', 'relu', 'leaky_relu']: |
| gain = init.calculate_gain(fn) |
| if fn == 'sigmoid': |
| self.assertEqual(gain, 1) |
| elif fn == 'tanh': # 5 / 3 |
| self.assertEqual(gain, 1.6666666666666667) |
| elif fn == 'relu': # sqrt(2) |
| self.assertEqual(gain, 1.4142135623730951) |
| elif fn == 'leaky_relu': # sqrt(2 / 1 + slope^2)) |
| self.assertEqual(gain, 1.4141428569978354) |
| elif fn == 'selu': |
| self.assertEqual(gain, 0.75) |
| |
| def test_calculate_gain_leaky_relu(self): |
| for param in [None, 0, 0.01, 10]: |
| gain = init.calculate_gain('leaky_relu', param) |
| if param is None: # Default slope is 0.01 |
| self.assertEqual(gain, 1.4141428569978354) |
| elif param == 0: # No slope = same gain as normal ReLU |
| self.assertEqual(gain, 1.4142135623730951) |
| elif param == 0.01: |
| self.assertEqual(gain, 1.4141428569978354) |
| elif param == 10: |
| self.assertEqual(gain, 0.14071950894605836) |
| |
| def test_calculate_gain_leaky_relu_only_accepts_numbers(self): |
| for param in [True, [1], {'a': 'b'}]: |
| with self.assertRaises(ValueError): |
| init.calculate_gain('leaky_relu', param) |
| |
| def test_calculate_gain_only_accepts_valid_nonlinearities(self): |
| for n in [2, 5, 25]: |
| # Generate random strings of lengths that definitely aren't supported |
| random_string = ''.join([random.choice(string.ascii_lowercase) for i in range(n)]) |
| with self.assertRaises(ValueError): |
| init.calculate_gain(random_string) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_uniform(self): |
| for dims in [1, 2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50) |
| a = self._random_float(-3, 3) |
| b = a + self._random_float(1, 5) |
| init.uniform_(input_tensor, a=a, b=b) |
| assert self._is_uniform(input_tensor, a, b) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_normal(self): |
| for dims in [1, 2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50) |
| mean = self._random_float(-3, 3) |
| std = self._random_float(1, 5) |
| init.normal_(input_tensor, mean=mean, std=std) |
| |
| assert self._is_normal(input_tensor, mean, std) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_trunc_normal(self): |
| for dims in [1, 2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50) |
| mean = self._random_float(-3, 3) |
| std = self._random_float(.01, 1) |
| a = self._random_float(mean - 2 * std, mean) |
| b = self._random_float(mean, mean + 2 * std) |
| init.trunc_normal_(input_tensor, mean=mean, std=std, a=a, b=b) |
| |
| assert self._is_trunc_normal(input_tensor, mean, std, a, b) |
| |
| def test_constant(self): |
| for dims in [1, 2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=5) |
| val = self._random_float(1, 10) |
| init.constant_(input_tensor, val) |
| |
| self.assertEqual(input_tensor, input_tensor.clone().fill_(val)) |
| |
| def test_ones_and_zeros(self): |
| for init_fn_, val in zip([init.ones_, init.zeros_], [1, 0]): |
| for dims in [1, 2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=5) |
| init_fn_(input_tensor) |
| |
| self.assertEqual(input_tensor, input_tensor.clone().fill_(val)) |
| |
| def test_eye(self): |
| input_tensor = self._create_random_nd_tensor(2, size_min=1, size_max=5) |
| init.eye_(input_tensor) |
| |
| # Check every single element |
| for i in range(input_tensor.size(0)): |
| for j in range(input_tensor.size(1)): |
| if i == j: |
| assert input_tensor[i][j] == 1 |
| else: |
| assert input_tensor[i][j] == 0 |
| |
| def test_eye_only_works_on_2d_inputs(self): |
| for dims in [1, 3]: |
| with self.assertRaises(ValueError): |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3) |
| init.eye_(tensor) |
| |
| def test_max_unpool(self): |
| # Test 1D |
| output, indices = F.max_pool1d(torch.randn([1, 1, 4]), 2, stride=2, return_indices=True) |
| self.assertEqual(F.max_unpool1d(output, indices, 2), F.max_unpool1d(output, indices, 2, stride=2)) |
| |
| # Test list / tuple passed as argument to max_unpool1d |
| input = torch.randn([1, 1, 5]) |
| output, indices = F.max_pool1d(input, 2, stride=2, return_indices=True) |
| self.assertEqual(F.max_unpool1d(output, indices, 2, stride=2, output_size=input.shape), |
| F.max_unpool1d(output, indices, 2, stride=2, output_size=input.size())) |
| |
| # Test 2D |
| output, indices = F.max_pool2d(torch.randn([1, 1, 4, 4]), 2, stride=2, return_indices=True) |
| self.assertEqual(F.max_unpool2d(output, indices, 2), F.max_unpool2d(output, indices, 2, stride=2)) |
| |
| # Test 3D |
| output, indices = F.max_pool3d(torch.randn([4, 4, 4, 4, 4]), 2, stride=2, return_indices=True) |
| self.assertEqual(F.max_unpool3d(output, indices, 2), F.max_unpool3d(output, indices, 2, stride=2)) |
| |
| def test_dirac_properties(self): |
| for dims in [3, 4, 5]: |
| for groups in [1, 2, 3]: |
| # prepare random tensor with random sizes, but fits groups |
| a, c, d, e = (random.randint(1, 5) for _ in range(4)) |
| b = random.randint(1, 5 * groups) # same range as a*groups but all range allowed |
| # make sure first dim divides by groups |
| input_tensor = torch.randn((a * groups, b, c, d, e)[:dims]) |
| |
| init.dirac_(input_tensor, groups) |
| |
| c_out, c_in = input_tensor.size(0) // groups, input_tensor.size(1) |
| min_d = min(c_out, c_in) |
| # Check number of nonzeros is equivalent to smallest dim (for each group) |
| assert torch.nonzero(input_tensor).size(0) == min_d * groups |
| # Check sum of values (can have precision issues, hence assertEqual) is also equivalent |
| self.assertEqual(input_tensor.sum(), min_d * groups) |
| |
| |
| def test_dirac_identity(self): |
| for groups in [1, 3]: |
| batch, in_c, out_c, size, kernel_size = 8, 3, 9, 5, 3 # in_c, out_c must divide by groups |
| eff_out_c = out_c // groups |
| |
| # Test 1D |
| input_var = torch.randn(batch, in_c, size) |
| filter_var = torch.zeros(eff_out_c, in_c, kernel_size) |
| filter_var = torch.cat([filter_var] * groups) |
| init.dirac_(filter_var, groups) |
| output_var = F.conv1d(input_var, filter_var) |
| input_tensor, output_tensor = input_var.data, output_var.data # Variables do not support nonzero |
| for g in range(groups): |
| # Assert in_c outputs are preserved (per each group) |
| self.assertEqual(input_tensor[:, :, 1:-1], |
| output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :]) |
| # Assert extra outputs are 0 |
| assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :]).numel() == 0 |
| |
| # Test 2D |
| input_var = torch.randn(batch, in_c, size, size) |
| filter_var = torch.zeros(eff_out_c, in_c, kernel_size, kernel_size) |
| filter_var = torch.cat([filter_var] * groups) |
| init.dirac_(filter_var, groups) |
| output_var = F.conv2d(input_var, filter_var) |
| input_tensor, output_tensor = input_var.data, output_var.data # Variables do not support nonzero |
| for g in range(groups): |
| # Assert in_c outputs are preserved (per each group) |
| self.assertEqual(input_tensor[:, :, 1:-1, 1:-1], |
| output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :, :]) |
| # Assert extra outputs are 0 |
| assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :, :]).numel() == 0 |
| |
| # Test 3D |
| input_var = torch.randn(batch, in_c, size, size, size) |
| filter_var = torch.zeros(eff_out_c, in_c, kernel_size, kernel_size, kernel_size) |
| filter_var = torch.cat([filter_var] * groups) |
| init.dirac_(filter_var, groups) |
| output_var = F.conv3d(input_var, filter_var) |
| input_tensor, output_tensor = input_var.data, output_var.data |
| for g in range(groups): |
| # Assert in_c outputs are preserved (per each group) |
| self.assertEqual(input_tensor[:, :, 1:-1, 1:-1, 1:-1], |
| output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :, :, :]) |
| # Assert extra outputs are 0 |
| assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :, :, :]).numel() == 0 |
| |
| def test_dirac_only_works_on_3_4_5d_inputs(self): |
| for dims in [1, 2, 6]: |
| with self.assertRaises(ValueError): |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3) |
| init.dirac_(tensor) |
| |
| def test_xavier_uniform_errors_on_inputs_smaller_than_2d(self): |
| for dims in [0, 1]: |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1) |
| with self.assertRaises(ValueError): |
| init.xavier_uniform_(tensor) |
| |
| def test_xavier_normal_errors_on_inputs_smaller_than_2d(self): |
| for dims in [0, 1]: |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1) |
| with self.assertRaises(ValueError): |
| init.xavier_normal_(tensor) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_xavier_uniform(self): |
| for use_gain in [True, False]: |
| for dims in [2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25) |
| gain = 1 |
| |
| if use_gain: |
| gain = self._random_float(0.1, 2) |
| init.xavier_uniform_(input_tensor, gain=gain) |
| else: |
| init.xavier_uniform_(input_tensor) |
| |
| fan_in = input_tensor.size(1) |
| fan_out = input_tensor.size(0) |
| if input_tensor.dim() > 2: |
| fan_in *= input_tensor[0, 0].numel() |
| fan_out *= input_tensor[0, 0].numel() |
| |
| expected_std = gain * math.sqrt(2.0 / (fan_in + fan_out)) |
| bounds = expected_std * math.sqrt(3) |
| assert self._is_uniform(input_tensor, -bounds, bounds) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_xavier_normal(self): |
| for use_gain in [True, False]: |
| for dims in [2, 4]: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25) |
| gain = 1 |
| |
| if use_gain: |
| gain = self._random_float(0.1, 2) |
| init.xavier_normal_(input_tensor, gain=gain) |
| else: |
| init.xavier_normal_(input_tensor) |
| |
| fan_in = input_tensor.size(1) |
| fan_out = input_tensor.size(0) |
| if input_tensor.dim() > 2: |
| fan_in *= input_tensor[0, 0].numel() |
| fan_out *= input_tensor[0, 0].numel() |
| |
| expected_std = gain * math.sqrt(2.0 / (fan_in + fan_out)) |
| assert self._is_normal(input_tensor, 0, expected_std) |
| |
| def test_kaiming_uniform_errors_on_inputs_smaller_than_2d(self): |
| for dims in [0, 1]: |
| with self.assertRaises(ValueError): |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1) |
| init.kaiming_uniform_(tensor) |
| |
| def test_kaiming_normal_errors_on_inputs_smaller_than_2d(self): |
| for dims in [0, 1]: |
| with self.assertRaises(ValueError): |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1) |
| init.kaiming_normal_(tensor) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_kaiming_uniform(self): |
| for use_a in [True, False]: |
| for dims in [2, 4]: |
| for mode in ['fan_in', 'fan_out']: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25) |
| if use_a: |
| a = self._random_float(0.1, 2) |
| init.kaiming_uniform_(input_tensor, a=a, mode=mode) |
| else: |
| a = 0 |
| init.kaiming_uniform_(input_tensor, mode=mode) |
| |
| fan_in = input_tensor.size(1) |
| fan_out = input_tensor.size(0) |
| if input_tensor.dim() > 2: |
| fan_in *= input_tensor[0, 0].numel() |
| fan_out *= input_tensor[0, 0].numel() |
| |
| if mode == 'fan_in': |
| n = fan_in |
| else: |
| n = fan_out |
| |
| expected_std = math.sqrt(2.0 / ((1 + a**2) * n)) |
| bounds = expected_std * math.sqrt(3.0) |
| assert self._is_uniform(input_tensor, -bounds, bounds) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_kaiming_normal(self): |
| for use_a in [True, False]: |
| for dims in [2, 4]: |
| for mode in ['fan_in', 'fan_out']: |
| input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25) |
| if use_a: |
| a = self._random_float(0.1, 2) |
| init.kaiming_normal_(input_tensor, a=a, mode=mode) |
| else: |
| a = 0 |
| init.kaiming_normal_(input_tensor, mode=mode) |
| |
| fan_in = input_tensor.size(1) |
| fan_out = input_tensor.size(0) |
| if input_tensor.dim() > 2: |
| fan_in *= input_tensor[0, 0].numel() |
| fan_out *= input_tensor[0, 0].numel() |
| |
| if mode == 'fan_in': |
| n = fan_in |
| else: |
| n = fan_out |
| |
| expected_std = math.sqrt(2.0 / ((1 + a**2) * n)) |
| assert self._is_normal(input_tensor, 0, expected_std) |
| |
| def test_sparse_only_works_on_2d_inputs(self): |
| for dims in [1, 3]: |
| with self.assertRaises(ValueError): |
| sparsity = self._random_float(0.1, 0.9) |
| tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3) |
| init.sparse_(tensor, sparsity) |
| |
| @unittest.skipIf(not TEST_SCIPY, "Scipy not found.") |
| def test_sparse_default_std(self): |
| for use_random_std in [True, False]: |
| input_tensor = self._create_random_nd_tensor(2, size_min=30, size_max=35) |
| rows, cols = input_tensor.size(0), input_tensor.size(1) |
| sparsity = self._random_float(0.1, 0.2) |
| |
| std = 0.01 # default std |
| if use_random_std: |
| std = self._random_float(0.01, 0.2) |
| init.sparse_(input_tensor, sparsity=sparsity, std=std) |
| else: |
| init.sparse_(input_tensor, sparsity=sparsity) |
| |
| for col_idx in range(input_tensor.size(1)): |
| column = input_tensor[:, col_idx] |
| assert column[column == 0].nelement() >= math.ceil(sparsity * rows) |
| |
| assert self._is_normal(input_tensor[input_tensor != 0], 0, std) |
| |
| @skipIfNoLapack |
| def test_orthogonal(self): |
| for use_gain in [True, False]: |
| for tensor_size in [[3, 4], [4, 3], [20, 2, 3, 4], [2, 3, 4, 5]]: |
| input_tensor = torch.zeros(tensor_size) |
| gain = 1.0 |
| |
| if use_gain: |
| gain = self._random_float(0.1, 2) |
| init.orthogonal_(input_tensor, gain=gain) |
| else: |
| init.orthogonal_(input_tensor) |
| |
| rows, cols = tensor_size[0], reduce(mul, tensor_size[1:]) |
| flattened_tensor = input_tensor.view(rows, cols) |
| if rows > cols: |
| self.assertEqual(torch.mm(flattened_tensor.t(), flattened_tensor), |
| torch.eye(cols) * gain ** 2, atol=1e-6, rtol=0) |
| else: |
| self.assertEqual(torch.mm(flattened_tensor, flattened_tensor.t()), |
| torch.eye(rows) * gain ** 2, atol=1e-6, rtol=0) |
| |
| def test_deprecation(self): |
| x = torch.randn(3, 3) |
| |
| def fn(): |
| init.normal(x) |
| |
| with self.assertWarnsRegex(UserWarning, 'deprecated', msg='methods not suffixed with underscore should be deprecated'): |
| fn() |
| |
| class TestFusionEval(TestCase): |
| @given(X=hu.tensor(shapes=((5, 3, 5, 5),)), |
| running_mean=hu.tensor(shapes=(6,)), |
| running_var=hu.tensor(shapes=(6,))) |
| def test_fuse_module_eval_numerics(self, X, running_mean, running_var): |
| inputs, _ = X |
| |
| iC, oC = inputs.shape[1], len(running_mean[0]) |
| inputs = torch.from_numpy(inputs).to(torch.double) |
| kernel_size = (3, 3) |
| |
| conv_ref = torch.nn.Conv2d(iC, oC, bias=True, kernel_size=kernel_size) |
| bn_ref = torch.nn.BatchNorm2d(oC) |
| bn_ref.running_mean = torch.from_numpy(running_mean[0]).to(torch.double) |
| bn_ref.running_var = torch.from_numpy(running_var[0]).to(torch.double) |
| |
| conv_ref.eval() |
| bn_ref.eval() |
| |
| Y_ref = bn_ref(conv_ref(inputs)) |
| conv_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref, |
| bn_ref) |
| Y_hat = conv_bn_fused(inputs) |
| |
| self.assertEqual(Y_ref, Y_hat, msg="Conv+BN fusion results are off") |
| |
| na_bn_ref = torch.nn.BatchNorm2d(oC, affine=False) |
| na_bn_ref.running_mean = torch.from_numpy(running_mean[0]).to(torch.double) |
| na_bn_ref.running_var = torch.from_numpy(running_var[0]).to(torch.double) |
| na_bn_ref.eval() |
| |
| Y_ref = na_bn_ref(conv_ref(inputs)) |
| conv_na_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref, |
| na_bn_ref) |
| Y_hat = conv_na_bn_fused(inputs) |
| |
| self.assertEqual(Y_ref, Y_hat, msg="Conv+BN(non-affine) fusion results are off") |
| |
| |
| class TestConstantPadNd(TestCase): |
| def test_constant_pad_nd(self): |
| a = torch.tensor([[1, 2], [3, 4]]) |
| res = torch.constant_pad_nd(a, [1, 2, 1, 0], 9) |
| expected = torch.tensor([ |
| [9, 9, 9, 9, 9], |
| [9, 1, 2, 9, 9], |
| [9, 3, 4, 9, 9] |
| ]) |
| self.assertEqual(res, expected) |
| |
| def test_preserves_memory_format(self): |
| nchw_tensor = torch.rand((1, 2, 5, 3)) |
| nchw_padded = torch.constant_pad_nd(nchw_tensor, [1, 2], 0.5) |
| self.assertTrue(nchw_padded.is_contiguous(memory_format=torch.contiguous_format)) |
| |
| nhwc_tensor = nchw_tensor.contiguous(memory_format=torch.channels_last) |
| nhwc_padded = torch.constant_pad_nd(nhwc_tensor, [1, 2], 0.5) |
| self.assertTrue(nhwc_padded.is_contiguous(memory_format=torch.channels_last)) |
| |
| |
| class TestAddRelu(TestCase): |
| def test_add_relu(self): |
| a = torch.rand((7, 11)) |
| b = torch.rand((7, 11)) |
| a = a.float() |
| b = b.float() |
| a = a * -10 |
| a = a + 5 |
| add_res = a + b |
| relu_res = torch.relu(add_res) |
| add_relu_res = torch._VF._add_relu(a, b) |
| |
| self.assertTrue(torch.allclose(add_relu_res, relu_res)) |
| |
| |
| def add_test(test, decorator=None): |
| def add(test_name, fn): |
| if hasattr(TestNN, test_name): |
| raise RuntimeError('Found two tests with the same name: ' + test_name) |
| if decorator is not None: |
| fn = decorator(fn) |
| setattr(TestNN, test_name, fn) |
| |
| test_name = test.get_name() |
| if not hasattr(test, 'test_cpu') or test.test_cpu: |
| add(test_name, lambda self, test=test: test(self)) |
| cuda_test_name = test_name + '_cuda' |
| # With dtype enable, it's good enough to test against three floating types |
| kwargs = {} |
| if 'extra_args' in get_function_arglist(test.test_cuda): |
| kwargs['extra_args'] = test.extra_args |
| |
| if 'dtype' in get_function_arglist(test.test_cuda): |
| if tf32_is_not_fp32() and test.with_tf32: |
| |
| def with_tf32_off(self, test=test, kwargs=kwargs): |
| with tf32_off(): |
| test.test_cuda(self, dtype=torch.float, **kwargs) |
| |
| add(cuda_test_name + '_fp32', with_tf32_off) |
| |
| def with_tf32_on(self, test=test, kwargs=kwargs): |
| with tf32_on(self, test.tf32_precision): |
| test.test_cuda(self, dtype=torch.float, **kwargs) |
| |
| add(cuda_test_name + '_tf32', with_tf32_on) |
| else: |
| add(cuda_test_name + '_float', lambda self, |
| test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.float, **kwargs)) |
| add(cuda_test_name + '_double', lambda self, |
| test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.double, **kwargs)) |
| |
| def test_half(self, test=test, kwargs=kwargs): |
| test.test_cuda(self, dtype=torch.half, **kwargs) |
| if getattr(test, 'check_half', True): |
| add(cuda_test_name + '_half', test_half) |
| |
| def test_bfloat16(self, test=test, kwargs=kwargs): |
| test.test_cuda(self, dtype=torch.bfloat16, **kwargs) |
| if getattr(test, 'check_bfloat16', True): |
| add(cuda_test_name + '_bfloat16', test_bfloat16) |
| |
| def test_cfloat(self, test=test, kwargs=kwargs): |
| test.test_cuda(self, dtype=torch.cfloat, **kwargs) |
| |
| def test_cdouble(self, test=test, kwargs=kwargs): |
| test.test_cuda(self, dtype=torch.cdouble, **kwargs) |
| if getattr(test, 'check_complex', False): |
| add(cuda_test_name + '_cfloat', test_cfloat) |
| add(cuda_test_name + '_cdouble', test_cdouble) |
| |
| else: |
| if tf32_is_not_fp32() and test.with_tf32: |
| |
| def with_tf32_off(self, test=test, kwargs=kwargs): |
| with tf32_off(): |
| test.test_cuda(self, **kwargs) |
| |
| add(cuda_test_name + '_fp32', with_tf32_off) |
| |
| def with_tf32_on(self, test=test, kwargs=kwargs): |
| with tf32_on(self, test.tf32_precision): |
| test.test_cuda(self, **kwargs) |
| |
| add(cuda_test_name + '_tf32', with_tf32_on) |
| else: |
| add(cuda_test_name, lambda self, test=test, kwargs=kwargs: test.test_cuda(self, **kwargs)) |
| |
| for test_params in module_tests + new_module_tests: |
| # TODO: CUDA is not implemented yet |
| if 'constructor' not in test_params: |
| name = test_params.pop('module_name') |
| test_params['constructor'] = getattr(nn, name) |
| decorator = test_params.pop('decorator', None) |
| test = NewModuleTest(**test_params) |
| add_test(test, decorator) |
| if 'check_eval' in test_params: |
| # create a new test that is identical but that sets module.training to False |
| desc = test_params.get('desc', None) |
| test_params['desc'] = 'eval' if desc is None else desc + '_eval' |
| |
| def gen_eval_constructor(constructor): |
| def eval_constructor(*args, **kwargs): |
| cons = constructor(*args, **kwargs) |
| cons.training = False |
| return cons |
| eval_constructor.__name__ = constructor.__name__ |
| return eval_constructor |
| |
| test_params['constructor'] = gen_eval_constructor(test_params['constructor']) |
| test = NewModuleTest(**test_params) |
| add_test(test, decorator) |
| if 'check_with_long_tensor' in test_params: |
| fullname = test_params.get('fullname', None) |
| if fullname: |
| test_params['fullname'] = fullname + '_with_long_tensor' |
| else: |
| desc = test_params.get('desc', None) |
| test_params['desc'] = 'with_long_tensor' if desc is None else desc + '_with_long_tensor' |
| |
| def double_equivalent_of_long_tensor(size): |
| return torch.randint(-1000, 1000, size=size).double() |
| |
| def apply_to_cons(t): |
| if t.is_floating_point(): |
| if isinstance(t, Parameter): |
| return Parameter(double_equivalent_of_long_tensor(t.size())) |
| elif isinstance(t, torch.Tensor): |
| return double_equivalent_of_long_tensor(t.size()) |
| else: |
| return t |
| |
| def gen_long_tensor_constructor(constructor): |
| def long_tensor_constructor(*args, **kwargs): |
| cons = constructor(*args, **kwargs) |
| cons._apply(apply_to_cons) |
| return cons |
| long_tensor_constructor.__name__ = constructor.__name__ |
| return long_tensor_constructor |
| |
| def gen_long_tensor_input(input_size): |
| def input_func(): |
| return double_equivalent_of_long_tensor(input_size) |
| return input_func |
| |
| def reference_fn(i, p, m): |
| # For bad reasons this would create LongTensors that requires gradients |
| # Remove requires_grad to avoid this |
| for p in m.parameters(): |
| p.requires_grad_(False) |
| m._apply(lambda t: t.long()) |
| input = i.long() |
| out = m.forward(input) |
| return out |
| |
| test_params['constructor'] = gen_long_tensor_constructor(test_params['constructor']) |
| test_params['input_fn'] = gen_long_tensor_input(test_params['input_size']) |
| test_params['reference_fn'] = reference_fn |
| test_params['check_forward_only'] = True |
| # Currently we don't support conv2d/conv3d for LongTensor in CUDA |
| test_params['test_cuda'] = False |
| test = NewModuleTest(**test_params) |
| |
| add_test(test, decorator) |
| |
| for test_params in criterion_tests: |
| name = test_params.pop('module_name') |
| test_params['constructor'] = getattr(nn, name) |
| test = CriterionTest(**test_params) |
| decorator = test_params.pop('decorator', None) |
| add_test(test, decorator) |
| if 'check_sum_reduction' in test_params: |
| desc = test_params.get('desc', None) |
| test_params['desc'] = 'sum_reduction' if desc is None else desc + '_sum_reduction' |
| |
| def gen_sum_reduction_constructor(constructor): |
| def sum_reduction_constructor(*args, **kwargs): |
| cons = constructor(*args, reduction='sum', **kwargs) |
| return cons |
| sum_reduction_constructor.__name__ = constructor.__name__ |
| return sum_reduction_constructor |
| |
| test_params['constructor'] = gen_sum_reduction_constructor(test_params['constructor']) |
| test = CriterionTest(**test_params) |
| add_test(test, decorator) |
| |
| |
| class UnpoolingNet(nn.Module): |
| def __init__(self, pool, unpool): |
| super(UnpoolingNet, self).__init__() |
| self.pool = pool |
| self.unpool = unpool |
| |
| def forward(self, input): |
| return self.unpool(*self.pool(input)) |
| |
| |
| add_test(NewModuleTest( |
| constructor=lambda: UnpoolingNet( |
| nn.MaxPool1d(2, return_indices=True), |
| nn.MaxUnpool1d(2)), |
| input_size=(1, 1, 4), |
| fullname='MaxUnpool1d_net',)) |
| add_test(NewModuleTest( |
| constructor=lambda: UnpoolingNet( |
| nn.MaxPool2d(2, return_indices=True), |
| nn.MaxUnpool2d(2)), |
| input_size=(1, 1, 2, 4), |
| fullname='MaxUnpool2d_net',)) |
| add_test(NewModuleTest( |
| constructor=lambda: UnpoolingNet( |
| nn.MaxPool3d(2, return_indices=True), |
| nn.MaxUnpool3d(2)), |
| input_size=(1, 1, 2, 4, 6), |
| fullname='MaxUnpool3d_net', |
| check_gradgrad=False,)) |
| |
| |
| class _AdaptiveLogSoftmaxWithLoss(nn.AdaptiveLogSoftmaxWithLoss): |
| def __call__(self, input): |
| t = torch.tensor([0, 1, 4, 8]).to(input.device) |
| return nn.AdaptiveLogSoftmaxWithLoss.__call__(self, input, t).output |
| |
| add_test(NewModuleTest( |
| constructor=lambda: _AdaptiveLogSoftmaxWithLoss(16, 10, [2, 6]), |
| input_size=(4, 16), |
| fullname='AdaptiveLogSoftmax', |
| with_tf32=True, |
| tf32_precision=0.005)) |
| |
| |
| # The following are helpers for TestNN.test_affine_* |
| if torch.cuda.is_available(): |
| def device_(): |
| return ['cpu', 'cuda'] |
| else: |
| def device_(): |
| return ['cpu'] |
| |
| |
| def angle_rad_(): |
| return [r * math.pi * 2 for r in [0.0, 0.5, 0.25, 0.125, random.random()]] |
| |
| |
| def axis_vector_(): |
| t = (random.random(), random.random(), random.random()) |
| l = sum(x ** 2 for x in t) ** 0.5 |
| |
| return [(1.0, 0.0, 0.0), (0.0, 1.0, 0.0), (0.0, 0.0, 1.0), tuple(x / l for x in t)] |
| |
| |
| def input_size2d_(): |
| return [[1, 1, 3, 5], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 3, 4]] |
| |
| |
| def output_size2d_(): |
| return [[1, 1, 5, 3], [1, 1, 3, 5], [1, 1, 4, 3], [1, 1, 5, 5], [1, 1, 6, 6]] |
| |
| |
| def input_size2dsq_(): |
| return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 6, 6]] |
| |
| |
| def output_size2dsq_(): |
| return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 5, 5], [1, 1, 6, 6]] |
| |
| |
| def input_size3d_(): |
| return [[1, 1, 2, 2, 2], [1, 1, 2, 3, 4], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 3, 4, 5]] |
| |
| |
| def input_size3dsq_(): |
| return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 6, 6, 6]] |
| |
| |
| def output_size3dsq_(): |
| return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]] |
| |
| |
| def output_size3d_(): |
| return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 3, 4, 5], [1, 1, 4, 3, 2], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]] |
| |
| |
| def _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad): |
| input_center = [(x - 1) / 2.0 for x in input_size] |
| output_center = [(x - 1) / 2.0 for x in output_size] |
| |
| s = math.sin(angle_rad) |
| c = math.cos(angle_rad) |
| |
| intrans_ary = np.array([ |
| [1, 0, input_center[2]], |
| [0, 1, input_center[3]], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| inscale_ary = np.array([ |
| [input_center[2], 0, 0], |
| [0, input_center[3], 0], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| rotation_ary = np.array([ |
| [c, -s, 0], |
| [s, c, 0], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| outscale_ary = np.array([ |
| [1.0 / output_center[2], 0, 0], |
| [0, 1.0 / output_center[3], 0], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| outtrans_ary = np.array([ |
| [1, 0, -output_center[2]], |
| [0, 1, -output_center[3]], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| reorder_ary = np.array([ |
| [0, 1, 0], |
| [1, 0, 0], |
| [0, 0, 1], |
| ], dtype=np.float64) |
| |
| transform_ary = np.dot(np.dot(np.dot(np.dot( |
| intrans_ary, |
| inscale_ary), |
| rotation_ary.T), |
| outscale_ary), |
| outtrans_ary) |
| grid_ary = np.dot(np.dot(np.dot(reorder_ary, rotation_ary.T), outscale_ary), outtrans_ary) |
| |
| transform_tensor = torch.from_numpy((rotation_ary)).to(device, torch.float32) |
| transform_tensor = transform_tensor[:2].unsqueeze(0) |
| |
| return transform_tensor, transform_ary, grid_ary |
| |
| |
| def _buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector): |
| input_center = [(x - 1) / 2.0 for x in input_size] |
| output_center = [(x - 1) / 2.0 for x in output_size] |
| |
| s = math.sin(angle_rad) |
| c = math.cos(angle_rad) |
| c1 = 1 - c |
| |
| intrans_ary = np.array([ |
| [1, 0, 0, input_center[2]], |
| [0, 1, 0, input_center[3]], |
| [0, 0, 1, input_center[4]], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| inscale_ary = np.array([ |
| [input_center[2], 0, 0, 0], |
| [0, input_center[3], 0, 0], |
| [0, 0, input_center[4], 0], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| l, m, n = axis_vector |
| scipyRotation_ary = np.array([ |
| [l * l * c1 + c, m * l * c1 - n * s, n * l * c1 + m * s, 0], |
| [l * m * c1 + n * s, m * m * c1 + c, n * m * c1 - l * s, 0], |
| [l * n * c1 - m * s, m * n * c1 + l * s, n * n * c1 + c, 0], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| z, y, x = axis_vector |
| torchRotation_ary = np.array([ |
| [x * x * c1 + c, y * x * c1 - z * s, z * x * c1 + y * s, 0], |
| [x * y * c1 + z * s, y * y * c1 + c, z * y * c1 - x * s, 0], |
| [x * z * c1 - y * s, y * z * c1 + x * s, z * z * c1 + c, 0], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| outscale_ary = np.array([ |
| [1.0 / output_center[2], 0, 0, 0], |
| [0, 1.0 / output_center[3], 0, 0], |
| [0, 0, 1.0 / output_center[4], 0], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| outtrans_ary = np.array([ |
| [1, 0, 0, -output_center[2]], |
| [0, 1, 0, -output_center[3]], |
| [0, 0, 1, -output_center[4]], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| reorder_ary = np.array([ |
| [0, 0, 1, 0], |
| [0, 1, 0, 0], |
| [1, 0, 0, 0], |
| [0, 0, 0, 1], |
| ], dtype=np.float64) |
| |
| transform_ary = np.dot(np.dot(np.dot(np.dot( |
| intrans_ary, |
| inscale_ary), |
| np.linalg.inv(scipyRotation_ary)), |
| outscale_ary), |
| outtrans_ary) |
| grid_ary = np.dot(np.dot(np.dot(reorder_ary, np.linalg.inv(scipyRotation_ary)), outscale_ary), outtrans_ary) |
| |
| transform_tensor = torch.from_numpy((torchRotation_ary)).to(device, torch.float32) |
| transform_tensor = transform_tensor[:3].unsqueeze(0) |
| |
| return transform_tensor, transform_ary, grid_ary |
| # end TestNN.test_affine_* helpers |
| |
| |
| class TestNNDeviceType(NNTestCase): |
| def _test_dropout(self, cls, device, input, memory_format=torch.contiguous_format): |
| p = 0.2 |
| input = input.to(device).fill_(1 - p) |
| |
| module = cls(p) |
| input_var = input.clone(memory_format=memory_format).requires_grad_() |
| output = module(input_var) |
| self.assertTrue(output.is_contiguous(memory_format=memory_format)) |
| self.assertLess(abs(output.data.mean() - (1 - p)), 0.05) |
| output.backward(input) |
| self.assertTrue(input_var.grad.is_contiguous(memory_format=memory_format)) |
| self.assertLess(abs(input_var.grad.data.mean() - (1 - p)), 0.05) |
| |
| module = cls(p, True) |
| input_var = input.clone(memory_format=memory_format).requires_grad_() |
| output = module(input_var + 0) |
| self.assertTrue(output.is_contiguous(memory_format=memory_format)) |
| self.assertLess(abs(output.data.mean() - (1 - p)), 0.05) |
| output.backward(input) |
| self.assertTrue(input_var.grad.is_contiguous(memory_format=memory_format)) |
| self.assertLess(abs(input_var.grad.data.mean() - (1 - p)), 0.05) |
| |
| # check eval mode doesn't change anything |
| for inplace in [True, False]: |
| module = cls(p, inplace).eval() |
| self.assertEqual(input, module(input)) |
| |
| # Check that these don't raise errors |
| module.__repr__() |
| str(module) |
| |
| def _test_dropout_discontiguous(self, cls, device, memory_format=torch.contiguous_format): |
| # In this test, we verify that dropout preserves the layout and data for different memory formats. |
| # We check whether, we get same values for the output of dropout, when the probability |
| # of dropout is 0 or very close to 0. |
| # Reference: https://github.com/pytorch/pytorch/issues/47176 |
| close_to_zero_p = 1e-10 # Should be almost zero but not zero, as for p=0 different path is taken |
| for p in [0, close_to_zero_p]: |
| inp = torch.ones(2, 3, 3, 3, device=device) |
| inp_discontiguous = torch.empty(2, 3, 3, 6, device=device, memory_format=memory_format)[..., ::2] |
| inp_discontiguous.copy_(inp) |
| mod = cls(p=p) |
| out = mod(inp_discontiguous) |
| if p != 0: # Zero will keep strides as is based on input. |
| # When prob == 0, input stride (54, 18, 6, 2) -> output stride (54, 18, 6, 2) |
| # When prob != 0, input stride (54, 18, 6, 2) -> output stride (27, 9, 3, 1) |
| self.assertTrue(out.is_contiguous(memory_format=memory_format)) |
| self.assertEqual(inp_discontiguous, out) |
| |
| def _test_dropout_stride_mean_preserve(self, cls, device): |
| def invert_perm(p): |
| d = {x: i for i, x in enumerate(p)} |
| return (d[0], d[1], d[2], d[3]) |
| |
| inp = torch.ones(2, 3, 4, 5, device=device) |
| shifts = [(0, 0), (1, 0), (0, 1), (1, 1)] |
| for perm in itertools.permutations((0, 1, 2, 3), r=4): |
| for shift in shifts: |
| for p in [1e-10, 0.3, 0.5, 0.7]: |
| mod = cls(p=p) |
| permuted_inp = inp.permute(perm).contiguous().permute(invert_perm(perm)) |
| permuted_inp = permuted_inp[shift[0]:, shift[1]:, :, :] |
| out = mod(permuted_inp) |
| |
| self.assertTrue(out.permute(perm).is_contiguous()) |
| self.assertEqual(inp.mean(), out.mean(), rtol=0.5, atol=0.5) |
| if p == 1e-10: |
| self.assertEqual(permuted_inp, out) |
| else: |
| self.assertNotEqual(permuted_inp, out) |
| |
| def _test_InstanceNorm_general(self, cls, input, device, dtype=torch.float): |
| # default case track_running_stats=False |
| b, c = input.size(0), input.size(1) |
| input_var = input.to(device=device, dtype=dtype).requires_grad_() |
| |
| IN = cls(c, eps=0).to(device, dtype) |
| |
| output = IN(input_var) |
| out_reshaped = output.view(b * c, -1) |
| |
| mean = out_reshaped.mean(1) |
| var = out_reshaped.var(1, unbiased=False) |
| |
| self.assertEqual(torch.abs(mean.data).mean(), 0, atol=1e-5, rtol=0) |
| self.assertEqual(torch.abs(var.data).mean(), 1, atol=1e-5, rtol=0) |
| |
| # check that eval mode doesn't change behavior |
| grad_out = torch.randn_like(output) |
| res1 = output.data.clone() |
| output.backward(grad_out) |
| grad1 = input_var.grad.data.clone() |
| |
| IN.eval() |
| output = IN(input_var) |
| input_var.grad = None |
| output.backward(grad_out) |
| res2 = output.data |
| grad2 = input_var.grad.data |
| self.assertEqual(res1, res2) |
| self.assertEqual(grad1, grad2) |
| |
| # If track_running_stats=True and momentum=1, running_mean/var should be |
| # equal to mean/var of the input (with unbias correction) |
| IN = cls(c, momentum=1, eps=0, track_running_stats=True).to(device, dtype) |
| |
| output = IN(input_var) |
| |
| input_reshaped = input_var.transpose(1, 0).reshape(c, -1) |
| mean = input_reshaped.mean(1) |
| |
| input_reshaped = input_var.transpose(1, 0).reshape(c, b, -1) |
| var = input_reshaped.var(2, unbiased=True)[:, :] |
| |
| self.assertEqual(torch.abs(mean.data - IN.running_mean).mean(), 0, atol=1e-5, rtol=0) |
| self.assertEqual(torch.abs(var.data.mean(1) - IN.running_var).mean(), 0, atol=1e-5, rtol=0) |
| |
| # in eval mode, adding X * std to a channel in input should make the |
| # corresponding channel in output have mean X |
| IN.eval() |
| delta = IN.running_var.sqrt() * torch.arange(c, device=device, dtype=dtype) |
| delta = delta.view(-1, *[1 for _ in range(2, input.dim())]) |
| output = IN(input_var + delta) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(output.transpose(0, 1).reshape(c, -1).mean(1), torch.arange(c)) |
| |
| def _test_InstanceNorm_cuda_half(self, cls, input, device): |
| # THNN |
| input = input.to(device=device, dtype=torch.half).random_(1, 10).requires_grad_(True) |
| m = cls(input.size(1), affine=True, track_running_stats=True).to(device, torch.half) |
| thnn_output = m(input) |
| thnn_output.sum().backward() |
| thnn_input_grad = input.grad.data.clone() |
| self.assertEqualTypeString(thnn_output, input) |
| # cuDNN |
| if TEST_CUDNN: |
| input.grad = None |
| m = m.float() |
| cudnn_output = m(input) |
| cudnn_output.sum().backward() |
| cudnn_input_grad = input.grad.data.clone() |
| self.assertEqualTypeString(cudnn_output, input) |
| self.assertEqual(cudnn_output, thnn_output, atol=1e-4, rtol=0) |
| self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0) |
| |
| def _test_LayerNorm_general(self, device, dtype=torch.float): |
| for i in range(2, 6): |
| shape = torch.randint(3, 6, (i,), dtype=torch.long).tolist() |
| x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10) |
| normalized_ndim = random.randint(1, i - 1) # inclusive |
| normalized_shape = shape[-normalized_ndim:] |
| unnormalized_shape = shape[:-normalized_ndim] |
| |
| # test that LN normalizes to mean 0 and stddev 1 |
| ln = nn.LayerNorm(normalized_shape, eps=0).to(device, dtype) |
| ln.weight.data.fill_(1) |
| ln.bias.data.fill_(0) |
| output = ln(x) |
| out_reshaped = output.view(*(unnormalized_shape + [-1])) |
| mean = out_reshaped.mean(-1) |
| var = out_reshaped.var(-1, unbiased=False) |
| |
| delta = 1e-1 if dtype == torch.bfloat16 else 1e-5 |
| self.assertEqual(torch.abs(mean.data).mean(), 0, atol=delta, rtol=0) |
| self.assertEqual(torch.abs(var.data).mean(), 1, atol=delta, rtol=0) |
| |
| # test that LN applies weight and bias correctly |
| scale, bias = torch.empty(2).uniform_(0.2, 2).tolist() |
| ln.weight.data.fill_(scale) |
| ln.bias.data.fill_(bias) |
| output = ln(x) |
| out_reshaped = output.view(*(unnormalized_shape + [-1])) |
| mean = out_reshaped.mean(-1) |
| var = out_reshaped.var(-1, unbiased=False) |
| self.assertEqual(torch.abs(mean.data).mean(), bias, atol=delta, rtol=0) |
| self.assertEqual(torch.abs(var.data).mean(), scale ** 2, atol=delta, rtol=0) |
| |
| bad_norm_shape_input_shape = { |
| (): (), |
| (2, 3): (3,), |
| (2,): (1, 2, 3), |
| (10,): (2, 3), |
| 10: (2, 3), |
| } |
| for norm_shape, input_shape in bad_norm_shape_input_shape.items(): |
| ln = nn.LayerNorm(norm_shape) |
| input = torch.empty(input_shape, device=device, dtype=dtype).uniform_(0, 10) |
| self.assertRaises(RuntimeError, lambda: ln(input)) |
| |
| def _test_LayerNorm_cuda_half(self, device): |
| input = torch.empty(2, 3, 3, 2, device=device, dtype=torch.half).random_(1, 10).requires_grad_(True) |
| m = nn.LayerNorm([3, 2]).to(device, torch.half) |
| output = m(input) |
| output.sum().backward() |
| self.assertEqualTypeString(output, input) |
| |
| def _test_GroupNorm_general(self, device, dtype=torch.float): |
| good_shape_g = { |
| (1, 2, 3, 4): 2, |
| (2, 3, 10): 3, |
| (3, 1, 1, 1, 2): 1, |
| (2, 6, 4, 2, 2): 3, |
| (1, 256, 1, 1): 32, |
| } |
| for shape_g, grad in product(good_shape_g.items(), [True, False]): |
| shape, g = shape_g |
| x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10) |
| x.requires_grad_(grad) |
| b = shape[0] |
| c = shape[1] |
| |
| # test that GN normalizes to mean 0 and stddev 1 |
| gn = nn.GroupNorm(g, c, eps=0).to(device, dtype) |
| gn.weight.data.fill_(1) |
| gn.bias.data.fill_(0) |
| output = gn(x) |
| out_reshaped = output.view(b, g, -1) |
| mean = out_reshaped.mean(-1) |
| var = out_reshaped.var(-1, unbiased=False) |
| # TODO: fix numerical issue. See #44863 |
| self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-3, rtol=1e-3) |
| self.assertEqual(torch.abs(var).mean(), 1, atol=1e-3, rtol=1e-3) |
| |
| output.backward(torch.randn_like(output)) |
| if output.is_cuda: |
| torch.cuda.synchronize() |
| |
| # test that GN applies weight and bias correctly |
| scale = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2) |
| bias = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2) |
| gn.weight.data.copy_(scale) |
| gn.bias.data.copy_(bias) |
| output = gn(x) |
| out_reshaped = output.view(b, c, -1) |
| out_normed = (out_reshaped - bias.view(c, 1)) / scale.view(c, 1) |
| out_normed_reshaped = out_normed.view(b, g, -1) |
| mean = out_normed_reshaped.mean(-1) |
| var = out_normed_reshaped.var(-1, unbiased=False) |
| # TODO: fix numerical issue. See #44863 |
| self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-3, rtol=1e-3) |
| self.assertEqual(torch.abs(var).mean(), 1, atol=1e-3, rtol=1e-3) |
| |
| bad_shape_g = { |
| (1, 2, 3, 4): 3, |
| (2, 3, 10): 2, |
| (3, 1, 1, 1, 2): 10, |
| (2, 6, 4, 2, 2): 4, |
| } |
| for shape, g in bad_shape_g.items(): |
| gn = nn.GroupNorm(g, shape[1]) |
| input = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10) |
| self.assertRaises(RuntimeError, lambda: gn(input)) |
| |
| def _test_GroupNorm_cuda_half(self): |
| input = torch.zeros(2, 4, 3, 2, requires_grad=True).cuda().half().random_(1, 10) |
| m = nn.GroupNorm(2, 4).to("cuda", torch.half) |
| output = m(input) |
| output.sum().backward() |
| self.assertEqualTypeString(output, input) |
| |
| def _test_module_empty_input(self, module, inp, check_size=True): |
| inp.requires_grad_(True) |
| out = module(inp) |
| gO = torch.rand_like(out) |
| out.backward(gO) |
| if check_size: |
| self.assertEqual(out.size(), inp.size()) |
| for p in module.parameters(): |
| if p.requires_grad: |
| self.assertEqual(p.grad, torch.zeros_like(p.grad)) |
| self.assertEqual(inp.grad, torch.zeros_like(inp)) |
| |
| @unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'), |
| "Scipy v1.0 and/or numpy not found") |
| @tf32_on_and_off() |
| def test_affine_2d_rotate0(self, device): |
| # scipy before 1.0.0 do not support homogeneous coordinate |
| # scipy.ndimage.affine_transform, so we need to skip. |
| input_size = [1, 1, 3, 3] |
| input_ary = np.array(np.random.random(input_size), dtype=np.float32) |
| output_size = [1, 1, 5, 5] |
| angle_rad = 0. |
| |
| transform_tensor, transform_ary, offset = \ |
| _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad) |
| |
| scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform( |
| input_ary[0, 0], |
| transform_ary, |
| offset=offset, |
| output_shape=output_size[2:], |
| order=1, |
| mode='nearest', |
| prefilter=False)) |
| |
| affine_tensor = torch.nn.functional.affine_grid( |
| transform_tensor, |
| torch.Size(output_size), |
| align_corners=True |
| ) |
| |
| gridsample_ary = torch.nn.functional.grid_sample( |
| torch.tensor(input_ary, device=device).to(device), |
| affine_tensor, |
| padding_mode='border', |
| align_corners=True |
| ).to('cpu') |
| |
| self.assertEqual(scipy_ary.mean(), gridsample_ary.mean()) |
| self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary)) |
| |
| @unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'), |
| "Scipy v1.0 and/or numpy not found") |
| @tf32_on_and_off(0.001) |
| def test_affine_2d_rotate90(self, device): |
| # scipy before 1.0.0 do not support homogeneous coordinate |
| # scipy.ndimage.affine_transform, so we need to skip. |
| for input_size2dsq, output_size2dsq in \ |
| itertools.product(input_size2dsq_(), output_size2dsq_()): |
| input_size = input_size2dsq |
| input_ary = np.array(np.random.random(input_size), dtype=np.float32) |
| output_size = output_size2dsq |
| angle_rad = 0.25 * math.pi * 2 |
| |
| transform_tensor, transform_ary, offset = \ |
| _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad) |
| |
| scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform( |
| input_ary[0, 0], |
| transform_ary, |
| offset=offset, |
| output_shape=output_size[2:], |
| order=1, |
| mode='nearest', |
| prefilter=True)) |
| |
| if input_size2dsq == output_size2dsq: |
| self.assertEqual(scipy_ary.mean(), input_ary.mean()) |
| self.assertEqual(scipy_ary[0, 0], input_ary[0, 0, 0, -1]) |
| self.assertEqual(scipy_ary[0, -1], input_ary[0, 0, -1, -1]) |
| self.assertEqual(scipy_ary[-1, -1], input_ary[0, 0, -1, 0]) |
| self.assertEqual(scipy_ary[-1, 0], input_ary[0, 0, 0, 0]) |
| |
| affine_tensor = torch.nn.functional.affine_grid( |
| transform_tensor, |
| torch.Size(output_size), |
| align_corners=True |
| ) |
| |
| gridsample_ary = torch.nn.functional.grid_sample( |
| torch.tensor(input_ary, device=device).to(device), |
| affine_tensor, |
| padding_mode='border', |
| align_corners=True |
| ).to('cpu') |
| |
| self.assertEqual(scipy_ary.mean(), gridsample_ary.mean()) |
| self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary)) |
| |
| @unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'), |
| "Scipy v1.0 and/or numpy not found") |
| @tf32_on_and_off(0.005) |
| def test_affine_2d_rotate45(self, device): |
| # scipy before 1.0.0 do not support homogeneous coordinate |
| # scipy.ndimage.affine_transform, so we need to skip. |
| input_size = [1, 1, 3, 3] |
| input_ary = np.array(np.zeros(input_size), dtype=np.float32) |
| input_ary[0, 0, 0, :] = 0.5 |
| input_ary[0, 0, 2, 2] = 1.0 |
| output_size = [1, 1, 3, 3] |
| angle_rad = 0.125 * math.pi * 2 |
| |
| transform_tensor, transform_ary, offset = \ |
| _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad) |
| |
| scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform( |
| input_ary[0, 0], |
| transform_ary, |
| offset=offset, |
| output_shape=output_size[2:], |
| order=1, |
| mode='nearest', |
| prefilter=False)) |
| |
| affine_tensor = torch.nn.functional.affine_grid( |
| transform_tensor, |
| torch.Size(output_size), |
| align_corners=True |
| ) |
| |
| gridsample_ary = torch.nn.functional.grid_sample( |
| torch.tensor(input_ary, device=device).to(device), |
| affine_tensor, |
| padding_mode='border', |
| align_corners=True |
| ).to('cpu') |
| |
| self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary)) |
| |
| @unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'), |
| "Scipy v1.0 and/or numpy not found") |
| @tf32_on_and_off(0.005) |
| def test_affine_2d_rotateRandom(self, device): |
| # scipy before 1.0.0 do not support homogeneous coordinate |
| # scipy.ndimage.affine_transform, so we need to skip. |
| for angle_rad, input_size2d, output_size2d in \ |
| itertools.product(angle_rad_(), input_size2d_(), output_size2d_()): |
| |
| input_size = input_size2d |
| input_ary = np.array(np.random.random(input_size), dtype=np.float32).round(3) |
| output_size = output_size2d |
| |
| input_ary[0, 0, 0, 0] = 2 |
| input_ary[0, 0, 0, -1] = 4 |
| input_ary[0, 0, -1, 0] = 6 |
| input_ary[0, 0, -1, -1] = 8 |
| |
| transform_tensor, transform_ary, grid_ary = \ |
| _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad) |
| |
| scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform( |
| input_ary[0, 0], |
| transform_ary, |
| output_shape=output_size[2:], |
| order=1, |
| mode='nearest', |
| prefilter=False)) |
| |
| affine_tensor = torch.nn.functional.affine_grid( |
| transform_tensor, |
| torch.Size(output_size), |
| align_corners=True |
| ) |
| |
| gridsample_ary = torch.nn.functional.grid_sample( |
| torch.tensor(input_ary, device=device).to(device), |
| affine_tensor, |
| padding_mode='border', |
| align_corners=True |
| ).to('cpu') |
| |
| affine_tensor = affine_tensor.to('cpu') |
| |
| for r in range(affine_tensor.size(1)): |
| for c in range(affine_tensor.size(2)): |
| grid_out = np.dot(grid_ary, [r, c, 1]) |
| self.assertEqual(affine_tensor[0, r, c], grid_out[:2]) |
| |
| self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary)) |
| |
| @unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'), |
| "Scipy v1.0 and/or numpy not found") |
| @tf32_on_and_off(0.005) |
| def test_affine_3d_rotateRandom(self, device): |
| # scipy before 1.0.0 do not support homogeneous coordinate |
| # scipy.ndimage.affine_transform, so we need to skip. |
| for angle_rad, axis_vector, input_size3d, output_size3d in \ |
| itertools.product(angle_rad_(), axis_vector_(), input_size3d_(), output_size3d_()): |
| input_size = input_size3d |
| input_ary = np.array(np.random.random(input_size), dtype=np.float32) |
| output_size = output_size3d |
| |
| input_ary[0, 0, 0, 0, 0] = 2 |
| input_ary[0, 0, 0, 0, -1] = 3 |
| input_ary[0, 0, 0, -1, 0] = 4 |
| input_ary[0, 0, 0, -1, -1] = 5 |
| input_ary[0, 0, -1, 0, 0] = 6 |
| input_ary[0, 0, -1, 0, -1] = 7 |
| input_ary[0, 0, -1, -1, 0] = 8 |
| input_ary[0, 0, -1, -1, -1] = 9 |
| |
| transform_tensor, transform_ary, grid_ary = \ |
| _buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector) |
| |
| scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform( |
| input_ary[0, 0], |
| transform_ary, |
| output_shape=output_size[2:], |
| order=1, |
| mode='nearest', |
| prefilter=False)) |
| |
| affine_tensor = torch.nn.functional.affine_grid( |
| transform_tensor, |
| torch.Size(output_size), |
| align_corners=True |
| ) |
| |
| gridsample_ary = torch.nn.functional.grid_sample( |
| torch.tensor(input_ary, device=device).to(device), |
| affine_tensor, |
| padding_mode='border', |
| align_corners=True |
| ).to('cpu') |
| |
| affine_tensor = affine_tensor.to('cpu') |
| |
| for i in range(affine_tensor.size(1)): |
| for r in range(affine_tensor.size(2)): |
| for c in range(affine_tensor.size(3)): |
| grid_out = np.dot(grid_ary, [i, r, c, 1]) |
| self.assertEqual(affine_tensor[0, i, r, c], grid_out[:3]) |
| |
| self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary)) |
| |
| def test_Dropout(self, device): |
| input = torch.empty(1000) |
| self._test_dropout(nn.Dropout, device, input) |
| |
| self._test_dropout_discontiguous(nn.Dropout, device) |
| self._test_dropout_discontiguous(nn.Dropout, device, memory_format=torch.channels_last) |
| |
| self._test_dropout_stride_mean_preserve(nn.Dropout, device) |
| |
| if self.device_type == 'cuda': |
| input = input.bfloat16() |
| self._test_dropout(nn.Dropout, device, input) |
| |
| def test_Dropout2d(self, device): |
| b = random.randint(1, 5) |
| w = random.randint(1, 5) |
| h = random.randint(1, 5) |
| num_features = 1000 |
| input = torch.empty(num_features, b, w, h) |
| self._test_dropout(nn.Dropout2d, device, input) |
| self._test_dropout(nn.Dropout2d, device, input, memory_format=torch.channels_last) |
| |
| self._test_dropout_discontiguous(nn.Dropout2d, device) |
| self._test_dropout_discontiguous(nn.Dropout2d, device, memory_format=torch.channels_last) |
| |
| def test_Dropout3d(self, device): |
| b = random.randint(1, 5) |
| w = random.randint(1, 5) |
| h = random.randint(1, 5) |
| d = random.randint(1, 2) |
| num_features = 1000 |
| input = torch.empty(num_features, b, d, w, h) |
| self._test_dropout(nn.Dropout3d, device, input) |
| |
| self._test_dropout_discontiguous(nn.Dropout3d, device) |
| self._test_dropout_discontiguous(nn.Dropout3d, device, memory_format=torch.channels_last) |
| |
| def test_InstanceNorm1d_general(self, device): |
| b = random.randint(3, 5) |
| c = random.randint(3, 5) |
| d = random.randint(8, 10) |
| |
| input = torch.rand(b, c, d) |
| self._test_InstanceNorm_general(nn.InstanceNorm1d, input, device) |
| |
| if self.device_type == 'cuda': |
| self._test_InstanceNorm_cuda_half(nn.InstanceNorm1d, input, device) |
| |
| def test_InstanceNorm2d_general(self, device): |
| b = random.randint(3, 5) |
| c = random.randint(3, 5) |
| w = random.randint(3, 6) |
| h = random.randint(6, 8) |
| |
| input = torch.rand(b, c, h, w) |
| self._test_InstanceNorm_general(nn.InstanceNorm2d, input, device) |
| |
| if self.device_type == 'cuda': |
| self._test_InstanceNorm_cuda_half(nn.InstanceNorm2d, input, device) |
| |
| def test_InstanceNorm3d_general(self, device): |
| b = random.randint(3, 5) |
| c = random.randint(3, 5) |
| w = random.randint(2, 5) |
| h = random.randint(2, 5) |
| d = random.randint(2, 5) |
| |
| input = torch.rand(b, c, h, w, d) |
| self._test_InstanceNorm_general(nn.InstanceNorm3d, input, device) |
| |
| if self.device_type == 'cuda': |
| self._test_InstanceNorm_cuda_half(nn.InstanceNorm3d, input, device) |
| |
| def test_instancenorm_raises_error_if_less_than_one_value_per_channel(self, device): |
| x = torch.rand(10)[None, :, None] |
| with self.assertRaises(ValueError): |
| torch.nn.InstanceNorm1d(10)(x).to(device) |
| |
| def test_LayerNorm_general(self, device): |
| self._test_LayerNorm_general(device) |
| |
| if self.device_type == 'cuda': |
| self._test_LayerNorm_general(device, dtype=torch.bfloat16) |
| |
| if self.device_type == 'cuda': |
| self._test_LayerNorm_cuda_half(device) |
| |
| @onlyOnCPUAndCUDA |
| def test_GroupNorm_general(self, device): |
| self._test_GroupNorm_general(device) |
| |
| if self.device_type == 'cuda': |
| self._test_GroupNorm_cuda_half() |
| |
| def test_GroupNorm_raises_error_if_one_value_per_group(self, device): |
| x = torch.rand(10)[None, :, None] |
| with self.assertRaises(ValueError): |
| torch.nn.GroupNorm(10, 10)(x).to(device) |
| |
| def test_GroupNorm_empty(self, device): |
| mod = torch.nn.GroupNorm(2, 4).to(device) |
| inp = torch.randn(0, 4, 2, 2, device=device) |
| self._test_module_empty_input(mod, inp) |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_module_empty_input(mod, inp) |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.float64, torch.complex128) |
| def test_pad(self, device, dtype): |
| inputs = torch.randn(1, 3, 4, 4, device=device, dtype=dtype, requires_grad=True) |
| _assertGradAndGradgradChecks(self, lambda x: F.pad(x, (1, 1, 1, 1)), (inputs,)) |
| _assertGradAndGradgradChecks(self, lambda x: F.pad(x, (-1, 1, -2, 1)), (inputs,)) |
| _assertGradAndGradgradChecks(self, lambda x: F.pad(x, (-1, 1, -2, 1), value=2), (inputs,)) |
| self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='replicate'), (inputs,))) |
| self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='reflect'), (inputs,))) |
| self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='circular'), (inputs,))) |
| |
| inputs = torch.randn(1, 2, 3, 4, 4, device=device, dtype=dtype, requires_grad=True) |
| self.assertTrue(gradcheck(lambda x: F.pad(x, (1, 1, 1, 1, 1, 1), mode='replicate'), (inputs,))) |
| |
| # Assert assertion errors are raised for invalid circular padding values |
| inputs = torch.randn(1, 1, 4, device=device, dtype=dtype, requires_grad=True) |
| # Should raise error when trying to wrap around more than once |
| self.assertRaises(AssertionError, lambda: F.pad(inputs, (5, 4), mode='circular')) |
| self.assertRaises(AssertionError, lambda: F.pad(inputs, (3, 6), mode='circular')) |
| # Should raise error when negative padding results in negative output shape |
| self.assertRaises(AssertionError, lambda: F.pad(inputs, (-3, -2), mode='circular')) |
| |
| # assert that relfection padding errors when pad >= input size |
| expected_err_msg = r"Padding size should be less than the corresponding input dimension" |
| inputs = torch.randn(1, 1, 2, 3, device=device, dtype=dtype) |
| self.assertRaisesRegex(RuntimeError, expected_err_msg, |
| lambda: F.pad(inputs, (1, 1, 3, 0), mode='reflect')) |
| inputs = torch.randn(1, 1, 2, device=device, dtype=dtype) |
| self.assertRaisesRegex(RuntimeError, expected_err_msg, |
| lambda: F.pad(inputs, (2, 1), mode='reflect')) |
| |
| inputs = torch.rand(1, 3, 4, 4, device=device, dtype=dtype) |
| # assert that pad doesn't return a view into the input tensor |
| for mode in 'constant', 'reflect', 'replicate', 'circular': |
| out = F.pad(inputs, (0, 0, 0, 0), mode=mode) |
| out.fill_(4) |
| self.assertTrue(torch.all(torch.abs(inputs) < 2)) |
| |
| out = F.pad(inputs, (0, 0, -1, -1), mode=mode) |
| out.fill_(4) |
| self.assertTrue(torch.all(torch.abs(inputs) < 2)) |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.float64, torch.complex128) |
| def test_ReplicationPad_empty(self, device, dtype): |
| for mod, inp in [ |
| (torch.nn.ReplicationPad1d(3), torch.randn(0, 3, 10, device=device, dtype=dtype)), |
| (torch.nn.ReplicationPad2d(3), torch.randn(0, 3, 10, 10, device=device, dtype=dtype)), |
| (torch.nn.ReplicationPad3d(3), torch.randn(0, 3, 10, 10, 10, device=device, dtype=dtype))]: |
| self._test_module_empty_input(mod, inp, check_size=False) |
| |
| with self.assertRaisesRegex(NotImplementedError, 'Only 3D'): |
| mod = torch.nn.ReplicationPad1d(2) |
| inp = torch.randn(3, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected 2D or 3D'): |
| mod = torch.nn.ReplicationPad1d(2) |
| inp = torch.randn(3, 0, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'): |
| mod = torch.nn.ReplicationPad2d((2, 2, 2, 2)) |
| inp = torch.randn(43, 0, 10, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected 4D or 5D'): |
| mod = torch.nn.ReplicationPad3d((2, 2, 2, 2, 2, 2)) |
| inp = torch.randn(3, 0, 10, 10, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| def test_ReplicationPad1d_large(self, device): |
| shapes = ([2, 65736, 4], [65736, 2, 4]) |
| pl, pr = 3, 4 |
| for shape in shapes: |
| x = torch.randn(shape, device=device, requires_grad=True) |
| model = torch.nn.ReplicationPad1d((pl, pr)) |
| |
| # forward |
| out = model(x) |
| self.assertEqual(out[:, :, pl : -pr], x) |
| |
| left_padding = out[:, :, : pl] |
| self.assertEqual(left_padding, x[:, :, :1].expand_as(left_padding)) |
| right_padding = out[:, :, -pr :] |
| self.assertEqual(right_padding, x[:, :, -1:].expand_as(right_padding)) |
| |
| # backward |
| g = torch.randn_like(out) |
| out.backward(g) |
| self.assertEqual(x.grad[:, :, 1 : -1], g[:, :, pl + 1 : -pr - 1]) |
| |
| self.assertEqual(x.grad[:, :, 0], g[:, :, : pl + 1].sum(-1)) |
| self.assertEqual(x.grad[:, :, -1], g[:, :, -pr - 1:].sum(-1)) |
| |
| def test_ReplicationPad2d_large(self, device): |
| shapes = ([2, 65736, 4, 4], [65736, 2, 4, 4]) |
| pl, pr, pt, pb = 3, 4, 5, 6 |
| for shape in shapes: |
| x = torch.randn(shape, device=device, requires_grad=True) |
| model = torch.nn.ReplicationPad2d((pl, pr, pt, pb)) |
| |
| # forward center, edge |
| out = model(x) |
| self.assertEqual(out[:, :, pt : -pb, pl : -pr], x) |
| |
| left_padding = out[:, :, pt : -pb, : pl] |
| self.assertEqual(left_padding, x[:, :, :, :1].expand_as(left_padding)) |
| right_padding = out[:, :, pt : -pb, -pr :] |
| self.assertEqual(right_padding, x[:, :, :, -1:].expand_as(right_padding)) |
| top_padding = out[:, :, : pt, pl : -pr] |
| self.assertEqual(top_padding, x[:, :, :1, :].expand_as(top_padding)) |
| bottom_padding = out[:, :, -pb : , pl : -pr] |
| self.assertEqual(bottom_padding, x[:, :, -1:, :].expand_as(bottom_padding)) |
| |
| # forward corner |
| tl_padding = out[:, :, : pt + 1, : pl + 1] |
| self.assertEqual(tl_padding, x[:, :, :1, :1].expand_as(tl_padding)) |
| tr_padding = out[:, :, : pt + 1, -pr - 1:] |
| self.assertEqual(tr_padding, x[:, :, :1, -1:].expand_as(tr_padding)) |
| bl_padding = out[:, :, -pb - 1:, : pl + 1] |
| self.assertEqual(bl_padding, x[:, :, -1:, :1].expand_as(bl_padding)) |
| br_padding = out[:, :, -pb - 1:, -pr - 1:] |
| self.assertEqual(br_padding, x[:, :, -1:, -1:].expand_as(br_padding)) |
| |
| # backward center, edge |
| g = torch.randn_like(out) |
| out.backward(g) |
| self.assertEqual(x.grad[:, :, 1:-1, 1:-1], g[:, :, pt + 1 : -pb - 1, pl + 1 : -pr - 1]) |
| |
| self.assertEqual(x.grad[:, :, 1:-1, 0], g[:, :, pt + 1 : -pb - 1, : pl + 1].sum(-1)) |
| self.assertEqual(x.grad[:, :, 1:-1, -1], g[:, :, pt + 1 : -pb - 1, -pr - 1 :].sum(-1)) |
| self.assertEqual(x.grad[:, :, 0, 1:-1], g[:, :, : pt + 1, pl + 1 : -pr - 1].sum(-2)) |
| self.assertEqual(x.grad[:, :, -1, 1:-1], g[:, :, -pb - 1 :, pl + 1 : -pr - 1].sum(-2)) |
| |
| # backward corner |
| self.assertEqual(x.grad[:, :, 0, 0], g[:, :, : pt + 1, : pl + 1].sum((-2, -1))) |
| self.assertEqual(x.grad[:, :, 0, -1], g[:, :, : pt + 1, -pr - 1 :].sum((-2, -1))) |
| self.assertEqual(x.grad[:, :, -1, 0], g[:, :, -pb - 1 :, : pl + 1].sum((-2, -1))) |
| self.assertEqual(x.grad[:, :, -1, -1], g[:, :, -pb - 1 :, -pr - 1 :].sum((-2, -1))) |
| |
| @largeTensorTest("6GB") |
| def test_ReplicationPad3d_large(self, device): |
| shapes = ([1, 65736, 2, 2, 2], [65736, 1, 2, 2, 2]) |
| pl, pr, pt, pbt, pf, pbk = 3, 4, 5, 6, 7, 8 |
| |
| for shape in shapes: |
| x = torch.randn(shape, device=device, requires_grad=True) |
| model = torch.nn.ReplicationPad3d((pl, pr, pt, pbt, pf, pbk)) |
| |
| # forward center |
| out = model(x) |
| self.assertEqual(out[:, :, pf : -pbk, pt : -pbt, pl : -pr], x) |
| |
| # backward center |
| g = torch.randn_like(out) |
| out.backward(g) |
| self.assertEqual(x.grad[:, :, 1:-1, 1:-1, 1:-1], g[:, :, pf + 1 : -pbk - 1, pt + 1 : -pbt - 1, pl + 1 : -pr - 1]) |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.float32, torch.complex64) |
| def test_ReflectionPad_empty(self, device, dtype): |
| for mod, inp in [ |
| (torch.nn.ReflectionPad1d(2), torch.randn(0, 3, 10, device=device, dtype=dtype)), |
| (torch.nn.ReflectionPad2d(2), torch.randn(0, 3, 10, 10, device=device, dtype=dtype))]: |
| self._test_module_empty_input(mod, inp, check_size=False) |
| |
| with self.assertRaisesRegex(RuntimeError, '2D or 3D'): |
| mod = torch.nn.ReflectionPad1d(2) |
| inp = torch.randn(3, 0, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| with self.assertRaisesRegex(RuntimeError, '3D or 4D'): |
| mod = torch.nn.ReflectionPad2d(2) |
| inp = torch.randn(3, 0, 10, 10, device=device, dtype=dtype) |
| mod(inp) |
| |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.float, torch.double) |
| def test_MarginLoss_empty(self, device, dtype): |
| for mod, x, y in [ |
| (torch.nn.MultiMarginLoss().to(device), |
| torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype), |
| torch.ones(0, device=device).type(torch.long)), |
| (torch.nn.MultiLabelMarginLoss().to(device), |
| torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype), |
| torch.ones(0, 10, device=device).type(torch.long))]: |
| |
| out = mod(x, y) |
| out.sum().backward() |
| |
| self.assertEqual(x, torch.zeros_like(x)) |
| self.assertEqual(x.grad, torch.zeros_like(x)) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected'): |
| x = torch.randn(0, requires_grad=True, device=device, dtype=dtype) |
| y = torch.ones(10, device=device).type(torch.long) |
| mod(x, y) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected'): |
| x = torch.randn(10, 0, requires_grad=True, device=device, dtype=dtype) |
| y = torch.ones(10, 0, device=device).type(torch.long) |
| mod(x, y) |
| |
| |
| @onlyOnCPUAndCUDA |
| def test_Unfold_empty(self, device): |
| inp = torch.randn(0, 3, 3, 4, device=device) |
| unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device) |
| self._test_module_empty_input(unfold, inp, check_size=False) |
| |
| with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'): |
| inp = torch.randn(3, 0, 3, 4, device=device) |
| unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device) |
| unfold(inp) |
| |
| @onlyCUDA |
| @dtypes(torch.float, torch.double) |
| @tf32_on_and_off(0.005) |
| def test_rnn_fused(self, device, dtype): |
| |
| def copy_rnn(rnn1, rnn2): |
| for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights): |
| for x, y in zip(x_layer, y_layer): |
| x.data.copy_(y.data) |
| |
| def check_rnn_grads(rnn1, rnn2): |
| for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights): |
| for x, y in zip(x_layer, y_layer): |
| self.assertEqual(x.grad, y.grad, atol=5e-5, rtol=0) |
| |
| input_size = 10 |
| hidden_size = 6 |
| num_layers = 2 |
| seq_length = 7 |
| batch = 6 |
| input_val = torch.randn(seq_length, batch, input_size, dtype=dtype) |
| grad_output = torch.randn(seq_length, batch, hidden_size, dtype=dtype) |
| hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype) |
| grad_hy = torch.randn(num_layers, batch, hidden_size, dtype=dtype) |
| with torch.backends.cudnn.flags(enabled=False, allow_tf32=None): |
| for module in (nn.GRU, nn.LSTM): |
| for bias in (True, False): |
| rnn = module(input_size, hidden_size, num_layers, bias=bias).to(dtype) |
| rnn_device = module(input_size, hidden_size, num_layers, bias=bias).to(device, dtype) |
| copy_rnn(rnn, rnn_device) |
| |
| is_lstm = isinstance(rnn, nn.LSTM) |
| if is_lstm: |
| hx = (hx_val.clone().requires_grad_(True), |
| hx_val.clone().add(1).requires_grad_(True)) |
| hx_device = (hx_val.clone().to(device).requires_grad_(True), |
| hx_val.clone().to(device).add(1).requires_grad_(True)) |
| else: |
| hx = hx_val.clone().requires_grad_(True) |
| hx_device = hx_val.clone().to(device).requires_grad_(True) |
| |
| inp = input_val.clone().requires_grad_(True) |
| inp_cu = input_val.clone().to(device).requires_grad_(True) |
| output1, hy1 = rnn(inp, hx) |
| output2, hy2 = rnn_device(inp_cu, hx_device) |
| if is_lstm: |
| torch.autograd.backward( |
| [output1, hy1[0], hy1[1]], [grad_output, grad_hy, grad_hy + 1] |
| ) |
| torch.autograd.backward( |
| [output2, hy2[0], hy2[1]], |
| [grad_output.to(device), grad_hy.to(device), (grad_hy + 1).to(device)] |
| ) |
| else: |
| torch.autograd.backward([output1, hy1], [grad_output, grad_hy]) |
| torch.autograd.backward([output2, hy2], [grad_output.to(device), grad_hy.to(device)]) |
| |
| self.assertEqual(output1, output2) |
| self.assertEqual(hy1, hy2) |
| |
| check_rnn_grads(rnn, rnn_device) |
| self.assertEqual(inp.grad, inp_cu.grad) |
| if is_lstm: |
| self.assertEqual(hx[0].grad, hx_device[0].grad) |
| self.assertEqual(hx[1].grad, hx_device[1].grad) |
| else: |
| self.assertEqual(hx.grad, hx_device.grad) |
| |
| def test_BatchNorm_empty(self, device): |
| mod = torch.nn.BatchNorm2d(3).to(device) |
| inp = torch.randn(0, 3, 2, 2, device=device) |
| self._test_module_empty_input(mod, inp) |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_module_empty_input(mod, inp) |
| |
| self.assertEqual(mod.running_mean, torch.tensor([0., 0, 0], device=device)) |
| self.assertEqual(mod.running_var, torch.tensor([1., 1, 1], device=device)) |
| self.assertEqual(mod.weight.grad, torch.tensor([0., 0, 0], device=device)) |
| self.assertEqual(mod.bias.grad, torch.tensor([0., 0, 0], device=device)) |
| |
| def test_group_conv_empty(self, device): |
| mod = torch.nn.Conv2d(4, 4, stride=2, kernel_size=3, padding=1, groups=4).to(device) |
| inp = torch.randn(0, 4, 4, 4, device=device) |
| self._test_module_empty_input(mod, inp, check_size=False) |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_module_empty_input(mod, inp, check_size=False) |
| |
| def test_group_convTranspose_empty(self, device): |
| mod = torch.nn.ConvTranspose2d(4, 4, stride=2, kernel_size=3, padding=1, groups=4).to(device) |
| inp = torch.randn(0, 4, 4, 4, device=device) |
| self._test_module_empty_input(mod, inp, check_size=False) |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_module_empty_input(mod, inp, check_size=False) |
| |
| def test_convTranspose_empty(self, device): |
| mod = torch.nn.ConvTranspose2d(4, 4, stride=2, kernel_size=3, padding=1).to(device) |
| inp = torch.randn(0, 4, 4, 4, device=device) |
| self._test_module_empty_input(mod, inp, check_size=False) |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_module_empty_input(mod, inp, check_size=False) |
| |
| @onlyOnCPUAndCUDA |
| def test_AvgPool2d_empty(self, device): |
| avgpool = torch.nn.AvgPool2d(3, stride=2).to(device) |
| inp = torch.randn(0, 16, 20, 32, device=device) |
| self._test_module_empty_input(avgpool, inp, check_size=False) |
| |
| clast_inp = torch.randn(0, 16, 20, 32, device=device).contiguous(memory_format=torch.channels_last) |
| self._test_module_empty_input(avgpool, clast_inp, check_size=False) |
| |
| # test with empty non-batch input |
| with self.assertRaisesRegex(RuntimeError, '3D or 4D'): |
| inp = torch.randn(16, 0, 20, 32, device=device) |
| avgpool(inp) |
| |
| @onlyCUDA |
| @largeTensorTest('16GB') |
| def test_prelu_backward_32bit_indexing(self, device): |
| m = torch.nn.PReLU().cuda().half() |
| input_ = torch.ones((1024, 1024, 1024, 2), dtype=torch.half, device=device) |
| output = m(input_) |
| output.backward(input_) |
| |
| def test_linear_empty(self, device): |
| mod = torch.nn.Linear(7, 7).to(device) |
| inp = torch.randn(0, 7, device=device) |
| self._test_module_empty_input(mod, inp) |
| |
| def test_one_hot(self, device): |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.one_hot(torch.tensor([3, 4, -1, 0], device=device), -1) |
| |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 3) |
| |
| t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device)) |
| expected = torch.tensor([[0, 0, 0, 1, 0], |
| [0, 0, 0, 0, 1], |
| [0, 1, 0, 0, 0], |
| [1, 0, 0, 0, 0]], device=device) |
| self.assertEqual(t, expected) |
| |
| t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -1) |
| expected = torch.tensor([[0, 0, 0, 1, 0], |
| [0, 0, 0, 0, 1], |
| [0, 1, 0, 0, 0], |
| [1, 0, 0, 0, 0]], device=device) |
| self.assertEqual(t, expected) |
| |
| t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 6) |
| expected = torch.tensor([[0, 0, 0, 1, 0, 0], |
| [0, 0, 0, 0, 1, 0], |
| [0, 1, 0, 0, 0, 0], |
| [1, 0, 0, 0, 0, 0]], device=device) |
| self.assertEqual(t, expected) |
| |
| t = torch.nn.functional.one_hot(torch.tensor([[3, 4], [1, 0]], device=device)) |
| expected = torch.tensor([[[0, 0, 0, 1, 0], |
| [0, 0, 0, 0, 1]], |
| [[0, 1, 0, 0, 0], |
| [1, 0, 0, 0, 0]]], device=device) |
| self.assertEqual(t, expected) |
| |
| t = torch.nn.functional.one_hot(torch.tensor(4, device=device)) |
| expected = torch.tensor([0, 0, 0, 0, 1], device=device) |
| self.assertEqual(t, expected) |
| |
| t = torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device), 100) |
| expected = torch.empty([4, 0, 100]) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(t, expected) |
| |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device)) |
| |
| with self.assertRaises(RuntimeError): |
| torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -2) |
| |
| def test_nn_scalars(self, device): |
| # One off tests to ensure scalars from nn.yaml are properly applied |
| def verify_scalars(input, output): |
| if input.dim() == 0: |
| self.assertEqual((), output.shape) |
| else: |
| self.assertNotEqual((), output.shape) |
| output.sum().backward() |
| self.assertEqual(input.shape, input.grad.shape) |
| |
| for input_shape in [(5, 6), ()]: |
| for module in [torch.nn.ELU, torch.nn.Hardtanh, torch.nn.LeakyReLU, torch.nn.LogSigmoid, |
| torch.nn.RReLU, torch.nn.Softshrink, torch.nn.Softplus, torch.nn.Sigmoid, |
| torch.nn.Tanh]: |
| input = torch.randn(input_shape, device=device, requires_grad=True) |
| m = module() |
| output = m(input) |
| verify_scalars(input, output) |
| |
| def test_nn_scalars_reductions(self, device): |
| # One off tests to ensure scalars from nn.yaml are properly applied |
| def verify_reduction_scalars(input, reduction, output): |
| if reduction != 'none' or input.dim() == 0: |
| self.assertEqual((), output.shape) |
| else: |
| self.assertNotEqual((), output.shape) |
| output.sum().backward() |
| self.assertEqual(input.shape, input.grad.shape) |
| |
| for input_shape in [(5, 6), ()]: |
| for reduction in ['none', 'mean', 'sum']: |
| for module in [torch.nn.BCELoss, torch.nn.L1Loss, torch.nn.MSELoss, |
| torch.nn.SmoothL1Loss, torch.nn.SoftMarginLoss]: |
| input = torch.randn(input_shape, device=device, requires_grad=True) |
| target = torch.empty(input_shape, device=device).random_(2) |
| sigmoid = nn.Sigmoid() |
| |
| input = torch.randn(input_shape, device=device, requires_grad=True) |
| m = module(reduction=reduction) |
| output = m(sigmoid(input), target) |
| verify_reduction_scalars(input, reduction, output) |
| |
| # verify that bogus reduction strings are errors |
| @onlyOnCPUAndCUDA |
| def test_invalid_reduction_strings(self, device): |
| input = torch.randn(3, 5, requires_grad=True, device=device) |
| cinput = torch.randn(3, 5, requires_grad=True, device=device, dtype=torch.cfloat) |
| target = torch.tensor([1, 0, 4], device=device) |
| var = torch.ones(size=input.size(), requires_grad=True, device=device) |
| |
| for reduction in ['none', 'invalid']: |
| def v(fn): |
| if reduction == 'invalid': |
| self.assertRaises(ValueError, lambda: fn()) |
| else: |
| fn() |
| |
| v(lambda: F.nll_loss(input, target, reduction=reduction)) |
| v(lambda: F.cross_entropy(input, target, reduction=reduction)) |
| v(lambda: F.multi_margin_loss(input, target, reduction=reduction)) |
| |
| v(lambda: F.kl_div(input, input, reduction=reduction)) |
| v(lambda: F.smooth_l1_loss(input, input, reduction=reduction)) |
| v(lambda: F.l1_loss(input, input, reduction=reduction)) |
| v(lambda: F.l1_loss(cinput, cinput, reduction=reduction)) |
| v(lambda: F.mse_loss(input, input, reduction=reduction)) |
| v(lambda: F.hinge_embedding_loss(input, input, reduction=reduction)) |
| v(lambda: F.poisson_nll_loss(input, input, reduction=reduction)) |
| v(lambda: F.gaussian_nll_loss(input, input, var, reduction=reduction)) |
| v(lambda: F.binary_cross_entropy_with_logits(input, input, reduction=reduction)) |
| |
| zeros = torch.zeros_like(input).to(torch.int64) |
| v(lambda: F.multilabel_soft_margin_loss(input, zeros, reduction=reduction)) |
| v(lambda: F.multilabel_margin_loss(input, zeros, reduction=reduction)) |
| |
| v(lambda: F.triplet_margin_loss(input, input, input, reduction=reduction)) |
| v(lambda: F.triplet_margin_with_distance_loss(input, input, input, reduction=reduction)) |
| v(lambda: F.margin_ranking_loss(input, input, input.sign(), reduction=reduction)) |
| v(lambda: F.cosine_embedding_loss(input, input, input[:, 0].sign(), reduction=reduction)) |
| |
| log_probs = torch.randn(50, 16, 20, requires_grad=True, device=device).log_softmax(2) |
| targets = torch.randint(1, 20, (16, 30), dtype=torch.long, device=device) |
| input_lengths = torch.full((16,), 50, dtype=torch.long, device=device) |
| target_lengths = torch.randint(10, 30, (16,), dtype=torch.long, device=device) |
| v(lambda: F.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction=reduction)) |
| |
| # FIXME: should we allow derivatives on these? |
| v(lambda: F.binary_cross_entropy(torch.sigmoid(input), input.detach(), reduction=reduction)) |
| v(lambda: F.soft_margin_loss(input, input.sign().detach(), reduction=reduction)) |
| |
| # We don't want to make propagating NaN a hard requirement on ops, but for |
| # these easy ones, we should make them do so. |
| def test_nonlinearity_propagate_nan(self, device): |
| def test(nonlinearity, *args, **kwargs): |
| x = torch.tensor([nan], device=device) |
| fn = getattr(F, nonlinearity) |
| try: |
| self.assertTrue(math.isnan(fn(x, *args, **kwargs).item())) |
| except Exception as e: |
| if 'not implemented' not in str(e): |
| raise |
| |
| test('relu') |
| test('relu', inplace=True) |
| test('relu6') |
| test('elu') |
| test('selu') |
| test('celu') |
| test('rrelu') |
| test('rrelu', inplace=True) |
| test('hardtanh') |
| test('tanh') |
| test('sigmoid') |
| test('logsigmoid') |
| test('hardshrink') |
| test('tanhshrink') |
| test('softsign') |
| test('softmin', 0) |
| test('softmax', 0) |
| test('log_softmax', 0) |
| test('leaky_relu', 0.2) |
| test('threshold', 3, 2) |
| test('threshold', 3, 2, inplace=True) |
| |
| def test_pooling_shape(self, device): |
| ''' Test the output shape calculation for pooling functions ''' |
| |
| # Checks output shape against expected for 1D, 2D and 3D |
| def check(expected_out_shape, sizes, *args, **kwargs): |
| for kernel in ['max', 'avg']: |
| for i in [1, 2, 3]: |
| if hasattr(torch.nn.functional, f'{kernel}_pool{i}d'): |
| op = getattr(torch.nn.functional, f'{kernel}_pool{i}d') |
| t = torch.randn(sizes[:i + 2], device=device) |
| self.assertEqual(op(t, *args, **kwargs).shape, expected_out_shape[:i + 2]) |
| |
| check((1, 1, 3, 3, 4), (1, 1, 5, 6, 7), kernel_size=1, stride=2, padding=0, ceil_mode=True) |
| check((1, 1, 2, 3, 3), (1, 1, 3, 4, 5), kernel_size=2, stride=2, padding=1, ceil_mode=False) |
| check((1, 1, 2, 3, 3), (1, 1, 3, 4, 5), kernel_size=2, stride=2, padding=1, ceil_mode=True) |
| |
| # Test case from issue https://github.com/pytorch/pytorch/issues/45357 |
| x = torch.randn(1, 1, 6, 7, device=device) |
| y = torch.nn.functional.max_pool2d(x, 1, stride=(2, 2), padding=0, ceil_mode=True) |
| self.assertEqual(y.size(), (1, 1, 3, 4)) |
| |
| @onlyOnCPUAndCUDA # TODO: fix on XLA |
| def test_adaptive_avg_pool2d_output_size_one(self, device): |
| def helper(size, memory_format): |
| x = torch.randint(1, 10, size, dtype=torch.float, device=device, requires_grad=True) |
| if memory_format == 'non_contiguous': |
| x = x[::2, ::2, ::2, ::2] |
| else: |
| x = x.to(memory_format=memory_format) |
| |
| net = torch.nn.AdaptiveAvgPool2d((1, 1)) |
| out = net(x) |
| ref_out = x.contiguous().mean((-1, -2)).view((x.size(0), x.size(1), 1, 1)) |
| |
| out.sum().backward() # make sure it doesn't crash |
| |
| self.assertEqual(out, ref_out) |
| if memory_format == torch.channels_last: |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| c = out.size(1) |
| self.assertEqual(out.stride(), [c, 1, c, c]) |
| else: |
| self.assertTrue(out.is_contiguous()) |
| c = out.size(1) |
| self.assertEqual(out.stride(), [c, 1, 1, 1]) |
| |
| for mf in (torch.contiguous_format, torch.channels_last, 'non_contiguous'): |
| helper((2, 3, 6, 6), mf) |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.uint8, torch.int8, torch.short, torch.int, torch.long) |
| def test_adaptive_pooling_no_suppot_input(self, device, dtype): |
| for numel in (2, 3): |
| for pool_type in ('Max', 'Avg'): |
| cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel) |
| module_cls = getattr(nn, cls_name) |
| output_size = (2,) * numel |
| module = module_cls(output_size) |
| input = torch.randn((4,) * (numel + 1), device=device).to(dtype) |
| with self.assertRaisesRegex(RuntimeError, "not implemented"): |
| output = module(input) |
| |
| @onlyCUDA |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| def test_avg_pool2d_nhwc(self, device, dtype): |
| def helper(n, c, h, w, kernel_size, stride=None, |
| count_include_pad=True, divisor_override=None, padding=0): |
| if stride is None: |
| stride = kernel_size |
| input = torch.randn(n, c, h, w, dtype=dtype, device=device) |
| input = input.contiguous(memory_format=torch.channels_last).requires_grad_() |
| grad = torch.randn(n, c, (h - kernel_size) // stride + 1, (w - kernel_size) // stride + 1, |
| dtype=dtype, device=device) |
| pool = torch.nn.AvgPool2d(kernel_size, stride=stride, count_include_pad=count_include_pad, |
| divisor_override=divisor_override).to(device) |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_pool = torch.nn.AvgPool2d(kernel_size, stride=stride, count_include_pad=count_include_pad, |
| divisor_override=divisor_override).to(device) |
| |
| out = pool(input) |
| out.backward(grad) |
| ref_out = ref_pool(ref_input) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertTrue(torch.allclose(out, ref_out)) |
| self.assertTrue(torch.allclose(input.grad, ref_input.grad)) |
| |
| helper(4, 8, 8, 8, 3) |
| helper(4, 8, 8, 8, 3, count_include_pad=False, padding=1) |
| helper(4, 8, 8, 8, 3, count_include_pad=False, padding=2, stride=2) |
| helper(4, 8, 8, 8, 3, divisor_override=42) |
| helper(4, 8, 8, 8, 7) |
| helper(200, 512, 28, 28, 2) |
| helper(4, 8, 7, 7, 3, stride=1) |
| helper(4, 8, 7, 7, 3, padding=2, stride=1) |
| helper(10, 512, 31, 31, 3, stride=2) |
| helper(1, 129, 8, 8, 3, stride=2) |
| |
| @onlyCPU |
| @dtypes(torch.float) |
| def test_max_pool1d_errors(self, device, dtype): |
| def check(x, args, message): |
| model = torch.nn.MaxPool1d(*args) |
| with self.assertRaisesRegex(RuntimeError, r'max_pool1d\(\) ' + message): |
| model(torch.tensor(x, device=device, dtype=dtype)) |
| |
| # Pooling args: (kernel_size, stride, padding, dilation, return_indices, ceil_mode) |
| check(0, (1,), "input tensor must have 2 or 3 dimensions but got 0") |
| check([], (1,), "input tensor must have 2 or 3 dimensions but got 1") |
| check([[]], (1, 0), "stride must be greater than zero, but got 0") |
| check([[]], (1, 1, -1), "padding must be non-negative, but got -1") |
| check([[]], (1, 1, 2), "padding should be at most half of kernel size, but got padding=2 and kernel_size=1") |
| check([[]], (1, 1, 0, 0), "dilation must be greater than zero, but got 0") |
| check([[]], (5, 1, 0, 1), "Invalid computed output size: -4") |
| |
| @onlyCPU |
| @dtypes(torch.float, torch.double) |
| def test_max_pool1d_corner_cases(self, device, dtype): |
| def check(x, args, expected): |
| model = torch.nn.MaxPool1d(*args) |
| if isinstance(x, list): |
| x = torch.tensor(x, device=device, dtype=dtype) |
| expected = torch.tensor(expected, device=device, dtype=dtype) |
| self.assertEqual(model(x), expected) |
| |
| # Pooling args: (kernel_size, stride, padding, dilation, return_indices, ceil_mode) |
| check([[]], (1, None, 0, 1, False, False), [[]]) |
| check([[[]]], (1, None, 0, 1, False, False), [[[]]]) |
| check([[[]]], (2, 1, 1, 2, False, True), [[[]]]) |
| check([[1]], (1, None, 0, 1, False, False), [[1]]) |
| check([[1]], (2, None, 1, 2, False, False), [[float('-inf')]]) |
| check([[1], [1]], (2, None, 1, 2, False, False), [[float('-inf')], [float('-inf')]]) |
| check([[1, 2]], (2, 1, 1, 2, False, False), [[2, 1]]) |
| check([[1, 2]], (2, 2, 1, 2, False, True), [[2, 2]]) |
| |
| empty_tensor = torch.empty((2, 0, 1), device=device, dtype=dtype) |
| check(empty_tensor, (1, None, 0, 1, False, False), empty_tensor) |
| |
| @onlyCPU |
| @dtypes(torch.float, torch.double) |
| def test_max_pool1d(self, device, dtype): |
| # FIXME For now compare against max_pool1d with indices |
| def check(x, *args, **kwargs): |
| model = torch.nn.MaxPool1d(*args, **kwargs) |
| ref_model = torch.nn.MaxPool1d(*args, **kwargs, return_indices=True) |
| self.assertEqual(model(x), ref_model(x)[0]) |
| |
| sizes = [random.sample(range(8, 128), 3) for _ in range(3)] |
| kernel_sizes = random.sample(range(1, 5), 3) |
| strides = random.sample(range(1, 5), 3) |
| dilations = random.sample(range(1, 5), 3) |
| ceil_modes = [True, False] |
| |
| for size, kernel_size, stride, dilation, ceil_mode in \ |
| itertools.product(sizes, kernel_sizes, strides, dilations, ceil_modes): |
| padding = random.sample(range(0, math.floor(kernel_size / 2) + 1), 1) |
| check(torch.randn(size, device=device, dtype=dtype), |
| kernel_size, stride, padding, dilation, ceil_mode=ceil_mode) |
| |
| # Non-contiguous test |
| tensor = torch.randn(5, 151, 33, device=device, dtype=dtype)[::2, ::3, ::2] |
| check(tensor, 3, 2, 1, 2, ceil_mode=True) |
| check(tensor.transpose(1, 2), 3, 2, 1, 2, ceil_mode=True) |
| |
| @onlyCUDA |
| def test_max_pool2d(self, device): |
| def helper(n, c, h, w, ks): |
| x = torch.randn(n, c, h, w, device='cuda', dtype=torch.float, requires_grad=True) |
| ref_x = x.detach().clone().cpu().requires_grad_() |
| |
| pool = torch.nn.MaxPool2d(kernel_size=ks) |
| |
| y = pool(x) |
| ref_y = pool(ref_x) |
| |
| y.sum().backward() |
| ref_y.sum().backward() |
| |
| self.assertEqual(y, ref_y) |
| self.assertEqual(x.grad, ref_x.grad) |
| |
| helper(2, 8, 4, 4, ks=2) |
| helper(1, 100000, 32, 32, ks=4) |
| helper(1, 100000, 1, 4, ks=(1, 4)) # test for max_pool1d |
| |
| @onlyCUDA |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| def test_max_pool2d_nhwc(self, device, dtype): |
| def helper(n, c, h, w, kernel_size, stride=None): |
| if stride is None: |
| stride = kernel_size |
| input = torch.randn(n, c, h, w, dtype=dtype, device=device) |
| input = input.contiguous(memory_format=torch.channels_last).requires_grad_() |
| grad = torch.randn(n, c, (h - kernel_size) // stride + 1, (w - kernel_size) // stride + 1, |
| dtype=dtype, device=device) |
| pool = torch.nn.MaxPool2d(kernel_size, stride).to(device) |
| |
| ref_input = input.detach().clone().contiguous().requires_grad_(True) |
| ref_grad = grad.detach().clone().contiguous() |
| ref_pool = torch.nn.MaxPool2d(kernel_size, stride).to(device) |
| |
| out = pool(input) |
| out.backward(grad) |
| ref_out = ref_pool(ref_input) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertTrue(torch.allclose(out, ref_out)) |
| self.assertTrue(torch.allclose(input.grad, ref_input.grad)) |
| |
| helper(4, 8, 8, 8, 7) |
| helper(200, 512, 28, 28, 2) |
| helper(4, 8, 7, 7, 3, stride=1) |
| helper(10, 512, 31, 31, 3, stride=2) |
| helper(1, 129, 8, 8, 3, stride=2) |
| |
| @onlyCUDA |
| def test_max_pool2d_indices(self, device): |
| def helper(n, c, h, w, ks): |
| if n is None: |
| x = torch.randn(c, h, w, device='cuda', dtype=torch.float, requires_grad=True) |
| else: |
| x = torch.randn(n, c, h, w, device='cuda', dtype=torch.float, requires_grad=True) |
| |
| ref_x = x.detach().clone().cpu().requires_grad_() |
| |
| pool = torch.nn.MaxPool2d(kernel_size=ks, return_indices=True) |
| |
| y, idx = pool(x) |
| ref_y, ref_idx = pool(ref_x) |
| |
| y.sum().backward() |
| ref_y.sum().backward() |
| |
| self.assertEqual(y, ref_y) |
| self.assertEqual(idx, ref_idx) # assertEqual implicitly compares shape for tensors |
| self.assertEqual(x.grad, ref_x.grad) |
| |
| helper(2, 8, 4, 4, ks=2) |
| helper(None, 3, 50, 50, ks=5) |
| |
| def test_embedding_dense_grad(self, device): |
| embd = nn.Embedding(20, 20).to(device) |
| weight = embd.weight |
| |
| def fn_wrapper(device): |
| def fn(weight): |
| inp = torch.tensor([[0, 1, 1, 2], [3, 5, 7, 11]], dtype=torch.long).to(device) |
| return torch.nn.functional.embedding(inp, weight) |
| return fn |
| |
| fn = fn_wrapper(device) |
| _assertGradAndGradgradChecks(self, fn, (weight, )) |
| |
| def fn_wrapper(device): |
| def padding_fn(weight): |
| inp = torch.tensor([[0, 1, 1, 2], [1, 1, 0, 2]], dtype=torch.long).to(device) |
| return torch.nn.functional.embedding(inp, weight, padding_idx=1) |
| return padding_fn |
| |
| fn = fn_wrapper(device) |
| _assertGradAndGradgradChecks(self, fn, (weight, )) |
| |
| def test_embedding_scalar_weight_error(self, device): |
| indices = torch.rand(2, 2, device=device).long() |
| weight = torch.tensor(1.0, device=device) |
| with self.assertRaisesRegex(RuntimeError, "'weight' must be at least 1-D"): |
| torch.nn.functional.embedding(indices, weight) |
| |
| @dtypesIfCUDA(torch.float16, torch.float64) |
| @dtypes(torch.float64) |
| def test_embedding_backward(self, device, dtype): |
| embedding = nn.Embedding(10, 3, sparse=True) |
| tensor = torch.tensor([[7, 1, 3]]) |
| ones = torch.tensor(1.).expand(3, 3) |
| tensorTwice = tensor.repeat(1, 2) |
| onesTwice = torch.cat((ones, ones)) |
| |
| embedding = embedding.to(dtype=dtype).to(device) |
| tensor = tensor.to(device) |
| ones = ones.to(device) |
| tensorTwice = tensorTwice.to(device) |
| onesTwice = onesTwice.to(device) |
| |
| embedding.zero_grad() |
| embedding(tensor[0]).sum().backward() |
| self.assertEqual(embedding.weight.grad._indices(), tensor) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(embedding.weight.grad._values(), ones) |
| |
| embedding.zero_grad() |
| embedding(tensor[0]).sum().backward() |
| embedding(tensor[0]).sum().backward() |
| self.assertEqual(embedding.weight.grad._indices(), tensorTwice) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(embedding.weight.grad._values(), onesTwice) |
| |
| embedding.zero_grad() |
| embedding(tensor[0]).sum().backward() |
| tensor[0, 0] = 8 |
| embedding(tensor[0]).sum().backward() |
| tensorTwice[0, 3] = 8 |
| self.assertEqual(embedding.weight.grad._indices(), tensorTwice) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(embedding.weight.grad._values(), onesTwice) |
| |
| @dtypesIfCUDA(*ALL_TENSORTYPES2) |
| @dtypes(torch.float32) |
| def test_embedding_padding_idx(self, device, dtype): |
| embedding = nn.Embedding(10, 20, padding_idx=0).to(device, dtype) |
| input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long).to(device) |
| output = embedding(input) |
| self.assertEqual(output[0][0].sum(), 0) |
| self.assertEqual(output[1][2].sum(), 0) |
| |
| embedding = nn.Embedding(10, 20, padding_idx=0, sparse=True).to(device, dtype) |
| input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long).to(device) |
| output = embedding(input) |
| self.assertEqual(output[0][0].sum(), 0) |
| self.assertEqual(output[1][2].sum(), 0) |
| |
| # negative indexing check for padding_idx |
| # padding_idx=-2, num_embeddings=10 ==> index 8 padded |
| embedding = nn.Embedding(10, 20, padding_idx=-2).to(device, dtype) |
| input = torch.tensor([[0, 2, 8, 5], [4, 8, 0, 9]], dtype=torch.long).to(device) |
| output = embedding(input) |
| self.assertEqual(output[0][2].sum(), 0) |
| self.assertEqual(output[1][1].sum(), 0) |
| |
| embedding = nn.Embedding(10, 20, padding_idx=-2, sparse=True).to(device, dtype) |
| input = torch.tensor([[0, 2, 8, 5], [4, 8, 0, 9]], dtype=torch.long).to(device) |
| output = embedding(input) |
| self.assertEqual(output[0][2].sum(), 0) |
| self.assertEqual(output[1][1].sum(), 0) |
| |
| # out of bounds check for padding_idx |
| self.assertRaises(AssertionError, nn.Embedding, num_embeddings=10, embedding_dim=20, padding_idx=25) |
| self.assertRaises(AssertionError, nn.Embedding, num_embeddings=10, embedding_dim=20, padding_idx=-25) |
| |
| padding_idx = 0 |
| embedding = nn.Embedding(5, 2, padding_idx=padding_idx).to(device, dtype) |
| for n in (1, 2, 1000): # Need large N to trigger all the methods we have implemented |
| for other_indices in ([], [1, 3], [2]): |
| indices = torch.tensor(other_indices + [padding_idx] * n, dtype=torch.long).to(device) |
| pre = embedding.weight[padding_idx].clone() |
| embedding(indices).sum().backward() |
| after = (embedding.weight + embedding.weight.grad)[padding_idx] |
| embedding.zero_grad() |
| self.assertEqual(after, pre) |
| |
| # test double backward |
| emb_sum = embedding(indices).sum() |
| emb_grad = torch.autograd.grad(outputs=emb_sum, inputs=list(embedding.parameters()), retain_graph=True) |
| scalar = emb_grad[0].sum() + emb_sum |
| scalar.backward() |
| after = (embedding.weight + embedding.weight.grad)[padding_idx] |
| embedding.zero_grad() |
| self.assertEqual(after, pre) |
| |
| # Test fails on Vg20 |
| @skipCUDAIfRocm |
| @dtypesIfCUDA(torch.half, torch.float) |
| @dtypes(torch.float) |
| def test_softmax_results(self, device, dtype): |
| # Non-even sizes and non-zero shifts test fallback paths in vectorized kernel |
| # Note: dim1 > 1024 is needed to exercise the vectorized (non-persistent) path, (16, 30576) is BERT-esque |
| sizes = [(0, 10), (32, 20), (10, 0), (31, 20), (32, 21), (31, 23), (32, 1536), (31, 2048), (33, 2049), (16, 30576)] |
| shifts = [(0, 0), (1, 0), (0, 1), (1, 1)] |
| for fn in [F.softmax, F.log_softmax]: |
| for size in sizes: |
| for shift in shifts: |
| input = torch.rand(size, device=device, dtype=dtype) |
| # Note: With the largest tests we can hit upper limit of fp16 when we |
| # sum, so scale the input down to stay in a nicer range. |
| if dtype == torch.float16: |
| input = input / 100. |
| input = input[shift[0]:, shift[1]:] |
| # Note; Don't want to bprop back through slice op |
| input = input.detach().requires_grad_(True) |
| ref_input = input.clone().cpu().detach().requires_grad_(True) |
| for dim in [0, 1]: |
| ref_output = fn(ref_input, dtype=torch.float, dim=dim) |
| output = fn(input, dtype=torch.float, dim=dim) |
| grad_output = torch.rand_like(output) |
| ref_grad_output = grad_output.clone().cpu().detach() |
| grad_input, = torch.autograd.grad(output, input, grad_outputs=(grad_output), create_graph=True) |
| ref_grad_input, = torch.autograd.grad(ref_output, ref_input, |
| grad_outputs=(ref_grad_output), create_graph=True) |
| grad_input.sum().backward() |
| ref_grad_input.sum().backward() |
| |
| self.assertEqual(output, ref_output) |
| self.assertEqual(grad_input, ref_grad_input) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| @dtypes(torch.float) |
| @dtypesIfCUDA(torch.float, torch.half) |
| def test_log_softmax_big(self, device, dtype): |
| def _test_helper(shape): |
| # generate a tensor with big numbers that are exactly representable in dtype |
| # and are at a constant offset from tensor with small numbers |
| # the logsoftmax of a small and big tensors should be equal |
| x_small = torch.randint(100, shape, dtype=dtype, device=device) |
| offset = 1.5e3 if dtype == torch.half else 1e7 |
| x_big = x_small + offset |
| self.assertEqual(F.log_softmax(x_small, -1), F.log_softmax(x_big, -1)) |
| _test_helper((16, 4)) |
| if self.device_type == 'cuda': |
| # test non-persistent softmax kernel |
| _test_helper((4, 1536)) |
| |
| @onlyCUDA |
| @largeTensorTest('12GB') |
| def test_conv_large_nosplit(self, device): |
| # Here we just test the convolution correctly route to the fallback implementation |
| # that is, it does not crash. The correctness of fallback implementation should be |
| # covered in other tests |
| dtype = torch.half if self.device_type == 'cuda' else torch.float |
| conv1 = nn.Conv2d(2, 2, 8, 8).to(device).to(dtype) |
| input_large = torch.randn(1, 2, 1024, 1024 * 1024, dtype=dtype, device=device) |
| conv1(input_large) |
| conv2 = torch.nn.Conv2d(1, 1024, 1, 1).to(device).to(dtype) |
| input_large = torch.randn(1, 1, 2048, 1024 , dtype=dtype, device=device) |
| conv2(input_large) |
| |
| def test_conv_noncontig_weights(self, device): |
| for dim in (1, 2, 3): |
| for grouped in (False, True): |
| nc = 3 |
| groups = 3 if grouped else 1 |
| w = torch.randn([3] * dim, device=device) |
| w = w.expand([nc, int(nc / groups)] + list(w.shape)) |
| w = w.detach().requires_grad_() |
| x = torch.randn([1, nc] + ([5] * dim), device=device, requires_grad=True) |
| y = getattr(F, 'conv{}d'.format(dim))(x, w, groups=groups) |
| y.sum().backward() |
| y = getattr(F, 'conv_transpose{}d'.format(dim))(x, w, groups=groups) |
| y.sum().backward() |
| |
| def test_conv_noncontig_weights_and_bias(self, device): |
| # need floats to exercise https://github.com/pytorch/pytorch/issues/16018 |
| for bias in [True, False]: |
| conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3, |
| bias=bias).to(device, torch.float) |
| |
| input_nc = torch.randn((1, 3, 224, 224, 2), device=device, dtype=torch.float)[:, :, :, :, 1] |
| input_c = input_nc.contiguous() |
| |
| weight_nc = torch.randn((64, 3, 7, 7, 2), device=device, dtype=torch.float)[:, :, :, :, 1] |
| conv1.weight = nn.Parameter(weight_nc) |
| weight_c = conv1.weight.contiguous() |
| |
| if bias: |
| bias_nc = torch.randn((64, 2), device=device, dtype=torch.float)[:, 1] |
| conv1.bias = nn.Parameter(bias_nc) |
| bias_c = conv1.bias.contiguous() |
| |
| out1 = conv1(input_nc) |
| conv1.weight = nn.Parameter(weight_c) |
| if bias: |
| conv1.bias = nn.Parameter(bias_c) |
| out2 = conv1(input_c) |
| self.assertEqual(out1, out2) |
| |
| @onlyCUDA |
| @tf32_on_and_off(0.005) |
| def test_grid_sample_large(self, device): |
| def issue_35202(): |
| input_tensor = torch.rand(1, 1, 480, 640, dtype=torch.float, device=device, requires_grad=True) |
| coords = torch.tensor([[-10059144, 67680944], [67680944, 67680944]], dtype=torch.float, device=device) |
| coords = coords.unsqueeze(0).unsqueeze(0).repeat(1, 1, 1, 1) |
| result = torch.nn.functional.grid_sample(input_tensor, coords) |
| self.assertEqual(result, torch.tensor([[[[0., 0.]]]], dtype=torch.float, device=device)) |
| result.backward(torch.ones_like(result)) |
| torch.cuda.synchronize() |
| issue_35202() |
| |
| def issue_24823_1(dtype): |
| image = torch.arange(27, 0, -1, dtype=dtype, device=device).view(1, 1, 3, 3, 3) |
| image.requires_grad_() |
| grid = torch.nn.functional.affine_grid( |
| torch.tensor([[[1, 0, 0, 0], [0, 1, 0, 0], [0, 0, 1, 0]]], dtype=dtype, device=device), |
| (1, 1, 3, 3, 3)) |
| grid[:, 1, 1, 1, 0] = float('inf') |
| result = torch.nn.functional.grid_sample(image, grid, padding_mode='zeros') |
| self.assertEqual(result, torch.tensor([[[[[27., 26., 25.], [24., 23., 22.], [21., 20., 19.]], |
| [[18., 17., 16.], [15., 0., 13.], [12., 11., 10.]], |
| [[9., 8., 7.], [6., 5., 4.], [3., 2., 1.]]]]], |
| device=device, dtype=dtype)) |
| result.backward(torch.ones_like(result)) |
| expected_grad = torch.ones_like(image) |
| expected_grad[0, 0, 1, 1, 1] = 0 |
| self.assertEqual(image.grad, expected_grad, atol=0.005, rtol=0) |
| issue_24823_1(torch.half) |
| issue_24823_1(torch.float) |
| issue_24823_1(torch.double) |
| |
| def issue_24823_2(): |
| param = torch.tensor([[[-1.0e+20, 0.0, 0.0], [0.0, -1.0e+20, 0.0]]], dtype=torch.float, device=device) |
| img = torch.zeros((1, 1, 4, 4), dtype=torch.float, device=device, requires_grad=True) |
| grid = torch.nn.functional.affine_grid(param, img.size()) |
| result = torch.nn.functional.grid_sample(img, grid) |
| self.assertEqual(result, torch.zeros(1, 1, 4, 4, device=device, dtype=torch.float)) |
| result.backward(torch.ones_like(result)) |
| torch.cuda.synchronize() |
| issue_24823_2() |
| |
| @onlyCUDA |
| @expectedAlertNondeterministic('grid_sampler_2d_backward_cuda', fn_has_device_arg=False) |
| def test_grid_sample_2d_alert_nondeterministic(self, device): |
| input = torch.empty(1, 1, 2, 2, device=device) |
| grid = torch.empty(1, 1, 1, 2, device=device) |
| input.requires_grad = True |
| output = F.grid_sample(input, grid, align_corners=False) |
| output.sum().backward() |
| |
| @onlyCUDA |
| @expectedAlertNondeterministic('grid_sampler_3d_backward_cuda', fn_has_device_arg=False) |
| def test_grid_sample_3d_alert_nondeterministic(self, device): |
| input = torch.empty(1, 1, 2, 2, 2, device=device) |
| grid = torch.empty(1, 1, 1, 2, 3, device=device) |
| input.requires_grad = True |
| output = F.grid_sample(input, grid, align_corners=False) |
| output.sum().backward() |
| |
| @dtypes(torch.float, torch.double) |
| @largeTensorTest(lambda self, device, dtype: |
| # Compute sum of the large tensor sizes: |
| # (im.numel() + small_image.numel() + small_image.grad.numel() + |
| # large_view.grad.numel()) * sizeof(dtype) |
| 32769 * (65536 + 3 * 65536 / 128) * |
| torch.tensor([], dtype=dtype).element_size()) |
| def test_grid_sample_large_index_2d(self, device, dtype): |
| # Test 64-bit indexing with grid_sample (gh-41656) |
| # Try accessing the corners, there should be no segfault |
| coords = torch.tensor([[[-1., -1.], |
| [+1., -1.]], |
| |
| [[-1., +1.], |
| [+1., +1.]]], device=device, dtype=dtype) |
| coords = coords.expand(1, 2, 2, 2) |
| im = torch.zeros([1, 1, 32769, 65536], device=device, dtype=dtype) |
| |
| # Compare sampling with large strides to the same op on a contiguous tensor |
| coords = torch.rand(1, 4, 4, 2, device=device, dtype=dtype) |
| large_view = im[..., 127::128] |
| small_image = torch.rand_like(large_view) |
| large_view[...] = small_image |
| large_view.requires_grad, small_image.requires_grad = True, True |
| self.assertTrue( |
| sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31, |
| msg="View must use 64-bit indexing") |
| for mode, padding_mode, align_corners in itertools.product( |
| ('nearest', 'bilinear', 'bicubic'), ('zeros', 'border', 'reflection'), (True, False)): |
| a = F.grid_sample( |
| small_image, coords, mode=mode, |
| padding_mode=padding_mode, align_corners=align_corners) |
| a.sum().backward() |
| |
| b = F.grid_sample( |
| large_view, coords, mode=mode, |
| padding_mode=padding_mode, align_corners=align_corners) |
| b.sum().backward() |
| |
| self.assertEqual(a, b) |
| self.assertEqual(small_image.grad, large_view.grad) |
| |
| small_image.grad.zero_() |
| large_view.grad.zero_() |
| |
| @dtypes(torch.float, torch.double) |
| @largeTensorTest(lambda self, device, dtype: |
| # Compute sum of the large tensor sizes: |
| # (im.numel() + small_image.numel() + small_image.grad.numel() + |
| # large_view.grad.numel()) * sizeof(dtype) |
| 2 * 32769 * (32768 + 3 * 32768 / 128) * |
| torch.tensor([], dtype=dtype).element_size()) |
| def test_grid_sample_large_index_3d(self, device, dtype): |
| # Test 64-bit indexing with grid_sample (gh-41656) |
| # Try accessing the corners, there should be no segfault |
| coords = torch.full((1, 2, 2, 2, 3), 1., device=device, dtype=dtype) |
| im = torch.zeros([1, 1, 2, 32769, 32768], device=device, dtype=dtype) |
| |
| result = F.grid_sample(im, coords, align_corners=False) |
| self.assertEqual(result, torch.zeros((1, 1, 2, 2, 2), device=device, dtype=dtype)) |
| |
| # Compare sampling with large strides to the same op on a contiguous tensor |
| coords = torch.rand(1, 1, 4, 4, 3, device=device, dtype=dtype) |
| large_view = im[..., 127::128] |
| small_image = torch.rand_like(large_view) |
| large_view[...] = small_image |
| small_image.requires_grad, large_view.requires_grad = True, True |
| self.assertTrue( |
| sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31, |
| msg="View must use 64-bit indexing") |
| for mode, padding_mode, align_corners in itertools.product( |
| ('nearest', 'bilinear'), ('zeros', 'border', 'reflection'), (True, False)): |
| a = F.grid_sample( |
| small_image, coords, mode=mode, |
| padding_mode=padding_mode, align_corners=align_corners) |
| a.sum().backward() |
| |
| b = F.grid_sample( |
| large_view, coords, mode=mode, |
| padding_mode=padding_mode, align_corners=align_corners) |
| b.sum().backward() |
| |
| self.assertEqual(a, b) |
| self.assertEqual(small_image.grad, large_view.grad) |
| |
| small_image.grad.zero_() |
| large_view.grad.zero_() |
| |
| @onlyCUDA |
| @largeTensorTest('12GB') |
| def test_conv_transposed_large(self, device): |
| dtype = torch.half if self.device_type == 'cuda' else torch.float |
| conv = nn.ConvTranspose2d(1, 1, 1, 1, bias=False).to(device).to(dtype) |
| input_large = torch.randn(4096, 1, 512, 1024, dtype=dtype, device=device) |
| # forward |
| ret = conv(input_large) |
| maxdiff0 = (ret.narrow(0, 0, 1024) - conv(input_large.narrow(0, 0, 1024))).abs_().max().item() |
| maxdiff1 = (ret.narrow(0, 1024, 1024) - conv(input_large.narrow(0, 1024, 1024))).abs_().max().item() |
| maxdiff2 = (ret.narrow(0, 2048, 1024) - conv(input_large.narrow(0, 2048, 1024))).abs_().max().item() |
| maxdiff3 = (ret.narrow(0, 3072, 1024) - conv(input_large.narrow(0, 3072, 1024))).abs_().max().item() |
| self.assertEqual(maxdiff0, 0) |
| self.assertEqual(maxdiff1, 0) |
| self.assertEqual(maxdiff2, 0) |
| self.assertEqual(maxdiff3, 0) |
| |
| @onlyCUDA |
| @skipCUDAIfRocm |
| @largeTensorTest('12GB') |
| def test_conv_large(self, device): |
| dtype = torch.half if self.device_type == 'cuda' else torch.float |
| conv = nn.Conv2d(2, 2, 8, 8, bias=False).to(device).to(dtype) |
| input_large = torch.randn(4097, 2, 512, 512, dtype=dtype, device=device) |
| # forward |
| ret = conv(input_large) |
| self.assertEqual(ret[:2048], conv(input_large[:2048])) |
| self.assertEqual(ret[2048:4096], conv(input_large[2048:4096])) |
| self.assertEqual(ret[4096:], conv(input_large[4096:])) |
| |
| # backward |
| conv.zero_grad() |
| # When computing the backward, we are using the `max(dim=1)`` to create |
| # some sparsity. Without this sparsity, the rounding error would be |
| # too large (as large as 1e-5) to satisfy the creterion (1e-6) of `assertEqual` |
| ret.view(4097, -1).max(dim=1).values.sum().backward() |
| del ret |
| grad1 = conv.weight.grad.detach().clone() |
| conv.zero_grad() |
| conv(input_large[:2048]).view(2048, -1).max(dim=1).values.sum().backward() |
| conv(input_large[2048:4096]).view(2048, -1).max(dim=1).values.sum().backward() |
| conv(input_large[4096:]).view(1, -1).max(dim=1).values.sum().backward() |
| grad2 = conv.weight.grad.detach().clone() |
| # gradients are at the order of hundreds, we need to scale it to |
| # the order of one so that we can compare |
| scale = 1 / grad1.abs().mean() |
| grad1 = grad1 * scale |
| grad2 = grad2 * scale |
| self.assertEqual(grad1, grad2) |
| |
| def _test_gumbel_softmax_st_shapes(self, device, dtype, shape, dim, count_expected): |
| logits = torch.randn(shape, dtype=torch.float, device=device) |
| logits = logits.to(dtype) |
| |
| y_draw = F.gumbel_softmax(logits, hard=True, dim=dim) |
| |
| # All values positive |
| self.assertGreaterEqual(y_draw.min(), 0) |
| # Shape unchanged |
| self.assertTrue(y_draw.shape == logits.shape) |
| # One choice per draw |
| self.assertEqual(y_draw.sum(), count_expected, atol=torch.finfo(y_draw.dtype).eps, rtol=0) |
| |
| def _test_gumbel_softmax_straight_through(self, device, dtype): |
| num_draws = 100 |
| |
| logits = torch.tensor([[0.2, 0.8, 0.1]], device=device) |
| logits = logits.reshape([1, 3]) |
| logits = logits.to(dtype).requires_grad_() |
| probs = logits.softmax(dim=-1) |
| |
| counts = torch.zeros_like(logits) |
| for _ in range(num_draws): |
| y_draw = F.gumbel_softmax(logits, hard=True) |
| counts = counts + y_draw |
| |
| # All values positive |
| self.assertGreaterEqual(y_draw.min(), 0) |
| # Each experiment should result in 1 draw. |
| self.assertEqual(counts.sum(), num_draws, atol=torch.finfo(counts.dtype).eps, rtol=0) |
| |
| # check results is asymptotically as expected. |
| expected = probs * num_draws |
| # ~z is approximately N(0,1) for unbiased count |
| z = (counts - expected) / (expected * (1 - probs)).sqrt() |
| # A (lazy) approximate 99% two-sided test: |
| # occurs with prob alpha~>=0.01 if unbiased |
| self.assertLess(z.abs().max().item(), 2.58) |
| |
| def _test_gumbel_softmax_grad(self, device, dtype): |
| # "hard" and "not hard" should propagate same gradient. |
| logits_soft = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True) |
| logits_hard = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True) |
| |
| seed = torch.random.get_rng_state() |
| y_soft = F.gumbel_softmax(logits_soft, hard=False) |
| torch.random.set_rng_state(seed) |
| y_hard = F.gumbel_softmax(logits_hard, hard=True) |
| |
| y_soft.sum().backward() |
| y_hard.sum().backward() |
| |
| # 2eps = 1x addition + 1x subtraction. |
| tol = 2 * torch.finfo(dtype).eps |
| self.assertEqual(logits_soft.grad, logits_hard.grad, atol=tol, rtol=0) |
| |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| @dtypes(torch.float, torch.double) |
| def test_gumbel_softmax(self, device, dtype): |
| self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=0, count_expected=1) |
| self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=-1, count_expected=1) |
| self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4], dim=1, count_expected=5) |
| self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=1, count_expected=5 * 3) |
| self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=-1, count_expected=5 * 4) |
| self._test_gumbel_softmax_straight_through(device, dtype) |
| self._test_gumbel_softmax_grad(device, dtype) |
| |
| def _test_rnn_retain_variables(self, device, dtype): |
| rnns = [nn.LSTM(10, 20, num_layers=2).to(device, dtype), |
| nn.GRU(10, 20, num_layers=2).to(device, dtype), |
| nn.RNN(10, 20, num_layers=2).to(device, dtype)] |
| for rnn in rnns: |
| input = torch.randn(5, 6, 10, device=device, dtype=dtype, requires_grad=True) |
| output = rnn(input) |
| output[0].sum().backward(retain_graph=True) |
| grads = [input.grad.data.clone()] + [p.grad.data.clone() for p in rnn.parameters()] |
| for _ in range(4): |
| rnn.zero_grad() |
| input.grad.data.zero_() |
| output[0].sum().backward(retain_graph=True) |
| grads2 = [input.grad.data] + [p.grad.data for p in rnn.parameters()] |
| self.assertEqual(grads, grads2) |
| |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| @dtypes(torch.double) |
| def test_rnn_retain_variables(self, device, dtype): |
| self._test_rnn_retain_variables(device, dtype) |
| |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_rnn_retain_variables(device, dtype) |
| |
| @onlyCUDA |
| def test_upsamplingNearest1d_launch_config(self, device): |
| m = nn.Upsample(scale_factor=2) |
| inp = torch.rand(2**25, 1, 1, device=device) |
| out = m(inp) |
| inp_ref = inp.cpu() |
| out_ref = m(inp_ref) |
| self.assertEqual(out_ref, out) |
| |
| @onlyCUDA |
| def test_upsamplingNearest2d_launch_config(self, device): |
| m = nn.Upsample(scale_factor=2) |
| inp = torch.rand(2**25, 1, 1, 1, device=device) |
| out = m(inp) |
| inp_ref = inp.cpu() |
| out_ref = m(inp_ref) |
| self.assertEqual(out_ref, out) |
| |
| @onlyCUDA |
| def test_upsamplingNearest3d_launch_config(self, device): |
| m = nn.Upsample(scale_factor=2) |
| inp = torch.rand(2**25, 1, 1, 1, 1, device=device) |
| out = m(inp) |
| inp_ref = inp.cpu() |
| out_ref = m(inp_ref) |
| self.assertEqual(out_ref, out) |
| |
| @unittest.expectedFailure |
| @skipIfRocm |
| @onlyCUDA |
| def test_upsamplingNearest2d_launch_fail(self, device): |
| m = nn.Upsample(scale_factor=2) |
| # launch grid_y == 2**16 (larger than maximum y-dimension limit 65535) |
| inp = torch.rand(1, 1, 2**15, 2**8, device=device) |
| out = m(inp) |
| |
| @onlyCUDA |
| @skipCUDAIfNotRocm |
| def test_upsamplingNearest2d_launch_rocm(self, device): |
| # test_upsamplingNearest2d_launch_fail should run OK on ROCm |
| m = nn.Upsample(scale_factor=2) |
| inp = torch.rand(1, 1, 2**15, 2**8, device=device) |
| out = m(inp) |
| |
| @onlyCUDA |
| @skipCUDAIfCudnnVersionLessThan(7600) |
| def test_CTCLoss_cudnn(self, device): |
| target_lengths = [30, 25, 20] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int) |
| log_probs = torch.randn(50, 3, 15, dtype=torch.float, device=device).log_softmax(2) |
| res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths) |
| expected = ctcloss_reference(log_probs, targets.cuda(), input_lengths, target_lengths).float() |
| with torch.backends.cudnn.flags(enabled=False): |
| res2 = torch.nn.functional.ctc_loss(log_probs, targets.cuda().long(), input_lengths, target_lengths) |
| self.assertEqual(res, expected) |
| self.assertEqual(res2, res) |
| |
| @onlyCUDA |
| @skipCUDAIfNoCudnn |
| def test_contig_wrong_stride_cudnn(self, device): |
| # x has to have batch_size 1 to test contiguous checks |
| x = torch.randn(1, 16, 5, 5, device=device) |
| stride = list(x.stride()) |
| stride[0] = 20 |
| # change the stride in dimension 0. the tensor is still contiguous because size[0] is 1 |
| x.set_(x.storage(), 0, x.size(), stride) |
| self.assertTrue(x.is_contiguous()) |
| F.conv_transpose2d(x, torch.randn(16, 1, 1, 1, device=device)) |
| F.conv2d(x, torch.randn(1, 16, 1, 1, device=device)) |
| |
| @onlyCUDA |
| def test_Conv2d_size_1_kernel(self, device): |
| x_cpu = torch.randn(2, 3, 5, 5) |
| conv_cpu = torch.nn.Conv2d(3, 3, kernel_size=1) |
| y_cpu = conv_cpu(x_cpu) |
| y = torch.rand_like(y_cpu) |
| y_cpu.backward(y) |
| |
| with cudnn.flags(enabled=False): |
| conv_cuda = torch.nn.Conv2d(3, 3, kernel_size=1).to(device) |
| conv_cuda.bias.data.copy_(conv_cpu.bias.data) |
| conv_cuda.weight.data.copy_(conv_cpu.weight.data) |
| y_cuda = conv_cuda(x_cpu.to(device)) |
| y_cuda.backward(y.to(device)) |
| |
| self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| |
| @onlyCUDA |
| def test_ConvTranspose2d_size_1_kernel(self, device): |
| x_cpu = torch.randn(2, 3, 5, 5) |
| conv_cpu = torch.nn.ConvTranspose2d(3, 3, kernel_size=1) |
| y_cpu = conv_cpu(x_cpu) |
| y = torch.rand_like(y_cpu) |
| y_cpu.backward(y) |
| |
| with cudnn.flags(enabled=False): |
| conv_cuda = torch.nn.ConvTranspose2d(3, 3, kernel_size=1).to(device) |
| conv_cuda.bias.data.copy_(conv_cpu.bias.data) |
| conv_cuda.weight.data.copy_(conv_cpu.weight.data) |
| y_cuda = conv_cuda(x_cpu.to(device)) |
| y_cuda.backward(y.to(device)) |
| |
| self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| |
| @onlyCUDA |
| def test_ConvTranspose3d_size_1_kernel(self, device): |
| x_cpu = torch.randn(2, 3, 3, 5, 5) |
| conv_cpu = torch.nn.ConvTranspose3d(3, 3, kernel_size=1) |
| y_cpu = conv_cpu(x_cpu) |
| y = torch.rand_like(y_cpu) |
| y_cpu.backward(y) |
| |
| with cudnn.flags(enabled=False): |
| conv_cuda = torch.nn.ConvTranspose3d(3, 3, kernel_size=1).to(device) |
| conv_cuda.bias.data.copy_(conv_cpu.bias.data) |
| conv_cuda.weight.data.copy_(conv_cpu.weight.data) |
| y_cuda = conv_cuda(x_cpu.to(device)) |
| y_cuda.backward(y.to(device)) |
| |
| self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False) |
| |
| def _ordered_sequence(self, device, dtype): |
| """Create ordered list of random sequences""" |
| seqs = [torch.empty(random.randint(1, 6), device=device, dtype=dtype) |
| for _ in range(5)] |
| seqs = [s.random_(-128, 128) for s in seqs] |
| ordered = sorted(seqs, key=len, reverse=True) |
| return ordered |
| |
| def _padded_sequence(self, device, dtype): |
| """Create Tensor of random padded sequences""" |
| ordered = self._ordered_sequence(device, dtype) |
| lengths = [len(i) for i in ordered] |
| padded_tensor = rnn_utils.pad_sequence(ordered) |
| return padded_tensor, lengths |
| |
| @onlyCUDA |
| def test_device_mask(self, device): |
| for enforce_sorted in [True, False]: |
| padded, lengths = self._padded_sequence('cpu', torch.float) |
| packed = rnn_utils.pack_padded_sequence( |
| padded, lengths, enforce_sorted=enforce_sorted) |
| self.assertFalse(packed.is_cuda) |
| packed = packed.to(device) |
| self.assertTrue(packed.is_cuda) |
| unpacked, _ = rnn_utils.pad_packed_sequence(packed) |
| self.assertTrue(unpacked.is_cuda) |
| self.assertEqual(unpacked.dtype, torch.float) |
| |
| @onlyCUDA |
| def test_overwrite_module_params_on_conversion_cpu_device(self, device): |
| # Test that under the current default settings |
| # (`torch.__future__.get_overwrite_module_params_on_conversion() == False`), |
| # a view to a module's parameters is not pointing to the same storage as |
| # its base variable after converting the module to a different device. |
| m = nn.Linear(20, 10) |
| mw = m.weight[:] |
| m.to(device) |
| with torch.no_grad(): |
| # Without using `torch.no_grad()`, this will leak CUDA memory. |
| # (Issue is filed at https://github.com/pytorch/pytorch/issues/21875) |
| mw[0][0] = 5 |
| self.assertTrue(mw[0][0].device.type == "cpu") |
| self.assertTrue(mw._base[0][0].device.type == "cuda") |
| |
| try: |
| torch.__future__.set_overwrite_module_params_on_conversion(True) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # a view to a module's parameters is still pointing to the same storage as |
| # its base variable after converting the module to a different device. |
| m = nn.Linear(20, 10) |
| mw = m.weight[:] |
| m.to(device) |
| with torch.no_grad(): |
| mw[0][0] = 5 |
| self.assertTrue(mw[0][0] == mw._base[0][0]) |
| |
| # Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`, |
| # `cpu_module.to("cuda")` doesn't preserve previous references to |
| # `cpu_module`'s parameters or gradients. |
| m = nn.Linear(20, 10) |
| m.weight.grad = torch.randn(10, 20) |
| weight_ref = m.weight |
| weight_grad_ref = m.weight.grad |
| m.to(device) |
| self.assertNotEqual(weight_ref.device, m.weight.device) |
| self.assertNotEqual(weight_grad_ref.device, m.weight.grad.device) |
| finally: |
| torch.__future__.set_overwrite_module_params_on_conversion(False) |
| |
| @onlyCUDA |
| @dtypes(*ALL_TENSORTYPES2) |
| def test_embedding_max_norm_device(self, device, dtype): |
| embedding = nn.Embedding(22, 5, max_norm=1.0).to(device, dtype=dtype) |
| # nn.Embedding only takes LongTensor as input |
| input = torch.tensor([2, 8, 8, 6], device=device, dtype=torch.long) |
| output = embedding(input) |
| self.assertEqual(output[1], output[2]) |
| self.assertTrue(output.data.norm(p=2, dim=1).le(1).all()) |
| |
| # Test fails on Vg20 |
| @skipCUDAIfRocm |
| @onlyCUDA |
| @dtypes(torch.half, torch.float) |
| def test_softmax(self, device, dtype): |
| input = torch.rand(32, 100, device=device, dtype=dtype, requires_grad=True) |
| inputf = input.to(torch.float).detach().requires_grad_(True) |
| out = F.softmax(input, dim=-1, dtype=torch.float) |
| outf = F.softmax(inputf, dim=-1) |
| # should be bitwise equal |
| self.assertEqual(out, outf, atol=0, rtol=0) |
| gO = torch.empty_like(outf).uniform_() |
| out.backward(gO) |
| outf.backward(gO) |
| # should be bitwise equal |
| self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0, rtol=0) |
| |
| @onlyCUDA |
| def test_pool3d_size_one_feature_dim(self, device): |
| # Tests crazy strides for feature dim of size 1 |
| x = torch.randn(7, 1, 5, 3, 2, device=device) |
| strange_strides = [30, 1234, 6, 2, 1] |
| y = x.as_strided(x.size(), strange_strides) |
| x = x.cpu().as_strided(x.size(), strange_strides) |
| |
| to_test = { |
| 'max_pool3d': lambda t: F.max_pool3d(t, (5, 1, 1), stride=(5, 1, 1)), |
| 'avg_pool3d': lambda t: F.avg_pool3d(t, (5, 1, 1), stride=(5, 1, 1)), |
| } |
| |
| for test, fn in to_test.items(): |
| # Should not crash |
| out_y = fn(y) |
| out_x = fn(x) |
| self.assertEqual(out_y, out_x.to(device), msg=test) |
| |
| @onlyCUDA |
| def test_AvgPool3d_backward_after_cat_dim1_device(self, device): |
| # x has to have batch_size 1 to test contiguous checks |
| x = torch.randn(1, 3, 4, 4, 4, device=device, requires_grad=True) |
| y = F.avg_pool3d(x, kernel_size=3, padding=1, stride=2) |
| |
| grad = torch.randn(y.size(), device=device) |
| # increase the stride in dimension 0. the tensor is still contiguous because size[0] is 1 |
| stride = list(grad.stride()) |
| stride[0] = stride[0] * 2 |
| grad.set_(grad.storage(), 0, grad.size(), stride) |
| assert grad.is_contiguous() |
| |
| y.backward(grad) |
| |
| def test_pooling_size_empty(self, device): |
| t = torch.rand([1, 2, 3, 4], device=device) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool1d(t, [])) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool2d(t, [])) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool3d(t, [])) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool1d(t, [])) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool2d(t, [])) |
| self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool3d(t, [])) |
| |
| @dtypes(torch.int, torch.long) |
| def test_embedding_bag_empty_input(self, device, dtype): |
| m = 4 |
| n = 3 |
| x = torch.tensor([], device=device, dtype=dtype) |
| for sparse in [True, False]: |
| Embed = torch.nn.EmbeddingBag(m, n, sparse=sparse) |
| Embed.to(device) |
| |
| output = Embed(input=x, offsets=torch.tensor([0], device=device, dtype=dtype)) |
| self.assertEqual(output, torch.zeros_like(output)) |
| |
| output = Embed(input=x, offsets=torch.tensor([0, 0], device=device, dtype=dtype)) |
| self.assertEqual(output, torch.zeros_like(output)) |
| |
| @dtypes(torch.int, torch.long) |
| def test_EmbeddingBag_per_sample_weights_failures(self, device, dtype): |
| # Failure 1: mismatched embeddings / per_sample_weights dtype |
| es = nn.EmbeddingBag(5, 2, mode='sum').to(dtype=torch.float, device=device) |
| input = torch.tensor([3, 1, 1, 1, 4, 0], dtype=dtype, device=device) |
| offsets = torch.tensor([0, 0, 3, 3, 6], dtype=dtype, device=device) |
| per_sample_weights = torch.randn_like(input, dtype=torch.double, device=device) |
| if device == 'cpu': |
| with self.assertRaisesRegex(RuntimeError, 'have the same type as'): |
| es(input, offsets, per_sample_weights) |
| else: |
| with self.assertRaisesRegex(RuntimeError, 'expected scalar type'): |
| es(input, offsets, per_sample_weights) |
| |
| # Failure 2.1: input/per_sample_weights have different sizes (1d input) |
| input = torch.tensor([3, 1, 1, 1, 4, 0], dtype=dtype, device=device) |
| offsets = torch.tensor([0, 0, 3, 3, 6], dtype=dtype, device=device) |
| per_sample_weights = torch.randn(5, dtype=torch.float, device=device) |
| with self.assertRaisesRegex(ValueError, 'same shape as the input'): |
| es(input, offsets, per_sample_weights) |
| |
| # Failure 2.2: input/per_sample_weights have different sizes (2d input) |
| input = torch.randint(5, (7, 3), dtype=dtype, device=device) |
| offsets = None |
| per_sample_weights = torch.randn(7 * 3, dtype=torch.float, device=device) |
| with self.assertRaisesRegex(ValueError, 'same shape as the input'): |
| es(input, offsets, per_sample_weights) |
| |
| # Failure 3: Unsupported per_sample_weights and mode=('max', 'mean') |
| for unsupported_mode in ('max', 'mean'): |
| es = nn.EmbeddingBag(5, 2, mode=unsupported_mode).to( |
| dtype=torch.float, device=device) |
| input = torch.randint(5, (7, 3), dtype=dtype, device=device) |
| offsets = None |
| per_sample_weights = torch.randn(7, 3, dtype=torch.float, device=device) |
| with self.assertRaisesRegex(NotImplementedError, |
| "only supported for mode='sum'"): |
| es(input, offsets, per_sample_weights) |
| |
| def _embedding_bag_reference_impl(self, input, weight, offsets=None, mode='sum', |
| per_sample_weights=None, include_last_offset=False): |
| assert mode == 'sum' or per_sample_weights is None |
| assert offsets is not None |
| if per_sample_weights is None: |
| per_sample_weights = torch.ones(input.size()).to( |
| dtype=weight.dtype, device=weight.device |
| ) |
| assert input.numel() == per_sample_weights.numel() |
| |
| bags = [] |
| long_input = input.to(torch.long) |
| embeddings = weight.index_select(0, long_input) * per_sample_weights.unsqueeze(1) |
| if include_last_offset: |
| for index in range(len(offsets) - 1): |
| offset = offsets[index] |
| next_offset = offsets[index + 1] |
| length = next_offset - offset |
| if length == 0: |
| bags.append( |
| torch.Tensor([0] * weight.size(1)).to( |
| dtype=embeddings.dtype, device=embeddings.device |
| ) |
| ) |
| else: |
| if mode == 'sum': |
| bags.append(embeddings.narrow(0, offset, length).sum(0)) |
| elif mode == 'mean': |
| bags.append(embeddings.narrow(0, offset, length).sum(0).div(length)) |
| else: |
| assert mode == 'max' |
| bags.append(embeddings.narrow(0, offset, length).max(0)[0]) |
| else: |
| for index, offset in enumerate(offsets): |
| if index + 1 < len(offsets): |
| next_offset = offsets[index + 1] |
| else: |
| next_offset = len(long_input) |
| length = next_offset - offset |
| if length == 0: |
| bags.append( |
| torch.Tensor([0] * weight.size(1)).to( |
| dtype=embeddings.dtype, device=embeddings.device |
| ) |
| ) |
| else: |
| if mode == 'sum': |
| bags.append(embeddings.narrow(0, offset, length).sum(0)) |
| elif mode == 'mean': |
| bags.append(embeddings.narrow(0, offset, length).sum(0).div(length)) |
| else: |
| assert mode == 'max' |
| bags.append(embeddings.narrow(0, offset, length).max(0)[0]) |
| return torch.stack(bags) |
| |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.float, torch.double, torch.half))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_EmbeddingBag_empty_per_sample_weights_and_offsets(self, device, dtypes): |
| # Test empty input and per sample weight, and backward pass. There was a CUDA |
| # invalid configuration bug (more context in #46572) |
| def test_per_sample_weights(mode, trainable_scale): |
| es = nn.EmbeddingBag(5, 2, mode=mode).to(dtype=dtypes[1], device=device) |
| es.weight.data.copy_( |
| torch.arange(1, 11, device=device, dtype=dtypes[1]).view_as(es.weight)) |
| input = torch.tensor([], device=device, dtype=dtypes[0]) |
| offsets = torch.tensor([0, 0, 0, 0, 0], device=device, dtype=dtypes[0]) |
| per_sample_weights = torch.randn_like(input, dtype=dtypes[1]) \ |
| .requires_grad_(trainable_scale) |
| ref_per_sample_weights = \ |
| per_sample_weights.detach().requires_grad_(trainable_scale) |
| reference_weights = es.weight.detach().requires_grad_() |
| |
| expected = self._embedding_bag_reference_impl( |
| input, reference_weights, offsets, mode, ref_per_sample_weights) |
| result = es(input, offsets, per_sample_weights) |
| self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| grad = torch.randn_like(expected) |
| result.backward(grad) |
| # the reference impl doesn't have grad fn for empty input; but the grad should |
| # simply be a zero tensor |
| ref_weights_grad = torch.zeros_like(es.weight) |
| self.assertEqual(es.weight.grad, ref_weights_grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| if trainable_scale: |
| ref_per_sample_weights_grad = torch.empty_like(per_sample_weights) |
| self.assertEqual(per_sample_weights.grad, ref_per_sample_weights_grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| modes = ('sum',) |
| trainable_scale = (True, False) |
| for mode, trainable in itertools.product(modes, trainable_scale): |
| test_per_sample_weights(mode, trainable) |
| |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.float, torch.double, torch.half))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_EmbeddingBag_per_sample_weights_and_offsets(self, device, dtypes): |
| def test_per_sample_weights(mode, trainable_scale): |
| es = nn.EmbeddingBag(5, 2, mode=mode).to(dtype=dtypes[1], device=device) |
| es.weight.data.copy_( |
| torch.arange(1, 11, device=device, dtype=dtypes[1]).view_as(es.weight)) |
| input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtypes[0]) |
| offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=dtypes[0]) |
| per_sample_weights = torch.randn_like(input, dtype=dtypes[1]) \ |
| .requires_grad_(trainable_scale) |
| ref_per_sample_weights = \ |
| per_sample_weights.detach().requires_grad_(trainable_scale) |
| reference_weights = es.weight.detach().requires_grad_() |
| |
| expected = self._embedding_bag_reference_impl( |
| input, reference_weights, offsets, mode, ref_per_sample_weights) |
| result = es(input, offsets, per_sample_weights) |
| self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| grad = torch.randn_like(expected) |
| result.backward(grad) |
| expected.backward(grad) |
| self.assertEqual(es.weight.grad, reference_weights.grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| if trainable_scale: |
| self.assertEqual(per_sample_weights.grad, ref_per_sample_weights.grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| modes = ('sum',) |
| trainable_scale = (True, False) |
| for mode, trainable in itertools.product(modes, trainable_scale): |
| test_per_sample_weights(mode, trainable) |
| |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.float, torch.double, torch.half))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_EmbeddingBag_per_sample_weights_and_new_offsets(self, device, dtypes): |
| def test_per_sample_weights_new_offsets(mode, trainable_scale, include_last_offset, has_weight=True): |
| es = nn.EmbeddingBag(5, 2, mode=mode, include_last_offset=include_last_offset).to(dtype=dtypes[1], device=device) |
| es.weight.data.copy_( |
| torch.arange(1, 11, device=device, dtype=dtypes[1]).view_as(es.weight)) |
| input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtypes[0]) |
| offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=dtypes[0]) |
| |
| if include_last_offset: |
| offsets = torch.cat((offsets, torch.tensor([input.size(0)], device=device, dtype=dtypes[0])), 0) |
| |
| if has_weight: |
| per_sample_weights = torch.randn_like(input, device=device, dtype=dtypes[1]) \ |
| .requires_grad_(trainable_scale) |
| ref_per_sample_weights = \ |
| per_sample_weights.detach().requires_grad_(trainable_scale) |
| else: |
| per_sample_weights = None |
| ref_per_sample_weights = None |
| |
| reference_weights = es.weight.detach().requires_grad_() |
| |
| expected = self._embedding_bag_reference_impl( |
| input, reference_weights, offsets, mode, ref_per_sample_weights, include_last_offset) |
| result = es(input, offsets, per_sample_weights) |
| self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| grad = torch.randn_like(expected) |
| result.backward(grad) |
| expected.backward(grad) |
| self.assertEqual(es.weight.grad, reference_weights.grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| if has_weight and trainable_scale: |
| self.assertEqual(per_sample_weights.grad, ref_per_sample_weights.grad, |
| atol=dtype2prec_DONTUSE[dtypes[1]], rtol=0) |
| |
| trainable_scale = (True, False) |
| include_last_offset = (True, False) |
| modes = (('sum', False), ('sum', True), ('max', False), ('mean', False)) |
| for (mode, has_weight), trainable, include_last_offset in itertools.product( |
| modes, trainable_scale, include_last_offset |
| ): |
| test_per_sample_weights_new_offsets( |
| mode, trainable, include_last_offset, has_weight |
| ) |
| |
| def _test_EmbeddingBag_vs_Embedding(self, N, D, B, L, max_norm=None, |
| mode='mean', |
| device='cpu', |
| wdtype=torch.float, |
| dtype=torch.long, |
| test_per_sample_weights=False, |
| trainable_per_sample_weights=False, |
| sparse=False, |
| test_backward=True, |
| backward_prec=None): |
| es = nn.EmbeddingBag(N, D, mode=mode, sparse=sparse, max_norm=max_norm).to(device, wdtype) |
| e = nn.Embedding(N, D, max_norm=max_norm).to(device, wdtype) |
| e.weight.data.copy_(es.weight) |
| input = torch.randint(N, (B, L), device=device, dtype=dtype) |
| offsets = torch.arange(0, B, device=device, dtype=dtype).mul_(L) |
| grad_output = torch.rand(B, D, device=device, dtype=wdtype) |
| |
| if test_per_sample_weights: |
| # To prevent large gradients, weights should sum to 1 for each bag |
| per_sample_weights = \ |
| torch.randn(B, L, device=device, dtype=wdtype).softmax(dim=-1) |
| per_sample_weights_reference = \ |
| per_sample_weights.clone().requires_grad_(trainable_per_sample_weights) |
| per_sample_weights.requires_grad_(trainable_per_sample_weights) |
| output = es(input.view(-1), offsets, per_sample_weights.view(-1)) |
| else: |
| output = es(input.view(-1), offsets) |
| per_sample_weights = None |
| per_sample_weights_reference = None |
| |
| if mode == 'sum': |
| if test_per_sample_weights: |
| ref_output = (e(input) * per_sample_weights_reference.unsqueeze(-1)).sum(1) |
| else: |
| ref_output = e(input).sum(1) |
| elif mode == 'mean': |
| assert not test_per_sample_weights |
| ref_output = e(input).mean(1) |
| elif mode == 'max': |
| assert not test_per_sample_weights |
| ref_output = e(input).max(1)[0] |
| |
| self.assertEqual(output, ref_output, atol=dtype2prec_DONTUSE[wdtype], rtol=0) |
| |
| if not test_backward: |
| return |
| |
| output.backward(grad_output) |
| ref_output.backward(grad_output) |
| es_weight_grad = es.weight.grad.data |
| if sparse: |
| es_weight_grad = es.weight.grad.data.to_dense() |
| |
| # We have more floating point error here because we are dealing with larger numbers |
| if backward_prec is None: |
| needed_prec = dtype2prec_DONTUSE[wdtype] * 3 |
| else: |
| needed_prec = backward_prec |
| |
| self.assertEqual(es_weight_grad, e.weight.grad, atol=needed_prec, rtol=0) |
| |
| if test_per_sample_weights and trainable_per_sample_weights: |
| self.assertEqual(per_sample_weights.grad, per_sample_weights_reference.grad, |
| atol=dtype2prec_DONTUSE[wdtype], rtol=0) |
| |
| @skipCUDAIf(True, "Temporarily disabled. See t54369166") |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.half, torch.float, torch.double))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_EmbeddingBag_per_sample_weights_and_no_offsets(self, device, dtypes): |
| def run_tests(mode, sparse, trainable_per_sample_weights): |
| kwargs = dict(test_per_sample_weights=True, device=device, |
| mode=mode, wdtype=dtypes[1], dtype=dtypes[0], sparse=sparse, |
| trainable_per_sample_weights=trainable_per_sample_weights) |
| |
| # Simple case |
| self._test_EmbeddingBag_vs_Embedding(2, 3, 5, 7, **kwargs) |
| |
| # B * L > 1000 |
| self._test_EmbeddingBag_vs_Embedding(2, 5, 53, 23, **kwargs) |
| |
| # Large num_embedding |
| self._test_EmbeddingBag_vs_Embedding(101, 5, 3, 7, **kwargs) |
| |
| # Large embedding_dim |
| self._test_EmbeddingBag_vs_Embedding(2, 101, 3, 7, **kwargs) |
| |
| modes = ('sum',) |
| sparsity = (True, False) |
| trainable_scale = (True, False) |
| for mode, sparse, trainable_per_sample_weights in \ |
| itertools.product(modes, sparsity, trainable_scale): |
| run_tests(mode, sparse, trainable_per_sample_weights) |
| |
| # Test CUDA Dense on half precision |
| if device == 'cuda': |
| modes = ('sum',) |
| sparsity = (False,) |
| trainable_scale = (True, False) |
| for mode, sparse, trainable_per_sample_weights in \ |
| itertools.product(modes, sparsity, trainable_scale): |
| run_tests(mode, sparse, trainable_per_sample_weights) |
| |
| def _test_EmbeddingBag(self, device, mode, sparse, wdtype=torch.double, dtype=torch.long, test_backward=True): |
| # check a known test example |
| es = nn.EmbeddingBag(5, 2, mode=mode, sparse=sparse).to(device, wdtype) |
| es.weight.data.copy_(torch.arange(1, 11, device=device, dtype=wdtype).view_as(es.weight)) |
| input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtype) |
| offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=dtype) |
| |
| grad_output = torch.tensor( |
| [1, 2, |
| 3, 4], device=device, dtype=wdtype).view(2, 2) |
| grad_output_with_empty = torch.tensor( |
| [99, 99, |
| 1, 2, |
| 99, 99, |
| 3, 4, |
| 99, 99], device=device, dtype=wdtype).view(5, 2) |
| |
| if mode == "sum" or mode == "mean": |
| denominator = 1 if mode == "sum" else 3 |
| expected_output = torch.tensor( |
| [[13, 16], |
| [13, 16]], device=device, dtype=wdtype) / denominator |
| |
| expected_output_with_empty = torch.tensor( |
| [[0, 0], |
| [13, 16], |
| [0, 0], |
| [13, 16], |
| [0, 0]], device=device, dtype=wdtype) / denominator |
| |
| expected_grad_weight = torch.tensor( |
| [[3, 4], |
| [5, 8], |
| [0, 0], |
| [1, 2], |
| [3, 4]], device=device, dtype=wdtype) / denominator |
| elif mode == "max": |
| expected_output = torch.tensor( |
| [[7, 8], |
| [9, 10]], device=device, dtype=wdtype) |
| |
| expected_output_with_empty = torch.tensor( |
| [[0, 0], |
| [7, 8], |
| [0, 0], |
| [9, 10], |
| [0, 0]], device=device, dtype=wdtype) |
| |
| expected_grad_weight = torch.tensor( |
| [[0, 0], |
| [0, 0], |
| [0, 0], |
| [1, 2], |
| [3, 4]], device=device, dtype=wdtype) |
| output = es(input, offsets) |
| output.backward(grad_output_with_empty) |
| |
| es_weight_grad = es.weight.grad.data |
| if sparse: |
| es_weight_grad = es.weight.grad.to_dense() |
| self.assertEqual(output, expected_output_with_empty) |
| self.assertEqual(es_weight_grad, expected_grad_weight, atol=dtype2prec_DONTUSE[wdtype], rtol=0) |
| |
| # check same example except as 2D (2 x 3) |
| input = input.view(2, -1) |
| es.zero_grad() |
| output = es(input) |
| output.backward(grad_output) |
| |
| es_weight_grad = es.weight.grad |
| if sparse: |
| es_weight_grad = es.weight.grad.to_dense() |
| self.assertEqual(output, expected_output) |
| self.assertEqual(es_weight_grad, expected_grad_weight, atol=dtype2prec_DONTUSE[wdtype], rtol=0) |
| |
| # test all empty bags |
| es.zero_grad() |
| inputs = torch.tensor([], dtype=dtype, device=device) |
| offsets = torch.tensor([0, 0, 0, 0], dtype=dtype, device=device) |
| es(inputs, offsets).sum().backward() |
| dense_grad = es.weight.grad |
| if dense_grad.is_sparse: |
| dense_grad = dense_grad.to_dense() |
| self.assertEqual(dense_grad, torch.zeros_like(es.weight)) |
| |
| # now compare EmbeddingBag vs Embedding + Sum/Mean, for constant bag length |
| N, D, B, L = random.randint(1, 100), random.randint(1, 100), random.randint(1, 50), random.randint(1, 50) |
| kwargs = dict(mode=mode, sparse=sparse, device=device, wdtype=wdtype, dtype=dtype, test_backward=test_backward) |
| self._test_EmbeddingBag_vs_Embedding(N, D, B, L, **kwargs) |
| for max_norm in (None, 3): |
| for p in itertools.product([1, 2], repeat=4): |
| self._test_EmbeddingBag_vs_Embedding(*p, max_norm=max_norm, **kwargs) |
| |
| # check that giving illegal input combos raises error |
| es = nn.EmbeddingBag(10, 20, mode=mode, sparse=sparse) |
| input = torch.ones(3, 4, dtype=dtype) |
| offset = torch.arange(0, 3, dtype=dtype) |
| self.assertRaises(ValueError, lambda: es(input, offset)) |
| self.assertRaises(ValueError, lambda: es(input.view(-1))) |
| offset[0] = 1 |
| if self.device_type == "cpu": |
| self.assertRaises(RuntimeError, lambda: es(input.view(-1), offset)) |
| offset[0] = 0 |
| offset[-1] = 100 |
| self.assertRaises(RuntimeError, lambda: es(input.view(-1), offset)) |
| |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.float, torch.double, torch.half))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_embedding_bag_device(self, device, dtypes): |
| self._test_EmbeddingBag(device, 'sum', False, wdtype=dtypes[1], dtype=dtypes[0]) |
| self._test_EmbeddingBag(device, 'mean', False, wdtype=dtypes[1], dtype=dtypes[0]) |
| self._test_EmbeddingBag(device, 'max', False, wdtype=dtypes[1], dtype=dtypes[0]) |
| |
| test_backward = False |
| if self.device_type == 'cuda': |
| # see 'todo' in test_embedding_bag. |
| test_backward = dtypes[1] is not torch.float16 |
| elif self.device_type == 'cpu': |
| # TODO: figure out why precision on sparse embeddings isn't the |
| # same as for dense. |
| test_backward = dtypes[1] is not torch.float |
| |
| self._test_EmbeddingBag(device, 'sum', True, wdtype=dtypes[1], dtype=dtypes[0], test_backward=test_backward) |
| self._test_EmbeddingBag(device, 'mean', True, wdtype=dtypes[1], dtype=dtypes[0], test_backward=test_backward) |
| |
| @dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.float, torch.double, torch.half))) |
| @dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double))) |
| def test_embedding_bag_non_contiguous_weight(self, device, dtypes): |
| weight_tensor = torch.randn(3, 4, dtype=dtypes[1], device=device) |
| |
| weight_tensor_non_contig = weight_tensor[:, :3] # This is non-contiguous strided. |
| weight_tensor_contig = weight_tensor_non_contig.clone().contiguous() # Contig-strided. |
| |
| index = torch.tensor([0, 1, 2], dtype=dtypes[0], device=device) |
| offsets = torch.tensor([0, 2], dtype=dtypes[0], device=device) |
| for mode in ['sum', 'mean', 'max']: |
| output_non_contig = F.embedding_bag( |
| input=index, |
| weight=weight_tensor_non_contig, |
| offsets=offsets, |
| mode=mode, |
| ) |
| output_contig = F.embedding_bag( |
| input=index, |
| weight=weight_tensor_contig, |
| offsets=offsets, |
| mode=mode, |
| ) |
| self.assertEqual(output_non_contig, output_contig) |
| |
| |
| @onlyCUDA |
| @dtypes(torch.int, torch.long) |
| def test_embedding_bag_bfloat16(self, device, dtype): |
| self._test_EmbeddingBag(device, 'sum', True, wdtype=torch.bfloat16, dtype=dtype, test_backward=True) |
| self._test_EmbeddingBag(device, 'mean', True, wdtype=torch.bfloat16, dtype=dtype, test_backward=True) |
| |
| |
| @onlyCUDA |
| @dtypes(torch.half, torch.float, torch.double) |
| def test_multihead_attention_dtype(self, device, dtype): |
| embed_dim = 128 |
| num_heads = 8 |
| sl = 10 |
| bs = 8 |
| model = nn.MultiheadAttention(embed_dim, num_heads).cuda().to(dtype) |
| q = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype) |
| k = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype) |
| v = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype) |
| out = model(q, k, v) |
| self.assertEqual(q.size(), out[0].size()) |
| self.assertEqual(dtype, out[0].dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM)) |
| @dtypes(torch.float) |
| def test_Conv2d_naive_groups(self, device, dtype): |
| # Check that grouped convolutions matches two half convolutions |
| m = nn.Conv2d(4, 4, kernel_size=3, groups=2).to(device, dtype) |
| i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True) |
| output = m(i) |
| grad_output = torch.randn(2, 4, 4, 4, device=device, dtype=dtype) |
| output.backward(grad_output) |
| |
| m1 = nn.Conv2d(2, 2, kernel_size=3).to(device, dtype) |
| m1.weight.data.copy_(m.weight.data[:2]) |
| m1.bias.data.copy_(m.bias.data[:2]) |
| i1 = i.data[:, :2].contiguous().requires_grad_(True) |
| output1 = m1(i1) |
| output1.backward(grad_output[:, :2].contiguous()) |
| |
| m2 = nn.Conv2d(2, 2, kernel_size=3).to(device, dtype) |
| m2.weight.data.copy_(m.weight.data[2:]) |
| m2.bias.data.copy_(m.bias.data[2:]) |
| i2 = i.data[:, 2:].contiguous().requires_grad_(True) |
| output2 = m2(i2) |
| output2.backward(grad_output[:, 2:].contiguous()) |
| |
| self.assertEqual(output, torch.cat([output1, output2], 1)) |
| self.assertEqual(i.grad.data, |
| torch.cat([i1.grad.data, i2.grad.data], 1), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.bias.grad.data, |
| torch.cat([m1.bias.grad.data, m2.bias.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| self.assertEqual(m.weight.grad.data, |
| torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0), |
| atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| |
| def _test_batchnorm_grad(self, device, dtype=torch.double): |
| bs, n_feat, size_feat = 4, 5, 6 |
| input = torch.arange(bs * n_feat * size_feat, device=device, |
| requires_grad=True, dtype=dtype).view(bs, n_feat, size_feat) |
| weight = torch.arange(1, n_feat + 1, device=device, requires_grad=True, dtype=dtype) |
| bias = torch.arange(n_feat, device=device, requires_grad=True, dtype=dtype) |
| running_mean = 1 - torch.arange(n_feat, device=device, dtype=dtype) |
| running_var = 2 * torch.arange(n_feat, device=device, dtype=dtype) |
| for training in [False, True]: |
| _assertGradAndGradgradChecks(self, F.batch_norm, (input, running_mean, running_var, weight, bias, |
| training, 0.1, 0.0001)) |
| |
| def test_batchnorm_grad(self, device): |
| self._test_batchnorm_grad(device) |
| |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_batchnorm_grad(device) |
| |
| |
| def test_hardsigmoid_grad(self, device): |
| inputs = (torch.randn(4, 16, 16, device=device) - 0.5) * 10 |
| inputs.requires_grad = True |
| self.assertTrue(gradcheck(F.hardsigmoid, (inputs,))) |
| |
| # currently fails on XLA |
| @onlyOnCPUAndCUDA |
| def test_hardswish_grad(self, device): |
| inputs = (torch.randn(4, 16, 16, device=device) - 0.5) * 10 |
| inputs.requires_grad = True |
| self.assertTrue(gradcheck(F.hardswish, (inputs,))) |
| |
| |
| def _test_batchnorm_eval(self, device, dtype=torch.float): |
| module = nn.BatchNorm1d(3).to(device, dtype) |
| module.eval() |
| |
| data = torch.rand(4, 3, device=device, dtype=dtype, requires_grad=True) |
| grad = torch.rand(4, 3, device=device, dtype=dtype) |
| |
| # 1st pass |
| res1 = module(data) |
| res1.backward(grad) |
| grad1 = data.grad.clone() |
| |
| # 2nd pass |
| if data.grad is not None: |
| data.grad.data.zero_() |
| |
| res2 = module(data) |
| res2.backward(grad) |
| grad2 = data.grad.clone() |
| self.assertEqual(res1, res2) |
| self.assertEqual(grad1, grad2) |
| |
| # track_running_stats=False |
| module = nn.BatchNorm1d(3, track_running_stats=False).to(device, dtype) |
| |
| data = torch.rand(4, 3, device=device, dtype=dtype, requires_grad=True) |
| grad = torch.rand(4, 3, device=device, dtype=dtype) |
| |
| # 1st pass |
| res1 = module(data) |
| res1.backward(grad) |
| grad1 = data.grad.clone() |
| |
| # set eval |
| module.eval() |
| |
| # 2nd pass |
| if data.grad is not None: |
| data.grad.data.zero_() |
| |
| res2 = module(data) |
| res2.backward(grad) |
| grad2 = data.grad.clone() |
| self.assertEqual(res1, res2) |
| self.assertEqual(grad1, grad2) |
| |
| def test_batchnorm_eval(self, device): |
| self._test_batchnorm_eval(device) |
| |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_batchnorm_eval(device) |
| |
| @onlyCUDA |
| def test_batchnorm_eval_bfloat16(self, device): |
| self._test_batchnorm_eval(device, torch.bfloat16) |
| |
| def _test_batchnorm_simple_average(self, device, dtype): |
| module = nn.BatchNorm1d(3, momentum=None).to(dtype=dtype, device=device) |
| zeros = torch.zeros(3, dtype=dtype, device=device) |
| ones = torch.ones(3, dtype=dtype, device=device) |
| self.assertEqual(module.running_mean, zeros) |
| self.assertEqual(module.running_var, ones) |
| |
| data1 = torch.rand(4, 3, dtype=dtype, device=device) |
| data2 = torch.rand(4, 3, dtype=dtype, device=device) |
| |
| # 1st pass |
| res1 = module(data1) |
| running_mean1 = module.running_mean.clone() |
| running_var1 = module.running_var.clone() |
| self.assertNotEqual(running_mean1, zeros) |
| self.assertNotEqual(running_var1, ones) |
| |
| # reset stats |
| module.reset_running_stats() |
| self.assertEqual(module.running_mean, zeros) |
| self.assertEqual(module.running_var, ones) |
| |
| # 2nd pass |
| res2 = module(data2) |
| running_mean2 = module.running_mean.clone() |
| running_var2 = module.running_var.clone() |
| self.assertNotEqual(running_mean2, zeros) |
| self.assertNotEqual(running_var2, ones) |
| |
| # reset stats |
| module.reset_running_stats() |
| self.assertEqual(module.running_mean, zeros) |
| self.assertEqual(module.running_var, ones) |
| |
| # 3rd (combined) pass |
| res3 = module(data1) |
| res4 = module(data2) |
| self.assertEqual(res3, res1) |
| self.assertEqual(res4, res2) |
| self.assertEqual(module.running_mean, (running_mean1 + running_mean2) / 2) |
| self.assertEqual(module.running_var, (running_var1 + running_var2) / 2) |
| |
| @dtypes(torch.float) |
| def test_batchnorm_simple_average(self, device, dtype): |
| self._test_batchnorm_simple_average(device, dtype) |
| |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_batchnorm_simple_average(device, dtype) |
| |
| def _test_maxpool_indices(self, num_dim, adaptive=False, device="cpu", dtype=torch.float): |
| def expected_indices(dim): |
| if dim == 1: |
| return torch.tensor([1, 3], dtype=torch.double).repeat(2, 2, 1) |
| if dim == 2: |
| return torch.tensor([[5, 7], [13, 15]], dtype=torch.double).repeat(2, 2, 1, 1) |
| |
| def expected_grad(dim): |
| if dim == 1: |
| return torch.tensor([0, 1, 0, 1], dtype=torch.double).repeat(2, 2, 1) |
| grad = expected_grad(dim - 1) |
| zero = torch.zeros(grad.size()) |
| return torch.stack((zero, grad, zero, grad), 2) |
| |
| def expected_output(dim): |
| if dim == 1: |
| return torch.arange(2, 17, 2).view(2, 2, 2) |
| if dim == 2: |
| col = torch.arange(6, 63, 8) |
| return torch.stack([col, col + 2], 1).view(2, 2, 2, 2) |
| |
| if adaptive: |
| cls_name = 'AdaptiveMaxPool{}d'.format(num_dim) |
| else: |
| cls_name = 'MaxPool{}d'.format(num_dim) |
| module_cls = getattr(nn, cls_name) |
| module = module_cls(2, return_indices=True).to(device, dtype=dtype) |
| numel = 4 ** (num_dim + 1) |
| input = torch.arange(1, numel + 1).view(2, 2, *repeat(4, num_dim)).to(device, dtype=dtype) |
| input_var = input.clone().detach().requires_grad_() |
| |
| # Check forward |
| output, indices = module(input_var) |
| if num_dim != 3: |
| expected_indices = expected_indices(num_dim) |
| expected_output = expected_output(num_dim) |
| self.assertEqual(indices.dim(), input.dim()) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(indices.data.squeeze(), expected_indices) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(output.data.squeeze(), expected_output) |
| self.assertTrue(output.requires_grad) |
| self.assertFalse(indices.requires_grad) |
| |
| # Make sure backward works |
| grad_output = torch.ones(output.size(), device=device, dtype=dtype) |
| output.backward(grad_output, retain_graph=True) |
| expected_grad = expected_grad(num_dim) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(input_var.grad.data, expected_grad.view_as(input)) |
| |
| # Make sure backward after changing indices will result in an error |
| indices.add_(1) |
| self.assertRaises(RuntimeError, lambda: output.backward(grad_output)) |
| |
| # Make sure -Infinity is handled correctly |
| t = torch.tensor([[[float("-inf")]]]) |
| m = nn.MaxPool1d(kernel_size=1, return_indices=True) |
| output, indices = m(t) |
| self.assertEqual(output[0, 0, 0], float("-inf")) |
| self.assertEqual(indices[0, 0, 0], 0) |
| |
| t = torch.tensor([[[float("-inf")]]]) |
| m = nn.MaxPool2d(kernel_size=1, return_indices=True) |
| output, indices = m(t) |
| self.assertEqual(output[0, 0, 0], float("-inf")) |
| self.assertEqual(indices[0, 0, 0], 0) |
| |
| t = torch.tensor([[[[float("-inf")]]]]) |
| m = nn.MaxPool3d(kernel_size=1, return_indices=True) |
| output, indices = m(t) |
| self.assertEqual(output[0, 0, 0, 0], float("-inf")) |
| self.assertEqual(indices[0, 0, 0, 0], 0) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_MaxPool1d_indices(self, device, dtype): |
| self._test_maxpool_indices(1, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_MaxPool2d_indices(self, device, dtype): |
| self._test_maxpool_indices(2, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_MaxPool3d_indices(self, device, dtype): |
| self._test_maxpool_indices(3, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_AdaptiveMaxPool1d_indices(self, device, dtype): |
| self._test_maxpool_indices(1, adaptive=True, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_AdaptiveMaxPool2d_indices(self, device, dtype): |
| self._test_maxpool_indices(2, adaptive=True, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_AdaptiveMaxPool3d_indices(self, device, dtype): |
| self._test_maxpool_indices(3, adaptive=True, device=device, dtype=dtype) |
| |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| @dtypes(torch.float) |
| @onlyOnCPUAndCUDA # TODO: Fails on XLA |
| def test_max_pool_nan_inf(self, device, dtype): |
| for adaptive in ['', 'adaptive_']: |
| for num_dim in [1, 2, 3]: |
| fn_name = '{}max_pool{}d'.format(adaptive, num_dim) |
| fn = getattr(F, fn_name) |
| |
| x = torch.full([1, 1] + num_dim * [3], nan, device=device, dtype=dtype, requires_grad=True) |
| res = fn(x, 1 if adaptive else 3) |
| res.backward(torch.randn_like(res)) |
| self.assertTrue(math.isnan(res.item())) |
| x.requires_grad_(False) |
| res = fn(x, 1 if adaptive else 3) |
| self.assertTrue(math.isnan(res.item())) |
| |
| x2 = torch.full([1, 1] + num_dim * [3], -inf, device=device, dtype=dtype, requires_grad=True) |
| res2 = fn(x2, 1 if adaptive else 3) |
| res2.backward(torch.randn_like(res2)) |
| self.assertTrue(math.isinf(res2.item())) |
| x2.requires_grad_(False) |
| res2 = fn(x2, 1 if adaptive else 3) |
| self.assertTrue(math.isinf(res2.item())) |
| |
| @onlyOnCPUAndCUDA |
| @dtypes(torch.float, torch.double) |
| def test_grid_sample_nan_inf(self, device, dtype): |
| input = torch.zeros([1, 1, 3, 3], device=device, dtype=dtype) |
| grid = torch.tensor([[[[nan, 0], [0, inf]]]], device=device, dtype=dtype) |
| for padding_mode in ('reflection', 'border', 'zeros'): |
| sample = torch.nn.functional.grid_sample(input=input, grid=grid, mode='nearest', |
| padding_mode=padding_mode, align_corners=False) |
| self.assertEqual(sample, torch.zeros([1, 1, 1, 2], device=device, dtype=dtype)) |
| |
| |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| @dtypes(torch.float) |
| @onlyOnCPUAndCUDA # TODO: Fails on XLA |
| def test_fractional_max_pool_nan_inf(self, device, dtype): |
| for num_dim in [2, 3]: |
| fn_name = 'FractionalMaxPool{}d'.format(num_dim) |
| fn = getattr(nn, fn_name)(kernel_size=2, output_size=1) |
| x = torch.full([1, 1] + num_dim * [3], nan, device=device, dtype=dtype, requires_grad=True) |
| res = fn(x) |
| res.backward(torch.randn_like(res)) |
| self.assertTrue(math.isnan(res.item())) |
| |
| x2 = torch.full([1, 1] + num_dim * [3], -inf, device=device, dtype=dtype, requires_grad=True) |
| res2 = fn(x2) |
| res2.backward(torch.randn_like(res2)) |
| self.assertTrue(math.isinf(res2.item())) |
| |
| @onlyOnCPUAndCUDA # TODO: RuntimeError message different on XLA |
| def test_pooling_zero_stride(self, device): |
| for op in ('max', 'avg'): |
| for num_dim in [1, 2, 3]: |
| fn_name = '{}_pool{}d'.format(op, num_dim) |
| fn = getattr(F, fn_name) |
| x = torch.ones([1, 2] + num_dim * [4], device=device, dtype=torch.float) |
| self.assertRaisesRegex(RuntimeError, r"stride should not be zero|stride must be greater than zero", |
| lambda: fn(x, kernel_size=2, stride=0)) |
| |
| fn_module_name = '{}Pool{}d'.format(op.title(), num_dim) |
| fn_module = getattr(nn, fn_module_name)(kernel_size=2, stride=0) |
| self.assertRaisesRegex(RuntimeError, r"stride should not be zero|stride must be greater than zero", |
| lambda: fn_module(x)) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_pool_large_size(self, device, dtype): |
| for op in ('max', 'avg'): |
| for num_dim in [1, 2, 3]: |
| fn_name = '{}_pool{}d'.format(op, num_dim) |
| fn = getattr(F, fn_name) |
| # 16777217 is the smallest integer not expressible in float32 |
| x = torch.ones([1, 1, 16777217] + (num_dim - 1) * [1], |
| device=device, dtype=dtype) |
| res = fn(x, 1, stride=1, padding=0) |
| # check if the output shape was still computed correctly |
| self.assertEqual(x.shape[2], res.shape[2]) |
| |
| @dtypesIfCUDA(*get_all_fp_dtypes()) |
| @dtypes(torch.float) |
| def test_pool_invalid_size(self, device, dtype): |
| for op in ('max', 'avg'): |
| for num_dim in [1, 2, 3]: |
| fn_name = '{}_pool{}d'.format(op, num_dim) |
| if op == 'max': |
| # New implementation without indices supports empty tensors |
| # TODO(Heitor) change once with_indices code is updated |
| fn_name += '_with_indices' |
| fn = getattr(F, fn_name) |
| # use a configuration that gives zero outputs only |
| # when doing a correct floor division by the stride |
| x = torch.ones([1, 1] + num_dim * [4], |
| device=device, dtype=dtype) |
| with self.assertRaisesRegex(RuntimeError, r"too small|smaller than"): |
| try: |
| res = fn(x, 3, stride=2, padding=0, dilation=2) |
| except TypeError: |
| # some implementations do not support dilation |
| res = fn(x, 6, stride=2, padding=0) |
| |
| def test_CTCLoss_empty_target(self, device): |
| target_lengths = [0, 0, 0] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (0,), dtype=torch.long, device=device) |
| log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2) |
| loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none') |
| self.assertTrue((loss >= 0).all().item()) |
| self.assertEqual(-log_probs.sum(0)[:, 0], loss) |
| |
| target_lengths = [0, 9, 0] |
| input_lengths = [50, 50, 50] |
| targets = torch.randint(1, 15, (9,), dtype=torch.long, device=device) |
| log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2) |
| loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none') |
| self.assertTrue((loss >= 0).all().item()) |
| self.assertEqual(-log_probs.sum(0)[[0, 2], 0], loss[[0, 2]]) |
| |
| def test_empty_dropout(self, device): |
| x = torch.Tensor([]).to(device) |
| out = torch.nn.functional.dropout(x) |
| self.assertEqual(out.size(), x.size()) |
| |
| @dtypesIfCUDA(torch.half, torch.float, torch.double) |
| @dtypes(torch.float) |
| @tf32_on_and_off(0.005) |
| def test_variable_sequence(self, device, dtype): |
| def pad(var, length): |
| if var.size(0) == length: |
| return var |
| return torch.cat([var, var.new_zeros(length - var.size(0), *var.size()[1:])]) |
| |
| def maybe_index_tuple(maybe_tuple_of_tensors, index): |
| if maybe_tuple_of_tensors is None: |
| return None |
| return tuple(maybe_tuple_of_tensors[j][:, index:index + 1, :].contiguous() |
| for j in range(2)) |
| |
| def check_lengths(lengths, enforce_sorted, use_default_hiddens, proj_size): |
| input_size = 3 |
| hidden_size = 4 |
| num_layers = 2 |
| bidirectional = True |
| |
| max_length = max(lengths) |
| x_leaf = torch.randn(max_length, len(lengths), input_size, device=device, |
| dtype=dtype, requires_grad=True) |
| num_directions = 2 if bidirectional else 1 |
| lstm = nn.LSTM(input_size, hidden_size, bidirectional=bidirectional, |
| num_layers=num_layers, proj_size=proj_size).to(device, dtype) |
| lstm2 = deepcopy(lstm).to(device, dtype) |
| x = x_leaf |
| |
| hidden0 = None |
| if not use_default_hiddens: |
| real_hidden_size = hidden_size if proj_size == 0 else proj_size |
| hidden0 = (torch.randn(num_directions * num_layers, len(lengths), real_hidden_size, |
| device=device, dtype=dtype), |
| torch.randn(num_directions * num_layers, len(lengths), hidden_size, |
| device=device, dtype=dtype)) |
| |
| # Compute sequences separately |
| seq_outs = [] |
| seq_hiddens = [] |
| for i, l in enumerate(lengths): |
| hidden_i = maybe_index_tuple(hidden0, i) |
| out, hid = lstm2(x[:l, i:i + 1], hidden_i) |
| out_pad = pad(out, max_length) |
| seq_outs.append(out_pad) |
| seq_hiddens.append(hid) |
| seq_out = torch.cat(seq_outs, 1) |
| seq_hidden = tuple(torch.cat(hids, 1) for hids in zip(*seq_hiddens)) |
| |
| # Use packed format |
| packed = rnn_utils.pack_padded_sequence(x, lengths, enforce_sorted=enforce_sorted) |
| packed_out, packed_hidden = lstm(packed, hidden0) |
| unpacked, unpacked_len = rnn_utils.pad_packed_sequence(packed_out) |
| |
| # Check forward |
| prec = dtype2prec_DONTUSE[dtype] |
| self.assertEqual(packed_hidden, seq_hidden, atol=prec, rtol=0) |
| self.assertEqual(unpacked, seq_out, atol=prec, rtol=0) |
| self.assertEqual(unpacked_len, lengths, atol=prec, rtol=0) |
| |
| # Check backward |
| seq_out.sum().backward() |
| grad_x = x_leaf.grad.data.clone() |
| x_leaf.grad.data.zero_() |
| unpacked.sum().backward() |
| |
| self.assertEqual(x_leaf.grad, grad_x, atol=dtype2prec_DONTUSE[dtype], rtol=0) |
| for p1, p2 in zip(lstm.parameters(), lstm2.parameters()): |
| prec = dtype2prec_DONTUSE[dtype] |
| if dtype == torch.float16: |
| prec = 4e-2 |
| self.assertEqual(p1.grad, p2.grad, atol=prec, rtol=0) |
| |
| tests = [ |
| # enforce_sorted, lengths |
| [True, [5]], |
| [False, [5]], |
| [True, [10, 10, 6, 2, 2, 1, 1]], |
| [False, [10, 10, 6, 2, 2, 1, 1]], |
| [False, [2, 1, 3, 2, 10, 5, 3]], |
| ] |
| |
| rocm_error_msg = "LSTM with projections is not supported with MIOpen" |
| for enforce_sorted, seq_lens, in tests: |
| for use_default_hiddens in (True, False): |
| for proj_size in [0, 2]: |
| # LSTM with projections is not supported with MIOpen |
| if device != 'cpu' and dtype == torch.float32 and TEST_WITH_ROCM and proj_size > 0: |
| with self.assertRaisesRegex(RuntimeError, rocm_error_msg): |
| check_lengths(seq_lens, enforce_sorted, use_default_hiddens, proj_size) |
| else: |
| check_lengths(seq_lens, enforce_sorted, use_default_hiddens, proj_size) |
| |
| def _test_batchnorm_update_stats(self, device, dtype=torch.float): |
| module = nn.BatchNorm1d(3).to(device, dtype) |
| |
| data = torch.rand(4, 3, device=device, dtype=dtype) |
| |
| # training pass |
| old_running_mean = module.running_mean.clone() |
| old_running_var = module.running_var.clone() |
| old_num_batches_tracked = module.num_batches_tracked.clone() |
| module(data) |
| self.assertNotEqual(old_running_mean, module.running_mean) |
| self.assertNotEqual(old_running_var, module.running_var) |
| self.assertEqual(old_num_batches_tracked + 1, module.num_batches_tracked) |
| |
| # eval pass |
| module.eval() |
| old_running_mean = module.running_mean.clone() |
| old_running_var = module.running_var.clone() |
| old_num_batches_tracked = module.num_batches_tracked.clone() |
| module(data) |
| self.assertEqual(old_running_mean, module.running_mean) |
| self.assertEqual(old_running_var, module.running_var) |
| self.assertEqual(old_num_batches_tracked, module.num_batches_tracked) |
| |
| def test_batchnorm_update_stats(self, device): |
| self._test_batchnorm_update_stats(device) |
| |
| if self.device_type == 'cuda' and self.has_cudnn(): |
| with torch.backends.cudnn.flags(enabled=False): |
| self._test_batchnorm_update_stats(device) |
| |
| def test_multi_margin_loss_errors(self, device): |
| self.assertRaises(RuntimeError, |
| lambda: nn.functional.multi_margin_loss(torch.randn(5, device=device), |
| torch.zeros(3, device=device))) |
| |
| def _test_bfloat16_ops(self, op, device, inp_dims=(), prec=1e-2): |
| # fp32 compute |
| input1 = torch.randn(inp_dims, dtype=torch.float32, device=device, requires_grad=True) |
| out1 = op(input1) |
| grad_input1 = torch.randn_like(out1, device=device) |
| out1.backward(grad_input1) |
| |
| # bfloat16 compute |
| op_bfp16 = op.bfloat16() |
| input2 = input1.detach().bfloat16().requires_grad_() |
| grad_input2 = grad_input1.bfloat16() |
| out2 = op_bfp16(input2) |
| out2.backward(grad_input2) |
| |
| self.assertEqual(out1, out2, atol=prec, rtol=0, exact_dtype=False) |
| self.assertEqual(input1.grad.data, input2.grad.data, atol=prec, rtol=0, exact_dtype=False) |
| |
| @onlyCUDA |
| def test_activations_bfloat16(self, device): |
| self._test_bfloat16_ops(torch.nn.ReLU(), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.Threshold(0.1, 20), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.ELU(), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.Softplus(), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.Hardshrink(), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.Softshrink(), device, inp_dims=(5), prec=1e-2) |
| self._test_bfloat16_ops(torch.nn.LeakyReLU(), device, inp_dims=(5), prec=1e-2) |
| |
| @onlyCUDA |
| def test_pooling_bfloat16(self, device): |
| self._test_bfloat16_ops(torch.nn.AvgPool1d(3, stride=2), device, inp_dims=(8, 4, 16), prec=0.05) |
| self._test_bfloat16_ops(torch.nn.AvgPool2d(3, stride=2), device, inp_dims=(8, 4, 16, 16), prec=0.05) |
| self._test_bfloat16_ops(torch.nn.AvgPool3d(3, stride=2), device, inp_dims=(8, 4, 16, 16, 16), prec=0.05) |
| self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool1d(3), device, inp_dims=(8, 4, 16), prec=0.05) |
| self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool2d((3, 5)), device, inp_dims=(8, 4, 16, 16), prec=0.05) |
| self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool3d((3, 5, 7)), device, inp_dims=(8, 4, 16, 16, 16), prec=0.05) |
| |
| @onlyCUDA |
| def test_softmax_bfloat16(self, device): |
| self._test_bfloat16_ops(torch.nn.Softmax(dim=1), device, inp_dims=(16, 32), prec=1e-2) |
| |
| @onlyCUDA |
| @skipCUDAIfRocm |
| @skipCUDAIfCudnnVersionLessThan(7603) |
| @dtypes(torch.half, torch.float) |
| def test_conv_cudnn_nhwc(self, device, dtype): |
| def helper(n, c, h, w, out_channels, kernel_size, groups): |
| input = torch.randint(-3, 3, (n, c, h, w), dtype=dtype, device=device)\ |
| .to(memory_format=torch.channels_last) |
| input.requires_grad_() |
| conv = nn.Conv2d(c, out_channels, kernel_size, groups=groups)\ |
| .to(device='cuda', dtype=dtype, memory_format=torch.channels_last) |
| for p in conv.parameters(): |
| p.data = torch.randint_like(p, -3, 3) |
| |
| # use FP64 channels-first conv as reference |
| ref_input = input.detach().clone().contiguous().double().requires_grad_() |
| ref_conv = nn.Conv2d(c, out_channels, kernel_size, groups=groups) |
| # load_state_dict will restore the stride & memory_layout on ref_conv.weight. |
| ref_conv.load_state_dict(conv.state_dict()) |
| ref_conv = ref_conv.to(device='cuda', dtype=torch.double, memory_format=torch.contiguous_format) |
| |
| out = conv(input) |
| ref_out = ref_conv(ref_input) |
| |
| grad = torch.randint_like(out, -3, 3) |
| ref_grad = grad.detach().clone().double().contiguous() |
| |
| out.backward(grad) |
| ref_out.backward(ref_grad) |
| |
| self.assertTrue(out.is_contiguous(memory_format=torch.channels_last)) |
| self.assertTrue(ref_out.is_contiguous()) |
| self.assertEqual(out, ref_out, exact_dtype=False) |
| self.assertEqual(conv.weight.grad, ref_conv.weight.grad, exact_dtype=False) |
| self.assertEqual(conv.bias.grad, ref_conv.bias.grad, exact_dtype=False) |
| self.assertEqual(input.grad, ref_input.grad, exact_dtype=False) |
| |
| helper(2, 8, 4, 4, out_channels=4, kernel_size=3, groups=1) |
| helper(2, 8, 4, 4, out_channels=8, kernel_size=3, groups=8) |
| helper(1, 16, 56, 56, out_channels=16, kernel_size=3, groups=1) |
| helper(1, 16, 56, 56, out_channels=16, kernel_size=3, groups=16) |
| |
| def _run_conv(self, layer, device, inp, grad, ref_conv, ref_input, ref_out, |
| input_format, weight_format, grad_format, output_format): |
| conv = layer(inp.size(1), grad.size(1), |
| ref_conv.weight.size(2)).float().to(device) |
| # load_state_dict will restore the stride & memory_layout on ref_conv.weight. |
| conv.load_state_dict(ref_conv.state_dict()) |
| weight_data = conv.weight.detach().clone().contiguous(memory_format=weight_format) |
| conv.weight.data = weight_data.resize_(weight_data.size(), memory_format=weight_format) |
| input = inp.clone().contiguous(memory_format=input_format) |
| input.resize_(input.size(), memory_format=input_format) |
| input = input.requires_grad_() |
| grad = grad.contiguous(memory_format=grad_format) |
| grad.resize_(grad.size(), memory_format=grad_format) |
| out = conv(input) |
| out.backward(grad) |
| self.assertTrue(out.is_contiguous(memory_format=output_format)) |
| self.assertEqual(out, ref_out) |
| self.assertEqual(conv.weight.grad, ref_conv.weight.grad) |
| self.assertEqual(conv.bias.grad, ref_conv.bias.grad) |
| self.assertEqual(input.grad, ref_input.grad) |
| |
| def _test_conv_cudnn_nhwc_nchw(self, layer, n, c, h, w, k, filter_size, device): |
| data = torch.randint(1, 10, (n, c, h, w), dtype=torch.float32, device=device) |
| ref_input = data.clone().contiguous().requires_grad_(True) |
| ref_conv = layer(c, k, filter_size).float().to(device) |
| ref_out = ref_conv(ref_input) |
| grad = torch.randint(1, 10, ref_out.size(), dtype=torch.float32, device="cuda") |
| ref_out.backward(grad) |
| |
| for w_f in [torch.contiguous_format, torch.channels_last]: |
| for g_f in [torch.contiguous_format, torch.channels_last]: |
| for input_format in [torch.contiguous_format, torch.channels_last]: |
| output_format = torch.contiguous_format |
| # Older versions of CudNN have Channels Last support disabled |
| if torch.backends.cudnn.version() >= 7603: |
| if input_format == torch.channels_last: |
| output_format = torch.channels_last |
| # This is because we have N111 weight that cannot handle |
| # the ambiguous memory_format |
| if w_f == torch.channels_last: |
| if layer == nn.Conv2d and filter_size * c != 1: |
| output_format = torch.channels_last |
| if layer == nn.ConvTranspose2d and filter_size * k != 1: |
| output_format = torch.channels_last |
| self._run_conv(layer, device, data, grad, ref_conv, ref_input, |
| ref_out, input_format, w_f, g_f, output_format) |
| |
| @onlyCUDA |
| @skipCUDAIfRocm |
| @skipCUDAIfCudnnVersionLessThan(7603) |
| @tf32_on_and_off(0.05) |
| def test_conv_cudnn_mismatch_memory_format(self, device): |
| configs = [ |
| [4, 2, 8, 8, 4, 2], |
| [4, 1, 8, 8, 4, 2], |
| [1, 1, 8, 8, 4, 2], |
| [4, 2, 2, 8, 4, 1], |
| [4, 2, 1, 8, 4, 1], |
| [4, 2, 8, 8, 4, 1], |
| [4, 1, 8, 8, 4, 1], |
| ] |
| for n, c, h, w, k, filter_size in configs: |
| self._test_conv_cudnn_nhwc_nchw(nn.Conv2d, n, c, h, w, k, filter_size, device) |
| self._test_conv_cudnn_nhwc_nchw(nn.ConvTranspose2d, n, c, h, w, k, filter_size, device) |
| |
| # torch.half is erroring out on Windows with CUDA 10.1 + cuDNN 7.6.4 |
| # returning CUDNN_STATUS_BAD_PARAM |
| # Disabling that specific test for now [see issue # 33918] |
| @onlyCUDA |
| @skipCUDAIfRocm |
| @skipCUDAIfNoCudnn |
| @dtypes(torch.float, torch.double) |
| def test_conv_cudnn_nhwc_support(self, device, dtype): |
| input = torch.randn((1, 16, 1, 1), dtype=dtype, device="cuda", requires_grad=True) |
| weight = torch.randn((8, 16, 3, 3), dtype=dtype, device="cuda", requires_grad=True) |
| weight = weight.to(memory_format=torch.channels_last) |
| o = torch.conv2d(input, weight, None, (2, 1), (1, 1), (1, 1), 1) |
| self.assertTrue(o.is_contiguous(memory_format=torch.channels_last)) |
| o.sum().backward() |
| |
| |
| @onlyCUDA |
| @skipCUDAIfRocm |
| @skipCUDAIfCudnnVersionLessThan(7603) |
| def test_convert_conv2d_weight_memory_format(self, device): |
| input = torch.randint(1, 10, (2, 8, 4, 4), dtype=torch.float32, device=device) |
| model = nn.Sequential( |
| nn.Conv2d(8, 4, 3), |
| nn.BatchNorm2d(4)).to(device).float() |
| for memory_format in [torch.channels_last, torch.contiguous_format]: |
| model = nn.utils.convert_conv2d_weight_memory_format(model, memory_format) |
| out = model(input) |
| self.assertTrue(out.is_contiguous(memory_format=memory_format)) |
| |
| model = nn.Sequential( |
| nn.ConvTranspose2d(8, 4, 3), |
| nn.BatchNorm2d(4)).to(device).float() |
| for memory_format in [torch.channels_last, torch.contiguous_format]: |
| model = nn.utils.convert_conv2d_weight_memory_format(model, memory_format) |
| out = model(input) |
| self.assertTrue(out.is_contiguous(memory_format=memory_format)) |
| |
| def test_nll_loss_mismatched_batch(self, device): |
| x = torch.randn((10, 3), requires_grad=True, device=device) |
| # t should have size (10,) |
| t = torch.zeros((3,), dtype=torch.int64, device=device) |
| with self.assertRaisesRegex(ValueError, 'Expected.*batch_size'): |
| F.nll_loss(x, t) |
| |
| def test_nll_loss_out_of_bounds_ignore_index(self, device): |
| x = torch.randn(6, 3, requires_grad=True, device=device) |
| t = torch.tensor([0, 1, 255, 0, 1, 2], dtype=torch.int64, device=device) |
| for reduction in ['mean', 'none']: |
| F.nll_loss(x, t, ignore_index=255, reduction=reduction).sum().backward() |
| |
| def _nll_loss_helper(self, input_size, reduction, expected, device): |
| input = torch.rand(input_size, requires_grad=True, device=device) |
| num_channels = input_size[1] |
| target_size = (input_size[0], ) + tuple(input_size[2:]) |
| target = torch.randint(num_channels, target_size, device=device) |
| |
| output = F.nll_loss(input, target, reduction=reduction) |
| # TODO(#38095): Replace assertEqualIgnoreType. See issue #38095 |
| self.assertEqualIgnoreType(output, expected) |
| |
| output.sum().backward() |
| self.assertEqual(input.grad.size(), input.size()) |
| |
| def test_nll_loss_empty_tensor_reduction_none(self, device): |
| self._nll_loss_helper([0, 3], "none", torch.empty([0], device=device), device) |
| self._nll_loss_helper([0, 3, 5, 7], "none", torch.empty([0, 5, 7], device=device), device) |
| self._nll_loss_helper([2, 3, 0, 7], "none", torch.empty([2, 0, 7], device=device), device) |
| self._nll_loss_helper([2, 3, 5, 0], "none", torch.empty([2, 5, 0], device=device), device) |
| self._nll_loss_helper([2, 3, 5, 7, 0], "none", torch.empty([2, 5, 7, 0], device=device), device) |
| |
| @unittest.skipIf(TEST_WITH_UBSAN, "division-by-zero error with UBSAN") |
| def test_nll_loss_empty_tensor_reduction_mean(self, device): |
| nan = torch.tensor(float('nan'), device=device) |
| self._nll_loss_helper([0, 3], "mean", nan, device) |
| self._nll_loss_helper([0, 3, 5, 7], "mean", nan, device) |
| self._nll_loss_helper([2, 3, 0, 7], "mean", nan, device) |
| self._nll_loss_helper([2, 3, 5, 0], "mean", nan, device) |
| self._nll_loss_helper([2, 3, 5, 7, 0], "mean", nan, device) |
| |
| def test_nll_loss_empty_tensor_reduction_sum(self, device): |
| zero = torch.tensor(0, device=device) |
| self._nll_loss_helper([0, 3], "sum", zero, device) |
| self._nll_loss_helper([0, 3, 5, 7], "sum", zero, device) |
| self._nll_loss_helper([2, 3, 0, 7], "sum", zero, device) |
| self._nll_loss_helper([2, 3, 5, 0], "sum", zero, device) |
| self._nll_loss_helper([2, 3, 5, 7, 0], "sum", zero, device) |
| |
| def test_nll_loss_total_weight_is_zero(self, device): |
| |
| def helper(input_size): |
| input = torch.ones(input_size, requires_grad=True, device=device) |
| num_channels = input_size[1] |
| target_size = (input_size[0], ) + tuple(input_size[2:]) |
| target = torch.zeros(target_size, dtype=torch.long, device=device) |
| weight = torch.zeros([num_channels], device=device) |
| self.assertEqual(F.nll_loss(input, target, weight).item(), 0) |
| |
| helper([2, 3]) |
| helper([2, 3, 5, 7]) |
| helper([2, 3, 5, 7, 9]) |
| |
| def test_softshrink_negative(self, device): |
| input = torch.randn(5, device=device, requires_grad=True) |
| m = torch.nn.Softshrink(-1) |
| with self.assertRaisesRegex(RuntimeError, |
| r'lambda must be greater or equal to 0, but found to be -1\.'): |
| m(input) |
| |
| def test_unfold(self, device): |
| def func(x): |
| return F.unfold(x, kernel_size=(3, 3)) |
| seeds = (13, 256, 811, 43, 7) |
| for sd in seeds: |
| torch.manual_seed(sd) |
| x = torch.randn(1, 1, 5, 5, device=device, requires_grad=True) |
| gradcheck(func, [x]) |
| gradgradcheck(func, [x]) |
| |
| def test_fold(self, device): |
| def func(x): |
| return F.fold(x, output_size=(4, 5), kernel_size=(2, 2)) |
| seeds = (44, 83, 71, 25, 999) |
| for sd in seeds: |
| torch.manual_seed(sd) |
| x = torch.randn(1, 12, 12, device=device, requires_grad=True) |
| gradcheck(func, [x]) |
| gradgradcheck(func, [x]) |
| |
| def test_logsigmoid_out(self, device): |
| # this isn't actually documented, but was broken previously: |
| # https://github.com/pytorch/pytorch/issues/36499 |
| x = torch.randn(2, 3, device=device).t() |
| empty_out = torch.randn(0, device=device) |
| self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=empty_out)) |
| |
| noncontig_out = torch.randn(2, 3, device=device).t() |
| self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=noncontig_out)) |
| |
| def test_maxpool3d_non_square_backward(self, device): |
| # previous CUDA routine of this backward calculates kernel launch grid size |
| # with last two dimensions interchanged, so the tailing along the longer dim |
| # get ignored. Here we test whether every position gets gradient. |
| for dim in (2, 3, 4): |
| shape = tuple(32 if i != dim else 256 for i in range(4)) |
| x = torch.randn(shape, device=device, requires_grad=True) |
| F.max_pool3d(x, kernel_size=(1, 1, 1)).sum().backward() |
| self.assertTrue(torch.allclose(x.grad, torch.ones_like(x.grad))) |
| |
| @onlyCUDA |
| @deviceCountAtLeast(2) |
| def test_clip_grad_norm_multi_device(self, devices): |
| class TestModel(nn.Module): |
| def __init__(self): |
| super(TestModel, self).__init__() |
| self.layer1 = nn.Linear(10, 10) |
| self.layer2 = nn.Linear(10, 10) |
| |
| test_model = TestModel() |
| test_model.layer1.to(devices[0]) |
| test_model.layer2.to(devices[1]) |
| ref_model = TestModel().to(devices[0]) |
| for norm_type in [2., math.inf]: |
| for p in test_model.parameters(): |
| p.grad = torch.ones_like(p) |
| for p in ref_model.parameters(): |
| p.grad = torch.ones_like(p) |
| norm = clip_grad_norm_(test_model.parameters(), 0.5, norm_type=norm_type) |
| expected = clip_grad_norm_(ref_model.parameters(), 0.5, norm_type=norm_type) |
| self.assertEqual(norm, expected) |
| for p, pe in zip(test_model.parameters(), ref_model.parameters()): |
| self.assertEqual(p.grad.to(devices[0]), pe.grad) |
| |
| def test_elu_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.elu(x, inplace=True) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.elu_(x) |
| |
| def test_hardswish_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.hardswish(x, inplace=True) |
| |
| def test_silu_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.silu(x, inplace=True) |
| |
| def test_softplus_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.softplus(x, out=x) |
| |
| def test_softshrink_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.softshrink(x, out=x) |
| |
| def test_leaky_relu_inplace_overlap(self, device): |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.leaky_relu(x, inplace=True) |
| with self.assertRaisesRegex(RuntimeError, 'unsupported operation'): |
| F.leaky_relu_(x) |
| |
| def test_threshold_inplace_overlap(self, device): |
| # Inplace threshold is okay, because it is idempotent |
| x = torch.randn((1, 6), device=device).expand((6, 6)) |
| F.threshold(x, 0.5, 0.5, inplace=True) |
| F.threshold_(x, 0.5, 0.5) |
| |
| @onlyOnCPUAndCUDA |
| def test_triplet_margin_with_distance_loss_default_parity(self, device): |
| # Test for `nn.TripletMarginWithDistanceLoss` and |
| # `F.triplet_margin_with_distance_loss`. Checks |
| # for parity against the respective non-distance-agnostic |
| # implementations of triplet margin loss (``nn.TripletMarginLoss` |
| # and `F.triplet_margin_loss`) under *default args*. |
| |
| for extra_args in \ |
| itertools.product((0.5, 1, 1.5), (True, False), ('none', 'mean', 'sum')): |
| kwargs = {'margin': extra_args[0], 'swap': extra_args[1], 'reduction': extra_args[2]} |
| |
| anchor = torch.randn(5, 10, device=device, requires_grad=True) |
| positive = torch.randn(5, 10, device=device, requires_grad=True) |
| negative = torch.randn(5, 10, device=device, requires_grad=True) |
| |
| # Test forward, functional |
| expected = F.triplet_margin_loss(anchor, positive, negative, **kwargs) |
| actual = F.triplet_margin_with_distance_loss(anchor, positive, negative, **kwargs) |
| self.assertEqual(actual, expected, rtol=1e-6, atol=1e-6) |
| |
| # Test forward, module |
| loss_ref = nn.TripletMarginLoss(**kwargs) |
| loss_op = nn.TripletMarginWithDistanceLoss(**kwargs) |
| self.assertEqual(loss_op(anchor, positive, negative), |
| loss_ref(anchor, positive, negative), |
| rtol=1e-6, atol=1e-6) |
| |
| # Test backward |
| self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss( |
| a, p, n, **kwargs), (anchor, positive, negative))) |
| self.assertTrue(gradcheck(lambda a, p, n: loss_op(a, p, n), |
| (anchor, positive, negative))) |
| |
| @onlyOnCPUAndCUDA |
| def test_triplet_margin_with_distance_loss(self, device): |
| # Test for parity between `nn.TripletMarginWithDistanceLoss` and |
| # `F.triplet_margin_with_distance_loss`. |
| |
| pairwise_distance = nn.PairwiseDistance() |
| |
| def cosine_distance(x, y): |
| return 1.0 - F.cosine_similarity(x, y) |
| |
| distance_functions = (pairwise_distance, cosine_distance, |
| lambda x, y: 1.0 - F.cosine_similarity(x, y)) |
| |
| reductions = ('mean', 'none', 'sum') |
| margins = (1.0, 1.5, 0.5) |
| swaps = (True, False) |
| |
| for distance_fn, reduction, margin, swap \ |
| in itertools.product(distance_functions, reductions, margins, swaps): |
| anchor = torch.randn(5, 10, device=device, requires_grad=True) |
| positive = torch.randn(5, 10, device=device, requires_grad=True) |
| negative = torch.randn(5, 10, device=device, requires_grad=True) |
| |
| # Test backward |
| self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss( |
| a, p, n, distance_function=distance_fn, reduction=reduction, margin=margin, swap=swap), |
| (anchor, positive, negative))) |
| loss_op = nn.TripletMarginWithDistanceLoss(distance_function=distance_fn, |
| reduction=reduction, margin=margin, swap=swap) |
| self.assertTrue(gradcheck(lambda a, p, n: loss_op( |
| a, p, n), (anchor, positive, negative))) |
| traced_loss_op = torch.jit.trace(loss_op, (anchor, positive, negative)) |
| self.assertTrue(gradcheck(lambda a, p, n: traced_loss_op( |
| a, p, n), (anchor, positive, negative))) |
| |
| # Test forward parity |
| functional = F.triplet_margin_with_distance_loss(anchor, positive, negative, |
| distance_function=distance_fn, |
| reduction=reduction, margin=margin, swap=swap) |
| modular = loss_op(anchor, positive, negative) |
| traced = traced_loss_op(anchor, positive, negative) |
| self.assertEqual(functional, modular, atol=1e-6, rtol=1e-6) |
| self.assertEqual(traced, modular, atol=1e-6, rtol=1e-6) |
| |
| def test_to_complex(self, device): |
| m = nn.Linear(3, 5).to(device) |
| self.assertIs(m, m.to(device)) |
| m.to(torch.cfloat) |
| self.assertIs(m.weight.dtype, torch.cfloat) |
| m.to(torch.cdouble) |
| self.assertIs(m.weight.dtype, torch.cdouble) |
| m.to(torch.float) |
| self.assertIs(m.weight.dtype, torch.float) |
| with warnings.catch_warnings(record=True) as w: |
| # Trigger warning |
| m.to(torch.cfloat) |
| # Check warning occurs |
| self.assertEqual(len(w), 1) |
| self.assertTrue("Complex modules are a new feature" in str(w[-1].message)) |
| |
| |
| class TestModuleGlobalHooks(TestCase): |
| |
| def tearDown(self): |
| nn.modules.module._global_backward_hooks = OrderedDict() |
| nn.modules.module._global_forward_hooks = OrderedDict() |
| nn.modules.module._global_forward_pre_hooks = OrderedDict() |
| |
| def test_module_global_hooks(self): |
| module = nn.Sigmoid |
| |
| module_1 = module() |
| module_2 = module() |
| module_3 = module() |
| |
| input = torch.ones(5, 5, requires_grad=True) |
| |
| counter = { |
| 'forwards': 0, |
| 'backwards': 0 |
| } |
| |
| def fw_hook(inc, h_module, input, output): |
| self.assertIsInstance(input, tuple) |
| self.assertTrue(isinstance(output, torch.Tensor)) |
| self.assertTrue(isinstance(h_module, module)) |
| self.assertEqual(input[0], torch.ones(5, 5)) |
| self.assertEqual(output, torch.Tensor(5, 5).fill_(1 / (1 + 1 / math.e))) |
| counter['forwards'] += inc |
| |
| def bw_hook(inc, h_module, grad_input, grad_output): |
| self.assertIsInstance(grad_input, tuple) |
| self.assertIsInstance(grad_output, tuple) |
| self.assertTrue(isinstance(h_module, module)) |
| self.assertEqual(grad_output[0], torch.ones(5, 5) * 2) |
| counter['backwards'] += inc |
| |
| test_fwd = nn.modules.module.register_module_forward_hook(lambda *args: fw_hook(1, *args)) |
| |
| module_1(input) |
| module_2(input) |
| module_3(input) |
| self.assertEqual(counter['forwards'], 3) |
| self.assertEqual(counter['backwards'], 0) |
| |
| test_bwd = nn.modules.module.register_module_backward_hook( |
| lambda *args: bw_hook(1, *args)) |
| |
| output_1 = module_1(input) |
| output_2 = module_2(input) |
| output_3 = module_3(input) |
| self.assertEqual(counter['forwards'], 6) |
| self.assertEqual(counter['backwards'], 0) |
| |
| output_1.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| output_2.backward(torch.ones(5, 5) * 2, retain_graph=False) |
| output_3.backward(torch.ones(5, 5) * 2, retain_graph=False) |
| self.assertEqual(counter['forwards'], 6) |
| self.assertEqual(counter['backwards'], 3) |
| |
| output_1.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| self.assertEqual(counter['forwards'], 6) |
| self.assertEqual(counter['backwards'], 4) |
| |
| test2_fwd = nn.modules.module.register_module_forward_hook(lambda *args: fw_hook(2, *args)) |
| |
| output = module_1(input) |
| output = module_2(input) |
| output = module_3(input) |
| self.assertEqual(counter['forwards'], 15) |
| self.assertEqual(counter['backwards'], 4) |
| |
| test2_bwd = nn.modules.module.register_module_backward_hook(lambda *args: bw_hook(2, *args)) |
| |
| module_1(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 18) |
| self.assertEqual(counter['backwards'], 7) |
| |
| test2_bwd.remove() |
| |
| module_2(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 21) |
| self.assertEqual(counter['backwards'], 8) |
| |
| test2_fwd.remove() |
| |
| module_3(input).backward(torch.ones(5, 5) * 2) |
| self.assertEqual(counter['forwards'], 22) |
| self.assertEqual(counter['backwards'], 9) |
| |
| test_fwd.remove() |
| test_bwd.remove() |
| |
| def test_module_global_hook_invalid_outputs(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| |
| def bw_fail1(self, grad_input, grad_output): |
| return grad_input[:-1] |
| |
| def bw_fail2(self, grad_input, grad_output): |
| return grad_input + (torch.randn(2, 2),) |
| |
| with nn.modules.module.register_module_backward_hook(bw_fail1): |
| with self.assertRaisesRegex(RuntimeError, 'got 0, but expected 1'): |
| module(input).sum().backward() |
| |
| with nn.modules.module.register_module_backward_hook(bw_fail2): |
| with self.assertRaisesRegex(RuntimeError, 'got 2, but expected 1'): |
| module(input).sum().backward() |
| |
| def test_module_backward_global_hook_writeable(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| sig_x = torch.sigmoid(input) |
| |
| def bw_hook(module, grad_input, grad_output): |
| for grad in grad_input: |
| self.assertTrue(isinstance(grad, torch.Tensor)) |
| for grad in grad_output: |
| self.assertTrue(isinstance(grad, torch.Tensor)) |
| return tuple(gi * 2 for gi in grad_input) |
| |
| nn.modules.module.register_module_backward_hook(bw_hook) |
| module(input).backward(torch.ones(5, 5)) |
| expected_grad = sig_x * (1 - sig_x) * 2 |
| self.assertEqual(input.grad, expected_grad) |
| |
| def test_module_global_forward_preforward_hook_writeable(self): |
| module = nn.Sigmoid() |
| input = torch.randn(5, 5, requires_grad=True) |
| sig_x = torch.sigmoid(input) |
| |
| def forward_pre_hook(m, input): |
| return torch.nn.functional.relu(input[0]) |
| |
| def forward_hook(m, input, output): |
| return -output |
| |
| nn.modules.module.register_module_forward_pre_hook(forward_pre_hook) |
| nn.modules.module.register_module_forward_hook(forward_hook) |
| output = module(input) |
| expected_res = -torch.sigmoid(torch.nn.functional.relu(input)) |
| self.assertEqual(output, expected_res) |
| output.backward(torch.ones(5, 5) * 2, retain_graph=True) |
| mask = (input > 0).double() |
| expected_grad = -sig_x * (1 - sig_x) * 2 * mask |
| self.assertEqual(input.grad, expected_grad) |
| |
| def test_global_and_local_hooks_order(self): |
| module = nn.Sigmoid() |
| |
| global_forward_pre_called = False |
| local_forward_pre_called = False |
| global_forward_called = False |
| local_forward_called = False |
| global_backward_called = False |
| local_backward_called = False |
| |
| def global_forward_pre_hook(m, input): |
| nonlocal global_forward_pre_called |
| self.assertTrue(not local_forward_pre_called) |
| global_forward_pre_called = True |
| return input |
| |
| def local_forward_pre_hook(m, input): |
| nonlocal local_forward_pre_called |
| self.assertTrue(global_forward_pre_called) |
| local_forward_pre_called = True |
| return input |
| |
| def global_forward_hook(m, input, output): |
| nonlocal global_forward_called |
| self.assertTrue(not local_forward_called) |
| global_forward_called = True |
| return output |
| |
| def local_forward_hook(m, input, output): |
| nonlocal local_forward_called |
| self.assertTrue(global_forward_called) |
| local_forward_called = True |
| return output |
| |
| def global_backward_hook(m, input, output): |
| nonlocal global_backward_called |
| self.assertTrue(not local_backward_called) |
| global_backward_called = True |
| return input |
| |
| def local_backward_hook(m, input, output): |
| nonlocal local_backward_called |
| self.assertTrue(global_backward_called) |
| local_backward_called = True |
| return input |
| |
| input = torch.randn(5, 5, requires_grad=True) |
| nn.modules.module.register_module_forward_pre_hook(global_forward_pre_hook) |
| module.register_forward_pre_hook(local_forward_pre_hook) |
| nn.modules.module.register_module_forward_hook(global_forward_hook) |
| module.register_forward_hook(local_forward_hook) |
| nn.modules.module.register_module_backward_hook(global_backward_hook) |
| module.register_backward_hook(local_backward_hook) |
| |
| output = module(input) |
| self.assertTrue(local_forward_called and local_forward_pre_called and global_forward_called and global_forward_pre_called) |
| |
| output.backward(torch.ones(5, 5), retain_graph=True) |
| self.assertTrue(local_backward_called and global_backward_called) |
| |
| |
| class LazyModule(torch.nn.modules.lazy.LazyModuleMixin, torch.nn.Module): |
| pass |
| |
| |
| class TestLazyModules(TestCase): |
| |
| @suppress_warnings |
| def test_lazy_module_parameter(self): |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| self.assertTrue(module.has_uninitialized_params()) |
| state_dict = module.state_dict() |
| self.assertIsInstance(state_dict['test_param'], UninitializedParameter) |
| new_module = LazyModule() |
| # An error is raised when there is an attempt to replace an existing parameter |
| # with an uninitialized one |
| new_module.register_parameter('test_param', nn.Parameter(torch.ones(5, 5))) |
| with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'): |
| new_module.load_state_dict(state_dict) |
| # Uninitialized parameters are overriden when the state dict to be loaded contains a valid one |
| new_module = LazyModule() |
| new_module.register_parameter('test_param', nn.Parameter(torch.ones(5, 5))) |
| module.load_state_dict(new_module.state_dict()) |
| self.assertEqual(module.test_param, torch.ones((5, 5))) |
| |
| # Uninitialized parameters are left unchanged |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| self.assertTrue(module.has_uninitialized_params()) |
| |
| new_module = LazyModule() |
| new_module.register_parameter('test_param', UninitializedParameter()) |
| module.load_state_dict(new_module.state_dict()) |
| self.assertTrue(module.has_uninitialized_params()) |
| |
| @suppress_warnings |
| def test_lazy_module_buffer(self): |
| module = LazyModule() |
| module.register_buffer('test_buffer', UninitializedBuffer()) |
| self.assertTrue(module.has_uninitialized_params()) |
| state_dict = module.state_dict() |
| self.assertIsInstance(state_dict['test_buffer'], UninitializedBuffer) |
| new_module = LazyModule() |
| # An error is raised when there is an attempt to replace an existing parameter |
| # with an uninitialized one |
| new_module.register_buffer('test_buffer', torch.ones(5, 5)) |
| with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'): |
| new_module.load_state_dict(state_dict) |
| # Uninitialized parameters are overriden when the state dict to be loaded contains a valid one |
| new_module = LazyModule() |
| new_module.register_buffer('test_buffer', torch.ones(5, 5)) |
| module.load_state_dict(new_module.state_dict()) |
| self.assertEqual(module.test_buffer, torch.ones((5, 5))) |
| |
| # Uninitialized parameters are left unchanged |
| module = LazyModule() |
| module.register_buffer('test_buffer', UninitializedBuffer()) |
| self.assertTrue(module.has_uninitialized_params()) |
| |
| new_module = LazyModule() |
| new_module.register_buffer('test_buffer', UninitializedBuffer()) |
| module.load_state_dict(new_module.state_dict()) |
| module.load_state_dict(new_module.state_dict()) |
| self.assertTrue(module.has_uninitialized_params()) |
| |
| @suppress_warnings |
| def test_lazy_module_jit_param(self): |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| self.assertTrue(module.has_uninitialized_params()) |
| with self.assertRaisesRegex(RuntimeError, 'run a forward pass'): |
| torch.jit.script(module) |
| |
| @suppress_warnings |
| def test_lazy_module_jit_buffer(self): |
| module = LazyModule() |
| module.register_buffer('test_buffer', UninitializedBuffer()) |
| self.assertTrue(module.has_uninitialized_params()) |
| with self.assertRaisesRegex(RuntimeError, 'run a forward pass'): |
| torch.jit.script(module) |
| |
| @suppress_warnings |
| def test_lazy_share_memory_param(self): |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| self.assertTrue(module.has_uninitialized_params()) |
| with self.assertRaisesRegex(RuntimeError, 'share memory on an uninitialized'): |
| module.share_memory() |
| |
| @suppress_warnings |
| def test_lazy_share_memory_buffer(self): |
| module = LazyModule() |
| module.register_buffer('test_buffer', UninitializedBuffer()) |
| self.assertTrue(module.has_uninitialized_params()) |
| with self.assertRaisesRegex(RuntimeError, 'share memory on an uninitialized'): |
| module.share_memory() |
| |
| @suppress_warnings |
| def test_linear(self): |
| module = nn.LazyLinear(10) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| input = torch.ones(5, 5) |
| module(input) |
| self.assertIsInstance(module, nn.Linear) |
| self.assertNotIsInstance(module, nn.LazyLinear) |
| self.assertTrue(module.weight.shape == (10, 5)) |
| y = module(input) |
| self.assertTrue(torch.equal(torch.nn.functional.linear(input, module.weight, module.bias), y)) |
| |
| @suppress_warnings |
| def test_lazy_linear_pickle(self): |
| module = nn.LazyLinear(10) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| module = pickle.loads(pickle.dumps(module)) |
| self.assertIsInstance(module, nn.LazyLinear) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| input = torch.ones(5, 5) |
| module(input) # fully materialized |
| new_module = pickle.loads(pickle.dumps(module)) |
| self.assertIsInstance(new_module, nn.Linear) |
| self.assertNotIsInstance(new_module, nn.LazyLinear) |
| self.assertTrue(new_module.weight.shape == (10, 5)) |
| self.assertNotIsInstance(new_module.weight, UninitializedParameter) |
| |
| @suppress_warnings |
| def test_linear_state(self): |
| module = nn.Linear(5, 10) |
| lazy_module = nn.LazyLinear(10) |
| lazy_module.load_state_dict(module.state_dict()) |
| # Parameters have been initialized but the module won't become a full |
| # Linear one until the first iteration. This is due to |
| # limitations on the state_dict loading logic |
| self.assertFalse(lazy_module.has_uninitialized_params()) |
| self.assertTrue(lazy_module.weight.shape == (10, 5)) |
| |
| module = nn.Linear(5, 10) |
| lazy_module = nn.LazyLinear(10) |
| with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'): |
| module.load_state_dict(lazy_module.state_dict()) |
| |
| def _check_lazy_conv(self, cls, lazy_cls, func, init_args, input_shape, expected_weight_shape): |
| module = lazy_cls(*init_args) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| input = torch.ones(*input_shape) |
| module(input) |
| self.assertIsInstance(module, cls) |
| self.assertNotIsInstance(module, lazy_cls) |
| self.assertEqual(module.weight.shape, expected_weight_shape) |
| y = module(input) |
| self.assertTrue(torch.equal(func(input, module.weight, module.bias), y)) |
| |
| def _check_lazy_conv_pickle(self, cls, lazy_cls, init_args, input_shape, expected_weight_shape): |
| module = lazy_cls(*init_args) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| module = pickle.loads(pickle.dumps(module)) |
| self.assertIsInstance(module, lazy_cls) |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| input = torch.ones(*input_shape) |
| module(input) # fully materialized |
| new_module = pickle.loads(pickle.dumps(module)) |
| self.assertIsInstance(new_module, cls) |
| self.assertNotIsInstance(new_module, lazy_cls) |
| self.assertEqual(new_module.weight.shape, expected_weight_shape) |
| self.assertNotIsInstance(new_module.weight, UninitializedParameter) |
| |
| def _check_lazy_conv_state(self, gen_module, gen_lazy_module, expected_weight_shape): |
| module = gen_module() |
| lazy_module = gen_lazy_module() |
| lazy_module.load_state_dict(module.state_dict()) |
| # Parameters have been initialized but the module won't become a full |
| # Conv one until the first iteration. This is due to |
| # limitations on the state_dict loading logic |
| self.assertFalse(lazy_module.has_uninitialized_params()) |
| self.assertEqual(lazy_module.weight.shape, expected_weight_shape) |
| |
| module = gen_module() |
| lazy_module = gen_lazy_module() |
| with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'): |
| module.load_state_dict(lazy_module.state_dict()) |
| |
| @suppress_warnings |
| def test_lazy_conv1d(self): |
| self._check_lazy_conv(nn.Conv1d, nn.LazyConv1d, torch.nn.functional.conv1d, |
| (32, 2), (192, 16, 50), (32, 16, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv1d_pickle(self): |
| self._check_lazy_conv_pickle(nn.Conv1d, nn.LazyConv1d, (32, 2), (192, 16, 50), (32, 16, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv1d_state(self): |
| self._check_lazy_conv_state(lambda: nn.Conv1d(16, 32, 2), |
| lambda: nn.LazyConv1d(32, 2), |
| (32, 16, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv2d(self): |
| self._check_lazy_conv(nn.Conv2d, nn.LazyConv2d, torch.nn.functional.conv2d, |
| (32, 2), (192, 16, 8, 6), (32, 16, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv2d_pickle(self): |
| self._check_lazy_conv_pickle(nn.Conv2d, nn.LazyConv2d, (32, 2), (192, 16, 8, 6), (32, 16, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv2d_state(self): |
| self._check_lazy_conv_state(lambda: nn.Conv2d(16, 32, 2), |
| lambda: nn.LazyConv2d(32, 2), |
| (32, 16, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv3d(self): |
| self._check_lazy_conv(nn.Conv3d, nn.LazyConv3d, torch.nn.functional.conv3d, |
| (32, 2), (192, 16, 8, 7, 6), (32, 16, 2, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv3d_pickle(self): |
| self._check_lazy_conv_pickle(nn.Conv3d, nn.LazyConv3d, (32, 2), (192, 16, 8, 7, 6), (32, 16, 2, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv3d_state(self): |
| self._check_lazy_conv_state(lambda: nn.Conv3d(16, 32, 2), |
| lambda: nn.LazyConv3d(32, 2), |
| (32, 16, 2, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transposed1d(self): |
| self._check_lazy_conv(nn.ConvTranspose1d, nn.LazyConvTranspose1d, torch.nn.functional.conv_transpose1d, |
| (32, 2), (192, 16, 50), (16, 32, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose1d_pickle(self): |
| self._check_lazy_conv_pickle(nn.ConvTranspose1d, nn.LazyConvTranspose1d, (32, 2), (192, 16, 50), (16, 32, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose1d_state(self): |
| self._check_lazy_conv_state(lambda: nn.ConvTranspose1d(16, 32, 2), |
| lambda: nn.LazyConvTranspose1d(32, 2), |
| (16, 32, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose2d(self): |
| self._check_lazy_conv(nn.ConvTranspose2d, nn.LazyConvTranspose2d, torch.nn.functional.conv_transpose2d, |
| (32, 2), (192, 16, 8, 6), (16, 32, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose2d_pickle(self): |
| self._check_lazy_conv_pickle(nn.ConvTranspose2d, nn.LazyConvTranspose2d, (32, 2), (192, 16, 8, 6), (16, 32, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose2d_state(self): |
| self._check_lazy_conv_state(lambda: nn.ConvTranspose2d(16, 32, 2), |
| lambda: nn.LazyConvTranspose2d(32, 2), |
| (16, 32, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose3d(self): |
| self._check_lazy_conv(nn.ConvTranspose3d, nn.LazyConvTranspose3d, torch.nn.functional.conv_transpose3d, |
| (32, 2), (192, 16, 8, 7, 6), (16, 32, 2, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose3d_pickle(self): |
| self._check_lazy_conv_pickle(nn.ConvTranspose3d, nn.LazyConvTranspose3d, (32, 2), (192, 16, 8, 7, 6), (16, 32, 2, 2, 2)) |
| |
| @suppress_warnings |
| def test_lazy_conv_transpose3d_state(self): |
| self._check_lazy_conv_state(lambda: nn.ConvTranspose3d(16, 32, 2), |
| lambda: nn.LazyConvTranspose3d(32, 2), |
| (16, 32, 2, 2, 2)) |
| |
| def _check_lazy_batchnorm(self, cls, lazy_cls, input_shape): |
| for affine in [False, True]: |
| for track_running_stats in [False, True]: |
| lazy_module = lazy_cls(affine=affine, track_running_stats=track_running_stats) |
| |
| if affine: |
| self.assertIsInstance(lazy_module.weight, UninitializedParameter) |
| self.assertIsInstance(lazy_module.bias, UninitializedParameter) |
| if track_running_stats: |
| self.assertIsInstance(lazy_module.running_mean, UninitializedBuffer) |
| self.assertIsInstance(lazy_module.running_var, UninitializedBuffer) |
| |
| input = torch.ones(*input_shape) |
| y = lazy_module(input) |
| self.assertIsInstance(lazy_module, cls) |
| self.assertNotIsInstance(lazy_module, lazy_cls) |
| |
| num_features = input_shape[1] |
| module = cls(num_features, affine=affine, track_running_stats=track_running_stats) |
| expected = module(input) |
| |
| if module.weight is not None: |
| self.assertEqual(lazy_module.weight.shape, module.weight.shape) |
| self.assertEqual(lazy_module.weight, module.weight) |
| if module.bias is not None: |
| self.assertEqual(lazy_module.bias.shape, module.bias.shape) |
| self.assertEqual(lazy_module.bias, module.bias) |
| if module.running_mean is not None: |
| self.assertEqual(lazy_module.running_mean.shape, module.running_mean.shape) |
| self.assertEqual(lazy_module.running_mean, module.running_mean) |
| if module.running_var is not None: |
| self.assertEqual(lazy_module.running_var.shape, module.running_var.shape) |
| self.assertEqual(lazy_module.running_var, module.running_var) |
| if module.num_batches_tracked is not None: |
| self.assertEqual(lazy_module.num_batches_tracked.shape, module.num_batches_tracked.shape) |
| self.assertEqual(lazy_module.num_batches_tracked, module.num_batches_tracked) |
| |
| def _check_lazy_batchnorm_pickle(self, cls, lazy_cls, input_shape): |
| for affine in [False, True]: |
| for track_running_stats in [False, True]: |
| module = lazy_cls(affine=affine, track_running_stats=track_running_stats) |
| module = pickle.loads(pickle.dumps(module)) |
| |
| self.assertIsInstance(module, lazy_cls) |
| if affine: |
| self.assertIsInstance(module.weight, UninitializedParameter) |
| self.assertIsInstance(module.bias, UninitializedParameter) |
| if track_running_stats: |
| self.assertIsInstance(module.running_mean, UninitializedBuffer) |
| self.assertIsInstance(module.running_var, UninitializedBuffer) |
| |
| input = torch.ones(*input_shape) |
| module(input) # fully materialized |
| module = pickle.loads(pickle.dumps(module)) |
| |
| self.assertNotIsInstance(module, lazy_cls) |
| self.assertIsInstance(module, cls) |
| if affine: |
| self.assertNotIsInstance(module.weight, UninitializedParameter) |
| self.assertNotIsInstance(module.bias, UninitializedParameter) |
| if track_running_stats: |
| self.assertNotIsInstance(module.running_mean, UninitializedBuffer) |
| self.assertNotIsInstance(module.running_var, UninitializedBuffer) |
| |
| def _check_lazy_batchnorm_state(self, cls, lazy_cls): |
| module = cls(10) |
| lazy_module = lazy_cls(affine=True, track_running_stats=True) |
| lazy_module.load_state_dict(module.state_dict()) |
| # Parameters have been initialized but the module won't become a full |
| # Conv one until the first iteration. This is due to |
| # limitations on the state_dict loading logic |
| self.assertFalse(lazy_module.has_uninitialized_params()) |
| self.assertEqual(lazy_module.weight.shape, (10,)) |
| self.assertEqual(lazy_module.bias.shape, (10,)) |
| self.assertEqual(lazy_module.running_mean.shape, (10,)) |
| self.assertEqual(lazy_module.running_var.shape, (10,)) |
| |
| module = cls(10) |
| lazy_module = lazy_cls() |
| with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'): |
| module.load_state_dict(lazy_module.state_dict()) |
| |
| def test_lazy_batchnorm1d(self): |
| self._check_lazy_batchnorm(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 3, 6)) |
| self._check_lazy_batchnorm(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 6)) |
| |
| def test_lazy_batchnorm1d_pickle(self): |
| self._check_lazy_batchnorm_pickle(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 3, 6)) |
| self._check_lazy_batchnorm_pickle(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 6)) |
| |
| def test_lazy_batchnorm1d_state(self): |
| self._check_lazy_batchnorm_state(nn.BatchNorm1d, nn.LazyBatchNorm1d) |
| self._check_lazy_batchnorm_state(nn.BatchNorm1d, nn.LazyBatchNorm1d) |
| |
| def test_lazy_batchnorm2d(self): |
| self._check_lazy_batchnorm(nn.BatchNorm2d, nn.LazyBatchNorm2d, (16, 3, 6, 7)) |
| |
| def test_lazy_batchnorm2d_pickle(self): |
| self._check_lazy_batchnorm_pickle(nn.BatchNorm2d, nn.LazyBatchNorm2d, (16, 3, 6, 7)) |
| |
| def test_lazy_batchnorm2d_state(self): |
| self._check_lazy_batchnorm_state(nn.BatchNorm2d, nn.LazyBatchNorm2d) |
| self._check_lazy_batchnorm_state(nn.BatchNorm2d, nn.LazyBatchNorm2d) |
| |
| def test_lazy_batchnorm3d(self): |
| self._check_lazy_batchnorm(nn.BatchNorm3d, nn.LazyBatchNorm3d, (16, 3, 6, 7, 8)) |
| |
| def test_lazy_batchnorm3d_pickle(self): |
| self._check_lazy_batchnorm_pickle(nn.BatchNorm3d, nn.LazyBatchNorm3d, (16, 3, 6, 7, 8)) |
| |
| def test_lazy_batchnorm3d_state(self): |
| self._check_lazy_batchnorm_state(nn.BatchNorm3d, nn.LazyBatchNorm3d) |
| self._check_lazy_batchnorm_state(nn.BatchNorm3d, nn.LazyBatchNorm3d) |
| |
| @suppress_warnings |
| def test_materialize_dtype(self): |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| module.test_param.materialize(10) |
| self.assertTrue(module.test_param.dtype == torch.float64) |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| module.half() |
| module.test_param.materialize(10) |
| self.assertTrue(module.test_param.dtype == torch.float16) |
| |
| @unittest.skipIf(not TEST_CUDA, 'CUDA not available') |
| @suppress_warnings |
| def test_materialize_device(self): |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| module.test_param.materialize(10) |
| self.assertTrue(module.test_param.device.type == 'cpu') |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| module.cuda() |
| module.test_param.materialize(10) |
| self.assertTrue(module.test_param.device.type == 'cuda') |
| |
| @suppress_warnings |
| def test_chained_initialization(self): |
| class MyNetwork(torch.nn.Module): |
| def __init__(self): |
| super(MyNetwork, self).__init__() |
| self.linear_1 = torch.nn.LazyLinear(15) |
| self.linear_2 = torch.nn.LazyLinear(10) |
| |
| def forward(self, x): |
| y = self.linear_1(x) |
| return self.linear_2(y) |
| |
| net = MyNetwork() |
| net(torch.ones(5, 10)) |
| self.assertTrue(net.linear_1.weight.shape == (15, 10)) |
| self.assertTrue(net.linear_2.weight.shape == (10, 15)) |
| |
| @suppress_warnings |
| def test_optimizer_pass(self): |
| optimizers = [torch.optim.Adadelta, torch.optim.Adagrad, torch.optim.Adam, |
| torch.optim.AdamW, torch.optim.Adamax, |
| torch.optim.ASGD, torch.optim.SGD, torch.optim.Rprop, |
| torch.optim.RMSprop, torch.optim.LBFGS] |
| |
| def run_step(module, optim): |
| self.assertIsInstance(optim.param_groups[0]['params'][0], UninitializedParameter) |
| module.test_param.materialize(10) |
| self.assertIsInstance(optim.param_groups[0]['params'][0], Parameter) |
| self.assertNotIsInstance(optim.param_groups[0]['params'][0], UninitializedParameter) |
| for p in module.parameters(): |
| p.grad = torch.rand_like(p) |
| if isinstance(optim, torch.optim.LBFGS): |
| optim.step(lambda: 1.0) |
| else: |
| optim.step() |
| |
| for optim_cls in optimizers: |
| module = LazyModule() |
| module.register_parameter('test_param', UninitializedParameter()) |
| if optim_cls is torch.optim.SGD: |
| optim = optim_cls(module.parameters(), lr=0.0) |
| elif optim_cls is torch.optim.Adagrad: |
| with self.assertRaisesRegex(ValueError, 'uninitialized parameter'): |
| optim = optim_cls(module.parameters()) |
| continue |
| else: |
| optim = optim_cls(module.parameters()) |
| run_step(module, optim) |
| |
| @suppress_warnings |
| def test_weight_norm(self): |
| m = nn.LazyLinear(7) |
| with self.assertRaisesRegex(ValueError, 'have uninitialized parameters.'): |
| m = torch.nn.utils.weight_norm(m) |
| |
| @suppress_warnings |
| def test_spectral_norm(self): |
| m = nn.LazyLinear(7) |
| with self.assertRaisesRegex(ValueError, 'have uninitialized parameters.'): |
| m = torch.nn.utils.spectral_norm(m) |
| |
| @suppress_warnings |
| def test_invalid_functions(self): |
| param = torch.nn.parameter.UninitializedParameter() |
| with self.assertRaisesRegex(ValueError, 'uninitialized parameter'): |
| torch.empty_like(param) |
| |
| with self.assertRaisesRegex(ValueError, 'uninitialized parameter'): |
| torch.add(param, param) |
| |
| with self.assertRaisesRegex(ValueError, 'uninitialized parameter'): |
| param + param |
| |
| instantiate_device_type_tests(TestNNDeviceType, globals()) |
| |
| if __name__ == '__main__': |
| run_tests() |